The indicator thymolpthalein has a Ka = 7.9 x 10-11. Over what approximate pH range does it change color?

Answers

Answer 1

At a pH of 9.3 to 10.5, the provided indicator changes from colourless to blue.

What pH does thymolphthalein have?

A phthalein dye called thymolphthalein is used to measure the pH of solutions. The pH 9.3 to 10.5 range is where it transitions. It is colourless below this pH; blue above.

Thymol blue indicator: what is it?

Using thymol blue as a pH indicator is common. It is soluble in alcohol and diluted alkali solutions but insoluble in water. At pH 1.2–2.8, it changes from red to yellow, and at pH 8.0–9.6, it changes from yellow to blue. Typically, it is a part of the Universal Indicator.

To know more about indicator visit:-

brainly.com/question/30694482

#SPJ1


Related Questions

For the reaction WNa+2H20->2NaOH+H2, how many grams of sodium are required to produce 50g NaOH?

Answers

In this question, we have a stoichiometry question, and the first thing we need to do is to set up the properly balanced equation:

2 Na + 2 H2O -> 2 NaOH + H2

As we can see, the molar ratio of NaOH and Na is 2:2, so we are going to need the same number of moles of Na to produce the same number of moles of NaOH, now we need to find how many moles of NaOH we have in 50 grams, we are going to use its molar mass = 40g/mol

40g = 1 mol

50g = x moles

x = 1.25 moles of NaOH

So if we have 1.25 moles of NaOH, we are also going to have 1.25 moles of Na as a reactant, and using the molar mass of Na = 23g/mol, we can find the final mass:

23g = 1 mol

x grams = 1.25 moles

x = 28.75 grams of Na are required to produce 50 grams of NaOH

1. Why do some combinations of ionic compounds form a precipitate while others do not?
2. Solutions of lead(II) nitrate and potassium iodide were combined in a test tube. The results of this reaction are shown below.
a. Write a formula equation for the reaction.




b. Which of the possible products is the precipitate, and how do you know?




c. Write a complete ionic equation for the reaction and identify the spectator ions.




d. Write a net ionic equation for the reaction between lead(II) nitrate and potassium iodide.

Answers

Answer:

1. Some combination of ions form a solid precipitate because it is not favorable for the ions to become solvated (dissolved). Large and lowly charged ions tend to form precipitates, especially metals such as lead, barium, and silver.

2.
a. Pb(NO3)2 + 2KI -> 2KNO3 + PbI2

b. PbI2 is a precipitate because no other combinations of cations and anions will make an insoluble compound. KI, KNO3, and Pb(NO3)2 are all soluble.

c.

\(Pb^{2+}(aq) + 2NO_3^{-}(aq) + 2K^+(aq) + 2I^-{aq} = > PbI_2(s) + 2NO_3^{-}(aq) + 2K^+{(aq)}\\\\\)

is the ionic equation. Spectator ions are NO3- and K+

d.

\(Pb^{2+}(aq)+ 2I^-{aq} = > PbI_2(s) \\\)  is the net ionic equation

ask questions in comments if you have any

[1] Mass of salt (g) 2.005 1.993 [2] Volume of DI water (mL) 49.8 50.0 Mass of DI water (g) [3] Temperature of DI water (°C) 23.4 23.5 [4] Temperature of mixture after dissolution (°C) 20.4 30.9 Temperature difference (°C) -3 7.4 [5] Total mass in reaction (g) 2.1 2.0 Total moles reacted (mol) .026 Total heat of the reaction (cal) [6] Enthalpy of solution ΔHsolution (cal/mol)

Answers

The reaction between hydrogen ion and hydroxide ion will be as follows.

       

so, ratio between hydrogen and hydroxide ions is 1 : 1.

Therefore, moles of  = volume × concentration of

                            =

                             = 0.06 mol

Similarly, moles of  = volume × concentration of

                              =

                             = 0.1 mol

Therefore, ratio of moles of hydrogen and hydroxide ions is as follows.

                                    0.06 : 0.1

                                 = 0.6 : 1

As, hydroxide ions are present in excess so, hydrogen ions are the limiting reagent.

Hence, moles of water formed = moles of  ions = 0.06 mol.

So,    heat released = moles of

                               = 0.062 × 62.0 kJ/mol

                               = 3.72 kJ

                               = 3.72 × 1000 J

                               = 3720 J

Let T is the initial temperature. So,

             Heat released = Heat absorbed by the solution

                                      =

           3720 J =

                         T =

Thus, we can conclude that initial temperature is .                          

