Transmission is referred to as the uninterrupted passage of insolation through the atmosphere or water.
What is Insolation?This can be defined as the process in which solar energy is incident onto objects which are usually in the form of waves. This is made possible through the process of heat transfer which is referred to as radiation in a medium such as air, water etc.
This is transmitted to the environment as it serves as a source of energy for the organisms which are present in the ecosystem. It is usually uninterrupted and are absorbed by plants during the process of photosynthesis.
Read more about Transmission here https://brainly.com/question/2023401
#SPJ4
2. Write a balance structural equation for each of the following reactions.
Name the ester formed in each case.
a) methanol + ethanoic acid
b) methanol + methanoic acid
c) butanol + propanoic acid
d) propanol + butanoic acid
e) ethanol + pentanoic acid
Answer:
a) Methanol + Ethanoic acid → Methyl ethanoate + Water
CH3OH + CH3COOH → CH3COOCH3 + H2O
Ester formed: Methyl ethanoate
b) Methanol + Methanoic acid → Methyl methanoate + Water
CH3OH + HCOOH → HCOOCH3 + H2O
Ester formed: Methyl methanoate
c) Butanol + Propanoic acid → Butyl propanoate + Water
CH3CH2CH2CH2OH + CH3CH2COOH → CH3CH2CH2CH2COOCH2CH3 + H2O
Ester formed: Butyl propanoate
d) Propanol + Butanoic acid → Propyl butanoate + Water
CH3CH2CH2OH + CH3CH2CH2COOH → CH3CH2CH2COOCH2CH5 + H2O
Ester formed: Propyl butanoate
e) Ethanol + Pentanoic acid → Ethyl pentanoate + Water
CH3CH2OH + CH3CH2CH2CH2COOH → CH3CH2CH2CH2COOCH2CH3 + H2O
Ester formed: Ethyl pentanoate
(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)
which laboratory department does sensitivity testing?
Sensitivity testing is performed by the microbiological division.
What is the Microbiology Department?
The laboratory groups that make up the department—which was founded in 1962—include those for bacteriology, parasitology, immunology, tuberculosis, enteric, virology, viral research& diagnostic laboratory (VRDL), and mycology. The following departments are part of the multidisciplinary division that is part of the Department of Microbiology: Bacteriology, Anaerobic Bacteriology, Virology, Mycology, Immunology, Parasitology, HIV laboratory (FICTC), Mycobacteriology, and Hospital Infection Control Laboratory. Microbiologists research the minute organisms, such as bacteria, fungus, viruses, and algae, that cause illnesses. In order to better understand these organisms' traits and prevent, diagnose, and cure infectious diseases, they concentrate on identifying and growing them.
Studying the biology of minute organisms like viruses, bacteria, algae, fungi, slime molds, and protozoa is known as microbiology.
To learn more about Department of microbiology refers to:
brainly.com/question/29304986
#SPJ4
The air in the balloon i heated up by leaving it in a warm place. Give two effect that thi ha on the air particle
If the balloon is closed, then yes, both volume and pressure will increase when the gas inside is heated.
What is pressure?
Pressure is the force applied perpendicular to the surface of an object per unit area over which that force is distributed.
Various units are used to express pressure. Some of these are units of force divided by units of area. For example, the SI unit of pressure, Pascal (Pa), is 1 Newton per square meter (N/m2). Similarly, pounds force per square inch (psi, symbol lbf/in2) is the traditional unit of pressure in imperial and US systems. Pressure can also be expressed as standard atmospheric pressure. Atmospheric pressure (atm) is equal to this pressure and torr is defined as 1/760 of this. Manometric units such as centimeters of water, millimeters of mercury, and inches of mercury are used to express pressure as the height of a particular liquid column within a manometer.
If the balloon is closed, then yes, both volume and pressure will increase when the gas inside is heated.
