are
Why the elements of d-block elements
called transition element?
Answer:
O nome "transição" vem da posição dos elementos na tabela, representando a transição do grupo 2 ao 13, pela sucessiva adição de elétrons ao orbital d. Elementos de transição externa (ou somente elementos de transição):
Octane C8H18 is an ingredient in gasoline. How many carbon atoms are in 20 kg of octane? help please
Answer:
Octane is a hydrocarbon and an alkane with the chemical formula C 8 H 18, and the condensed structural formula CH 3 (CH 2) 6 CH 3.Octane has many structural isomers that differ by the amount and location of branching in the carbon chain. One of these isomers, 2,2,4-trimethylpentane (commonly called iso-octane) is used as one of the standard values in the octane rating scale.
Chemical formula: C₈H₁₈
Molar mass: 114.232 g·mol−1
Melting point: −57.1 to −56.6 °C; −70.9 to −69.8 °F; 216.0 to 216.6 K
Solubility in water: 0.007 mg dm−3 (at 20 °C)
Answer:
Explanation:
Octane is C8H18, carbon is C. Therefore, for every mol of C8H18 there will be 8 mols of carbon.
Convert 20 kg of octane to mols octane using molar mass of octane.
Molar Mass octane = (8*12.011)+(18*1.008)=114.23 g/mol, where 8 and 18 are the atoms in the molecule and 12.011 and 1.008 are the respective molar masses of carbon and hydrogen.
20kg C8H18 *1000g/kg * mol C8H18/114.23g C8H18 = 175.1 mols octane.
Now convert that number of mols to mols carbon:
175.1 mol C8H18 * (8 mol C/mol C8H18)=1400.8 mol C.
Now remember that a mol of any given atom=6.022*10^23 atoms.
So 1400.8 mol C=1400.8*(6.022*10^23) atoms C, which is equal to your final answer, 8.4*10^26 atoms. (round to 2 significant digits since the initial number given, 20, has 2 significant digits.)
The main thing you want to look for here is your conversion factors. Once you have those down it is simple algebra from there, so be sure to practice those!
Identify the state(s) of matter that each property describes.
takes the shape of its container:
gas
liquid
solid
fills all available space:
gas
liquid
solid
maintains its shape:
gas
liquid
solid
can be poured:
gas
liquid
solid
is compressible:
gas
liquid
solid
has a fixed volume:
gas
liquid
solid
Answer:
1) takes the shape of its container ( liquid and gas).
2) fills all available space (gas)
3) maintains its shape ( solid)
4) can be poured ( liquid)
5) is compressible ( gas)
6) has a fixed volume ( liquid and solid)
Explanation:
Matter is simply defined as anything that has weight and occupies space. It exists in three states, namely: solid, liquid and gaseous states.
The properties of different states of matter includes:
SOLID STATE
--> It has a definite shape: The shape of a solid is fixed; it does not depend on the shape of other materials.
--> It has a definite volume: it occupies its own shape due to the force of cohesion among its molecules.
--> It is tightly packed: The molecular movements of particles are negligible.
LIQUID STATE
--> liquid has a defined volume.
--> it has no definite shape: There is no specific shape of a liquid. It occupies any available space. It's shape depends on the shape of the container into which it is poured.
GASEOUS STATE
--> it has no fixed shape: Due to the distance in the molecules of gas, the gaseous state has no shape. It occupies the shape of its container.
--> It has no fixed volume: it occupies the shape of any container that is closed.
--> It is highly compressible: The particles of gas are far off from one another and there is room for collision.
Plzzzzzzzzzzzzz help
Answer:
A layer of soft hot rock
Explanation:
7. An element's most stable ion forms an ionic compound with chlorine having the formula XCl2. If the ion of element X has a mass of 89 and 36 electrons, what is the identity of the element, and how many neutrons does it have
Answer:
The element is strontium and the number of neutrons it have is 51.
Explanation:
Based on the given information, the ionic compound is,
XCl₂ ⇔ X₂⁺ + 2Cl⁻
X2+ is the ion of the mentioned element
As mentioned in the given question, the number of electrons of the element X is 36 and as seen from the reaction the charge present on the ion is +2. Now the atomic number will be,
No. of electrons = atomic number - charge
36 = atomic number - 2
Atomic number = 38
Based on the periodic table, the atomic number 38 is for strontium element, and the sign of strontium is Sr. Hence, the element X is Sr.
