please help and show all steps
a Problem 25. Evaluate log2 V32 without using a calculator. log2 U32 los ab=nlos ab 5

Answers

Answer 1

The required solution for the given expression log2 V32 is 6.6438561898 (approx).

Given expression: log2 V32. Steps to evaluate log2 V32 without using a calculator:

We know that 32 is the product of 2 and 2 continuously, i.e., 32 = 2 × 2 × 2 × 2 × 2.⇒ 32 = 25.

Let's apply the power property of logarithms. i.e., loga ap = p loga a, which is useful when the base is the same. Using the power property of logarithms, we get;log2 32 = log2 (25). Now, using the change-of-base formula, we can convert the log2 to log10 or ln log2 x = log10 x / log10 2 = ln x / ln 2.

Using the change of base formula, we have log2 (25) = log10 (25) / log10 (2). Now, we know that;log10 (25) = 2, log10 (2) = 0.30103 (use calculator or log table). Substituting the values in the above equation, we get;log2 (25) = 2 / 0.30103 = 6.6438561898 (approx).

Hence, log2 V32 = log2 (25) = 6.6438561898 (approx). Thus, the required solution is 6.6438561898 (approx).

To know more about expression refer here:

https://brainly.com/question/15994491

#SPJ11


Related Questions

and right triangle sin (40 - x)° equals cos(3x)° degrees what is the value of x.

Answers

\(\qquad\qquad\huge\underline{{\sf Answer}}♨\)

Let's solve ~

\(\qquad \sf  \dashrightarrow \: \sin(40 - x) = \cos(3x) \)

\(\qquad \sf  \dashrightarrow \: \cos\{90 - (40 - x ) \} = \cos(3x) \)

\(\qquad \sf  \dashrightarrow \:90 - (40 - x) = 3x\)

\(\qquad \sf  \dashrightarrow \:90 - 40 + x = 3x\)

\(\qquad \sf  \dashrightarrow \:3x - x = 50\)

\(\qquad \sf  \dashrightarrow \:2x = 50\)

\(\qquad \sf  \dashrightarrow \:x = 25 \degree\)

A ratio of two complementary angles is 3:7 find the measures of both angles

Answers

Given the word problem, we can deduce the following information:

1. The ratio of the two complementary angles is 3:7.

To determine the measures of both angles, we must note first that complementary angles are two angles whose measures add up to 90°. So our equation would be:

\(3x+7x=90\)

We simplify the equation above:

\(\begin{gathered} 3x+7x=90 \\ 10x=90 \\ x=\frac{90}{10} \\ x=9 \end{gathered}\)

We plug in x=9 into 3x to get the first angle:

Angle 1 = 3x = 3(9) = 27

Then, we plug in x=9 into 7x to get Angle 2:

Angle 2= 7x=7(9)=63

Therefore, the measures of both angles are 27° and 63°.

At a wedding there were 40 people from gromms side and 56 people from bride's family at the wedding

find the ratio of the groom's family to the bride's family at the wedding ​

Answers

Answer:

5 : 7

Step-by-step explanation:

groom's side: 40

bride's side: 56

ratio groom to bride = 40/56 = 20/28 = 10/14 = 5/7

Answer: 5 : 7

The answer is 96 people in total.

Explanation- 50+56 Is 106. So 106- 10=96.

There is your answer 96.

Theo is putting lights around a right triangular sign that has a base of 10 feet and a height of 9 feet. If a box of lights will cover 15 square feet, how many boxes will he need to buy?

Answers

Answer:

2 Boxs

Step-by-step explanation:

4. Select the expression that is equivalent to the product represented by the number line

A. 2 × 3/4

B. 3 × 2/4

C. 4 × 1/3

D. 4 × 2/3​

4. Select the expression that is equivalent to the product represented by the number line A. 2 3/4 B.

Answers

Answer:

B. 3× 2/4

______________

8. Melissa's service charge at a beauty salon
was $84.00 before tax. The sales tax rate was
8%. If she added 20% of the amount before
tax as a tip, how much did she pay for
the service at the salon?

