Many household cleaning products contain oxalic acid, H₂C₂O4 a diprotic acid with the following dissociation constants
Ka1 = 5.9 x 10^-2
Ka2 = -6.4 × 10^-5

calculate the equilibrium concentration of h3o^+ in a 0.20 m solution of oxalic acid.

Answers

Answer 1

The equilibrium concentration of H3O+ ina 0.2 m solution of oxalic acid is [H3O+] = 0.08.

When a chemical process reaches equilibrium, the equilibrium constant (often represented by the letter K) sheds light on the interaction between the reactants and products. For instance, the ratio of the concentration of the products to the concentration of the reactants, each raised to their respective stoichiometric coefficients, can be used to establish the equilibrium constant of concentration (denoted by Kc) of a chemical reaction at equilibrium. It is significant to remember that there are several kinds of equilibrium constants that establish relationships between the reactants and products of equilibrium reactions in terms of various units.

The proportion of the reactant to the product in a chemical reaction is known as the equilibrium constant.

For more information on equilibrium constant kindly visit to

https://brainly.com/question/10038290

#SPJ4


Related Questions

Which two appliances transforms electrical energy into mechanical energy?

Question 15 options:

trampoline, fan


lamp, trampoline


fan, drill


drill, rubber band

Answers

Fan and drill transforms electrical energy into mechanical energy.

What is electromechanical energy conversion?

The process of converting electrical energy into mechanical energy is known as electromechanical energy conversion. To achieve this, an electric motor with a rotor and stator is utilized. As the current flows through the stator, it generates a rotating magnetic field that interacts with the rotor's magnetic field, ultimately leading to the generation of mechanical energy.

Which two appliances transforms electrical energy into mechanical energy?

The fan and drill are two devices that run on electric motors, which convert electrical energy into mechanical energy. This energy is then utilized to power the respective devices. For instance, in a fan, the motor rotates a set of blades to create a cool airflow, while in a drill, the motor spins a drill bit used for boring holes. The mechanical force generated by the electric motor is what propels these appliances to perform their intended tasks. Essentially, both fans and drills serve as excellent examples of machines that can transform electrical energy into mechanical energy for various applications.

To know more about electromechanical energy, click here

https://brainly.com/question/13257554

#SPJ1

A titration of 200.0 mL of 1.00 M H2A was done with 1.38 M NaOH. For the diprotic acid H2A, Ka1 = 2.5  10–5, Ka2 = 3.1  10–9. Calculate the pH after 100.0 mL of 1.38 M NaOH have been added.

Answers

Answer:

4.95

Explanation:

1.00 M H2A

1.38 m NaOH

Titration = 200.0 mL

Calculate moles of NaOH

= \(\frac{100*1.38}{300}\)  = 0.46

calculate moles of H2A

= \(\frac{200 * 1.0}{300}\) = 0.667

therefore the moles of acid left = moles of H2A - moles of NaOH

                                                    = 0.667 - 0.46 = 0.207

pka = - log( ka )

       = - log ( 2.5 * 10^-5 ) = 4.61

calculate PH after 100 ml of 1.38 M NaOH have been added

PH = pka + log \((\frac{salt}{acid} )\)

     = 4.61 + log \((\frac{0.46}{0.207} )\) = 4.95

who discovered periodic changes in properties of elements

Answers

Answer:

The person is Dmitri Mendeleev

Dmitri Mendeleev is the one

1. The rate-determining step has two iodide ions coming together. 2. The rate-determining step involves a persulfate ion decomposing. 3. The rate-determining step has an iodide ion and a persulfate ion coming together. Which mechanism did your experiment confirm

Answers

In the given lab write-up, the third possibility for the mechanism of the rate-determining step was confirmed, where the rate-determining step involves an iodide ion and a persulfate ion coming together.

If the first mechanism were correct, where the rate-determining step has two iodide ions coming together, the rate of the reaction would be second order with respect to the iodide ion concentration, and doubling the iodide ion concentration would increase the rate by a factor of four. If the first mechanism were correct, where the rate-determining step involves a persulfate ion decomposing, the rate of the reaction would be first order with respect to the persulfate ion concentration, and doubling the persulfate ion concentration would double the rate.