To know more about Pressure, visit:
https://brainly.com/question/28012687
#SPJ4
What is the keystone species in the Chesapeake Bay Estuary?
The keystone species in the Chesapeake Bay Estuary are Blue Crabs (Callinectes sapidus) and Eastern Oysters (Crassostrea virginica).
Blue Crabs (Callinectes sapidus) and Eastern Oysters (Crassostrea virginica) are two key species that play an important role in the Chesapeake Bay Estuary ecosystem.Blue Crabs are considered a keystone species because they are predators that feed on benthic animals that inhabit the bottom of the estuary. They keep these populations under control, which maintains the estuary's biodiversity. Furthermore, their feeding habits aid in nutrient cycling, which is crucial for the estuary's health.
Eastern oysters are also a keystone species since they help filter water. They are filter feeders that filter up to 50 gallons of water each day, removing algae and other particles. They also provide a habitat for other creatures in the estuary. Oysters' shells form the building blocks for reefs that protect shorelines from erosion and provide habitat for many species. Other species in the Chesapeake Bay Estuary include zooplankton, phytoplankton, and marsh grasses, which are also essential to the estuary's ecosystem.
To know more about species visit:
https://brainly.com/question/31972089
#SPJ11
The genotype RR would be considered a purebred and the genotype Rr would be considered a hybrid. *
True or False
Answer:
true
Explanation:
Question 1: For the reduction of iron oxide (FeO) by carbon reductant at 9500C to form
pure iron and carbon dioxide (C02) gas leaving the reactor at 9500C.
a) Give the balanced chemical reaction
b) Determine the variation of Gibbs standard free enetW of the reaction at 9500C
c) Determine the partial pressure of carbon dioxide (C02) at 9500C assuming that
the activities of pure solid and liquid species are equal to one
Use the table of thermodynamic data to find the approximate values of enthalpy; entropy
and Gibbs free enerw for the calculation and show all the calculations. The molar mass
in g/mole of elements are given below.
Fe: 55.85g/m01e; O: 16g/m01e and C: 12g/m01e
Question 2: Determine the energy required in Kilowatt-hour (Kwh) to priKIuce 500kg o
pure iron at 15000C during the reduction of iron oxide (Cu) by carbon reductant to
produce pure iron and carbon dioxide (C02) gas leaving the reactor at 7000C.
Use the table of thermodynamic data to find the approximate values of enthalpy; entropy
and Gibbs free energy for the calculation and show all the calculations. The molar mass
in g/mole of elements are given below
Fe: 55.85g/mole; O: 16g/mole and C: 12g/mole
1) a) Balanced chemical reaction equation: FeO(s) + C(s) → Fe(s) + CO₂(g) ; b) ΔG°T = -2.14 × 10⁶ J/mol ; c) P(CO₂) = 1.65 × 10⁻⁶ bar 2) a) The energy required to produce 500kg of pure iron at 15000C during the reduction of iron oxide by carbon reductant is -5.325 × 10⁶ kWh.
