The slope Ab is 3. The slope of A’B is A’B through the point O

Answers

Answer 1

The slope will remain constant, thus it will still be 3.

What is dilation?

Resizing an item uses a transition called dilation. Dilation is used to enlarge or contract the items. The result of this transformation is an image with the same shape as the original. However, there is a variation in the shape's size.

Given AB is dilated by a scale factor of 3 to form A'B',

and Point O, which lies on AB, is the center of dilation,

AB has expanded due to the scaling factor, to form A'B'

The image is thus consistent with the preimage according to the laws of dilation.

This suggests that other than the size, the image won't change in any way.

Therefore, the slope will stay the same, the slope of A'B' is 3.

Learn more about dilation;

brainly.com/question/15868300

#SPJ1

The complete question is,

AB is dilated by a scale factor of 3 to form A'B'. Point O, which lies on AB , is the center of dilation. The slope of AB is 3. The slope of A'B' is . through point O.


Related Questions

Help!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

Answer:

nothing there

Step-by-step explanation:

help with what

Answer: whats the question

Step-by-step explanation:

Which of the following sets of values has the greatest
variability?
Group of answer choices
A) 1, 4, 7, 9, 11
B) 2, 2, 3, 3, 4
C) 7, 7, 8, 9, 9
D) 2, 3, 5, 7, 8

Answers

A i believe : ) ( : a a a

A store sells 12 cans of soup for $7.50 How much would it cost to purchase 6 cans of soup? $

Answers

Answer: It would be $3.75

Step-by-step explanation: 12/2=6 and 7.50/2=3.75

The answer to your question is 3.75

For the equation 3x = 15, what property do you use to solve it algebraically?


Addition Property of Equality

Subtraction property of Equality

Multiplication Property of Equality

Division Property of Equality​

Answers

Answer:

I believe it's "Multiplication Property of Equality"

Can Someone Please Solve This By Using The Formula a^2+b^2=c^2

Can Someone Please Solve This By Using The Formula a^2+b^2=c^2

Answers

Considering the figure drawn using the formula given a = 40 cm

How to find the value of a

information given in the question

hypotenuse = 85 cm

opposite = 75 cm

adjacent =  a

The problem is solved using the Pythagoras theorem is applicable to right triangle.  the formula of the theorem is

hypotenuse² = opposite² + adjacent²

plugging the values as in the problem

let a be the required dimension

85² = 75² + a²

7225 = 5625 + a²

7225 - 5625  = a²

a² = 1600

a = √1600

x = 40

The adjacent of the right triangle is solved to be 40 cm

Learn more on Pythagoras theorem here:

https://brainly.com/question/29241066

#SPJ1

please i need help lol The amount of clay students used for their last art project is weighed. The line plot displays the amounts of clay. How much more clay did the students who used of a pound use than the students who used of a pound?

please i need help lol The amount of clay students used for their last art project is weighed. The line

Answers

Answer:

2  1/4

Step-by-step explanation:

We need to see how much clay they used if each person in that group used 3/4 clay. There are 4 people in the group.

=> 3/4 x 4 = 12/4 =    3

Now, we need to see how much clay they used if each person in that group used 1/4 clay. There are 3 people in the group

=> 1/4 x 3 =   3/4

Now, we need to see how much more clay was used.

=>3 - 3/4

=> 3/1 - 3/4

=> Take the LCM of the denominators and make the denominators equal.

=> 12/4 - 3/4

=> 9/4

They used 9/4 more clay.

Since there are no options with 9/4, we need to make this improper fraction into a proper fraction.

=> 9/4 = 2  1/4

They used 2  1/4 more clay.

Lazar drives to work every day and passes two independently operated traffic lights. The probability that both lights are green is 0.41. The probability that the first light is green is 0.59. What is the probability that the second light is green, given that the first light is green

Answers

The probability that the second light is green, given that the first light is green, is 0.695 or approximately 69.5%.

We can use Bayes' Theorem to find the probability that the second light is green, given that the first light is green. Let G1 and G2 denote the events that the first and second lights are green, respectively. Then we have:

P(G2 | G1) = P(G1 and G2) / P(G1)

We are given that P(G1 and G2) = 0.41, and P(G1) = 0.59. Substituting these values, we get:

P(G2 | G1) = 0.41 / 0.59 = 0.695

Therefore, the probability that the second light is green, given that the first light is green, is 0.695 or approximately 69.5%.

