Photon a. Having characteristics of both a wave and a particle 7. Spectral lines b. A discrete amount of energy 8. Excited c. The range of different types of electromagnetic radiation (light, x-rays, ultraviolet radiation, and so on) 9. Quantum d. States with higher energy than the ground state 10. Electromagnetic spectrum e. Discrete pattern of narrow bands produced by heated gases 11. Wave-particle duality f. A particle of electromagnetic radiation

Answers

Answer 1

Photon is  particle of electromagnetic radiation , spectral lines are discrete pattern of narrow bands produced by heated gases , excited means states with higher energy than  ground state , quantum is discrete amount of energy, electromagnetic spectrum is range of different types of electromagnetic radiation , wave-particle duality is having characteristics of both wave and  particle.

What is electromagnetic radiation?

The electromagnetic radiation consists of waves made up of electromagnetic field which are capable of propogating through space and carry the radiant electromagnetic energy.

The radiation are composed of electromagnetic waves which are synchronized oscillations of electric and magnetic fields . They are created due to change which is periodic in electric as well as magnetic fields.

Learn more about electromagnetic radiation,here:

https://brainly.com/question/10759891

#SPJ1


Related Questions

if 2.22 moles of ammonia (NH3) decomposes according to the reaction shown how many moles of hydrogen (H2) are formed?

Answers

Answer:

five(5) hydrogen are formed

identify the part of the slow carbon cycle in whitch the total amount of carbon is most likely decreasing and explain why this decrease occurs

Answers

Answer:

i just had gthe sme question looked it up and got it WRONG

Explanation:

sorry i ont have a clue

In the slow carbon cycle, carbon moves through rocks, soil, oceans, and the atmosphere over a period of 100–200 million years through a series of chemical reactions and tectonic activity.

What is carbon cycle?

Carbon cycle is defined as the exchange of carbon compounds between the earth's biosphere, geosphere, pedosphere, hydrosphere, and atmosphere. Life on Earth is reliant on the carbon cycle. Because nature tends to keep carbon levels in balance, the amount of carbon that is naturally released from reservoirs equals the amount that is naturally absorbed by reservoirs.

The slow carbon cycle is the term used to describe the flow of carbon compounds between the atmosphere and the Earth. The carbon cycle processes of combustion and breakdown are primarily involved in this process. The annual average for the slow carbon cycle is 1013 to 1014 grams of carbon.

Thus, in the slow carbon cycle, carbon moves through rocks, soil, oceans, and the atmosphere over a period of 100–200 million years through a series of chemical reactions and tectonic activity.

To learn more about carbon cycle, refer to the link below:

https://brainly.com/question/1627609

#SPJ2

Fill in the blank: If an atom is in column V (or 15), it will most likely ____________ to fulfill the octet rule.

Gain 3 electrons

Lose 5 electrons

Gain 5 electrons

Lose 5 protons

Gain 3 protons

Answers

Answer:

If an atom is in column V (or 15), it will most likely gain 3 electrons to fulfill the octet rule.

Explanation:

The octet rule defines the property that atoms have to complete their last energy level with eight electrons to achieve stability through an ionic, covalent or metallic bond.

The pair of electrons that are transferred or gained belong to the last shell of the atom. If an atom is in column V (or 15), it means that it has 5 electrons in its last shell. So an atom in this group is more likely to gain 3 electrons to achieve stability than to lose the 5 electrons it has.

If an atom is in column V (or 15), it will most likely gain 3 electrons to fulfill the octet rule.

A.  Gain 3 electrons

What does Octet rule say?

The octet rule defines the property that atoms have to complete their last energy level with eight electrons to achieve stability through an ionic, covalent or metallic bond.

The pair of electrons that are transferred or gained belong to the last shell of the atom. If an atom is in column V (or 15), it means that it has 5 electrons in its last shell. So an atom in this group is more likely to gain 3 electrons to achieve stability than to lose the 5 electrons it has.

Thus, correct option is A.

Find more information about Octet rule here:

brainly.com/question/865531

According to erikson, unsuccessful completion of the first psychosocial stage will result in

Answers

Answer:

Unsuccessful completion of this stage can result in an inability to trust, and therefore an sense of fear about the inconsistent world. It may result in anxiety, heightened insecurities, and an over feeling of mistrust in the world around them.

Hope this helps!

Answer: Unsuccessful completion of this stage can result in an inability to trust, and therefore an sense of fear about the inconsistent world. It may result in anxiety, heightened insecurities, and an over feeling of mistrust in the world around them.