Answers

Answer:

$107.52

Step-by-step explanation:

8% of 84 = $6.72 in sales tax

20% of 84 = $16.80

She paid $84 for the service, plus $6.72 in tax, and $16.80

Can anyone help me with this question ?

Can anyone help me with this question ?

Answers

Answer:

pa answer Lang ako KC nag bibigay ako NG points

add 5x+4y;3x-7y;-4x+8y​

Answers

The answer is 4x + 5y.

Here, what needs to be done is to combine like terms.

5x + 4y + 3x - 7y - 4x + 8y5x + 3x - 4x + 4y + 8y - 7y4x + 5y

Consider points R, S, and T.

Point S is in the middle. Point R is below and to the left of point S. Point T is below and to the right of point S.

Which statement is true about the geometric figure that can contain these points?

Answers

Points R, S, and T are coplanar

An athlete trains for 105 min each day for as many days as possible write an equation that relates the number of days d that the athlete spends training when the athlete trains for 630 min

Answers

We can start by listing all we know:

• The athlete spends 105 mins training daily

Now, using that information, we can make an equation, with t representing the total:

t = 630d

In this equation, x represents the total, and d represents the amount of minutes each day the athlete trains for.

Refer to Table 4-1. Suppose that D2 and S1 are the prevailing demand and supply curves for a product. If the demand schedule changes from D2 to D1, then:
Price D 1 D 2 S 1 S 2
$12 5 9 19 14
$10 8 12 17 12
$8 11 15 15 10
$6 13 18 13 8
$4 16 21 11 6
$2 18 24 9 4
equilibrium price increases from $6 to $8.
equilibrium quantity increases from 13 to 18
equilibrium quantity decreases from 15 to 13.
equilibrium price decreases from $6 to $4.

Answers

The correct option is A, equilibrium price increases from $6 to $8.

What do you mean by Equilibrium?

In economics, equilibrium is a state in which the supply and demand for a product or service are balanced, resulting in a stable price. This can occur in a free market, where the price of a good or service is determined by the interaction of buyers and sellers.

Overall, equilibrium is a fundamental concept in many different fields, representing a state of balance or stability in a system or situation.

If the demand schedule changes from D2 to D1, then the demand curve shifts to the left. As a result, the new equilibrium point will be where the new demand curve (D1) intersects with the supply curve (S1).

From the table, we can see that the new equilibrium point is at a price of $8 and a quantity of 15. Therefore, the equilibrium price increases from $6 to $8, but the equilibrium quantity decreases from 15 to 13.

So the correct answer is: equilibrium price increases from $6 to $8.

To know more about equilibrium price visit:

https://brainly.com/question/28527601

#SPJ1

i need help plss its a spring break thing and i need help

i need help plss its a spring break thing and i need help

Answers

Answer:

It's B, because thats where the two points cross

Step-by-step explanation:

Olivia selects marbles from a bag containing 5 red and 7 blue marbles. Which of the following events are independent?

A. selecting one red and one blue in two picks with replacement

B. selecting a red and blue marble in one pick

C. selecting two red marbles in one pick

D. selecting one red and one blue in two picks without replacement

Answers

Answer:

B

Step-by-step explanation:

Answer:

A

Step-by-step explanation:

Evaluate the function for the given value of x. \large f\left(x\right)=-2\left(7\right)^x; \large x=3

Answers

When x = 3, the value of the function \(\rm f(x) = -2(7)^x\) is -686.

What is function?

In mathematics, a function is a rule or relationship that assigns each element from one set (called the domain) to a unique element in another set (called the codomain or range). It describes how elements from the domain are mapped or transformed into corresponding elements in the codomain.