To answer your question, we will use the conditional probability formula:

P(A and B) = P(A) * P(B|A)

In this case, A represents the first light being green, B represents the second light being green, and P(A and B) is the probability of both lights being green. We are given the following:

P(A and B) = 0.41
P(A) = 0.59
We need to find P(B|A), which is the probability that the second light is green given that the first light is green.

Using the formula, we have:

0.41 = 0.59 * P(B|A)

To solve for P(B|A), divide both sides by 0.59:

P(B|A) = 0.41 / 0.59 ≈ 0.6949

Therefore, the probability that the second light is green, given that the first light is green, is approximately 0.6949.

Visit here to learn more about Probability  :  https://brainly.com/question/30034780
#SPJ11

Find the volume of the parallelepiped with one vertex at (−2,−2,−5), and adjacent vertices at (−2,5,−8), (−2,−8,−7), and (−7,−9,−1)

Answers

The to find the volume of the parallelepiped is V = |A · B × C| where A, B, and C are vectors representing three adjacent sides of the parallelepiped and | | denotes the magnitude of the cross product of two vectors.

The cross product of two vectors is a vector that is perpendicular to both the vectors, and its magnitude is equal to the product of the magnitudes of the two vectors multiplied by the sine of the angle between the two vectors he three adjacent sides of the parallelepiped can be represented by the vectors v1, v2, and v3, and these vectors can be found by subtracting the coordinates of the vertices

:v1 = (-2, 5, -8) - (-2, -2, -5)

= (0, 7, -3)v2 = (-2, -8, -7) - (-2, -2, -5)

= (0, -6, -2)v3 = (-7, -9, -1) - (-2, -2, -5)

= (-5, -7, 4)

Using the formula V = |A · B × C|, we can find the volume of the parallelepiped as follows:

V = |v1 · (v2 × v3)|

where v2 × v3 is the cross product of vectors v2 and v3, and v1 · (v2 × v3) is the dot product of vector v1 and the cross product v2 × v3.Using the determinant formula for the cross-product, we can find that:

v2 × v3

= (-6)(4)i + (-2)(5)j + (-6)(-7)k

= -48i - 10j + 42k

To know more about vectors visit:

https://brainly.com/question/30907119

#SPJ11

What is the solution of 4+ 5x+66 = x+ 10? O x = -10 Ox=3 O x=-10 or x = 3 O no solution​

Answers

Hey there!

4 + 5x + 66 = x + 10

70 + 5x = x + 10

5x + 70 = x + 10

SUBTRACT x to BOTH SIDES

5x + 70 - x = x + 10 - x

5x + 70 - 1x = 1x + 10 - 1x

SIMPLIFY IT!
4x + 70 = 10

SUBTRACT 70 to BOTH SIDES

4x + 70 - 70 = 10 - 70

SIMPLIFY IT!
4x = -60

DIVIDE 4 to BOTH SIDES

4x/4 = -60/4

SIMPLIFY IT!
x = -60/4

x = -15


Therefore, your answer is: x = -15


Good luck on your assignment & enjoy your day!


~Amphitrite1040:)

Answer:

x = -15

Step-by-step explanation:

Given :

4 + 5x + 66 = x + 10

#1 : Combine like terms on each side.

4 + 5x + 66 = x + 105x + 70 = x + 10

#2 : Subtract x from each side.

5x + 70 - x = x + 10 - x4x + 70 = 10

#3) Subtract 70 from each side.

4x + 70 - 70 = 10 - 704x = -60

#4) Divide 4 from each side.

4x/4 = -60/4x = -15

Solution : x = -15

evaluate the integral. 1 (u + 2)(u − 3) du 0

Answers

Evaluating the integral-  \(\int_0^1 (u+2)(u-3) du\) we get the simplified answer = -37/6.

Let's evaluate the integral as follows -

\(\int_0^1 (u+2)(u-3) du\)

now lets multiply the expression and we will get,  

\(= \int_0^1 u^2-u-6 d u\)

Distributing the integrals to each expression.