Now based on the given information, the mass number of the element is 89. Now the no. of neutrons will be,
No. of neutrons = mass number - atomic number
= 89 - 38
= 51 neutrons.
Rank the following amine derivatives from highest acidity (lowest pKa value) to lowest acidity (highest pKa value).
Highest acidity
anilinium ion
aniline
ammonium ion
secondary amine
amide
Lowest acidity
Answer:
anilinium ion > ammonium ion > amide > aniline > secondary amine
Explanation:
Acidity of amine derivatives can derived from their pKa values.
The rule of thumb for acidity with relation to pKa values is that:
As the pKa decreases the acid strength increases and the conjugate base decreases. Similarly, as the pKa increases, the acid strength decreases and the conjugate base increase.
Hence the stronger the acid , the lower pKa value and the weaker the acid , the stronger the pKa value.
So the pKa value for anilinium ion = 4.6
ammonium ion = 9.4
Amide = 15
Similarly, for aniline and secondary amine, in order to determine the derivative with the higher acidity, we will consider the electron withdrawing substituent group.
The more difficult the electron are being withdraw from the electron withdrawing substituent , the more acidic the compound.
In aniline , the stabilized benzene ring attached to NH₂ makes it a less electron withdrawing group compared to the straight chains structure found in secondary amine where electron are easily withdraw by nucleophilic substitution reactions.
Thus, from highest acidity (lowest pKa value) to lowest acidity (highest pKa value).
the amine derivatives ranking is as follows:
anilinium ion > ammonium ion > amide > aniline > secondary amine
the reaction 2NaOH(s) —> Na2O(s) + H2O(g) is a combustion reaction
T or F
The given statement " The reaction 2NaOH(s) —> Na₂O(s) + H₂O(g) is a combustion reaction is false as it is the decomposition reaction.
The decomposition reaction can be explained as the chemical reaction in which the one reactant will breaks down into the two or the more products. The Decomposition reaction is the processes in the reaction the chemical species will break into the simpler parts. the, decomposition reactions require the energy input.
The general representation of the equation of the decomposition reaction is as :
AB → A + B.
The chemical equation is :
2NaOH(s) —> Na₂O(s) + H₂O(g)
This is called as the decomposition reaction.
To learn more about decomposition reaction here
https://brainly.com/question/16987748
#SPJ1
32 g of zinc were used in a chemical reaction how many moles of zinc would have been used
To convert mass (g) and number of moles, we can always use the molar mass of the substance, which can be found in the periodic table. For Zinc (Zn), the molar mass is 65 g/mol, which means that each 65 g of Zn corresponds to 1 mol.
So, if we want to discover how many moles of Zinc there are in 32g of Zn, we can set the following proportion:
\(\begin{gathered} 65g-----1\text{mol} \\ 32g-----\text{x mol} \\ \\ x=\frac{32}{65}=0.49\approx0.5\text{ moles} \end{gathered}\)So, in 32g of Zinc (Zn), we have 0.5 moles.
Which sample uses the substance(s) that Jacob and Natalie
should use to make a cold pack that will do the BEST job of
keeping food cool
The sample that uses the substance that Jacob and Natalie should use to make a cold pack that will do the best job of keeping food cool is sample 2, because it absorbs the most energy (option B).
What is endothermic process?Endothermic refers to a chemical reaction that absorbs heat energy from its surroundings. This ensures that the temperature of the surroundings is cool or has a lower temperature.
According to this question, Jacob and Natalie are asked by their science teacher to design a warming or cooling device. They make use of certain substances, however, sample 2 has the lowest final temperature of -4°C.
This shows that sample 2 absorbs the most energy, hence, would be the best for keeping the food cool.
The incomplete question is as follows:
Jacob and Natalie are asked by their science teacher to design a warming or cooling device. They decide to design a cold pack that can be used to help keep food cool. Jacob and Natalie read about different substances that can be used inside cold packs and learn that most cold packs use endothermic reactions to cool objects.