Explanation:

The theory of evolution states

Answers

Answer:

the theory of evolution states that all living things which exist today, and many more that are now extinct, evolved from simple life forms which first developed 3 billion years ago.

Explanation:

what is the name of the product when 3-methyl-2-butanol is oxidized?​

Answers

Answer:

3-methyl-2-butanone.

Explanation:

Hello there!

In this case, for these types of oxidation of secondary alcohols, due to the 2-butanol, it is possible for us to remember that the product is a ketone exhibiting a carbonyl (C=O) group as the product of the oxidation. In such a way, the reaction would be:

CH3 - CH - CH - CH3      ------->       CH3 - C - CH - CH3

           |        |                                                ||     |  

          OH   CH3                                          O  CH3

Therefore, the product would be 3-methyl-2-butanone.

Best regards!

In 24 g of carbon ,how many number of carbon atoms.

Answers

There are 1.204 × 10²⁴ atoms in 24 grams of carbon.

How to calculate number of atoms?

The number of atoms present in a substance can be calculated by multiplying the number of moles in the substance by Avogadro's number as follows;

no of atoms = no of moles × 6.02 × 10²³

According to this question, there are 24 grams of carbon atom. The number of moles in this carbon is as follows:

no of moles = 24g ÷ 12g/mol = 2mol

no of atoms = 2 × 6.02 × 10²³

no of atoms = 1.204 × 10²⁴ atoms.

Learn more about atoms at: https://brainly.com/question/14190064

#SPJ1

How many grams of Cu are there in a sample of Cu that contains 1.09×1024 atoms?

Answers

1.15 g of Cu are there in a sample of Cu that contains\(1.09*10^{24}\)atoms

The number of grams of Cu in a sample containing\(1.09*10^{24}\)atoms can be determined using Avogadro's number, which is \(6.02*10^{23}\)atoms/mol.

First, we need to calculate the number of moles of Cu in the sample. To do this, we divide the number of atoms by Avogadro's number to get the number of moles:

\(\frac{1.09*10^{24} atoms }{6.02*10^{23} atoms/mol }= 1.81*10^{-1 }mol\)

The sample's mass needs to be determined next. Since copper has an atomic mass of 63.55 g/mol, we can use this to determine the sample's mass:

\(1.81*10^{-1} mol * 63.55 g/mol = 1.15 g\)

Therefore, the sample contains 1.15 g of Cu.

learn more about Avogadro's number refer:brainly.com/question/11907018

#SPJ1

After performing a western blot analysis, you obtain a blot showing a single band. Plotting electrophoretic mobility of the marker proteins and the protein of interest, you determine that the molecular weight of the protein is 213 kD . Estimate the number of amino acids in the protein.

Answers

Answer:

The estimate is \(N = 1936 \)

Explanation:

From the question we are told that

The molecular weight of the protein is \(MW_p = 213 kD = 213 *10^{3} \ D\)

Generally the average molecular weight of amino acid is \(MW_a = 110 \ D\)

Generally the number of amino acids in the protein is mathematically represented as

\(N = \frac{MW_p}{MW_a}\)

         \(N  = \frac}{213 *10^{3}{110}\)

=> \(N = 1936 \)

calculate
ture
chemical equation:
2S03(g) 2502(g) + O2(g)
(a)
temperature and give its units.
In the vapour phase, sulphur trioxide dissociates according to the follow
Write , expression for this dissociation reaction.
producing a pressure of 10 atm. Calculate the value of Kp
At a particular temperature, 75% of sulphur trioxide is dissociate​

Answers

Answer:

calculate

ture

chemical equation:

2S03(g) 2502(g) + O2(g)

(a)

temperature and give its units.

In the vapour phase, sulphur trioxide dissociates according to the follow

Write , expression for this dissociation reaction.

producing a pressure of 10 atm. Calculate the value of Kp

At a particular temperature, 75% of sulphur trioxide is dissociate

What systems keep something inside them the same temperature (either hot or cold) without using electricity?

Answers

Answer:

Solar Gain. Solar gain is our bread and butter, defined as an object's increase in temperature from solar radiation. ...

Thermal Mass. If an object has great thermal mass, it is capable of retaining heat for long periods of time. ...

Insulation. ...

Orientation. ...

Convection. ...

Cooling Tubes. ...

Deflection. ...

Explanation:

the lewis dot structure for CSBr2?

Answers

Answer:

See attached picture.

Explanation:

Hello!

In this case, by considering that the carbon has four valence electrons as it is in group IVA, sulfur has six valence electrons as it is in group VIA and bromine has seven valence electrons as it is in group VIIA we infer that the carbon is the central atom in CSBr2 so one double bond between carbon and sulfur makes it complete the octet and two carbon-to-bromine bonds are formed in order to complete the octets of both carbon and bromine as shown on the attached picture.