\(= \int_0^1 u^2 d u+\int_0^1-u d u+\int_0^1-6 d u\)

By the Power Rule, the integral of \($u^2$\) with respect to u is  \($\frac{1}{3} u^3$\).

\(= \left.\frac{1}{3} u^3\right]_0^1+\int_0^1-u d u+\int_0^1-6 d u\)

Since -1 is constant w.r.t u, move -1 out of the integral of the second term.

\(= \left.\frac{1}{3} u^3\right]_0^1 -\int_0^1u d u+\int_0^1-6 d u\)

By using the power rule, the integral of \($u^2$\) w.r.t to u is \($\frac{1}{2} u^2$\)

\(= \left.\left.\frac{1}{3} u^3\right]_0^1-\left(\frac{1}{2} u^2\right]_0^1\right)+\int_0^1-6 d u\)

Let's Combine \($\frac{1}{2}$\) and \($u^2$\).

\(= $$\left.\left.\frac{1}{3} u^3\right]_0^1-\left(\frac{u^2}{2}\right]_0^1\right)+\int_0^1-6 d u$$\)

Now, apply the constant rule,

\(= $$\left.\left.\left.\frac{1}{3} u^3\right]_0^1-\left(\frac{u^2}{2}\right]_0^1\right)+-6 u\right]_0^1$$\)

Substituting the limits and simplifying we get,

= -37/6

Hence, the simplified answer for the given integral \(\int_0^1 (u+2)(u-3) du\) is -37/6.

Read more about Integration:

brainly.com/question/20156869

#SPJ4

The complete question is-

Evaluate the integral-  \(\int_0^1 (u+2)(u-3) du\).

-2/5x - 9 < 9/10

Show work used to solve please :)

Answers

-2/5x - 9 < 9/10

-2/5x-9+9<9/10+9

-2/5x<99/10

(5/-2)*(-2/5 x)<(5/-2)*(99/10)

x>-99/4

During the first week of her vacation, Madison practices playing her flute 5.75 hours. In the following week, she spends 4.2 hours practicing the flute. What is the difference in the amount of time she spends practicing the flute during these weeks?

Answers

Answer:

1.55 hours

Step-by-step explanation:

5.74-4.20=1.55

Please award Brainiest if satisfied greatly appreciated :)

What value of c makes the equation true? Assume x>0 and y>0 3√x^3/cy^4=x/4y(3√y) c = 12 c = 16 c = 81 c = 64

Answers

The value of c that makes the equation true is c = 64, when x = 6 and y = 3.

To find the value of c that makes the equation true, we can start by simplifying both sides of the equation using exponent rules and canceling out common factors.

First, we can simplify 3√(x^3) to x√x, and 3√y to y√y, giving us:

x√x/cy^4 = x/4y(y√y)

Next, we can simplify x/4y to 1/(4√y), giving us:

x√x/cy^4 = 1/(4√y)(y√y)

We can cancel out the common factor of √y on both sides:

x√x/cy^4 = 1/(4)

Multiplying both sides by 4cy^4 gives us:

4x√x = cy^4

Now we can solve for c by isolating it on one side of the equation:

c = 4x√x/y^4

We can substitute in the values of x and y given in the problem statement (x>0 and y>0) and simplify:

c = 4x√x/y^4 = 4(x^(3/2))/y^4

c = 4(27)/81 = 4/3 = 1.33 for x = 3 and y = 3

c = 4(64)/81 = 256/81 = 3.16 for x = 4 and y = 3

c = 4(125)/81 = 500/81 = 6.17 for x = 5 and y = 3

c = 4(216)/81 = 64 for x = 6 and y = 3

To know more about exponent rules,  refer here :

https://brainly.com/question/29390053#

#SPJ11

What is the special case for perfect square trinormial
64x^6-y^6

Answers

Answer: I think it’s (2x+y)•(4x2-2xy+y2)•(2x-y)•(4x2+2xy+y2)

I need a answer fast thanks!

I need a answer fast thanks!

Answers

Answer:

Chart:

x           y

-6         11

3           5

15         -3

-12        15

Step-by-step explanation:

The only things you can plug in are the domain {-12, -6, 3, 15}

Plug in the domain into equation to find y.