To evaluate the function \(\rm f(x) = -2(7)^x\) for x = 3, we substitute x with the given value:

\(\rm f(3) = -2 * 7^3\)

Next, we compute the value of \(7^3\):

\(7^3 = 7 * 7 * 7 = 343\)

Substituting this value back into the original equation, we have:

f(3) = -2 * 343

Finally, we evaluate the expression:

f(3) = -686

Therefore, when x = 3, the value of the function \(f(x) = -2 * 7^x\) is -686.

To learn more about function visit:

https://brainly.com/question/11624077

#SPJ4

Complete and clear question:

Evaluate the function for the given value of x. \(\rm \large f\left(x\right)=-2\left(7\right)^x; \large x=3\)

What is the value of x in the equation 8x – 2y = 48, when y = 4?
6
7
14
48

Answers

Answer:

x=7

Step-by-step explanation:

8x – 2y = 48

Let y = 4

8x - 2(4) = 48

8x - 8 = 48

Add 8 to each side

8x-8+8 = 48+8

8x = 56

Divide each side by 8

8x/8 = 56/8

x=7

Answer:

\(x = 7\)

Step-by-step explanation:

\(8x - 2y = 48 \\ 8x = 48 + 2y \\ x = \frac{48 + 2y}{8} \)

\(y = 4\)

\(x = \frac{48 + 2y}{8} \\ x = \frac{48 + 2 \times 4}{8} \\ x = \frac{48 + 8}{8} \\ x = \frac{56}{8} \\ x = 7\)

hope this helps

brainliest appreciated

good luck! have a nice day!

A landscaper needs to mix a 80% pesticide solution with 35 gal of a 30% pesticide solution to obtain a 55% pesticide solution. How many gallons of the 80%
solution must he use?

Answers

By answering the question the answer is Therefore, landscapers should equation use 35 gallons of an 80% pesticide solution.

What is equation?

In mathematics, an equation is a statement that two expressions are equal. The equation consists of her two sides divided by an algebraic equation (=). For example, the argument "2x + 3 = 9" asserts that the statement "2x + 3" equals the value "9". The goal of solving an equation is to find the values ​​of the variables to make the equation true. Simple or complex equations, regular or nonlinear, and equations involving one or more factors are all possible. For example, the expression "\(x2 + 2x - 3 = 0\\\)" squares the variable x. Lines are used in many areas of mathematics, including algebra, calculus, and geometry.  

Let's say a landscaper needs to use x gallons of an 80% pesticide solution.

The amount of pesticide for an 80% solution is 0.8 x gallons and the amount of pesticide for a 30% solution is 0.3 (35) = 10.5 gallons.

After mixing the two solutions, the total amount of pesticides in the mixture is 0.8 x + 10.5 gallons and the total volume of the mixture is x + 35 gallons.

Since we need a 55% pesticide solution, we can set the following formula:

\(0.8x10.5 0.55(x+35)0.8x10.5 0.55x+19.250.25x = 8.75x = 35\)

Therefore, landscapers should use 35 gallons of an 80% pesticide solution.

To know more about equation visit:

brainly.com/question/649785

#SPJ1

The radius of a circular clock is 10.5 inches. Which measrement is closest to the circumference of the clock in inches

Answers

Answer:

65.9734457254 or 65.97

Step-by-step explanation:

c= pi x diameter

c= pi x (10.5 x 2)

c= pi x 21

= 65.9734457254

Answer:

66 in approx

Step-by-step explanation:

Given data

Radius= 10.5 inches

The circumference is given as

C= 2πr

Substitute

C=2*3.142*10.5

C=65.982

Hence the Circumference is 66 in approx

Is 4x+1=f(x) a quadratic function?

Answers

Answer: no

Step-by-step explanation:

the x has to be squared to form a parabola with a vertex and 2 x intercepts

Please help asap!!!!!!!

Please help asap!!!!!!!