Question 1a) The balanced chemical reaction equation for the reduction of iron oxide by carbon reductant is given below; FeO(s) + C(s) → Fe(s) + CO₂(g)
Question 1 b) We can determine the variation of Gibbs standard free energy for the reaction from the equation,ΔG°T = ΔH°T - TΔS°TWhere;ΔG°T = Variation of Gibbs standard free energy for the reaction at temperature TΔH°T = Enthalpy change for the reaction at temperature TΔS°T = Entropy change for the reaction at temperature TT = Temperature
The enthalpy, entropy, and Gibbs free energy values for the calculation are as follows; ΔH°fFeO(s) = -270.0kJ/mol, ΔH°fFe(s) = 0kJ/mol, ΔH°fCO₂(g) = -393.5kJ/mol. S°FeO(s) = 50.5 J/mol
KS°Fe(s) = 27.3 J/mol, KS°CO₂(g) = 213.6 J/mol K
At 9500C = 12273K;
ΔH°T = ΣΔH°f(Products) - ΣΔH°f(Reactants)ΔH°T
= (0kJ/mol + -393.5kJ/mol) - (-270.0kJ/mol + 0kJ/mol)ΔH°T
= -123.5kJ/molΔS°T
= ΣS°(Products) - ΣS°(Reactants)ΔS°T
= (213.6 J/mol K + 0 J/mol K) - (50.5 J/mol K + 27.3 J/mol K)ΔS°T
= 135.8 J/mol
KΔG°T = ΔH°T - TΔS°T
ΔG°T = -123.5kJ/mol - 12273K (135.8 J/mol K)
ΔG°T = -2.14 × 10⁶ J/mol
Question 1 c)The partial pressure of carbon dioxide (CO2) at 9500C can be determined from the formula;
\(P(CO2)/P° = e^(-ΔG°/RT)\)
Where; P(CO₂) = partial pressure of carbon dioxide, P° = standard pressure (1 bar), ΔG° = Variation of Gibbs standard free energy for the reaction, T = temperature R = Universal gas constant = 8.314 J/mol K
Substituting the values we have; ΔG° = -2.14 × 10⁶ J/mol, T = 12273 KP° = 1 bar, R = 8.314 J/mol K
Then, \(P(CO2)/1 = e^(-(-2.14 × 10⁶ J/mol)/(8.314 J/mol K × 12273 K))\)
P(CO₂) = 1.65 × 10⁻⁶ bar
Question 2) The enthalpy change for the reaction and the Gibbs free energy change for the reaction are given from part (a); ΔH°T = -123.5kJ/mol
ΔG°T = -2.14 × 10⁶ J/mol
The molar mass of Fe is 55.85 g/mol
Therefore, the number of moles in 500kg of Fe is given by; No. of moles = mass/molar mass = 500000 g/55.85 g/mol
No. of moles = 8947.8546 moles
We can determine the amount of energy required using the equation; E = nΔG°T Where; E = Energy required, n = Number of moles of product produced ΔG°T = Variation of Gibbs standard free energy for the reaction at temperature T
Substituting the values we have; E = 8947.8546 mol × (-2.14 × 10⁶ J/mol)E
= -1.917 × 10¹⁰ J
To convert to kilowatt-hours (kWh); E(kWh) = E(J) / (3600 J/kWh)E(kWh)
= (-1.917 × 10¹⁰ J) / (3600 J/kWh)E(kWh)
= -5.325 × 10⁶ kWh
Therefore, the energy required to produce 500kg of pure iron at 15000C during the reduction of iron oxide by carbon reductant is -5.325 × 10⁶ kWh.
To know more about chemical reaction, refer
https://brainly.com/question/25769000
#SPJ11
Describe in three sentences how Ca (Calcium) can get a positive two charge?
16 meters per hour to miles per sec
Answer:
2.76 (full answer) 2.7617e-6
Explanation:
thin filaments of si may be prepared by the deomposition of sih4 to si and h2. what mass of sih4 is required to prepare 0.2173 g of si using this method
Mole of \(SiH_{4}\) is0.0077 and The mass of \(SiH_{4}\) is required to prepare is 0.2464g
The mole, abbreviated as mol, is the International System of Units' unit of material amount. How many elementary entities of a particular substance are contained in an object or sample is determined by the quantity of that material. The Avogadro number, or approximately how many nucleons (protons or neutrons) are in one gram of common matter, is the number of elementary particles in one mole. The most prevalent carbon isotope, carbon-12, weighs 12 grams, therefore the traditional definition of a mole was the quantity of elementary particles equal to that weight.