Learn more about endothermic at: https://brainly.com/question/28909381
#SPJ1
What is the specific heat of a diamond if 4.5 J of heat is required to heat a 0.72 g piece of diamond
from 10°C to 22.3°C?
Answer:
0.51 J/g°C
Explanation:
The amount of water (density 1.00 g mL-1) in grams that must be added to 26.2 g of
MgCl2 in the preparation of a 1.5 % by mass solution is:
Answer:
1720.8g water are necessaries
Explanation:
Mass percent is defined as the mass of solute (In this case, MgCl2) in 100g of solution (Mass MgCl2 + Mass water). To solve this question we must find the mass of solution that we need to produce th 1.5% by mass solution. Thus, we can find the mass of water that we need as follows:
Mass solution:
26.2g MgCl2 * (100g Solution / 1.5g MgCl2) = 1747g solution
Mass water:
1747g solution - 26.2g MgCl2 = 1720.8g water are necessaries
Two identical light bulbs are connected to a battery in a series circuit.
An ammeter is wired into the circuit at measures a current of the
battery to be 0.5 Amps. The two light bulbs are then wired in parallel.
The ammeter shows that the current:
Answer:
0.10 amps
Explanation:
Imagine designing an experiment in which the presence of a gas is determined by simply listening to the gas with your ear. The human ear can detect pressures as low as 2 x 10^-5 N*m^-2. Assuming that the eardrum has an area of roughly 1 mm^2, what is the minimum collisional rate that can be detected by ear? Assume that the gas of interest is N2 at 298 K.
Answer:
Explanation:
Pressure = Force/Area
so,
Force =Pressure x Area
Force =(2x 10⁻⁵ )N/M² x (1 x (10⁻³)² M²
Force = 2 x 10⁻¹¹N
as we know,
Force= mass x acceleration ( F=m.a)
a = F/m
a =(2 x 10⁻¹¹N)/28
g since 1 N=1.kg.m.s⁻²
a=(2 x 10-11kg.m.s⁻² )/(28 x 10⁻³kg)
a = 5.6 x 10-7 m.s⁻²
thus minimum collision rate that can be detected is 5.6 x 10-7 m.s⁻²NEED HELP ASAP
1) Is Sulfur a metal or nonmetal? _______________________
2) Which family is Calcium in? _________________________
3) What is the Element’s name for the element that has the atomic number 72?
_______________________________________________________________
4) What is the atomic mass of Thallium? _________________________
5) What are all the atomic symbols for the Noble gases?
______________________________________________________________________
______________________________________________________________________
______________________________________________________________________
6) What are all the Element’s names in the metalloids?
______________________________________________________________________
______________________________________________________________________
______________________________________________________________________
7) What are all the atomic masses for the Actinides?
______________________________________________________________________
______________________________________________________________________
______________________________________________________________________
8)How many protons does Arsenic have? __________________
9) How many electrons does Radium have? ________________
10) How many neutrons does Nickel have? ________________
I'll see what I can do here...
1) Nonmetal
2) Calcium (Ca), chemical element, one of the alkaline-earth metals of Group 2 (IIa) of the periodic table.
3) Hafnium
4) 204.3833 u
5) Not sure what you're asking, but oble gas, any of the seven chemical elements that make up Group 18 (VIIIa) of the periodic table. The elements are helium (He), neon (Ne), argon (Ar), krypton (Kr), xenon (Xe), radon (Rn), and oganesson (Og)
6) The metalloids; boron (B), silicon (Si), germanium (Ge), arsenic (As), antimony (Sb), tellurium (Te), polonium (Po) and astatine (At)
7) The Actinide series contains elements with atomic numbers 89 to 103 and is the third group in the periodic table.
8) 33
9) 88
10) 30
Hope this helps!
What type of cell is the typical human body cell
Answer:
Red blood cells
Explanation:
An average adult human has somewhere around 25 trillion red blood cells in their body.
Answer:
Heya! Maddie here! The answer is Red Blood Cells.
Explanation:
Hope this helps!
How does body temperature, energy level, and water level affect a person’s ability to survive?
For the reaction
4PH3(g)↽−−⇀6H2(g)+P4(g)
the equilibrium concentrations were found to be [PH3]=0.250 M, [H2]=0.580 M, and [P4]=0.750 M.