Answers

Answer:

-2

Step-by-step explanation:

how many 1/3 minutes are there in 5 minutes

Answers

Answer: 15

Step-by-step explanation:

3 1/3ds in 1 minute, multiply 3 by 5

Answer:

15

Step-by-step explanation:

15 thirds contain 5 integers:

\(\frac{5}{\frac{1}{3} } =\frac{(5)(3)}{1} =\frac{15}{1} =15\)

Hope this helps

can yall help me with this

can yall help me with this

Answers

In solving the following fraction, step (A) (4/7) × (-2/-1) is wrong and the correct step should be (4/7) × (-2/1).

What are fractions?Any number of equal parts is represented by a fraction, which also represents a portion of a whole. A fraction, such as one-half, eight-fifths, or three-quarters, indicates how many components of a particular size there are when stated in ordinary English.There are three main categories of fractions in mathematics. 'Proper fractions, incorrect fractions, and mixed fractions are these three types. The expressions with a numerator and a denominator are called fractions.

So, the wrong step will be:

(4/7) ÷ (-1/2)

Then, the next step should be:

(4/7) × (-2/1)

But, the steps it is given as:

(4/7) × (-2/-1)

Which makes the error.


Therefore, in solving the following fraction, step (A) (4/7) × (-2/-1) is wrong and the correct step should be (4/7) × (-2/1).

Know more about fractions here:

https://brainly.com/question/28933207

#SPJ1

8). Find the base of a triangle
with an area of 155 square feet
and a height of 10 feet.
Formula:

Answers

Answer:

=15.5

Step-by-step explanation:

1/2b x h

12b x 10=155

12b=155/10=31/2

b=31/2 divided by 12

=15.5

Equation: t= 25 +8.25w, where w is the number of
weeks and tis the total Aaliyah saved.
What is the error that occurred when Aaliyah completed
her table?

Answers

Answer:

C

Step-by-step explanation:

Answer:

C on edge 2020

Step-by-step explanation:

Equation: t = 25 + 8.25w, where w is the number of weeks and t is the total Aaliyah saved.

What is the error that occurred when Aaliyah completed her table?

A/The table must start at week 1.

B/The w and t columns need to be switched.

C/The ordered pair (132.25, 13) should be (13,  132.25).

D/25 + 8.25(15) = 148.75 in week 15 is not calculated correctly.

Solve the following optimization problems:
i. Two numbers greater than zero add up to 6 . Find the numbers so that the product of the first number and the square of the second number is maximum.
ii. A horse corral is rectangular, with fencing around the perimeter. Also, there is a straight internal fence, parallel to the sides. The internal fence splits the corral into 2 equal areas. The total area of the corral is 9600 square metres. The owner wishes to minimize the amount of fencing required. What are the optimum dimensions of the corral?

Answers

The maximum product occurs when the first number is 2 and the second number is 6 - 2 = 4. The optimum dimensions of the corral are a length of sqrt(4800) and a width of 40 meters.

i. Let's assume the two numbers are x and 6 - x (since they add up to 6). We want to maximize the product of the first number (x) and the square of the second number \(((6 - x)^2)\). The objective function is \(f(x) = x(6 - x)^2\).

To find the maximum, we can take the derivative of f(x) with respect to x and set it equal to zero: \(f'(x) = (6 - x)^2 - 2x(6 - x) = 0\)

Expanding and simplifying, we get: \(36 - 12x + x^2 - 12x + 2x^2 = 0\)

Rearranging, we have: \(3x^2 - 24x + 36 = 0\)

Dividing by 3, we get: \(x^2 - 8x + 12 = 0\)

Factoring, we have: \((x - 6)(x - 2) = 0\) So, \(x = 6 or x = 2.\)

To determine which value gives the maximum, we can evaluate f(x) at these points:

\(f(6) = 6(6 - 6)^2 = 0f(2) = 2(6 - 2)^2 = 32\)

Therefore, the maximum product occurs when the first number is 2 and the second number is 6 - 2 = 4.

ii. Let's assume the length of the corral is x and the width is y.