\(SiH_{4}\rightarrow Si+2H_{2}\)For the 0.2173g of Si , The moles of Si=\(\frac{Given\: mass}{Molar \:mass}\)
moles of Si=\(\frac{0.2173}{28}\)
moles of Si=0.0077
then,, According to Stoichiometry
moles of Si=moles of \(SiH_{4}\)=0.0077
molar mass of \(SiH_{4}\)=32g
mass of \(SiH_{4}\)=moles of \(SiH_{4}\) x 32g
mass of \(SiH_{4}\)=32 x 0.0077=0.2464g
Learn more about mole
brainly.com/question/26416088
#SPJ4
1. Based on the functional groups present in each analgesic compound (aspirin, acetaminophen, ibuprofen, and caffeine) discuss the overall polarity of these compound relative to one another.
2. Discuss how the Rf value (on a TLC plate) of each compound is affected by the molecule’s structure and polarity.
3. Discuss the choice of eluent (mobile phase). For example, what would happen if a much less polar eluent was used?
1. Aspirin and ibuprofen, which contain carboxylic acid functional groups, are more polar compared to acetaminophen and caffeine.
2. The Rf value on a TLC plate is affected by the molecule's structure and polarity.
3. The choice of eluent affects the separation of compounds in TLC, and using a less polar eluent would have specific consequences.
1. Aspirin and ibuprofen contain carboxylic acid functional groups, which contribute to their overall polarity. Carboxylic acids are polar due to the presence of oxygen atoms and the ability to form hydrogen bonds. Acetaminophen, although it also contains a functional group (an amide), is less polar compared to aspirin and ibuprofen. Caffeine, on the other hand, is relatively nonpolar as it contains aromatic rings and alkyl groups.
2. The Rf value on a thin-layer chromatography (TLC) plate is influenced by the molecule's structure and polarity. In general, polar compounds tend to have lower Rf values compared to nonpolar compounds. This is because polar compounds interact more strongly with the polar stationary phase (such as silica gel) on the TLC plate, leading to reduced mobility and lower Rf values. Nonpolar compounds, on the other hand, have weaker interactions with the stationary phase and therefore exhibit higher Rf values.
3. The choice of eluent (mobile phase) in TLC plays a crucial role in separating compounds. An eluent with higher polarity will facilitate the movement of polar compounds and result in lower Rf values for those compounds. Conversely, using a less polar eluent would promote the movement of nonpolar compounds, leading to higher Rf values. If a much less polar eluent is used, it could potentially cause poor separation and overlapping spots on the TLC plate, making it difficult to distinguish between different compounds.
Learn more about Rf value
brainly.com/question/31554651
#SPJ11
how many coefficients need to be changed to make this chemical equation balanced? Zn + HNO3 --> Zn (No3)2 + H2
Coefficient 2 should be placed in the equation before the nitric acid in the reactant so that the chemical reaction becomes balanced.
The given chemical reaction is,
Zn + HNO3 --------> Zn (No3)2 + H2
Here, the elements Hydrogen, Nitrogen, and Oxygen are unbalanced.
These elements are altogether found in HNO₃ on the reactant side and are found as nitrate and hydrogen gas on the product side.
To balance the equation, the coefficient 2 is to be added in the reactant side so that 2 moles of Hydrogen, Nitrogen, and Oxygen would be balanced with 2 moles of Nitrate and two moles of Nitrogen.
On adding 2 on reactant side, we get
Zn + 2HNO3 -----------> Zn(NO3)₂ + H₂
This gives us a balanced equation and thus the equation could be balanced this way.
Therefore, coefficient 2 is to be added to make the equation to be balanced.
To know more about the balanced equation, click below:
https://brainly.com/question/26694427
#SPJ1
A gas has a mass of 3.82 g and occupies a volume of 0.854 L. The temperature in the laboratory is 302 K, and the air pressure is 1.04 atm. calculate the molar mass of the gas.
1) 93.4 g/ mol
2) 72.3 g/ mol
3) 107 g/ mol
4) 35.8 g/mol
The molar mass of the gas that has a mass of 3.82 g and occupies a volume of 0.854 L is 106.66g/mol.