Best regards!

the lewis dot structure for CSBr2?

When you convert a measurement from SI to English, what changes? units , values , error , or resolution

Answers

The answer to your question is units and values

When you convert a measurement from SI to English, units and values are changed. The correct options are A and B

What are SI units?

SI units are measurement units. It is the international system of measurement. There are five main SI units. These units are meters, kilometers, ampere, second, and kelvin.

These units are used to write after the measurement values. Like, are we calculating the length? Length is measured in meters and kilometers. So we will write the meter and kilometer after the value.

The English measurement system is discovered in England. The main units of this system are the inch, foot, yard, and mile. So if we convert the SI to an English measurement system. The units of the value will be changed and the value also change.

Thus, the correct option is A, unit, and B, values.

To learn more about SI units, refer to the link:

https://brainly.com/question/12750330

#SPJ2

match the following pairs of atoms with the statement that correctly describes both atoms in the pair.

Answers

They have the same number of electrons in their outermost shells.---Nitrogen & Phosphorus

2. They have two electron shells.----Carbon & Nitrogen

3. Their outermost electron shell is full.---Helium & Argon

4. They have one electron shell. ----Hydrogen & Helium

5. They have three electron shells.-----Sodium & Chlorine

The protons in the carbon atom's nucleus attract the two valence electrons of both oxygen atoms. They form a double covalent bond because they both have a lot of attraction and room for electrons.

Which pair of atoms is held together by a covalent bond?

Nonmetal atoms are the only ones that can form covalent bonds. A covalent bond can bind two atoms from the same element or from different elements together. A covalent compound is formed when elements' atoms join together.

Incomplete question :

Match the following pairs of atoms with the statement that correctly describes both atoms in the pair.

1. They have the same number of electrons in their outermost shells.

2. They have two electron shells.

3. Their outermost electron shell is full.

4. They have one electron shell.

5. They have three electron shells.

Pairs given :

Helium & Argon

Nitrogen & Phosphorus

Carbon & Nitrogen

Hydrogen & Helium

Sodium & Chlorine

Learn more about pair of atoms :

brainly.com/question/29117040

#SPJ1

What type of boundary exists at letter b?

What type of boundary exists at letter b?

Answers

Answer:

Convergent boundaries

Explanation:


Which statement best describes the mass numbers of the atoms in the reaction?


OThere is one atom with a mass number of 1

O There are two atoms with mass numbers of 2.

OThere is one atom with a mass number of 2.

O There are two atoms with mass numbers of 1.

Which statement best describes the mass numbers of the atoms in the reaction?OThere is one atom with

Answers

There are two atoms with mass numbers of 2 best describes the mass numbers of the atoms in the reaction

What is a Mass number ?

The sum of protons and neutrons in an atomic nucleus is known as the mass number, often known as the atomic mass number or nucleon number. It roughly equates to the atom's atomic mass given in atomic mass units.

They are collectively referred to as nucleons since protons and neutrons are both present in the atomic nucleus. An atom of carbon, for instance, has 6 protons and 6 neutrons. Its mass number is therefore 12. All atoms of an element have the same number of protons, but their neutron counts can differ.

Learn more about Mass number here:

https://brainly.com/question/28409714

#SPJ13

a. Identify the structures shown in the diagram. b. Identify the information that is contained within these structures. c. Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person. d. Explain why the structures are in pairs.

Answers

The answer responses to  the structures shown in the diagram are:

A. chromosomes

C. They would be the same.

B. They are in pairs because each one comes from a different parent.

What is the structure about?

The chromosomes are in pairs because humans have a diploid number of chromosomes, meaning they have two sets of chromosomes, one inherited from each parent.

The nucleus is important in eukaryotic cells and has many important parts that help the cell work properly. There are some parts inside cells called the nuclear membrane, nucleoplasm, nucleolus, and chromatin. Chromatin is made up of DNA and other proteins.

Every part of a person's body has the same genes, but the way they are organized can be different in different types of cells. The chromosomes in our skin cells might not be the same as the chromosomes in our muscle cells, even if they come from the same person.

Learn more about  nucleus from

https://brainly.com/question/9376695

#SPJ1

Identify the structures shown.

A. chromosomes

B. mitochondria

C. nuclei

D. vacuoles

C

Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.

A. There would be longer.

B. They would be shorter.

C. They would be the same.

D. They would be different.

Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.

A. There would be longer.

B. They would be shorter.

C. They would be the same.

D. They would be different.

Explain why the structures are in pairs.