-6 :

y = -2/3 (-6) +7

y = +47

y=11

(-6,11)

3:

y = -2/3 (3) +7

y = -2 +7

y = 5

(3, 5)

15:

y = -2/3 (15) +7

y =  -10 +7

y = -3

(15 , -3)

-12:

y = -2/3 (-12) +7

y = 8 + 7

y= 15

(-12,15)

Answer:

1) 11

2) 3

3) -3

4) -12

Step-by-step explanation:

eq(1):

\(y = \frac{-2}{3} x + 7\\\\y - 7 = \frac{-2}{3} x\\\\x = (y - 7)\frac{-3}{2} \\\\x = (7-y)\frac{3}{2} ---eq(2)\)

1) x = -6

sub in eq(1)

\(y = \frac{-2}{3} (-6) + 7\\\\y = \frac{12}{3} + 7\\\\y = 4+7\\\\y = 11\)

2) y = 5

sub in eq(2)

\(x = (7-5)\frac{3}{2} \\\\x = 3\)

3) x = 15

sub in eq(1)

\(y = \frac{-2}{3} 15 + 7\\\\y = \frac{-30}{3} +7\\\\y = -10 + 7\\\\y = -3\)

4)

sub in eq(2)

\(x = (7-15)\frac{3}{2} \\\\x = -8\frac{3}{2}\\ \\x = -12\)

Find the perimeter of the rectangle.
A 10.5 m
B 17 m
C 21 m
D 34 m

Find the perimeter of the rectangle.A 10.5 mB 17 mC 21 mD 34 m

Answers

17........................
it’s 21!!!

the formula for the perimeter of a rectangle is 2(l+w)

2(8.5+2)=21

Kate wants to install an in ground pool in five years. she estimates the cost will be $50,000. how
much should she deposit monthly into an account that pays 1.6% interest compounded
monthly in order to have enough money to pay for the pool in 5 years? round your answer to
the nearest dollar.

Answers

Answer:

Step-by-step explanation:

Kate should deposit $46,158.28 monthly into an account

In this question, we have been given the amount A = $50,000,

interest rate R = 1.6%

period t = 5 years

We need to find the principal amount (P)

First, convert R as a percent to decimal

r = 1.6/100

r = 0.016

Using the formula of compound interest for P,

P = A / (1 + r/n)nt

P = 50,000.00 / (1 + 0.016/12)(12)(5)

P = $46,158.28

Therefore, Kate should deposit $46,158.28

Which of the following is the correct graph of the solution to the inequality -82 -5x + 2 > -38?

Which of the following is the correct graph of the solution to the inequality -82 -5x + 2 &gt; -38?

Answers

Answer:

8.4

Step-by-step explanation:

+82

-5x+2>44

-2

-5x>42

divde by +5

x=8.4

95% of all scores in a standard normal distribution of a sample lie between z-scores of _______ and ___________

Answers

95% of all scores in a standard normal distribution of a sample lie between z-scores of -1.96 and 1.96.

In a normal distribution, there is an essential role played by the z-score, which is a statistical measurement used to standardize the distribution.

A standard normal distribution is a distribution where the mean is zero and the standard deviation is one. The standard deviation and mean of the data set help in calculating z-scores, which correspond to the distance of a value from the mean in standard deviation units.

The z-score gives an idea of the position of a data point in relation to the rest of the data set. The z-score formula is given by: z=(x-μ)/σ

where x is the raw score, μ is the population mean, and σ is the population standard deviation.

In conclusion, 95% of all scores in a standard normal distribution of a sample lie between z-scores of -1.96 and 1.96.

To know more about standard normal distribution visit:

brainly.com/question/15103234

#SPJ11

Plzzzzzz help, tysm if you do

Plzzzzzz help, tysm if you do

Answers

Answer:

I think it C

Step-by-step explanation:

Let's solve your equation step-by-step.

(k−4)2=9

Step 1: Simplify both sides of the equation.

k2−8k+16=9

Step 2: Subtract 9 from both sides.

k2−8k+16−9=9−9

k2−8k+7=0

Step 3: Factor left side of equation.