However, since the third mechanism was confirmed, where the rate-determining step has an iodide ion and a persulfate ion coming together, the rate of the reaction is second order overall, and doubling either the iodide or persulfate ion concentration would increase the rate by a factor of four.

Learn more about the reaction

https://brainly.com/question/28984750

#SPJ4

Full Question: your lab write-up, three possibilities for the mechanism of the rate-determining step were listed. 1. The rate-determining step has two iodide ions coming together. 2. The rate-determining step involves a persulfate ion decomposing. 3. The rate-determining step has an iodide ion and a persulfate ion coming together. Which mechanism did your experiment confirm? the third. (a) If the first mechanism is correct, what should happen to the rate if the concentration of iodide ion is doubled and other concentrations are held constant? (b) If the first mechanism is correct, what should happen to the rate if the concentration of persulfate ion is doubled and other concentrations are held constant? (c) If the second mechanism is correct, what should happen to the rate if the concentration of iodide ion is doubled and other concentrations are held constant? (d) If the second mechanism is correct, what should happen to the rate if the concentration of persulfate ion is doubled and other concentrations are held constant?

.

What volume of 0.200 M Na2CO3 (Mm = 106 g/mol) solution contains 53.0 g of Na2CO3?

Question 1 options:

0.200 L of solution


0.400 L of solution


0.500 L of solution


1.60 L of solution


2.50 L of solution

Answers

Answer:

volume in Liter = 2.50 L

Explanation:

Given:

Na2CO3 = 0.2 M

Molar mass of Na2CO3 = 106 g/mol

Mass of Na2CO3 solution = 53 gram

Find:

Volume of Na2CO3

Computation:

Number of mol of Na2CO3  = (53 g) / (1.06 x 10² g/mol)

Number of mol of Na2CO3  = 0.5 mol

M = Number of mol / volume in Liter

0.2 = 0.5/ volume in Liter

volume in Liter = 0.5 / 0.2

volume in Liter = 2.50 L




The balloon in this image was rubbed with a piece of wool material. Now, it is negatively charged. What force allows the charged balloon to "pick up" the small pieces of paper off of the table?



The negatively charged balloon is attracted to negative static charges in the paper..



The negatively charged balloon is attracted to the north pole of the paper pieces.



The negatively charged balloon is attracted to the south pole of the paper pieces.



The negatively charged balloon is attracted to the positive static charges in the paper.


What is the best explanation of electric current in a wire?



Electrons build up in the wire and create a charge.



Electrons flow because of electrical attraction and repulsion.



Protons are pushed along by electric forces.



Atoms move because of heat.


Why does the light bulb in a circuit turn on when you close the switch?



The switch absorbs the electrical energy.



The switch changes the direction of the flow of electrons.



Closing the switch completes the circuit, making it a closed circuit.



The switch changes the circuit from series to parallel.


Earth is dipolar, like a bar magnet.


What does this mean about its magnetic poles?



There is only a magnetic south pole.



There is only a magnetic north pole.



There are both magnetic north and south poles.



There are two magnetic north poles.



Which arrangement described below would result in magnetic poles that attract one another?


North Pole + South Pole


South Pole + West Pole


East Pole + North Pole


North Pole + North Pole



Why is an electromagnet a temporary magnet?




An electromagnet only attracts other permanent magnets.




An electromagnet becomes a magnet when a current flows through the wire. An electromagnet no longer acts as a magnet when the current flow stops.




An electromagnet cannot be turned on and off.




An electromagnet is a magnet when no current flows through the wire. The electromagnet no longer acts as a magnet when current flows through the wire.



What set of materials listed below could be used to create a complete electromagnet?



wires and battery




iron nail and battery




iron nail, magnet, and wire




battery, iron nail, copper wire



Where is a bar magnet's magnetic field the strongest?



red part of the magnet



longest part of the magnet



magnetic poles (N + S)



center of the magnet



A(n) ___________ is represented in the diagram it converts electrical energy into mechanical motion.


generator


electromagnet


parallel circuit


motor

Answers

Answer:

I actually have no idea

Explanation:

Sorry my man

Answer:

Explanation:

generator

The side chain of which amino acid is most likely to be a substrate for HRP. Lys, Leu, Tyr, or Gln. oxygen.