A. They aren't in pairs.

B. They are in pairs because each one comes from a different parent.

C. This cell is making a copy of itself.

D. The cell always has 2 copies in case 1 is damaged.

33) Which is the correct name for the molecule depicted below?

A. 2-isopropyl-2,3,4-trimethylbutane

B. 2-isopropyl-2,3-dimethylpentane

C. 2,3,3,4-tetramethylhexane

D. 1,1,2,2,3-pentamethylpentane

E. None of these choices is correct.

33) Which is the correct name for the molecule depicted below?A. 2-isopropyl-2,3,4-trimethylbutaneB.

Answers

Answer:

C. 2,3,3,4-tetramethylhexane

Explanation:

If we put 1g samples of all four of these into a hot oven, which would absorb the most heat in order to reach 100 degrees Celsius?

If we put 1g samples of all four of these into a hot oven, which would absorb the most heat in order

Answers

Answer:

Alluminum

I have to extend the answer: wedfojnwenlgeqoirhgkreqh

What is the heat capacity (J/°C) of a 250.0 g block of metal whose specific heat is 0.220 J/gºC ?

Answers

Answer:

0.220 J/gCº  * 250.0 g = 55.0 J/Cº

Janelle hikes along the beach every morning at the same time. Throughout the month, she notices the shoreline follows a pattern of receding and advancing. What causes the shoreline to follow this pattern?


tides


water cycle


chemical weathering


erosion and deposition

Answers

Answer:

Erosion and deposition

Answer:

Tides

Explanation:

just did it:)

(GIVING BRAINLIEST)Match the type of chemical bond with the best description:

A.) ionic bonding
B.) covalent bonding
C.) metallic bonding
-------------------------------------------
1.)sea of electrons surrounding metal cations
2.) sharing of electrons between nonmetal atoms
3.) transfer of electrons from cation to anion​

Answers

Answer:

A and 3

B and 2

C and 1

Explanation:

Ionic bonding is the transfer of electrons from a cation to an anion.

Covalent bonding is the sharing of electrons between nonmetal atoms.

Metallic bonding is the sea of electrons metal cations.

Hope this helped!

Calculate the pH when 90.0 mL of 0.200 M HBr is mixed with 30.0 mL of 0.400 M CH₃NH₂ (Kb = 4.4 × 10⁻⁴).

Answers

The pH of the solution is 10.82.

To solve this problem, we need to determine the concentration of the hydronium ion (\(H_3O^+\)) in the solution. This can be done using the following steps:

Write the balanced chemical equation for the reaction between HBr and CH₃NH₂.

HBr + CH₃NH₂ → CH₃NH₃⁺ + Br⁻

Write the expression for the base dissociation constant (Kb) for CH₃NH₂.

Kb = [CH₃NH₃⁺][OH⁻]/[CH₃NH₂]

Calculate the concentration of hydroxide ions (OH⁻) in the solution using the Kb value and the concentration of CH₃NH₂.

Kb = [CH₃NH₃⁺][OH⁻]/[CH₃NH₂]

4.4 × 10⁻⁴ = x² / (0.400 M)

x = 6.63 × 10⁻³ M

[OH⁻] = 6.63 × 10⁻³ M

Calculate the concentration of \(H_3O^+\) using the equilibrium constant for the reaction between HBr and \(H_2O\).

\(HBr + H_2O = H_3O^+ + Br^-\)

\(Kw = [H_3O^+][OH^-] = 1.0 * 10^{-14}\\[H_3O^+] = Kw/[OH-] = 1.51 * 10^{-11}\)

Calculate the pH using the concentration of \(H_3O^+\).

\(pH = -log[H_3O^+]\\pH = -log(1.51 * 10^{-11})\)

pH = 10.82

For more question on pH click on

https://brainly.com/question/172153

#SPJ11

Which statement is best supported by this scale? (LT 2)


(Insert Mohs Hardness scale)





Your answer:

A fingernail will scratch calcite, but not quartz.


A piece of glass can be scratched by calcite, but not quartz.


A piece of glass can be scratched by quartz, but not calcite.

Answers

Answer:

The answer is C I think..

Okay thank you thank y’all so much and I love you mommy love you see you soon buddy love you mommy love you buddy bye bye buddy bye love mommy love y’all mommy mommy daddy mommy love bye ✌️ I don’t think can

round 77.616 to two significant figures

Answers

Answer:

The answer to the question is 78

Answer:

78

Explanation:

In rounding off to two, we consider the third digit. if it is more than five we ad one to the second digit otherwise we truncate.

in the case of 77.616, we add one to the second digit and truncate the rest.