What type of reaction is shown below:
Al₂O3 (s) → Al(s) + +O₂(g)

O Acid/Base Neutralization
O Synthesis
O Double Replacement
O Decomposition
O Single Replacement
O Combustion

Answers

Answer: Decomposition

Explanation:

The compound, (Aluminum Oxide), decomposes to form Aluminum and Oxygen.

Describe the trend of the reactivity of the elements in group VII

Answers

The non-metal elements in Group 7 – known as the halogens – get less reactive as you go down the group

Answer & Explanation:

The reactivity of elements in Group VII, also known as Group 17, decreases with increasing atomic radius. This is because halogens have high electronegativities and a proclivity to gain electrons in noble gas configurations. Myths are traditional stories or beliefs that explain cultural or societal beliefs, customs, or natural phenomena. They can be passed down through generations and can be based on true or fictitious events. Mythology, on the other hand, is the collection of myths associated with a specific culture or religion. Mythology can be amplified through retelling, incorporation into religious practices; association with significant events or figures, and adaptation into other media forms such as literature, film, or art.

Which element has a higher ionization energy than silicon? Magnesium, Germanium, Sodium, or Phosphorus

Answers

Answer:

Phosphorus

Explanation:

Phosphorus will have higher ionization energy than silicon from the given choices.

Ionization energy is the energy required to remove the most loosely held electron in an atom.

Based on the periodic trends:

Across the period, ionization energy increases from left to rightDown a group, ionization energy decreases.

Since phosphorus is the element in the right most part after silicon, it has higher ionization energy

a sportsman whose business is renting rowboats must buy a pair of new oars for each of his 60 boats. if the oars cost $200 per dozen pairs, how much does he pay for the oars? (Chemistry)

Answers

Answer:$100

Explanation:Divide 60 by 12=5

5x200=$1000

Two scientists were comparing the boiling points of two different substances. They each measured the boiling point of one substance. When they compared data, they found that they had used different temperature scales. The first scientist reported that Substance A boiled at 245 K. The second scientist reported that Substance B boiled at -92°C. Change the measurements to a single temperature scale. Which substance boils at a higher temperature?

Answers

Substance A has a higher boiling point compared to Substance B when measured on the same temperature scale.

To compare the boiling points of Substance A and Substance B, which were measured using different temperature scales, we need to convert the temperatures to a single scale for accurate comparison. The boiling point of Substance A was reported as 245 K, and the boiling point of Substance B was reported as -92°C. To convert Substance B's temperature from Celsius to Kelvin, we need to add 273.15 to the Celsius value. Thus, -92°C + 273.15 = 181.15 K. Now, both temperatures are in Kelvin: Substance A boils at 245 K, and Substance B boils at 181.15 K. Comparing the temperatures, we find that Substance A boils at a higher temperature (245 K) than Substance B (181.15 K). Therefore, Substance A has a higher boiling point compared to Substance B when measured on the same temperature scale.

For more question on temperature

https://brainly.com/question/4735135

#SPJ11

What is the electron configuration for La (lanthanum)?

Answers

Answer:

Lathanum .

Atomic number = 57

Symbol = La

Atomic weight = 138.9

No of energy orbitals = 6

Electronic configuration

\([Xe]6s^25d^1\)

What is the electron configuration for La (lanthanum)?
What is the electron configuration for La (lanthanum)?
What is the electron configuration for La (lanthanum)?

Which description of groundwater is correct?

Groundwater cannot be replenished and is, therefore, a limited resource.
Groundwater cannot be replenished, but its supply is practically infinite.
Groundwater can be replenished by rainfall.
Groundwater can be replenished through reactions in Earth’s core.

Answers

C because that’s the definition of ground water

Fill in the blank with the correct answer to complete the sentence.
Word bank
size
velocity
distance
time
Momentum increases with an increase in mass and​

Answers

Explanation:

momentum increases with an increase in mass and velocity

could some some one help with 2 4 5 7 8​

could some some one help with 2 4 5 7 8

Answers

Answer:

For number 2, your answer is C.

Explanation:

The nucleus is positively charged because the proton is positive and a neutron is neutral. An electron has a negative charge.

Help!!!

Question: What is the correct order of the particles that give texture to soil from smallest to largest?