Answers

The side chain of the amino acid most likely to be a substrate for Horseradish Peroxidase (HRP) is tyrosine (Tyr).

HRP is an enzyme that catalyzes the oxidation of various substrates, and it requires a hydrogen donor, such as a phenolic compound or a reductive substrate, to complete this process.

Tyrosine has a phenol group in its side chain, making it a suitable substrate for HRP due to its ability to donate a hydrogen atom. The other amino acids mentioned - lysine (Lys), leucine (Leu), and glutamine (Gln) - do not have phenol groups in their side chains and therefore are less likely to be substrates for HRP.

During the oxidation process, HRP converts the hydrogen donor to a more reactive form, which can then participate in subsequent reactions. This property of HRP is useful in various applications, such as detecting and measuring the presence of specific molecules in biological samples.

For more such questions on amino acid, click on:

https://brainly.com/question/24106148

#SPJ11

HELP ME PRETTY PLS PLS HELP ME FAST

HELP ME PRETTY PLS PLS HELP ME FAST

Answers

Answer:

The producer is the grass, and energy flows from the mouse to both the snake and the owl.

Explanation:

The producer is usually defined as a "Producers, also known as autotrophs, make their own food.". Thus, the grass is the producer of the food web provided.

The energy also flows from the mouse to the snake and the owl, as the mouse has two arrows that lead away from it, leading both to the snake and the owl.

Hope this helps.

3. Human activity can cause changes in one of the Earth's systems that lead to subsequent alterations in a different system. For example, the combustion of fuel in automobiles can cause elevated levels of atmospheric nitrogen oxides, Reactions within the atmosphere convert nitrogen oxides into nitric acid, which can subsequently return to the Earth's surface as acid rain. Which of the following statements best describes the effect of acid rain on the hydrosphere? O A. Surface water in nearby areas will evaporate at an increased rate. B. Surface water in nearby areas can become polluted. O C. Soil in nearby areas will erode at an increased rate. O D. Soil in nearby areas can become contaminated.​

Answers

answer: Surface water in nearby areas can become polluted.

Explanation:

What is the∆S° of 0₂​

Answers

Answer:0

Explanation: zero because it is the most stable form of oxygen in its standard state

How are elements similar in a group/family on the periodic table?

Answers

All the elements in each group have the same number of electrons in their outer orbitals, also known as valence electrons.

Perform a DNA extraction from green peas at home or school lab, under adult supervision, by following the given procedure carefully.

Procedure for DNA extraction:

To half cup of split peas, add 1/8 teaspoon of salt and one cup of cold water.
Transfer this mixture in a blender and blend it on high speed for 15 seconds.
Filter the blended mixture, using a strainer, into a measuring container. Observe the amount of mixture you obtain after filtration. Add liquid detergent equal to 1/6 volume of the obtained pea mixture.
Mix by swirling. Allow the mixture to rest for about five to ten minutes.
Transfer this mixture to test tubes. Fill the tubes to about 1/3 of their volume.
Add a pinch of meat tenderizer to each of these tubes. Mix gently to avoid damaging the DNA.
Tilt the test tube, and pour alcohol (75% isopropyl alcohol or 95% ethanol) down the sides of the tube. Add alcohol to about 2/3 volume of the tube. You will obtain two layers. The layer at the top contains the DNA.

Now that you are done with the DNA extraction process, answer the following questions:

What purpose does blending the pea mixture serve?
Why do you need to add liquid detergent?
What role does the meat tenderizer play?
Why is alcohol added and why does the DNA get extracted in the alcohol layer?

Answers

Answer:

Blending is done to break open, or lyse, the cells.