How to calculate molar mass?The molar mass of a substance can be calculated by dividing the mass of the substance by its number of moles.
However, the number of moles of the gas in this question needs to be calculated first using the ideal gas law equation:
PV = nRT
Where;
P = pressureV = volumen = number of molesT = temperatureR = gas law constant1.04 × 0.854 = n × 0.0821 × 302
0.888 = 24.79n
n = 0.888/24.79
n = 0.036mol
Molar mass of gas = 3.82g/0.036mol
Molar mass = 106.66g/mol
Therefore, the molar mass of the gas that has a mass of 3.82 g and occupies a volume of 0.854 L is 106.66g/mol.
Learn more about molar mass at: https://brainly.com/question/12127540
I and II are: constitutional isomers. enantiomers. identical. diastereomers. not isomeric.
The correct answer is: I and II are constitutional isomers, but not enantiomers, identical, or diastereomers.
If I and II are constitutional isomers, it means that they have the same molecular formula but different connectivity or arrangement of atoms.
If they are enantiomers, it means that they are non-superimposable mirror images of each other. Enantiomers have the same connectivity but differ in their spatial arrangement of atoms.
If they are identical, it means that they are exactly the same molecule in every way, including connectivity and spatial arrangement.
If they are diastereomers, it means that they are stereoisomers that are not mirror images of each other. Diastereomers have different connectivity and different spatial arrangements of atoms.
If I and II are not isomeric, it means that they are not related to each other by any type of isomerism.
So, based on the given options, if I and II are constitutional isomers, they cannot be identical, enantiomers or diastereomers. If they are not isomeric, it means that they are also not enantiomers or diastereomers.
learn more about diastereomers Refer: https://brainly.com/question/21506956
#SPJ11
Part A Which mode of enzyme inhibition decreases both the apparent km and apparent Vmax? ► View Available Hint(s) O Competitive inhibition O Irreversible inhibition O Uncompetitive inhibition O Mixed inhibition Submit
The mode of enzyme inhibition that decreases both the apparent Km and apparent Vmax is C: uncompetitive inhibition.
Uncompetitive inhibition occurs when the inhibitor binds to the enzyme-substrate complex, preventing the release of products and effectively decreasing the apparent Vmax. Since the inhibitor only binds to the enzyme-substrate complex, it also decreases the apparent Km as the enzyme has a higher affinity for the substrate in the presence of the inhibitor.
In contrast, competitive inhibition only affects the apparent Km, as the inhibitor competes with the substrate for the active site of the enzyme. Irreversible inhibition and mixed inhibition both decrease the apparent Vmax, but do not affect the apparent Km in the same way as uncompetitive inhibition.
You can learn more about uncompetitive inhibition at
https://brainly.com/question/12948473
#SPJ11
a 1.0 l balloon has a pressure of 2 atm. when the pressure increases to 2,000 kpa, what is the volume? responses 0.1 l 0.1 l 0.2 l 0.2 l 2.0 l 2.0 l 510 l 510 l
When the pressure of the 1.0 L balloon increases to 2,000 kPa, the volume will be 510 L.
The ideal gas law also states that if the temperature of the gas is increased while the pressure is held constant, the volume of the gas will increase. This is because the increased temperature will cause the gas particles to move faster, and the faster they move, the more space they will take up, resulting in an increase in volume.
Therefore, if the temperature of the 1.0 L balloon is increased while the pressure is held constant, the volume of the gas will increase.
Learn more about the pressure of the balloon:
https://brainly.com/question/12148102
#SPJ4
At STP 101.3 kPa 0 C one mole of Ar gas was collected and was found to occupy a volume of 22.4L What is the value of the gas constant in rounded to the nearest hundredth?
Answer:
8.31 KPa.L/Kmol
Explanation:
From the question given above, the following data were obtained:
Pressure = 101.3 KPa
Temperature (T) = 0 °C = 273 K
Number of mole (n) = 1 mole
Volume = 22.4 L
Gas constant (R) =?