What is the equilibrium constant for this reaction?
c=
The equilibrium constant (Kc) for the given reaction is approximately 16.448. The value of Kc indicates the relative concentrations of reactants and products at equilibrium. In this case, a Kc greater than 1 suggests that the products (H2 and P4) are favored at equilibrium, indicating that the forward reaction is more favorable.
To determine the equilibrium constant (Kc) for the given reaction:
4PH3(g) ↔ 6H2(g) + P4(g)
We can write the equilibrium constant expression based on the stoichiometric coefficients:
Kc = ([H2]^6 * [P4]) / ([PH3]^4)
Substituting the given equilibrium concentrations:
[PH3] = 0.250 M
[H2] = 0.580 M
[P4] = 0.750 M
We can plug in these values into the equilibrium constant expression:
Kc = ([0.580]^6 * [0.750]) / ([0.250]^4)
Kc = (0.0860128 * 0.750) / (0.00390625)
Kc = 16.448
for more question on equilibrium
https://brainly.com/question/18849238
#SPJ8
The stationary state with the lowest energy is called the _______.
Answer:
Ground state
the state with the smallest amount of energy.
Given that an IV is mixed so that each 150. mL of the solution contains 500. mg
of the drug lidocaine and the rate of infusion is set at 300. mL/hr. How many minutes will
it take for 0.750 g of lidocaine to be administered?
Answer:
First, we need to convert 0.750 g of lidocaine into milligrams (mg):
0.750 g = 750 mg
Next, we can calculate the total volume of the solution needed to administer 750 mg of lidocaine. Since each 150 mL of the solution contains 500 mg of lidocaine, we can set up the following proportion:
(750 mg) / (500 mg) = (x mL) / (150 mL)
Cross-multiplying:
500x = 750 * 150
500x = 112,500
x = 112,500 / 500
x = 225 mL
Now, we know that it will take 225 mL of the solution to administer 750 mg of lidocaine.
To find the time it takes to infuse 225 mL at a rate of 300 mL/hr, we can set up another proportion:
(225 mL) / (300 mL/hr) = (y min) / (60 min)
Cross-multiplying:
300y = 225 * 60
300y = 13,500
y = 13,500 / 300
y = 45 min
Therefore, it will take 45 minutes to administer 0.750 g (or 750 mg) of lidocaine at a rate of infusion of 300 mL/hr.
It will take approximately 75 minutes for 0.750 g of lidocaine to be administered through the IV at a rate of 300 mL/hr.
To calculate the time it takes to administer 0.750 g of lidocaine, we need to use the information provided.
Given:
Each 150 mL of the solution contains 500 mg of lidocaine.
The rate of infusion is set at 300 mL/hr.
First, we need to determine the amount of lidocaine administered per mL of the solution:
500 mg of lidocaine per 150 mL of solution = 500 mg / 150 mL ≈ 3.33 mg/mL
Next, we can convert the amount of lidocaine to be administered (0.750 g) to milligrams:
0.750 g * 1000 mg/g = 750 mg
Now, we can calculate the total volume of the solution needed to administer 750 mg of lidocaine:
750 mg / 3.33 mg/mL ≈ 225.23 mL
Finally, we can find the time it takes to administer 225.23 mL of the solution at a rate of 300 mL/hr.:
Time (in hours) = Volume (mL) / Rate (mL/hr.)
Time (in hours) = 225.23 mL / 300 mL/hr ≈ 0.75077 hr.
Converting hours to minutes:
Time (in minutes) ≈ 0.75077 hr * 60 min/hr ≈ 45.05 min
Therefore, it will take approximately 75 minutes for 0.750 g of lidocaine to be administered.
To learn more about lidocaine here
https://brainly.com/question/33427933
#SPJ2
What happens in a reaction if it is at chemical equilibrium?
Responses
The reaction rates of making products and using reactants are equal.
All of the reactants are used up.
The amount of the product is constantly decreasing.
There are no products in the system.
The reaction can be said to be at equilibrium when the reaction rates of making products and using reactants are equal.
When is a reaction at equilibrium?When the rates of the forward and reverse reactions are equal and the concentrations of the reactants and products don't change over time, a chemical reaction is said to be in equilibrium.