DNA resides in the nucleus, which is enclosed by the nuclear membrane. The nucleus is further enclosed by the cell membrane. So, to get the DNA, we need to break open both the membranes. Cell membranes are made up of lipids and proteins. The detergent molecules to attach to the cell and nuclear membranes, causing them to break open.

Meat tenderizer contains the enzyme protease that helps cleave proteins. Even after breaking open the nucleus and cell membrane, the DNA is still protected by cell proteins. Meat tenderizer cleaves the proteins, leaving behind only the DNA molecule.

DNA is insoluble in alcohol and hence, when alcohol is added, it precipitates out the DNA.

Explanation:

PLATO Answer

Atom A has triply as long a half-life as atom B. Part A If both of them start out with an amount N0, then in the time that A has been reduced to N0/2, B has been reduced to

Answers

If atom A has a triply as long half-life as atom B, then in the time it takes for atom A to reduce to half its initial amount (N0/2), atom B would be reduced to N0/8. Therefore, the correct answer is option (C) N0/8.

The half-life of a radioactive substance is the time it takes for half of the substance to decay. Let's consider atom A and atom B starting with an initial amount N0.

If atom A has a triply as long half-life as atom B, it means that the half-life of atom A is three times longer than the half-life of atom B. Let's assume the half-life of atom A is t_A and the half-life of atom B is t_B.

In the time it takes for atom A to reduce to half its initial amount (N0/2), the number of half-lives that have passed can be calculated as follows:

N_A = N0 * (1/2)^(t/t_A)

Since we want N_A to be N0/2, we can set up the equation:

N0/2 = N0 * (1/2)^(t/t_A)

Simplifying the equation, we find:

1/2 = (1/2)^(t/t_A)

Since (1/2)^(t/t_A) is equal to (1/2)^1, we can conclude that t/t_A = 1.

Now let's consider atom B. Since the half-life of atom B is t_B, in the same time t that it takes for atom A to reach N0/2, the number of half-lives that have passed for atom B can be calculated as:

N_B = N0 * (1/2)^(t/t_B)

Since t/t_A = 1, we can substitute this value into the equation:

N_B = N0 * (1/2)^(1/t_B)

We know that N_B is the amount to which atom B is reduced. So, when N_B is equal to N0/8, it implies:

N0/8 = N0 * (1/2)^(1/t_B)

Simplifying the equation, we find:

1/8 = (1/2)^(1/t_B)

Since (1/2)^(1/t_B) is equal to (1/2)^3, we can conclude that 1/t_B = 3.

Therefore, in the time it takes for atom A to be reduced to N0/2, atom B is reduced to N0/8. Thus, the correct answer is option (C) N0/8.

To learn more about atom, click here:

brainly.com/question/26952570

#SPJ11

Atom A has triply as long a half-life as atom B.If both of them start out with an amount N0, then in the time that A has been reduced to N0/2, B has been reduced to_______?

(A) N0/2

(B) N0/16

(C) N0/8

(D) N0/4

What are three main ocean currents?

Answers

The North Equatorial Current, the North Atlantic Current, and the Canary Current.

Which of the following compounds has more atoms of sulfur (S)? Explain your reasoning.



Sodium Sulfate (4Na2SO4)

Nitrogen Sulfate (N2(SO4)3)

Answers

Answer:

Nitrogen sulfate

Explanation:

In Sodium sulfate there is 1 sulfur ion since the poly atomic ion SO4 has only one sulfur. In nitrogen sulfate there are 3 sulfur ions since it is (SO4)3 so there are three SO4 poly atomic ions meaning there are 3 sulfur ions.

Why are molecular solids not expanded to conduct electricity

Answers

The molecular solids can not expand to conduct electricity because there are small distances between the atoms and also their bonds are very strong, both characteristics make the movement of particles very small (they only vibrate in place), and that also causes the electrons to be attracted to the atoms with greater force and therefore they do not move easily.

What volume does 40.5 g of N2 occupy at STP?
A)
64.8 L
B)
1.81 L
C)
32.4 L
D)
50.7 L
E)
none of these

Answers

40.5 g of N2 occupies 32.7 L at STP. The correct answer is (C) 32.4 L.