The gas constant can be obtained as follow:
PV = nRT
101.3 × 22.4 = 1 × R × 273
2269.12 = R × 273
Divide both side by 273
R = 2269.12 / 273
R = 8.31 KPa.L/Kmol
Therefore, the value of the gas constant is 8.31 KPa.L/Kmol
a 25.0-gram sample of magnesium oxide contains 10.8 grams of magnesium. what is the percent of oxygen by mass in this compound?
Answer:56.8%
Explanation:
17) which one of the following types of elements is most likely to be a good oxidizing agent? a) transition elements b) alkaline earth elements c) lanthanides d) alkali metals e) halogens
The most likely type of elements to be good oxidizing agents among the given options are e) halogens.
Halogens are non-metallic elements found in Group 17 of the periodic table and include fluorine (F), chlorine (Cl), bromine (Br), iodine (I), and astatine (At). These elements have seven valence electrons in their outer shell, which means they only need one more electron to complete their octet and achieve a stable configuration.
Halogens have high electronegativities, making them very reactive and eager to gain an electron from other elements. When a halogen gains an electron, it undergoes reduction, while the element donating the electron undergoes oxidation. Due to their strong tendency to gain electrons, halogens function as excellent oxidizing agents.
Alkaline earth elements (b), found in Group 2, and alkali metals (d), found in Group 1, are not as likely to be good oxidizing agents. They are more inclined to lose electrons, making them reducing agents instead. Meanwhile, transition elements (a) and lanthanides (c) are less predictable in their behavior as oxidizing or reducing agents, as their reactivity depends on their specific oxidation states and the context in which they are interacting with other elements.
Learn more about halogens here:
https://brainly.com/question/11156152
#SPJ11
The answer is e) halogens. Halogens are highly electronegative elements and have a tendency to attract electrons from other elements, making them good oxidizing agents.
The Alkaline earth elements, on the other hand, have a relatively low electronegativity and are therefore less likely to act as oxidizing agents. The most likely type of elements to be good oxidizing agents among the given options is e) halogens. Halogens have high electronegativities, meaning they have a strong tendency to attract electrons from other elements. As an oxidizing agent, a halogen gains electrons from other elements, causing them to become oxidized. This makes halogens effective oxidizing agents compared to the other options provided.
learn more about Halogens here.
https://brainly.com/question/11156152
#SPJ11
1. What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2+ concentration is 8.24×10-4 M and the Mn2+ concentration is 1.42 M ? Cu2+(aq) + Mn(s) Cu(s) + Mn2+(aq) Answer: ______V The cell reaction as written above is spontaneous for the concentrations given:
2. A concentration cell similar to the one shown is composed of two Mg electrodes and solutions of different Mg2+ concentrations. The left compartment contains 0.841 M Mg2+ , and the right compartment contains 1.36 M Mg2+ . Calculate the cell potential for this reaction at 298 K. ____volts .In this magnesium concentration cell, the reaction would proceed spontaneously _________
3. When the Hg2+ concentration is 1.46 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 2.587V. What is the Al3+ concentration? 3Hg2+(aq) + 2Al(s)3Hg(l) + 2Al3+(aq) Answer: ____M
1. The reaction is spontaneous
2. The reaction is not spontaneous
3.The concentration of the aluminum is 0.0027 M
What is the Nernst equation?We know that;
Ecell = E°cell - 0.0592/nlog Q
For question 1;
Ecell = 1.53 - 0.0592/2 log (1.42/ 8.24×10-4)
= 1.43 V
The reaction is spontaneous
For question 2;
Ecell = 0 - 0.0592/2 log(1.36/0.841)
= - 0.047 V
The reaction is not spontaneous
For question 3;
2.587= 2.56 - 0.0592/6 log([Al^3+]/1.46)
2.587 - 2.56 = - 0.0592/6 log([Al^3+]/1.46)
0.027 = - 0.0592/6 log([Al^3+]/1.46)
0.027 * -(6/ 0.0592) = log([Al^3+]/1.46)
Antilog [0.027 * -(6/ 0.0592) ) = ([Al^3+]/1.46)
[Al^3+] = Antilog [0.027 * -(6/ 0.0592) ) * 1.46
= 0.0027 M
Learn more about Nernst equation:https://brainly.com/question/31593791
#SPJ4
Which of the following is stored in the skeletal system?