FILL THE BLANK In the bicarbonate buffering system, carbon dioxide and water join to form ___________, which dissociates into hydrogen and ________________

Answers

In the bicarbonate buffering system, carbon dioxide and water join to form carbonic acid, which dissociates into hydrogen and bicarbonate ions.

The blood's bicarbonate buffer system keeps the pH or H+ ion concentration where it needs to be.

The majority of blood is water, which breaks down into the hydroxide ions H+ and OH-.

The pH of the blood is set by the hydrogen ions, or H+. The blood's acidity or basicity will have an impact on how the body functions. A byproduct of respiration is dissolved carbon dioxide, or CO2, which is found in blood. When these react, carbonic acid, or H2 CO3, can be created. Being a weak acid, carbonic acid is willing to give up an H+ ion.

Learn more about bicarbonate buffering system:

https://brainly.com/question/22821585

#SPJ4

Where are the metals located on the periodic table? the nonmetals?

Answers

Answer:

The metals are located on the left and the non-metals are located on the right.

Explanation:

Hope this helps :)

How many mL are in 0.365 L?

Answers

Answer:

365 mL

Explanation:

There are 1,000 mL per every 1 L. As such, to convert between the two measurements, you need to multiply the given volume (0.365 L) by the conversion. To allow for the cancellation of units (liters), liters should be in the denominator of the conversion.

1,000 mL = 1 L

 0.365 L            1,000 mL
----------------  x  -----------------  = 365 mL
                               1 L

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

A sample of hydrogen takes up 34.0 dm3 of space when it is under 500.0 kPa of pressure. When the pressure is changed to 340.0 kPa, what is the new volume? dm3 H2

Answers

Answer:

50 dm³

Explanation:

Assuming constant temperature, we can solve this problem using Boyle's law, which states:

P₁V₁=P₂V₂

Where in this case:

P₁ = 500.0 kPaV₁ = 34.0 dm³P₂ = 340.0 kPaV₂ = ?

We input the data:

500.0 kPa * 34.0 dm³ = 340.0 kPa * V₂

And solve for V₂:

V₂ = 50.0 dm³

Thus the answer is 50.0 dm³ H₂.

Other Questions
Which of the following is the strongest base?A.LiOHB.KOHC.CsOHD.NaOH A block with mass $m$ starts from rest and slides down a plane inclined at an angle $\theta$. The coefficient of kinetic friction is $\mu$. Which equation correctly yields the block's speed $v$ after it has traveled a distance $d$ down along the plane, assuming that it does indeed start sliding down Graph the equation y= -1/2x how do rip currents form? view available hint(s)for part b how do rip currents form? water moves toward the beach by wave activity. water is moved along the sea floor, especially near submarine canyons. What did the federalist led by Alexander Hamilton believe about the new nations system of banking The cost to manufacture a sofa is $600 per sofa plus a fixed setup cost of $4,500. Each sofa sellsfor $750. How many sofas must be sold to turn a profit of $12,000? A box of mass m is pushed at an angle 0 by a force Fp along a frictionless surface. The box accelerates to theright. What is the magnitude of the horizontal acceleration ? and shot lasers directly forward from my eyes, the lasers would be travelling anteriorly along what plane? How is the city alive? In the city we became once you have written your pseudo-code, you can then translate your psuedo-code directly to code. True or False is/are available if the policy holder lives permanently in a nursing home, is terminally ill, needs long-term care for an extended period of time, or has a life-threatening diagnosis, such as aids quizlet Who was monica seles playing in a tennis tournament in hamburg, germany when she got stabbed? What tool gives scientists the best data to study ice loss near the poles? (1 point)A. Argo floatsB.satellite measurementsC.air bubbles trapped in iceD.ice core samples A neutral metal sphere is brought close to a charged insulating sphere. The electrostatic force between the metal sphere and insulating sphere is: You are a civil engineer and your company wants to pursue an earthworks project. You need to buy a machine for RM 150, 000, it will bring in revenueof RM 45, 000 per year over a period of 5 years. Assume the discount rate required is 12%. Calculate the Net PresentValue (NPV) of this project and comment on the course of action to betaken.(ii) Estimate the Internal Rate of Retum (IRR) for the project using adiscount rate of 12% and 18%. why is plant nutrition important? plllllllllzzzzz helppppzzzz mezzzzzChlorine (Cl) has nine electrons. How many electrons are in the n=1 shell?2791 a*b=a+b-2ab find2*(3*5)(2*3)*5 simulation lab 9.2: module 09 configuring defender firewall-ports which protocol did you block in the lab How many muscles does a human body have?