We can use the ideal gas law to solve this problem:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature.

At STP, the pressure is 1 atm and the temperature is 273.15 K. The ideal gas constant is 0.08206 L·atm/(mol·K). We can calculate the number of moles of N2 using its molar mass, which is 28.02 g/mol:

n(N2) = 40.5 g / 28.02 g/mol = 1.446 mol

Substituting these values into the ideal gas law equation:

V = nRT / P = (1.446 mol)(0.08206 L·atm/(mol·K))(273.15 K) / 1 atm = 32.7 L

Therefore, 40.5 g of N2 occupies 32.7 L at STP.

The correct answer is (C) 32.4 L.

Learn more about occupies here:

https://brainly.com/question/223894

#SPJ11

Please help me with this please!!! I’m begging you :(
Use the following terms to complete the concept map below:


malleable
brittle
metals
nonmetals
covalent bonds
electrostatic attraction

Please help me with this please!!! Im begging you :(Use the following terms to complete the concept map

Answers

1 = metals

2 = nonmetals

3 = covalent bonds

4 = malleable

5 = electrostatic attraction

6 = brittle

Which combination of elements produce compounds with a large electronegativity difference and high conductivity?

Answers

Answer:

C. H2(g)

Explanation:

How do we know what parts make up the atom?

Answers

Answer:nucleus protons nuetrons electrons

Explanation:

The smallest partical into which an element can be divied and still be the smallest element

.( A basic unit o f matter)

Answer:

Nucleus, electrons, and protons

Explanation:

Multiple experiments and results accumulated over the years. Dalton is credited through his ray cathode tube experiments, and Rutherford's Gold Foil experiment led to the discovery of the positively charged nucleus and protons. His student Chadwick continued his studies and discovered the neutron.


What do you think is hotter, a blue flame or a red flame, explain why?

Answers

Answer:

Blue Flame

Explanation:

Because, flames consists of photons which can be defined as quantum of energies of varying freq. and wavelengths in the electromagnetic spectrum, blue has higher freq than the red colour. Thus, energy is directly proportional to energy which makes the blue flame hotter than the red flame.

Which of the electron transitions involves the most energy? Explain why this transition involves the most energy based in your understanding of the attractive forces between the electrons and protons in the atom

Answers

The attraction between the electron and the atom's nucleus grows stronger as it travels closer to it. The electron goes to a lower potential energy. The electron transition involves the most in n=6 and n=2.

More energy must be changed for a larger movement. The electric charge of the electron, a subatomic particle, is a negative one elementary charge. Due to their lack of known components or substructure, electrons, which are part of the first generation of the lepton particle family, are typically considered to bepotential energy.

The energy that an object retains due to its position in relation to other objects, internal stresses, electric charge, or other factors is known as potential energy in physics.

Learn more about electron here

https://brainly.com/question/5365825

#SPJ4

which of the fallowing are examples of kinetic energy? select all correct answers.
a. the energy in a sports drink
b. the energy given off by the sun
c. the energy of molecules in motion
d. the energy of a book on a tall shelf
e. the energy that holds together ions in a crystal

Answers

Answer:

c

Explanation:

kenetic energy is energy an object has because it's in motion

Which of the following foods contains the same amount of calcium as 8 oz of nonfat milk?
A) 4.9 oz plain, nonfat yogurt
B) 4.9 oz Swiss cheese
C) 1.5 oz canned sardines
D) 1 cup of lima beans

Answers

The correct answer is option C.  if you are looking for a non-dairy alternative to get the same amount of calcium as 8 oz of nonfat milk, canned sardines can be an excellent option.

which is 1.5 oz of canned sardines. Nonfat milk contains approximately 300 milligrams of calcium per 8-ounce serving. Sardines are an excellent source of calcium and a 1.5-ounce serving of canned sardines contains around 325 milligrams of calcium, which is equivalent to the calcium content in 8 ounces of nonfat milk.

