the metal block had a mass of 1.50kg

Answers

Answer 1

The amount of heat energy lost by the metal is

E = 200 J/kg*C x 1.5kg x (100–20)  = 24000 J

That is transferred to the liquid, raising it's temperature

24000 J = 1,000 kg/J*C x 3kg x ∆T

∆T = 8

Since the liquid started at 0ºC, the final temp is 8ºC


Related Questions

1.0 mol of an ideal
gas starts at 1.0 atm and 77F and does 1.0 kJ of work during an
adiabatic expansion. Calculate the final volume of the gas. Express
your answer in litres. In your calculation, f

Answers

The final volume of the gas is 15.8 L.

The Ideal gas law is the equation of state of a hypothetical ideal gas. It is a good approximation to the behaviour of many gases under many conditions, although it has several limitations. The ideal gas equation can be written as-

                      PV = nRT

where,

P = Pressure

V = Volume

T = Temperature

n = number of moles

Given,

n = 1

Pressure = 1 atm

W = 1 kJ

Temperature = 77⁰F

γ = 1.4

PV = nRT

The temperature in K is written as -

T = ( 77 - 32 ) 5/9 + 273.15

= 298.15 K

\(w = \frac{nr( T_{1} - T_{2)} }{\pi - 1}\)

T₂ = 250.04 K

The initial volume of the container is -

P₁V₁ = nRT₁

101.32 Pa × V = 1 × 8.314 × 298

V = 0.025 m³

The final volume of the gas is worked out from the equation -

\((\frac{V_{2} }{V_{1} } ) = (\frac{T_{1} }{T_{2} })^{(1.4 - 1)}\)

V = 0.0158 m³ = 15.8 L

Learn more about Ideal gas Law, here:

https://brainly.com/question/12624936

#SPJ4

a. What is the pH of a solution with a [H+] of 6.8 x 10^-11?

Answers

Answer:

[H+] = 6.8×10^-11

so, pH = - log[H+]

= - log [6.8×10^-11]

= -(-10.167)

= 10.167

what volume (in L) of carbon dioxide will be produced from the reaction of 11.8L of ethane

Answers

Volume (in L) of Carbon dioxide : 23.6 L

Further explanation

Avogadro's hypothesis:  

In the same T,P and V, the gas contains the same number of molecules  

So the ratio of gas volume will be equal to the ratio of gas moles  

\(\tt \dfrac{V_1}{n_1}=\dfrac{V_2}{n_2}\)

Combustion of ethane :

\(\tt 2C_2H_6+7O_2\Rightarrow 4CO_2+6H_2O\)

mol ratio of C₂H₆ : CO₂ ⇒ 2 : 4

so the volume of CO₂ :

\(\tt \dfrac{V_1}{n_1}=\dfrac{V_2}{n_2}\\\\\dfrac{11.8}{2}=\dfrac{V_2}{4}\\\\V_2=\boxed{\bold{23.6~L}}\)

 

Answer:

23.6

Explanation:

Please help me out I need to know what the two atoms have in common.

Please help me out I need to know what the two atoms have in common.

Answers

Answer:

I think it's atomic number?

Explanation:

Really sorry if that's wrong

which example involves a colligative property? responses pouring salt on an icy sidewalk to make it free of ice pouring salt on an icy sidewalk to make it free of ice transferring some of a concentrated solution into a dilute solution transferring some of a concentrated solution into a dilute solution bringing a carbonated beverage to room temperature bringing a carbonated beverage to room temperature heating a pure solvent to boiling

Answers

Pouring salt on an icy sidewalk to make it free of ice is an example of a colligative property. Colligative properties are properties of solutions that depend on the concentration of solute particles, but not on their identity.

Four common colligative properties are:

Freezing point depression: The freezing point of a solution is lower than the freezing point of the pure solvent.Boiling point elevation: The boiling point of a solution is higher than the boiling point of the pure solvent.Osmotic pressure: The pressure required to prevent osmosis, the flow of solvent from a region of low solute concentration to a region of high solute concentration, across a semipermeable membrane.Vapor pressure lowering: The vapor pressure of a solution is lower than the vapor pressure of the pure solvent.

Pouring salt on an icy sidewalk to make it free of ice is an example of freezing point depression. The salt dissolves in the water on the surface of the ice and forms a solution. The presence of salt in the water lowers the freezing point of the water, causing it to melt even at temperatures below the normal freezing point of pure water. This effect is due to the increased number of solute particles in the solution, which interferes with the formation of the crystal lattice of ice.