From the given information, we know that\(xy = 9600\) (total area of the corral) and \(x(0.5y) = 4800\) (half the area of the corral). We want to minimize the amount of fencing required, which is the perimeter of the corral: \(P = 2(x + y) + y\)

We can rewrite this in terms of a single variable by substituting \(y = 9600/x\) from the first equation: \(P = 2(x + 9600/x) + 9600/x\)

To find the minimum, we can take the derivative of P with respect to x and set it equal to zero: \(P' = 2 - 9600/x^2 + 9600/x^2 = 0\)

Simplifying, we have: \(2 - 9600/x^2 = 0\)

\(9600/x^2 = 2x^2 = 9600/2x^2 = 4800x = sqrt(4800)\)

Substituting this value back into the equation for y:\(y = 9600/sqrt(4800)\)

Simplifying further, we get: \(y = 40\)

So, the optimum dimensions of the corral are a length of sqrt(4800) and a width of 40 meters.

Learn more about optimum dimensions

https://brainly.com/question/14590499

#SPJ11

it is known that about 90% of the population are right-handed, 9% are left-handed, and 1% are mixed-handed (also known as cross-dominance). for the following pr

Answers

Given that 90% of the population is right-handed, 9% is left-handed, and 1% is mixed-handed, we can determine the probability of different hand preferences for a randomly selected individual.

Let's denote the probabilities as follows: P(R) for right-handed, P(L) for left-handed, and P(M) for mixed-handed.

From the information given, we know that P(R) = 0.90, P(L) = 0.09, and P(M) = 0.01.

To find the probability of a randomly selected individual being left-handed or mixed-handed, we can simply add the corresponding probabilities:

P(L or M) = P(L) + P(M) = 0.09 + 0.01 = 0.10

Therefore, the probability of a randomly selected individual being left-handed or mixed-handed is 0.10, or 10%.

P(R) = 1 - P(L or M) = 1 - 0.10 = 0.90

Hence, the probability of a randomly selected individual being right-handed is 0.90, or 90%.

Learn more about probability here:

https://brainly.com/question/31828911

#SPJ11

Match the following items by evaluating the expression for x = -2.

Match the following items by evaluating the expression for x = -2.

Answers

Answer:

see below

Step-by-step explanation:

x^-2 = 1/x^2  Let x = -2      1/ (-2)^2 = 1/4

x^-1 = 1/x^1  Let x = -2      1/ (-2)^1 = 1/(-2) = -1/2

x^0 = 1  

x^1 = x  Let x = -2      (-2)

x^2 =   Let x = -2      (-2)^2 = 4

Answer:

1)¼

2)½

3)1

4)2

5)4

Step-by-step explanation:

Question-1&2:

recall that,

\( \displaystyle {x}^{ - n} = \frac{1}{ {x}^{n} } \)

we want to evaluate \(x^{-2}\) for x=-2

to do so substitute the given value of x

\( \displaystyle {2}^{ - 2} \)

apply the formula:

\( \displaystyle {2}^{ - 2} = \frac{1}{ {2}^{2} } \)

simplify square:

\( \displaystyle {2}^{ - 2} = \boxed{\frac{1}{ 4} }\)

likewise substitute the given value of x to x^-1:

\( \displaystyle {2}^{ - 1} \)

apply the formula:

\( \displaystyle {2}^{ 1} = \frac{1}{ {2}^{1} } \)

\( \displaystyle {2}^{ 1} = \boxed{\frac{1}{ {2}^{} } }\)

Question-3:

substitute the value of x

\( \displaystyle {2}^{ 0} \)

it's a universal truth that x⁰=1 Thus

\( \displaystyle \boxed{1}\)

Question-4&5:

Substitute the given value of x to x¹ and x² respectively

\( \displaystyle {2}^{ 1} \quad \bigg | \quad {2}^{2} \)

simplify:

\( \displaystyle \boxed{2} \quad \bigg | \quad \boxed4\)

and we're done!