When the system reaches equilibrium, it is in a state of balance, which means that the concentrations of the reactants and products have not changed significantly.
Learn more about reaction equilibrium:https://brainly.com/question/9024475
#SPJ1
Salt water has a density of 1.183g/mL. A ball has a density of 0.0134 g/mL. Will the ball float or sink?
12. If mercury reacted with Fluorine (F), would a COVALENT or IONIC compound be
formed?
Answer: Ionic Compound
Explanation:
An ionic compound is formed when an element completely transfers its valence electron to another element. The element which donates the electron is known as electropositive element or the metal and the element which accepts the electrons is known as electronegative element or non metal.
A covalent compound is formed when an element shares its valence electron with another element. This bond is formed between two non metals.
Mercury flouride contain ionic bonds as it is made up of mercury metal and fllourine non metal.
What is the best method of separating the mixture of sand and fine salt?
By using filtration, the sand and fine salt can be effectively separated based on their difference in particle size, providing a clean separation of the two components.
Filtration is a separation technique that takes advantage of the difference in particle size between sand and salt. It involves passing the mixture through a porous material, such as filter paper or a filter funnel, which allows the liquid (saltwater) and small salt particles to pass through while retaining the larger sand particles.
Here's how the filtration process can be carried out:
1. Set up a filter apparatus with a funnel and filter paper or a filter flask.
2. Place the mixture of sand and salt in a beaker or a flask.
3. Slowly pour the mixture into the filter paper or funnel, allowing the liquid (saltwater) to pass through while retaining the sand on the filter paper.
4. Once the liquid has passed through completely, the sand will be left behind on the filter paper or in the filter flask.
5. Carefully remove the sand from the filter paper or filter flask, and the saltwater solution can be collected separately.
For more such questions on filtration
https://brainly.com/question/29756050
#SPJ8
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What is always true of a salt
(a) shows both acidic and basic properties
(b) creates a neutral pH in solution
(c) is an ionic compound formed from an acid-base reaction
(d) can react with acid but not with a base
Suppose that a person eats a diet of 2388 Calories per day.
Convert this energy into joules.
Convert this energy into kilojoules.
Convert this energy into kilowatt-hours.
Answer:
9991 J
9.991 kJ
2.78 × 10⁻³ kWh
Explanation:
Step 1: Given data
Energy consumed per day by a person (E): 2388 cal
Step 2: Convert "E" to J
We will use the conversion factor 1 cal = 4.184 J.
2388 cal × 4.184 J/1 cal = 9991 J
Step 3: Convert "E" to kJ
We will use the conversion factor 1 kJ = 1000 J.
9991 J × 1 kJ/1000 J = 9.991 kJ
Step 4: Convert "E" to kWh
We will use the conversion factor 1 kWh = 3600 kJ.
9.991 kJ × 1 kWh/3600 kJ = 2.78 × 10⁻³ kWh
PLS HELP ASAP (no links)
Which of the following is not composed of atoms?
A. Ice cream
B. You
C. Energy
D. The floor
Answer:
energy
Explanation:
6 g of metal M react completely with 23.66 g of chlorine to form 29.66 g of the metallic chloride. Find the empirical formula of the metallic chloride. (M = 27, C1 = 35.5) stop'
Answer:
Below in bold.
Explanation:
6 / 27 = 0.22222..
29.66 / 35.5 = 0.66648
Ratio of M to Cl is 1:6
Empirical formula = MCl3.
An unknown organic compound composed of carbon, hydrogen and oxygen was analyzed and found to be 60% C, 8% H and the rest being oxygen Its molecular weight is found to be 300g What is its molecular formula?
A sample of a gas has a pressure of 248mm Hg at 298K. What is the pressure of the gas at 398K?
Select the correct answer below:
0.00539mm Hg
478mm Hg
331mm Hg
186mm Hg
Answer:
P1= 248mm Hg
V1= 1.05L
P2= ? (<-- What we are going to be solving for)
V2= 3.98L
Explanation:
1. (248 mmHg) (1.05L) = (P2) (3.98L)
2. (248 mm Hg) (1.05L)
----------------------------- = P2
(3.98L)
3. P2 = 65.4 mm Hg is your answer