Options:

A: Clay, sand, silt

B: silt, sand, clay

C: clay, silt, sand

D: sand, silt, clay

Answers

The correct order of the particles that give texture to the soil from smallest to largest is clay, silt, and sand; option C.

What is soil texture?

Soil texture refers to a physical classification of the component and types of soils based on their physical texture either as coarse or fine particles.

There are several types of soils and these various types of soils have different textures.

The types of soils and their arrangement based on increasing particle size are as follows:

clay soil - this is the finest particle soil typesilt - this is the next soil type in terms of texturesandy soil - this is the largest of the three soil types in terms of size and texture.

Learn more about soil texture at: https://brainly.com/question/8513717

#SPJ1

Write the equation for the equilibrium constant (K) of the reaction studied in this exercise.

2C04 2- (ag) + 2Ht (ag) = CI20, 2- (ag) + H20(1)

Answers

The equation for the equilibrium constant (K) of the reaction studied in this exercise can be written as follows: K = ([\(CI_20\), 2-] * [\(H_20\)(1)]) / ([\(C0_4^ 2\)-] * [Ht])

In this equation, the concentrations of the species involved in the reaction are represented by the square brackets [ ]. The subscripts indicate the stoichiometric coefficients of each species in the balanced chemical equation.

The reaction being studied involves the following species:

\(C0_4^ 2\)- (ag) + 2Ht (ag) = \(CI_20\), 2- (ag) + \(H_20\)(1)

In the equilibrium constant expression, the concentration of \(CI_20\), 2- is multiplied by the concentration of \(H_20\)(1) and divided by the product of the concentrations of \(C0_4^ 2\)- and Ht. The stoichiometric coefficients in the balanced equation are used as exponents for the concentrations of the respective species.

It is important to note that the concentrations used in the equilibrium constant expression should be in molar units (mol/L) or expressed as partial pressures for gases.

Additionally, the equilibrium constant is specific to a given temperature, and its value provides information about the relative amounts of reactants and products at equilibrium.

For more such question on  equilibrium constant visit:

https://brainly.com/question/3159758

#SPJ8

Move the red warning icon to focus of the earthquake.

Move the green location icon to the epicenter of the earthquake.

Move the blue star icon to the fault.

Move the red warning icon to focus of the earthquake.Move the green location icon to the epicenter of

Answers

Answer:

Red goes in the spiky yellow box. Green goes where the red circles are. Blue goes in the small yellow box that is pointing to the line.

Explanation:

The focus of an earthquake is where it starts in the earth. The epicenter is the part directly above the focus on the surface. The fault is the part where the earth's crust splits.

The cell potential of the following electrochemical cell depends on the pH of the solution in the anode half-cell:Pt(s)|H2(g, 1atm)|H+(aq, ?M)||Cu2+(aq,1.0M)|Cu(s)What is the pH of the solution if Ecell = 355 mV?

Answers

Answer:

0.51

Explanation:

Given the Nernst equation;

E= E° - 0.0592/n logQ

E= 355 mV or 0.355 V

E° = 0.34 - 0= 0.34 V

n= 2(two electrons were transferred in the process)

Equation of the reaction;

H2(g) + Cu^2+(aq) -----> 2H^+(aq) + Cu(s)

Substituting values;

0.355 = 0.34 - 0.0592/2 log([H^+]/1)

0.355 - 0.34 = - 0.0296 log [H^+]

0.015/-0.0296 = log [H^+]

Antilog (-0.5068) = [H^+]

[H^+] = 0.311 M

pH = -log[H^+]

pH= - log(0.311 M)

pH = 0.51

The potential difference between the half cell of the electrochemical cell is called cell potential. The pH of the solution at 355 mV will be 0.51.

What is an electrochemical cell?

An electrochemical cell generates electricity from the redox chemical reactions occurring inside the cell.