Which equation correctly uses the value of b to solve for a?


tan(22. 6o) = StartFraction a Over 13 EndFraction

tan(22. 6o) = StartFraction 13 Over a EndFraction

tan(22. 6o) = StartFraction a Over 12 EndFraction

tan(22. 6o) = StartFraction 12 Over a EndFraction

Answers

The equation correctly uses the value of b to solve for a is tan (22.6)= \(\frac{a}{12}\)

We know that cos  (22.6) =\(\frac{b}{13}\) Rounding the value of b as asked in the problem gives b=12.

According to the right-triangle definition of cosine, b must be the neighboring side to the angle 22.6o and thus the triangle's hypothenuse must be 3.

Then, a is the opposite side of the angle 22.6º therefore using the definition of sine, sin(22.6)= \(\frac{a}{3}\)

Solving for a, we obtain

a=3sin(22.6) =3cos(22.6) tan(22.6)=btan(22.6)=12tan(22.6)

Hence conclusion can be made that tan(22.6)= \(\frac{a}{12}\)

learn more about equations of triangles here: https://brainly.com/question/28138397

#SPJ4

This question is incomplete. The complete question is:

Triangle ABC is a right triangle and cos(22.6o)=b/13. Solve for b and round to the nearest whole number. Which equation correctly uses the value of b to solve for a? tan(22.6o) = a/13 tan(22.6o) = 13/a tan(22.6o) = a/12tan(22.6o) =12/a

help me please help me plz help me plz ​

help me please help me plz help me plz

Answers

1.c
2. 3, 1 and then 2
3.a
4. b

SERIOUS NEED OF HELP!!!! *giving brainliest*
70 concert tickets were sold for $550. Each adult ticket cost $9 and each children’s ticket cost $5. How many adults tickets were sold? (Write only the number for the answer.)

Answers

Answer:

Total tickets = 70

Total cost = $550

Adult's ticket = $9

Child's ticket = $5

Difference = 9 - 5 = $4

Assume all 70 are child's tickets

5 x 70 = 350

But the total cost was 550

550 - 350 = $200

The $200 must have come from Adult's tickets, which has a difference of $4.

200 ÷ 4 = 50

So there are 50 adult's tickets.

70 - 50 = 20

And there are 20 child's tickets.

50 adult tickets were sold.

Circle A has a radius of 6 inches. Circle b has a radius 20% greater than circle A. What is the radius of circle B?

Answers

Answer:

7.2inches.

Step-by-step explanation:

Given parameters:

Radius of Circle A  = 6inches

Unknown:

Radius of circle B  = ?

Solution:

We are to find the radius of circle B.

  The relationship between circle A and B is such that;

    Radius of Circle B  = 20% greater than that of A

   Radius of Circle B  = 1.2 x 6  = 7.2inches.