To learn more about colligative property refer to this link

https://brainly.com/question/12538175

#SPJ4

write the second step of the aldol reaction using curved arrows to show electron reorganization. ethanal -->dilute aq NaOH --> aldol

Answers

The second step of the aldol reaction using ethanal and dilute aq NaOH involves the nucleophilic attack of the enolate ion on the carbonyl carbon of another ethanal molecule, forming a new C-C bond and an alkoxide ion.

In the aldol reaction, the first step is the formation of the enolate ion by the deprotonation of the alpha hydrogen of ethanal by NaOH. In the second step, the enolate ion acts as a nucleophile and attacks the electrophilic carbonyl carbon of another ethanal molecule.

The curved arrow originates from the negatively charged oxygen of the enolate ion and points towards the carbonyl carbon, indicating the movement of the electron pair.

As a result, the double bond between the carbonyl carbon and oxygen shifts to form a bond with the oxygen, creating an alkoxide ion. The new C-C bond and alkoxide ion ultimately lead to the formation of the aldol product.

To know more about nucleophilic attack click on below link:

https://brainly.com/question/31279781#

#SPJ11

Under which conditions of temperature and pressure would a sample of CO2(g) behave least like an ideal gas? C

1) 0°C and 100 kPa
2) 150°C and 100 kPa
3) 150°C and 300 kPa
4) 0°C and 300 kPa

Answers

The conditions of temperature and pressure in which a sample of CO₂ (g) would behave least like an ideal gas are high temperature and high pressure; 150°C and 300 kPa, option C

What are ideal gases?

An ideal gas is any gas whose molecules obey the gas law and whose behavior follows the ideal gas behavior.

The behavior of ideal gases is as follows:

the intermolecular forces of attraction between the gases are negligiblethe collision of the molecules of the gas is perfectly elastic

For a given gas to behave as an ideal gas, it must be under conditions of extremely high temperatures and low pressure.

Learn more about ideal gases at: https://brainly.com/question/27870704

#SPJ1

3.4 x 10^23 atoms of potassium to grams

Answers

To solve this problem, we must take into account Avogadro's number. Avogadro's number tells us that in one mole of any substance there are 6.022x10^23 atoms. Applying this relationship we have that the moles of potassium (K) are:

\(\begin{gathered} molK=givenatomsK\times\frac{1molK}{6.022\times10^{23}atoms} \\ \end{gathered}\)\(\begin{gathered} molK=3.4\times10^{23}atomsK\times\frac{1molK}{6.022\times10^{23}atoms} \\ molK=0.6molK \end{gathered}\)

Now, to go from moles to grams, we must multiply the moles by the molar mass of potassium. The molar mass of potassium is 39.1g/mol. So, the grams of potassium will be:

\(gK=givenmolK\times\frac{MolarMass,gK}{1molK}\)\(\begin{gathered} gK=0.6molK\times\frac{39.1gK}{1molK} \\ gK=22.1gK \end{gathered}\)

Answer: In 3.4x10^23 atoms of potassium there are 22.1 grams

what is the ph of 0.779 m ethylammonium chloride, c2h5nh3cl. the kb of ethylamine, c2h5nh2, is 4.3 x 10-4.

Answers

The pH of 0.779 M ethylammonium chloride (C2H5NH3Cl) is 10.08. What is ethylammonium chloride? Ethylammonium chloride is a chloride salt that is formed from the reaction between ethylamine and hydrochloric acid.

Ethylamine (C2H5NH2) is the primary component in the synthesis of ethylammonium chloride. When ethylamine is added to hydrochloric acid, a white solid is formed that has the chemical composition C2H5NH3Cl.How to find pH of ethylammonium chloride?The Kb value for ethylamine is given as 4.3 x 10^-4.