The balanced chemical reaction is shown as,

\(\rm H_{2}(g) + Cu^{2+}(aq) \rightarrow 2H^{+}(aq) + Cu(s)\)

Using the Nernst equation:

\(\rm E= E^{\circ} - \dfrac{0.0592}{n }logQ\)

Given,

E = 0.355 V

E° = 0.34 V

n = 2

Substituting values in the above equation:

\(\begin{aligned} 0.355 &= 0.34 - \dfrac{0.0592}{2} \;\rm log(\dfrac{[H^{+}]}{1})\\\\0.355 - 0.34 &= - 0.0296 \rm \; log [H^{+}]\\\\\dfrac{0.015}{-0.0296} &= \rm \; log [H^{+}]\end{aligned}\)

Solving further,

\(\begin{aligned} \rm Antilog (-0.5068)& = \rm [H^{+}]\\\\\rm [H^{+}] &= 0.311 \;\rm M \end{aligned}\)

The pH of the solution is calculated as:

\(\begin{aligned} \rm pH &= \rm -log[H^{+}]\\\\&= \rm - log(0.311\; M)\\\\&= 0.51\end{aligned}\)

Therefore, 0.51 is the pH of the solution.

Learn more about pH here:

https://brainly.com/question/9207631

What is the molar mass of KOH?

Answers

Answer:

56.11 g/mol

General Formulas and Concepts:

Math

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Chemistry

Atomic Structure

Reading a Periodic TableExplanation:

Step 1: Define

[Compound] KOH

Step 2: Identify

[PT] Molar Mass of K - 39.10 g/mol

[PT] Molar Mass of O - 16.00 g/mol

[PT] Molar Mass of H - 1.01 g/mol

Step 3: Find

39.10 + 16.00 + 1.01 = 56.11 g/mol

Name of this product

Name of this product

Answers

Answer:

Explanation:

ethyl 3-methylbenzoate

The flame from the stove the thermal energy
of the pressure cooker system, which
the
temperature.
The volume of the system
The pressure of the system

Answers

The temp is the flam

when electric current is applied externally, which of the following produces a redox reaction: A wood. B. electrolytic C. Solid

Answers

Answer:

the answer is a

Explanation:

Answer is B. Electrolytic . A redox reaction is a chemical reaction where electrons transfer.

How many moles of NH3 are in 4.20 x 1024 molecules of it? ​

Answers

Answer:

              6.97 moles

Explanation:

Formula Used,

Moles = No. of Molecules ÷ 6.022 × 10²³

Putting Values,

Moles = 4.20 × 10²⁴ ÷ 6.022 × 10²³

Moles = 6.97 moles

What volume of CO2(g), measured at STP is produced if 15.2 grams of CaCO(s) is heated?

Answers

Answer:

Volume = 3.4 L

Explanation:

In order to calculate the volume of CO₂ produced when 15.2 g of CaCO₃ is heated, we need to first write out the balanced equation of the thermal decomposition of CaCO₃:

CaCO₃ (s) + [Heat] ⇒ CaO (s) + CO₂ (g)

Now, let's calculate the number of moles in 15.2 g CaCO₃:

mole no. = \(\mathrm{\frac{mass}{molar \ mass}}\)

                 = \(\frac{15.2}{40.1 + 12 + (16 \times 3)}\)

                 = 0.1518 moles

From the balanced equation above, we can see that the stoichiometric molar ratios of CaCO₃ and CO₂ are equal. Therefore, the number of moles of CO₂ produced is also 0.1518 moles.

Hence, from the formula for the number of moles of a gas, we can calculate the volume of  CO₂:

mole no. = \(\mathrm{\frac{Volume \ in \ L}{22.4}}\)

⇒ \(0.1518 = \mathrm{\frac{Volume}{22.4}}\)

⇒ Volume = 0.1518 × 22.4

                 = 3.4 L

Therefore, if 15.2 g of CaCO₃ is heated, 3.4 L of CO₂ is produced at STP.

If a certain piof metal is cooled, it will conduct electricity better

Answers

If a certain piece of metal is cooled it will conduct current better is a hypothesis.

When a conductor is connected to a fluctuating magnetic flux, it induces closed loops of electric currents known as eddy currents. They create closed circuits in a plane perpendicular to the magnetic field and are subject to Faraday's law of electromagnetic induction. These currents will flow in a direction that opposes the shift required by the Lenz law.

Eddy currents are created when a conductor is traveling through a magnetic field or when the magnetic field around a conductor at rest changes over time. They arise from variations in the strength and direction of a conductor-linked magnetic field or magnetic flux.

To know more about  current visit : brainly.com/question/13076734

#SPJ9

The bond angles around a carbon in a
triple bond are
and it
is
hybridized
A. 180, sp?
B. 120, sp
C. 180, sp
D. 120, sp?
Enter

Answers

A 180,sp is da answer

The bond angles around carbon in the triple bond are 180 degrees and it is sp hybridized. option B is correct

What is sp hybridization?