A. potassium
B. calcium
phosphorous
D. sodium
Answer:
b calcium
Explanation:
HELP PLEASE! There is a water-filled continental rift in Iceland. What type of plate boundary would cause this rift? *
A. convergent
B. divergent
C. transform
Lithospheric plates move because of the movement of the ___________________________ under them.
A. lower mantle
B. asthenosphere
C. outer core
D. inner core
Answer:
B. Divergent
The rift formed in the Divegent tectonic boundary between the North America and Eurasian Plates and is located now in Iceland (Im sorry im not good at explaining)
pls helpppp
Is the law of conservation of mass observed in each equation?
1. 2KClO3=2KCl+3O2
2. CaCO3+2HCl=CaCl2+H2O+CO2
Answer:
its c my guy
Explanation:
a chemical engineer has determined by measurements that there are 81.2 moles of carbon in a sample of methyl tert-butyl ether. how many moles of oxygen are in the sample? round your answer to 3 significant digits.
It is 194.88 moles of oxygen that the chemical engineer determined in the sample of methyl tert-butyl ether if there are 81.2 moles of carbon
Procedure to calculate moles of oxygenIf C5H12O the formula of methyl tert-butyl ether, it is observed that there are 5 hydrogen atoms for every 12 oxygen atoms
And if each mole contains exactly 6.022 × 10∧23 atoms, according to Avogadro's number, then a simple rule of thumb can determine how many hydrogen atoms are present.
Rule of three1 mole ------------- 6.022 ×10∧23
81.2 moles ----------- x
X = 81.2 x 6.022 140 76×10∧23
x = 488,986 x 10∧23
Once again, by the rule of three, the amount of elementary oxygen particles is determined.
5 H atoms ---------- 12 O atoms
488.986 x ×1023 H ------ x O
X = 488,986 x ×10∧23 x 12 /5
X = 1173.567 x 10∧23
And with the rule of three and Avogadro's number, the number of moles of oxygen is also determined.
Rule of three6.022 ×1023 ------------- 1 mol
1173.567 x 1023----------- x mol
X moles = 1173.567 x 10∧23 x 1 / 6.022 x 10∧23
X = 194.88 moles
Learn more about moles in a compound at https://brainly.com/question/26416088
#SPJ4
(Science)
(Quarter 4)
Solve the puzzle game's to have 5 point's
(BEGIN)
( •O•)!?
| |
| |
| |______|________
|________|_____ |
| |
(FINISH)
(real question)
can you know why Sam is nosebleeding
_ ~
(> ㅍuㅍ)>
Explanation:
because of blood pressure
HELP PLEASE!!!!!
show work
What is the pH of a solution if the pOH is 2.96
The pH of a solution if the pOH is 2.96 will be 11.04. As the sum of the pH and pOH is always 14.
A pH can be regarded as a scale that is used to measure acids and bases. The scale measures from 0 to 14. A litmus paper is used to indicate if the substance is an acid or a base and then the color of the litmus paper is used to match the numbers on the pH scale in order to indicate what kind of substance is it. The term PH is widely used in the fields of biology, chemistry, and agronomy. In chemistry, it depicts the hydrogen potentials. It shows us the concentration of hydrogen ions in a solution.To know more about, pH levels, visit :
https://brainly.com/question/2288405
J
Question 7 of 25
Why are many scientists dependent on the government for funding?
OA. The government is in control of all public research.