The reaction for ethylamine is:C2H5NH2(aq) + H2O(l) ⇌ C2H5NH3+(aq) + OH-(aq)We can assume that ethylammonium chloride is completely ionized. So, we can write:C2H5NH3Cl → C2H5NH3+ + Cl-The hydrolysis of the ethylammonium ion is given by the following equation: C2H5NH3+ (aq) + H2O(l) ⇌ C2H5NH2(aq) + H3O+(aq)Therefore, Kb = [C2H5NH2][H3O+]/[C2H5NH3+]Let's assume x is the H3O+ ion concentration. Then [C2H5NH2] = [H3O+] and [C2H5NH3+] = 0.779 - x.Substituting these values in the above equation, we get the equation: 4.3 x 10^-4 = x^2 / (0.779 - x)By solving the above equation, we can get x, which is the H3O+ ion concentration. Once we get x, we can calculate the pH of the solution, which is given by the equation:pH = - log [H3O+]Finally, by substituting the value of [H3O+] we get the pH of the solution. PH of the solution is 10.08.

learn more about ph of ethylammonium chloride at: brainly.com/question/31096747

#SPJ11


Which quantum number represents the main energy level of an electron?
A. n
B. m
c. e
D. /

Answers

Answer:

A

Explanation:

Which of the following is a change in which the identity of the substance
does NOT change
Chemical change
Chemical property
Physical change
Physical property


Which of the following terms when something transforms one type of
matter into another kind, which may have different properties.*

A:Chemical change
B:Chemical property
C:Physical change
D:Physical property

Answers

Answer:

physical

Explanation:

physical is the answer not chemical

I think so


Two scientists were competing to earn some grant money to fund their research, because
there was only enough money for one project. What type of impact were these scientists
experiencing?

•Political

•economical

•societal

•comical

Answers

Societal and economical
Economical and Societal

Using the equation: 3 NO2(g)H2O-->2 HNO3(aq)+ NO (g)If you start with 10.0 g of NO2(g) and 30.0 g of H2O0):a. What is the limiting reagent for this reaction?b. How many grams of nitric acid can be produced? (theoretical yield)

Answers

Answer:

a. The limiting reagent is NO2.

b. 126g of nitric acid can be produced.

Explanation:

1st) It is necessary to write the balanced equation:

\(3NO_2+H_2O\text{ }\rightarrow2HNO_3\text{ + NO}\)

From the balanced equation we know that 3 moles of NO2 (3x46g= 138g) react with 1 mol of water (18g/mol) to produce 2 moles of nitric acid (2x63g= 126g) and 1 mol of NO (30g/mol).

2nd) To calculate the limiting reagent it is necessary to use the given values and the stoichiometry of the balanced equation:

\(\begin{gathered} 138gNO_2-18gH_2O \\ 10.0gNO_2-x=\frac{10.0gNO_2\cdot18gH_2O}{138gNO_2} \\ x=1.30gH_2O \end{gathered}\)

The 10.0g of NO2 will need 1.30g of H2O to react.

\(\begin{gathered} 18gH_2O-138gNO_2 \\ 30.0gH_2O-x=\frac{30.0gH_2O\cdot138gNO_2}{18gH_2O} \\ x=230gNO_2 \end{gathered}\)

The 30.0g of H2O will need 230g of NO2 to react.

So, as we only have 10.0g of NO2 and 30.0g of H2O, the limiting reagent will be NO2.

3rd) Now, to calculate the theorical yield, we need to use the stoichiometry of the balanced equation using the limiting reagent:

1 mol of H2O produces 2 moles of nitric acid. With the molar mass of nitric acid (63g/mol), we can calculate the grams.

\(2\text{moles}\cdot(\frac{63g}{1\text{mol}})=126g\)

Finally, 126g of nitric acid will be produced if the reaction is 100% efficient (theoretical yield).

Which is a form of kinetic energy?
gravitational energy
chemical energy
electrical energy
sound energy
DO

Answers

Answer:

Electrical

There are five types of kinetic energy: radiant, thermal, sound, electrical and mechanical.

Why is innate immunity referred to as nonspecific?

because it provides a built-in mechanism of defense that does not require "training"

because it is a form of defense found in all animal species

because it is a form of defense that functions in all human body systems

because it provides defense against a wide range of pathogens

Answers

Answer:

c

Explanation:

The innate immune system is the body's first line of defense against germs entering the body. It responds in the same way to all germs and foreign substances, which is why it is sometimes referred to as the "nonspecific" immune system

Which example is an organism?

lung


virus

heart


bacteria

Answers

Answer:

Bacteria

Explanation:

bactiera are single-celled oraganism.

Answer:

bacteria

Explanation: cuz i said so

Identify whether longhand notation or noble-gas notation was used in each case below. Potassium (K): 1s22s22p63s23p64s1 longhand notation noble-gas notation

Answers

Answer:

Longhand Notation

Explanation:

Explanation I just did it. Sorry I know I might be late to answer.