Option A, 4.9 oz plain, nonfat yogurt, contains around 150 milligrams of calcium, which is less than half the amount present in 8 oz of nonfat milk. Option B, 4.9 oz Swiss cheese, contains around 270 milligrams of calcium, which is slightly less than the amount present in 8 oz of nonfat milk. Option D, 1 cup of lima beans, contains around 32 milligrams of calcium, which is a significantly lower amount than what is present in 8 oz of nonfat milk.

For more such questions on milk

https://brainly.com/question/23823196

#SPJ11

If the moon is full on January 16, on approximately what date will it be full in February?
A. February 10
B. February 22
C. February 1
D. February 12​

Answers

Answer:

February 12th.

Explanation:

Trust me.

the correct answer is c

The delivery van arrives at an office every day between 3 pm and 5 pm. the office doors were locked between 3:15 pm and 3:35 pm. what is the probability that the doors were unlocked when the delivery van arrived?

Answers

The probability that the doors were unlocked when the delivery van arrived is 0.75 or 75%. The delivery van arrives between 3 pm and 5 pm, which is a 2-hour window. The office doors were locked for 20 minutes between 3:15 pm and 3:35 pm, which is a 20-minute period within that 2-hour window.

Therefore, the doors were unlocked for 100 minutes (2 hours - 20 minutes) during the delivery van's potential arrival time. To calculate the probability that the doors were unlocked when the delivery van arrived, we need to determine the proportion of time that the doors were unlocked during the delivery van's arrival window. We can do this by dividing the time that the doors were unlocked by the total time that the delivery van could arrive. 100 minutes / 120 minutes = 0.833.

This means that the doors were unlocked for 83.3% of the time that the delivery van could arrive. However, we need to subtract the 20-minute period when the doors were locked, as the delivery van could not arrive during this time. 100 minutes / 100 minutes = 1, 1 - 20 minutes / 100 minutes = 0.8. This means that the doors were unlocked for 80% of the time that the delivery van could arrive. Therefore, the probability that the doors were unlocked when the delivery van arrived is 0.75 or 75%.

To know more about arrived visit:

https://brainly.com/question/28646672

#SPJ11

The first sign of neutrophilic differentiation and appearance of secondary granules is evident in what cell type?

Answers

The appearance of secondary granules and the first indication of neutrophilic differentiation can be seen in : Myelocyte.

Early granulocyte precursors (myeloblast and promyelocyte) appear similar across granulocytic cell lines until they reach the myelocyte stage, which is the final stage capable of cell division. They develop distinctive secondary lineage-specific granules at this stage (neutrophilic, eosinophilic or basophilic).

OR

White blood cells (leukocytes) go through the myelocyte stage of development where granules first show up in the cell cytoplasm. A precursor called a myeloblast transforms into a promyelocyte, which can be recognized by a nucleus that is slightly indented and shifted to one side of the cell.

When the promyelocyte cytoplasm fills with numerous granules, which may obscure the nucleus, the myelocyte stage develops. Hence, the first sign of neutrophilic differentiation and appearance of secondary granules is evident in myelocyte cell type.

Find more on neutrophils related questions at : brainly.com/question/28027508

#SPJ4

What are the respective concentrations (M) of Fe 3 and I - afforded by dissolving 0.200 mol FeI 3 in water and diluting to 725 mL

Answers

The concentration of Fe₃+ will be 0.275 M and the concentration of I- will be 0.825 M.

The concentration of the solution can be calculated as shown below.

Molarity = moles/Volume

Substitute the respective values in the above equation.

Molarity = 0.200 mol / 0.725 L

Molarity = 0.275 M

The dissociation of FeI3 is shown below.

\(FeI_3 -- > Fe^3^++ 3I^-\)

So, according to the equation, one mole of FeI₃ gives one mole of Fe³⁺ and one mole of I-.

0.275 M  FeI³ gives 0.275 M Fe3+ and 0.275 M × 3 I- = 0.825 M

Therefore, the concentration of Fe3+ will be 0.275 M, and the concentration of I- will be 0.825 M.