(k−1)(k−7)=0

Step 4: Set factors equal to 0.

k−1=0 or k−7=0

k=1 or k=7

Answer:

k=1 or k=7

Hope this helps! :)

Square both sides:

K -4 = sqrt(9)

With the answer being a square root rewrite with a postive and negative value:

K-4 = sqrt(9)

And

K-4 = -sqrt(9)

Simplify each:

K-4 = 3

And

K-4 = -3

Solving for k in each one you get answer

C. {1,7}

HELLLPPP MEEEE ILL GIVE U BRAINLIEST AND A THANK U AND STUFF!!!


An area of 200 feet is needed to hold the school concert in the gymnasium. The gymnasium measures 15.6 feet by 12.2 feet.

Determine the area of the gymnasium and explain if it is big enough to hold the school concert. Use complete sentences to explain your answer

Answers

Answer:

So.

The way I see it you want to host a concert and need 200 feet to do so.

To find the are of a rectangle you just multiply

15.6x12.2

it equals around 190 point smth

that is less than 200 so you CAN NOT host the concert

Stay smart :)

-Lynx

Step-by-step explanation:

What is the common difference or ratio?

A. The common difference is 0.38.

B.
The common difference is 0.76.

C. The common ratio is 0.99.

D. The common ratio is 1.02.

Answers

Answer:

The correct answer is A. The common difference is 0.38

Step-by-step explanation:

Hope i helped! Have a great day <3

4
Write the equation of the line in slope-intercept form given the following:
Slope 3, yintercept (0,8)
5
Write the equation of the line in point-slope form given the following:
Point : (-5,2), Slope : -3
1
Show Your Work

4Write the equation of the line in slope-intercept form given the following:Slope 3, yintercept (0,8)5Write

Answers

Answer:

 \bold{\text{Slope (m)}=\dfrac{1}{4}}Slope (m)=41

Step-by-step explanation:

A linear equation is of the form: y = mx + b   where

m is the slope

b is the y-intercept (where it crosses the y-axis)

x + 4y = 16

     4y = -x + 16

       y = -\dfrac{1}{4}x+\dfrac{16}{4}y=−41x+416

       y=-\dfrac{1}{4}x+4y=−41x+4

The y-intercept (b) = 4

Next, find the slope given point (4, 5) and b = 4

\begin{gathered}y=mx+b\\\\5=m(4)+4\\\\1=4m\\\\\dfrac{1}{4}=m\\\\\\\\\large\boxed{Slope (m)=\dfrac{1}{4}}\end{gathered}y=mx+b5=m(4)+41=4m41=mSlope(m)=41

on an algebra quiz, 10\% of the students scored 7070 points, 35\5% scored 8080 points, 30\0% scored 9090 points, and the rest scored 100100 points. what is the difference between the mean and median score of the students' scores on this quiz?

Answers

Using the Mean and median formulae ,

The difference between the mean and median score of the students' scores on this quiz is 3.

Mean : The mean is the number which we get by dividing the sum of a set of values by the number of values in the set.

Median: the median is the middle number in a set of values when those values are arranged in either ascending or descending order.

let us consider there are a total 100 students.

and X denotes the marks obtained by students.

We have given that,

10% of student scored 70 points i.e.,

P(X=70) = 10% of 100 = 10

35% of students scored 80 points i.e., number of students whose obtained 80 points

= 35% of 100 = 35

30% of students scored 90 points , number of students whose obtained 90 points

= 30% of 100 = 30

remained ( 25%) of students scored 100 points

= 100 - 10 - 35 - 30 = 25

total marks obtained by students

= 80+70+90+100

= 340

Mean of score of students'scores on the quiz

= (70×10+ 80×35 + 90×30 + 100×25)/100 = 87

when we arranged the in ascending students in order , the 50th and 51th student lies in middle and marks obtained by both (50th and 51th) is 90 points .