Answer:

the anwser is A or longhand notation

Explanation:

why is hardness important in identifying minerals

Answers

hardness plays a major role in identifying a mineral. it can make the identification process much simpler by considerably narrowing a search. hardness is defined by how well a substance will resist scratching by another substance.

what is the name of this organic compound?

what is the name of this organic compound?

Answers

The name of the organic compound is 2-methyl pentane. The given organic compound is a five-carbon system with a substitution at the C-2 carbon. The naming of an organic compound is done according to the rules given by IUPAC.

The given organic compound has 5 carbon in its main chain. So It has the root word Pent. Since, all the bonds are single bonds, the organic compound is saturated, hence it has the suffix -ane. Hence the unsubstituted straight chain is pentane.

Numbering is done from right to left, because when the numbering is from right to left, the substituted carbon gets C-2, when it is numbered from left to right, the substituted carbon gets C-4. So the numbering is from the right and the substituted carbon is C-2. The substituent is a single carbon system, a methyl substituent. So the organic compound is named 2-methyl pentane .

Learn more about naming of organic compounds here,

https://brainly.com/question/27843604?

What is the name given to substances that are initially involved in a chemical reaction?

Answers

Answer:

the awnser is reactants

The answer is reactants:)

Listed below are four weak acids and their ionization constants in alphabetical order. Which acid has the greatest acid strength (the strongest acid)?
a. hydrocyanic acid, HCN, Ka = 6.2 x 10-10
b. hydrofluoric acid, HF, Ka = 7.2 x 10-4
c. lactic acid, HC3H5O3, Ka = 1.4 x 10-4
d. benzoic acid, C6H5COOH, Ka = 6.3 x 10-5

Answers

Hydrofluoric acid, HF, Ka = 7.2 x 10-4 has the greatest acid strength (the strongest acid).

What is acid?

Acid is a substance that has a sour taste, is corrosive, and can react with other substances to form salts. Acids have a pH level lower than 7, making them acidic and can be found in nature in the form of citrus fruits, vinegar, and even in rainwater. Acids are used in the laboratory for a variety of purposes, including titrations, neutralizing bases, and even in chemical syntheses. Acids have a wide range of applications, from cleaning agents to antacids, baking soda, and even food and beverage production.

Therefore, Hydrofluoric acid, HF, Ka = 7.2 x 10-4 has the greatest acid strength (the strongest acid).

To learn more about acid

Here: https://brainly.com/question/25148363

#SPJ4

Explain how the complexity and diversity of living things has changed over time

Answers

Answer:

Dylan invested $ 600 in a savings account at a 1.6 % annual interest rate . He made no deposits or withdrawals on the account for 2 years. The interest was compounded annually . Find, to the nearest cent, the balance in the account after 2 years. a₁ What information from the question is important ? b . How much does Dylan have in his bank account after 2 years ? Show work .

10) Air masses are different in many ways. Which of these is NOT different?
a) Atmospheric pressure
b) Temperature
c) Ratio of oxygen/nitrogen
d) Moisture contents ​

Answers

Answer:D. Ratio of oxygen/nitrogen

Explanation: the ratio will never change no matter the air pressure!

What is the mass of O2 needed when 8.75 * 10^70 molecules of CH4 combust to form CO2?

Answers

As a result, when you enter your pertinent values, you get:E = -891 * 1.65 E = -1470.15 kJ.

What is the mass ?

The following results are obtained after entering the data into the formula:

((2*-238) + -394)

- [-75 + (2*0)]

H(reaction)=-891 kJ/mol

Now you need to find the kJ value for 1.65 mol.

You use the following standard formula:

Where E is energy expressed in kJ, E is equal to (reaction) * mol.