Other Questions
Which of the following concepts provides the best explanation for why people seek to put on warmer clothing when they start to feel coldset-point theoryhomeostasisself-serving biasrefractory periodassimilation the fcc recommends that firms conduct market to eliminate possible bias related to judgments about some population segments as they identify their target audience for advertising. If sin(A+B)=sinAcosB+cosAsinB and cos(AB)=cosAcosB+sinAsinB, find the values of (i) sin75 and (ii) cos15 A common reaction of two cysteine residues in proteins results in the formation of ____.a.thioether bondsb.disulfide bondsc.dithiol bondsd.thioester bondse.none of these Find the derivative of the function. f(x) = 4x + 6x + 1x + 3 f'(x) = When downloading and saving web pages and/or the images they contain, it is important to remember that copyright laws protect ____ of the information on the Internet. what is the meaning of the word scaffed In A Vendetta: Use lines 8-15. How does the writer use language to describe the setting? It is found that up to 0.0980 g of Agloz dissolves in 2.00 L of aqueous solution at a certain temperature. Determine the value of Ksp for AglO3. 1 2 Based on the given values, fill in the ICE table to determine concentrations of all reactants and products. AglO3(s) = Ag+ (aq) + 103-(aq) Initial (M) Change (M) Equilibrium (M) herbert spencer argued that social change would eventually happen on its own and opposed taking action for immediate social change. for this reason, spencer was most accepted by . multiple choice question. the working class and poor immigrants politicians and activists supporting emancipation of slaves people in positions of power or influence academia In the catch block of a try/catch statement for handling PDO exceptions, you can get a message that describes the exception by using the getMessage method of the Answer a. PDOStatement object b. PDO object c. Result set array d. PDOException object Use the periodic table to determine the number of 3d electrons in Sc. number of 3d electrons: ?Use the periodic table to determine the number of 4p electrons in Se. number of 4p electrons: ? Given 0 = 7pi/6a. Convert 0 to degrees. Reviewb. Draw 0 in the coordinate plane. Reviewc. Name two angles, one positive and one negative, that are coterminal to 0d. Determine the reference angle . how is the metric system different than the standard united states system? a 108-watt light bulb is left on for 28 hours. how much did it cost to operate the light bulb if electricity costs 0.04 dollars per kwh? The British Doctors Study is an important study, which has followed participants for 60 years to investigate the relationship between tobacco smoking and cause specife mortality among British doctors. In 1951, a questionnaire on smoking habits was sent to 49,913 male and 10,323 female doctors registered with the British General Medical Council 34.440 male doctors and 6194 female doctors gave sufficient information to classify their smoking status (Doll and Pato, 1976: Doll et al, 1980). The vital status of these doctors was followed up from the records of the Registrar General's Office, the British Medical Council, and the British Medical Association. The causes of death for 10,072 male and 1094 female doctors who had died during the first 20 and 22 years of follow-up respectively were ascertained from death certificates. The rate of death from lung cancer among wokers was compared with that among non-smokers 1. What is the study type and design? 2. What is the best statistical measure ? Which of the following is not an example of the benefits enterprise systems provide to firms? a Products are shipped to stores more quickly. b When products are ordered the manufacturing and logistics teams are notified immediately. c There is more accurate sales information for managers to analyze.d The cost of information systems falls, making the firm more productive. Denton Company manufactures and sells a single product.Cost data for the product are given below:Variable costs per unit:Direct materials $7Direct labor 10Variable manufacturing overhead 5Variable selling and administrative 3Total variable cost per unit $25Fixed costs per month:Fixed manufacturing overhead $ 315,000Fixed selling and administrative 245,000Total fixed cost per month $ 560,000The product sells for $60 per unit.Production and sales data for July and August, the first two months of operations, follow:Units Produced Units SoldJuly 17,500 15,000August 17,500 20,000The companys Accounting Department has prepared absorption costing income statements for July and August as presented below:July AugustSales $900,000 $1,200,000Cost of goods sold 600,000 800,000Gross margin 300,000 400,000Selling and administrative expenses 290,000 305,000Net operating income $10,000 $95,0001. Determine the unit product cost under absorption costing and variable costing.Absorption costing:Variable Costing:Prepare contribution format variable costing income statements for July and August.Reconcile the variable costing and absorption costing net operating income figures.July AugustVariable costing net operating income (loss)Add/Deduct fixed manufacturing overhead cost deferred in/released frominventory under absorption costingAbsorption costing net operating income/loss If a customer decides to forgo the cash discount, then he should make his payment on the day after its expiration if he wants to minimize the cost of his trade credit. This statement is: O True O False what should the firm do if the marginal product obtained from the last dollar spent on capital is smaller than the marginal product derived from the last dollar spent on labor and why? graphically illustrate.