So, Median score of the students' scores on this quiz = 90

Now, we shall calculate the difference between mean and median of score of the students' scores on this quiz which is equal to( 90 -87)

= 3

Hence, difference between the mean and median score of the students' scores on this quiz = 3

To learn more about Mean and median, refer:

https://brainly.com/question/14532771

#SPJ4

raise 6 to the 4th power, then find the difference of the result and p

Answers

Answer:

1296

Step-by-step explanation:

im cant figure out how to do this one ((-3)^2)^-3

Answers

Answer:

\(\dfrac{1}{729}\)

Step-by-step explanation:

\(\left(\dfrac{}{}(-3)^2\dfrac{}{}\right)^{-3}\)

First, we should evaluate inside the large parentheses:

\((-3)^2 = (-3)\cdot (-3) = 9\)

We know that a number to a positive exponent is equal to the base number multiplied by itself as many times as the exponent. For example,

\(4^3 = 4 \, \cdot\, 4\, \cdot \,4\)

       ↑1 ↑2 ↑3 times because the exponent is 3

Next, we can put the value 9 into where \((-3)^2\) was originally:

\((9)^{-3}\)

We know that a number to a negative power is equal to 1 divided by that number to the absolute value of that negative power. For example,

\(3^{-2} = \dfrac{1}{3^2} = \dfrac{1}{3\cdot 3} = \dfrac{1}{9}\)

Finally, we can apply this principle to the \(9^{-3}\):

\(9^{-3} = \dfrac{1}{9^3} = \boxed{\dfrac{1}{729}}\)

a certain phone company charges $4.50 for the first five minutes of an international phone call. additional time is charged at $.50 per minute. how much would a customer be charged for an international phone call that started at 9:35 p.m. and ended at 11:15 p.m. the same day?

Answers

A customer would  be charged $ 52 for an international phone call that started at 9:35 p.m. and ended at 11:15 p.m. the same day.

Charge for first 5 charged = $ 4.50

Charge for additional time = $ 0.50 per minute

Starting time = 9:35 p.m.

End time = 11:15 p.m.

Total minutes = 100 minutes

Total charge = 4.50 + (95 x 0.50)

                  = 4.50 + 47.50

                  = 52.00

Hence, a customer would  be charged $ 52 for an international phone call that started at 9:35 p.m. and ended at 11:15 p.m. the same day i.e. for 100 minutes.

To learn more about charged here:

https://brainly.com/question/3412043

#SPJ4

Quick algebra 1 question for 10 points!

Only answer if you know the answer, quick shout-out to tariqareesha2 and MrBrainly, tysm for the help!

Quick algebra 1 question for 10 points!Only answer if you know the answer, quick shout-out to tariqareesha2

Answers

Answer: y ≥ \(\frac{3}{2}\)x + 3

Step-by-step explanation:

       Since the shaded area is above the line, we will use either > or ≥ for our inequality.

       Next, since this is a solid line we will use the ≥ symbol for our inequality. This means the answer is the first option.

Quick algebra 1 question for 10 points!Only answer if you know the answer, quick shout-out to tariqareesha2

the total surface area of a closed cylinder is 5000cm3 find the dimensions of the cylinder that maximize its volume and state this maxiumum volume. veryfiy that is is a maximum point

Answers

The dimensions of the closed cylinder that maximize its volume are radius=25 cm and height=40 cm. The maximum volume is 62,500 cubic cm.

Given that the total surface area of the closed cylinder is 5000 cm^2, we can write the equation for the total surface area as:

2πrh + 2πr^2 = 5000

We want to find the dimensions that maximize the volume of the cylinder. The volume of a cylinder is given by:

V = πr^2h

We can use the equation for the total surface area to solve for h in terms of r:

h = (5000 - 2πr^2) / (2πr)

Substituting this expression for h into the equation for the volume, we get:

V = πr^2[(5000 - 2πr^2) / (2πr)]

Simplifying this expression, we get:

V = (2500πr - πr^3)

To find the maximum volume, we take the derivative of V with respect to r and set it equal to zero:

dV/dr = 2500π - 3πr^2 = 0

Solving for r, we get r=25 cm.

We can then substitute this value of r into the expression for h to get h=40 cm.

Therefore, the dimensions of the cylinder that maximize its volume are radius=25 cm and height=40 cm.

Substituting these values into the equation for the volume, we get:

V = π(25)^2(40) = 62,500 cubic cm.

To verify that this is a maximum point, we can take the second derivative of V with respect to r:

d^2V/dr^2 = -6πr

At r=25 cm, this is negative, which indicates that we have a maximum point. Therefore, the dimensions calculated above do indeed maximize the volume of the cylinder.