As a result, when you enter your pertinent values, you get:

E = -891 * 1.65 E = -1470.15 kJ

To learn more mass refer

https://brainly.com/question/6685683

#SPJ1

1. Calculate the frequency and the energy of light that has a wavelength of 568 cm
2. Calculate the frequency and the energy of light that has a wavelength of 726 cm
3. Calculate the frequency and the energy of light that has a wavelength of 482 cm
4. Calculate the frequency and the energy of light that has a wavelength of 879 cm
5. Calculate the frequency and the energy of light that has a wavelength of 167 cm
6. Calculate the frequency and the energy of light that has a wavelength of 572 cm

1. Calculate the frequency and the energy of light that has a wavelength of 568 cm2. Calculate the frequency

Answers

Answer:

Please find the answers to the frequency and energy to each question below

Explanation:

Using the formulas;

λ = v/f

E = hf

Where;

λ = wavelength (metres)

v = speed of light (2.998 × 10^8 m/s)

f = frequency (Hz)

E = Energy of photon (J)

h = Plancks constant (6.63 × 10^-34 J.s)

1.) λ = 568cm = 5.68m

f = v/λ

f = 2.998 × 10^8 ÷ 5.68

f = 0.5278 × 10^8

f = 5.278 × 10^7 Hz

E = hf

E = 6.63 × 10^-34 × 5.278 × 10^7

E = 34.99 × 10^(-34+7)

E = 3.499 × 10^-26 J

2). λ = 726cm = 7.26m

f = v/λ

f = 2.998 × 10^8 ÷ 7.26

f = 0.413 × 10^8

f = 4.13 × 10^7 Hz

E = hf

E = 6.63 × 10^-34 × 4.13 × 10^7

E = 27.38 × 10^(-34+7)

E = 2.74 × 10^-26 J

3). λ = 482cm = 4.82m

f = v/λ

f = 2.998 × 10^8 ÷ 4.82

f = 0.622 × 10^8

f = 6.22 × 10^7 Hz

E = hf

E = 6.63 × 10^-34 × 6.22 × 10^7

E = 41.24 × 10^(-34+7)

E = 4.124 × 10^-26 J

4). λ = 879cm = 8.79m

f = v/λ

f = 2.998 × 10^8 ÷ 8.79

f = 0.341 × 10^8

f = 3.41 × 10^7 Hz

E = hf

E = 6.63 × 10^-34 × 3.41 × 10^7

E = 22.61 × 10^(-34+7)

E = 2.26 × 10^-26 J

5). λ = 167cm = 1.67m

f = v/λ

f = 2.998 × 10^8 ÷ 1.67

f = 1.795 × 10^8

f = 1.795 × 10^8 Hz

E = hf

E = 6.63 × 10^-34 × 1.795 × 10^8

E = 11.9 × 10^(-34+8)

E = 1.19 × 10^-25 J

6). λ = 572cm = 5.72m

f = v/λ

f = 2.998 × 10^8 ÷ 5.72

f = 0.524 × 10^8

f = 5.24 × 10^7 Hz

E = hf

E = 6.63 × 10^-34 × 5.24 × 10^7

E = 34.74 × 10^(-34+7)

E = 3.474 × 10^-26 J

Which properties of alkaline earth metals decrease going down group 2?

Answers

Answer:

Ionization energy

Electron affinity

Electronegativity

Explanation:

Wind erosion
ER
O removes the fertile B horizon of soil
o can be reduced by cutting down trees
O happens slowly in dry climates
en in de
is both destructive and constructive

Answers

Answer:

removes the fertile B horizon of soil

Explanation:

Wind erosion has the capacity to remove the fertile B horizon of the soil.

The term wind erosion generally refers to the capacity of high-magnitude wind to cause damages to the terrestrial environment. Soils can get their topmost layers removed by a strong wind if there are no barriers such as vegetation to break the speed of the wind.

The topmost layers in most cases consist of humus and the fertile minerals from parent materials. When the topmost layer is lost, the soil becomes unproductive for agriculture.

need a top pick for another slide to talk about crystals

Answers

Answer:

tigers eyes

Explanation:

2. What is peat?
the aromatic compounds that are part of coal
O a soft, spongy material that may be changed into coal
O a mixture of methane, ethane, and other gaseous hydrocarbons
a very hard, dense form of coal

Answers

Answer:

a soft, spongy material that may be changed into coal

Explanation:

describe how to identify the smell of gas in the laboratory

Answers

Answer:

When you are in the laboratory and take a direct sniff the chemicals you are using, you run the risk of damaging your mucous membranes or your lungs. When its necessary to smell chemicals in the lab, the proper technique is to cup your hand above the container and waft the air towards your face.

Gas is a naturally odourless substance, but the completely harmless artificial smell is added to make it more detectable. The substance is called mercaptan and gives off a strong sulphur like smell.