OB. Research is often too expensive to do without the government's
help.
C. Scientists have no other source of money.
OD. Scientists can do only the research the government will pay for.
Many scientists are dependent on the government for funding for many reasons. One of the main reasons is that research is often too expensive to carry out without the help of the government. Option b)
The government plays a major role in scientific research, especially in areas of national interest. Government research funding plays an important role in promoting scientific inquiry and advancing knowledge of the natural world. The government is in charge of allocating research funds to public and private organizations. For scientists who want to carry out their research, it can be challenging to find funding from other sources, such as private companies.
As a result, the majority of researchers rely on government grants to finance their work. This dependence on government funding has advantages and disadvantages . One of the advantages is that it ensures that scientific research is carried out in areas that are of national interest. By prioritizing funding for specific areas, the government can direct research toward those issues that are considered important to the country. Another advantage is that it can lead to more innovation. Government grants often provide funding for research that might not be carried out otherwise, such as new technologies or techniques. This can result in breakthroughs that lead to new products, services, or ideas.However, there are also some disadvantages to being dependent on government funding. One of the main drawbacks is that it can lead to a lack of independence. Researchers who rely on government grants may feel obligated to focus on areas that the government deems important, rather than pursuing their own interests or those that are considered unconventional. Another disadvantage is that government funding can be unpredictable. Grants are usually awarded for a limited period of time and may be subject to budget cuts or changes in priorities. As a result, scientists may have to constantly seek new sources of funding or may be forced to abandon their research projects. Hence option b) is correct.
for such more questions on research
https://brainly.com/question/2988619
#SPJ8
3. The total pressure of helium and Argon gas in a closed cylinder is 3.0 atm. If the partial pressure of the Argon is 0.365 atm, what is the partial pressure of the helium?
: Propose a structure for a compound with molecular formula CgH1403 that fits the following spectroscopic data. IR:1820cm, 1760cm1 1H NMR: 1.08 (triplet, 1-6), 1.6δ (sextet, 1-4), 2.20 (triplet, 1-4)
The molecular formula of the compound is given as CgH1403 and the spectroscopic data are given as follows: IR:1820cm, 1760cm1 1H NMR: 1.08 (triplet, 1-6), 1.6δ (sextet, 1-4), 2.20 (triplet, 1-4).The molecular formula suggests the compound to have 14 hydrogen atoms.
The IR spectrum of the compound suggests the presence of a carbonyl group (C=O) around 1760 cm-1 and the N-H bond (O-H is missing from the spectrum) which suggests the presence of carboxylic acid or amide. The 1H NMR spectrum indicates three types of hydrogen atoms: A triplet at 1.08 ppm (J = 7 Hz) with integration of 6 protons. A sextet at 1.6 ppm (J = 7 Hz) with integration of 4 protons. A triplet at 2.20 ppm (J = 7 Hz) with integration of 4 protons.
From the chemical shift of the hydrogen atoms, we can propose that the hydrogen atoms with δ = 1.08 ppm are CH3 groups, the hydrogen atoms with δ = 1.6 ppm are CH2 groups, and the hydrogen atoms with δ = 2.20 ppm are CH groups. From the integration values of the signals, we can deduce the following:- The triplet at 1.08 ppm (J = 7 Hz) with integration of 6 protons indicates that there are two CH3 groups (6 protons in total).- The sextet at 1.6 ppm (J = 7 Hz) with integration of 4 protons indicates that there are two CH2 groups (8 protons in total).- The triplet at 2.20 ppm (J = 7 Hz) with integration of 4 protons indicates that there are two CH groups (8 protons in total).From the above information, we can propose the structure of the compound as follows: CH3-CH(CH3)-CH2-CO-NH-CH2-CH2-CH2-CO-CH-CH3
To know more about carbonyl group visit
https://brainly.com/question/13564853
#SPJ11
What caused the formation of Mammoth Caves?