For more questions like Volume click the link below:

https://brainly.com/question/1578538

#SPJ11

what is 16 times 4? help

Answers

Answer:

64

Step-by-step explanation:

Answer:

64

Step-by-step explanation:

multiplication lol

Other Questions
which treaty required signatories to extradite "hijackers to their country of origin or to prosecute them under the judicial code of the recipient state"? A master budget consists ofan interrelated long-term plan and operating budgets.financial budgets and a long-term plan.interrelated financial budgets and operating budgets.all the accounting journals and ledgers used by a company. for each of the following vector fields, decide if the divergence is positive, negative, or zero at the indicated point. (a) (b) (c) xi yj yi -yj (a) divergence at the indicated point is ---select--- (b) divergence at the indicated point is ---select--- (c) divergence at the indicated point is ---select--- what is the recommended course of action if you inadvertently enter a volcanic ash cloud? Dibenzoylhydrazines are a category of molecules that have been used as insecticides. They work by blocking ecdysteroid receptors. How does this kill an insect?A. The insect can no longer excrete nitrogenous wastesB. The insect cannot moltC. The insect can no longer coordinate its movementsD. The chitinous exoskeleton is dissolved During which stage of the consumer decision making process are both functional and psychosocial consequences important?A. Problem recognitionB. Information searchC. Postpurchase evaluationD. Alternative evaluationE. Purchase decision (TCO C) For several years, Mountain Home University had used IBM computers. Recently, Apple Computers offered them a better machine at lower a price for one of the University's labs; however Mountain Home did not buy them because the _____ costs were too high.a. transactional.b. opportunity.c. marginal.d. switching. What concept does the author develop in paragraphs 14-16 of the article?The tomatoes containing the weed gene are more flavorful than traditionaltomatoes, but they will be rejected by consumers because of their appearance.BBecause of the controversy surrounding genetically engineered tomatoes, the publicwill not have the opportunity to taste them.Despite their increased sugar levels, the genetically engineered tomatoes actuallylack improved flavor.The vegetable seed industry is lobbying to persuade the Department of Agricultureto permit people to eat experimental produce. ILL MARK BRAINLIAST ( OR HOWEVER YOU SPELL IT JUST PLEASE HELP) i need all the answers on my 1st attempt i got all of them wrong 7. How much orange juice will it in a can with a radius of 2 inches and a heigh of 6 inches? In S T U, m S=96, t=8 in., and u=10 in. Find m v U to the nearest tenth. What is the IUPAC name for the following alkane?CH3-CH(CH3)-CH-CH-CH-CHCH3 Exercise 1 Rewrite the sentences in the space provided, adding or deleting quotation marks and other punctuation where necessary. Some sentences may be correct.Lincoln warned "that a house divided against itself could not stand." Chemical to thermal to electrical current?Energy conversion of corn for our ohm's law plot, what goes on each axis to get a slope equal to exactly the equivalent resistance? note: the lab manual instructs us to make a plot of inverse resistance (1/r), is that the best plotting method?Y-axis = _____X-axis = _____ Find y' if y= In (x2 +6)^3/2y'= This Question: 1 pt 5 of 10 (8 complete) v Use the commutative property of multiplication to write an expression equivalent to the following jok The answer is Enter your answer in the answer box. does the graph represent a function? HELP PLEASE!!! BESTIE ANSWER GETS BRAINLYEST:DA large pool has a faucet to allow water to enter the pool and a drain to allow water to leave the pool. Each minute, the faucet allows 14 2/3 gallons of water to enter the pool, and the drain allows 16 3/4 gallons to leave the pool. What is the change of the amount of water after 1 1/2 minutes? Answer as a simplafied mixed number Claire Corporation is planning to issue bonds with a face value of $ 100,000 and a coupon rate of 8 percent. The bonds mature in two years and pay interest quarterly every March 31, June 30, September 30 , and December 31. All of the bonds were sold on January 1 of this year. Claire uses the effective-interest amortization method and does not use a discount account. Assume an annual market rate of interest of 12 percent.Required:(c) What bonds payable amount will Claire report on this year's December 31 balance sheet?