Other Questions
The belief in many gods who are all different aspects of one supreme being is a part of the a. Hindu religion. b. Muslim religion. c. feudal system. d. merit system. Please select the best answer from the choices provided A B C D according to marxist feminists, which of the following results in the devaluation of women as a gender? Suppose the U.S. economy is producing at the natural rate of output. A depreciation of the U.S. dollar will cause ________ in real GDP in the short run and ________ in inflation in the short run, everything else held constant. (Assume the depreciation causes no effects in the supply side of the economy.) what is 306r= -36 ? Some forms of vitamin D, CHO, can be found in red meat. How many total atoms are in 5 molecules of CHO A bird flew 180 feet above the desert surface. A mole dug 18 feet below the desert surface. Which of the following is a true answer? Options: A. The hawk's elevation is 198 feet. B. The mole's elevation is -18 feet. C. The difference in the animals' elevation is 162 feet. D. The difference in the animals' elevation is 190 feet. The fact that both parties contribute to the meaning created during interpersonal communication suggests that interpersonal communication is: write y=-5x2+x+ 1 in vertex form 6. A 15.53 kg bag of soil falls 5.50 m at a construction site. If all the energy is retained by the soil in the bag, how much will its temperature increase i need help please!!!! (1) It is observed that the decrease in the mass of a radioactive substance over a fixed time period is proportional to the mass that was present at the beginning of the time period. If the half-life of radium is 1600 years, find a formula for its mass as a function of time. (2) Suppose the constant sum T is deposited at the end of each fixed period in a bank that pays interest at the rate r per period. Let A(n) be the amount accumulated in the bank after n periods. (a) Write a difference equation that describes A(n). (b) Solve the difference equation obtained in (a), when A(0) = 0, T = $200, and r = 0.008. (3) Let S(n) be the number of units of consumer goods produced for sale in period n, and let T(n) be the number of units of consumer goods produced for inventories in period n. Assume that there is a constant noninduced net investment Vo in each period. Then the total income Y(n) produced in time n is given by Y(n) = T(n) +S(n) + Vo. Develop a difference equation that models the total income Y(n), under the assumptions: (i) S(n) = 3Y(n-1), (ii) T(n) = 2Y(n-1)-6Y(n-2) and solve it. (4) Solve above problem with variable noninduced net investment Vo= 2n +3" A scientist has a tomato plant with red-skinned tomatoes. it has one allele for red skin (r) and one for yellow skin (r). which describes the phenotype of the tomato plant? a. red skinb. yellow skinc. homozygous d. heterozygous official permission to postpone the payments of a loan is known as a: capitalization default deferment subsidizationtrue or false Circle the adverbs and adverbial Phrases in each sentence. Underline the verb that the adverb or adverb phrase modifies. 1. Alexandra practiced soccer frequently.2. Jeffrey always wanted to be an astronaut.3. Aaron's father sang the song loudly.4. The small girl eagerly licked her ice cream cone.5. My parents will arrive tomorrow.6. We skied on the tallest mountain.Circle the adverbs and adverbial phrases in each sentence.Underline the verb that the adverb or adverb phrase modifies.7. Alice fell into the rabbit hole.8. We expect rain all week.9. The angry bear in the forest growled menacingly.10. The captain quickly boarded the boat anchored in the harbor.11. The show will begin soon.12. The sneaky snake slithered swiftly and silently.13. Jessica and Ashleigh are reading their books in the yard.14. My next-door neighbors often visit their grandmother.15. Janie and her friend play hopscotch on the sidewalk. Please help I will give brainiest to the best answer There was an increase in consumerism in the 1920s. What were people buying? Why were people able to buy more? What are the pros and cons of this rise in a mass consumer culture? Oh brother! I am so bored! Mr. Blather, my science teacher, is lecturing on the weather patterns in the Arctic Circle. YAWN! YAWN! To keep myself awake, I started doodling. I started with one hexagon, and then kept drawing larger and larger hexagons (see diagram). I must be really bored because I found myself wondering how many dots I would have altogether after the fiftieth (50th) hexagon. What's the answer? Show your work and explain in complete sentences how you thought about the problem. If ______________, then _________________. What is the simple interest that is missing from the table? i ? p $5,630 r 4% t 2 years $450.00 $450.40 $45,000.40 $45,040.00 State two reasons why researching admission requirements in advance can help grade 11s to set achievable academic goals Find the annual interest rate. (Round your answer to the nearest whole number.)