This hybridization process involves mixing the valence s orbital with one of the valence p orbitals to yield two equivalent sp hybrid orbitals that are oriented in a linear geometry.

The set of sp orbitals appears similar in shape to the original p orbital, but there is an important difference. The number of atomic orbitals combined always equals the number of hybrid orbitals formed.

The p orbital is one orbital that can hold up to two electrons. The sp set is two equivalent orbitals that point 120° from each other. The two electrons that were originally in the s orbital are now distributed to the two sp orbitals, which are half filled.

Therefore, due to the sp hybrid and 120-degree angle option B is correct

learn more about hybridization, here :

https://brainly.com/question/23038117

#SPJ2

Match the tools with the advantages they offer to astronomers.
photography
space telescope
radio telescope
optical telescope
w
detects electromagnetic frequencies outside
the visible spectrum that reaches Earth
captures images that can be shared and
compared by scientists
obtains a magnified and clear view of a part
of the sky to observe celestial objects
allows access to images taken from outside
Earth's atmosphere

Answers

Answer:

- photography     (captures images that can be shared and

compared by scientists)

- space telescope    (allows access to images taken from outside

Earth's atmosphere)

- radio telescope     (detects electromagnetic frequencies outside

the visible spectrum that reaches Earth)

- optical telescope    (obtains a magnified and clear view of a part

of the sky to observe celestial objects)

Explanation:

Photography is used to capture still images based on the principle that some compounds react in the presence of optical energy.

Space telescope is a type of observatory telescope positioned in outer space to observe distant planets, galaxies and other astronomical objects. Space telescopes reduces the interference from ultraviolet frequencies, X-rays and gamma rays; as well as light pollution which ground-based observatories encounter.

A radio telescope is a specialized antenna and radio receiver used to receive radio waves from astronomical radio sources in the sky. Radio telescope is used to study radio frequencies  emitted by astronomical objects, that fall outside the visible light spectrum.

An optical telescope is used to gather and focuses light, from a far distant object. Optical telescope is used within the visible light spectrum of the electromagnetic spectrum, to create a magnified image, for direct view, or to make a photograph, or to collect data through electronic image sensors.

Answer:

- photography     (captures images that can be shared and

compared by scientists)

- space telescope    (allows access to images taken from outside

Earth's atmosphere)

- radio telescope     (detects electromagnetic frequencies outside

the visible spectrum that reaches Earth)

- optical telescope    (obtains a magnified and clear view of a part

of the sky to observe celestial objects)

Explanation:

true or false energy cannot be changed into different forms

Answers

Answer:

False

Explanation:

Energy can be changed into different forms

How many atoms (or molecules) are present in 1 mole?Question 19 options:A) 1B) 6.022×1020C) 6.022×1023D) 6.022

Answers

Answer:

The answer is C.

Explanation:

The number of particles (atoms/molecules) in 1 mole is referred to as the Avogadro's number. The Avogadro's number = 6.022 * 10 ^ 23. Therefore, the answer is C.

Which two the following functional groups does the amino acid have according to the picture? ( worth 50 points <3)

Which two the following functional groups does the amino acid have according to the picture? ( worth

Answers

The two functional groups that the aminoacid has according to the picture are amine and carboxyl.

What is a functional group?

In chemistry and related areas, a functional group can be defined as a group of atoms bonded in a specific molecule that can affect the was the molecule reacts or the specific behavior of it.

In the case of the molecule presented, which is an amino acid, two functional groups can be identified:

An amine group: This includes the N atom bonded to the two hydrogens.A carboxyl group: This includes the terminal carbon linked to two oxygen atoms and a hydrogen atom.

Learn more about functional groups in https://brainly.com/question/1356508

#SPJ1

Intravenous lidocaine therapy is started for a patient. The doctor's order says to add 1.0 grams of lidocaine to 250 mL of I.V. solution and deliver it to the patient at 4.0 mg/min. In this particular I.V., 20. drops = 1.0 mL. What is the flow rate in drops per minute?

Answers

The flow rate of the IV solution in drops per minute is 80 drops/min.

To determine the flow rate in drops per minute, we need to consider the conversion factors and relationships between different units.

First, let's convert the lidocaine dose from grams to milligrams, as the flow rate is given in milligrams per minute:

1 gram = 1000 milligrams

So, 1.0 gram of lidocaine is equal to 1000 milligrams.