To learn more about dissociation:

https://brainly.com/question/28330679

#SPJ4

What are the procedures for performing an acid property test

Answers

Answer:

In the context of transaction processing, the acronym ACID refers to the four key properties of a transaction: atomicity, consistency, isolation, and durability. Atomicity. All changes to data are performed as if they are a single operation

See Periodic Table The oxidation of NADH fuels the translocation of protons into the intermembrane space of the mitochondria with the following stoichoimetry: Complex I pumps ______protons, Complex Il pumps _____protons, Complex III pumps_____protons, and Complex IV pumps_____protons.

Answers

The stoichiometry of proton translocation during the oxidation of NADH in the mitochondria is as follows:

Complex I (NADH dehydrogenase) pumps 4 protons.
Complex II (succinate dehydrogenase) does not directly contribute to proton translocation.
Complex III (cytochrome bc1 complex) pumps 4 protons.
Complex IV (cytochrome c oxidase) pumps 2 protons.

During oxidative phosphorylation, NADH donates electrons to the electron transport chain (ETC) at Complex I. As electrons pass through the ETC, protons are pumped across the inner mitochondrial membrane from the matrix to the intermembrane space, establishing an electrochemical gradient. This gradient is subsequently used to generate ATP through ATP synthase.

The proton pumping activities of Complex I, Complex III, and Complex IV contribute to the overall electrochemical gradient and the production of ATP during oxidative phosphorylation.

 To learn more about ATP click here:brainly.com/question/174043

#SPJ11

Other Questions
what would you identify as the biggest risk to delivery of the proposal on friday? select the one (1) best response option. What is the equation (in rectangular coordinates) of the highest horizontal tangent line to the polar curve r=5-6sin(t)? Find the probability of having 2, 3, or 4successes in five trials of a binomialexperiment in which the probability ofsuccess is 40%.p = [?] %Round to the nearest tenth of a percent. Topics: ProbabilityIf the events have the same theoretical probability ofhappening, then they are called Find the missing side lengths. Answers are in simplest radical form with thedenominator rationalized. Oxygen at 30 c and 300 kpa absolute pressure expands isothermally to an absolute pressure of 140 kpa. determine the final density of the gas. Richard had a balance of $322.25 in his account, and Scott had a balance of $241.75 in his account. Which statement explains why Richard owes the bank more than Scott? why did France and Spain wait so long to officially support the colonial army? i need help with this if x/y -4 = 2 + 1/y then what is equivalent to x, in terms of y What is Parliament and why do you think it is important? I have earnestly opposed violent tension, but there is a type of constructive, nonviolent tension which is necessary for growth. how does king support this claim in the rest of his letter? by providing examples of recent nonviolent sit-ins by quoting socrates and establishing historical precedent by chronicling the history of violent tension throughout the south by presenting a visual image of a world in which equality reigns Ian, age 2, watched his father hammer a nail. His father hit his own thumb and then yelled several inappropriate words. As his father went into the house for a band-aid, ian went over to the nail, picked up the hammer, pretended to hit his finger, and repeated the inappropriate words. This scenario is an example of what kind of learning?. A small object a, electrically charged, creates an electric field. At a point p located 0. 250 m directly north of a, the field has a value of 40. 0 n/c directed to the south. Select all quantities that are proportional to the diagonal length of a square. A. Area of a square B. Perimeter of a square C. Side length of a square Please help me, this is assignment is due soon.Kirk claims that he is thinking of a number in his head. He states that if he doubles the number he is thinking of and adds this result to five more than the number the sum will be two more than three times the original number he was thinking about.Could the number Kirk is thinking of be 10? Justify.Which number, if any, is Kirk thinking of? Justify. Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 2 5/6 * 2/5HELP ASAP Seventy-year-old Vinita has been having difficulty seeing while driving at night. When she is seen by an optometrist, she is told that the problem is the fact that both of her lenses have clouded. The correct specific diagnosis would by that Vinetta has Keesha gets sick pretty often. But she almost never finishes taking the antibiotics that her doctor prescribes. Instead, she often keeps a few leftover pills from each prescription in her bathroom cabinet. Why is it so dangerous for Keesha to stop taking her prescriptions early?