Next, we can calculate the total volume of the IV solution in milliliters:

250 mL

To find the flow rate in milligrams per minute, we divide the dose by the total time:

Flow rate = Dose / Time

The dose is 1000 milligrams (1.0 gram) and the time is 1 minute.

Flow rate = 1000 mg / 1 min = 1000 mg/min

Now, to determine the flow rate in drops per minute, we need to convert the IV solution volume from milliliters to drops. Given that 20 drops = 1.0 mL, we can set up a conversion factor:

20 drops / 1 mL

To find the flow rate in drops per minute, we multiply the flow rate in milligrams per minute by the conversion factor:

Flow rate (drops/min) = Flow rate (mg/min) * Conversion factor

Flow rate (drops/min) = 1000 mg/min * (20 drops / 1 mL)

Now we need to convert milliliters to drops:

Flow rate (drops/min) = 1000 mg/min * (20 drops / 250 mL)

Simplifying the expression:

Flow rate (drops/min) = 1000 mg/min * (4/50)

Flow rate (drops/min) = 80 drops/min

For more such question on flow rate visit;

https://brainly.com/question/1154328

#SPJ8

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Other Questions
Explain the reasons for the temperature range between summer(100F) and winter(10F) for Kansas City. base on this questions below: 1. What was your location / question? 2. What was your explanation? 3. What did you learn? the goal of constructing a frequency distribution is to identify a useful pattern in the data and often there is more than one acceptable way to accomplish this with grouped quantitative data. true or false In which of the following would you find the highest population density? Question 1 options: A. In a region with little to no rainfall B. Along the Amazon River C. In the peak of the Andes Mountain D. In the Atacama Desertget the right answer and i will give you points How does the author use the chorus to enhance the meaning in Nakamitsu?Select all that apply. when consumers in belgium are charged lower prices for no particular reason for nike shoes than consumers in italy, it is an example of TRUE/FALSE. An audit report should include an emphasis of matter paragraph that refers the reader to a note to the financial statements when the auditor has been unable to observe the taking of the beginning inventory because of the effect on Cost of Goods Sold. How does Mercutio serve as a foil to Romeo? In the space provided, write a 150-word essay comparing and contrasting the two friends and their personalities, based on this discussion of love. Include at least three specific references to the text. Helpppppp pleaseeeee find the angle measurements Find the missing value so that the line passing through the points has the given slope Solve the following proportion for x Describe your preferred learning strategies. compare your current preferred learning strategies to the identified strategies for your preferred learning style. The data table below shows the number of bacteria in two samples A and B growing in a laboratory over a five hour period Data were collected every half hour If the pattern of growth continues how many bacteria Will be in simple B when it six hours have elapsed if g(x)=f(1/3x), which statement is true?A the graph of function f is Stretched vertically by a scale factor of 3 to create the graph of function gB The graph of function F stretched horizontally by a scale factor of 3 to create the graph of function gC The graph of the function F is compressed horizontally by a scale factor of 1/3 to create the graph of function GD The graph of function F is compressed vertically by a scale Factor of 1/3 to create the graph function G This "war'' pitted the United States against China and Russia over the concerns of the spread of communism? On a softball field, home plate is 43 feet from the pitcher's mound. A ball is hit at an angle of 27 east of the pitcher's mound. The ball travels 162 feet before it is caught by an outfielder. A triangle is drawn on a baseball field. A point is at home plate, another point is at the pitcher apostrophe s mound, and another point is at an outfielder. The distance from home plate to the pitcher is 43 feet. The distance from home plate to the outfielder is 162 feet. The angle between the 2 sides is 27 degrees. Law of cosines: How far must the outfielder throw the ball to return it to the pitcher? Round to the nearest foot. 112 feet 125 feet 145 feet 156 feet Write a scientific explanation that explains how organelles perform specific tasks within cells. Hurricanes are large tropical storms with heavy winds that exceed 74 miles per hour. Hurricanes produce heavy rains and may give rise to tornadoes. What is the source of the energy contained in hurricanes?. The two angles are supplementary. One angle is 65 degrees. What is the degree of the other angle? solution only input the number. * What is the Hellenistic Empire? How did it get its name? f(x)=x2+12x+20 For a given quadratic function, Find:1. zeros of the function2. line of symmettry(vertex)3. minimum4. The rate of change from x=1 to =3