If 3.31 moles of argon gas occupies a volume of 100 L what volume does 13.15 moles of argon occupy under the same temperature and pressure

Answers

Answer 1

Answer:

397 L

Explanation:

Recall the ideal gas law:

\(\displaystyle PV = nRT\)

If temperature and pressure stays constant, we can rearrange all constant variables onto one side of the equation:

\(\displaystyle \frac{P}{RT} = \frac{n}{V}\)

The left-hand side is simply some constant. Hence, we can write that:

\(\displaystyle \frac{n_1}{V_1} = \frac{n_2}{V_2}\)

Substitute in known values:

\(\displaystyle \frac{(3.31 \text{ mol})}{(100 \text{ L})} = \frac{(13.15\text{ mol })}{V_2}\)

Solving for V₂ yields:

\(\displaystyle V_2 = \frac{(100 \text{ L})(13.15)}{3.31} = 397 \text{ L}\)

In conclusion, 13.15 moles of argon will occupy 397* L under the same temperature and pressure.

(Assuming 100 L has three significant figures.)


Related Questions

A chemical reaction between X and Y forms C according to the reaction below. The data for three trials to measure the
rate of this reaction are also given.
Trial
1
2
3
[X] (M)
0.01
0.01
0.02
X+Y→C
[Y] (M)
0.015
0.030
0.015
What is the rate law for this reaction?
OR=KX²M
OR=KX³M²
OR=KXM²
OR=KX²M²
Initial Rate (M/s)
7.83x10-5
BIBE
3.13x 104
1.57x10

Answers

Explanation: The rate law for a chemical reaction is an equation that relates the rate of the reaction to the concentrations of the reactants. To determine the rate law for a reaction, experiments are typically conducted with different initial concentrations of the reactants and the initial rate of the reaction is measured.

From the data provided, it appears that the reaction is of the form X + Y → C. And the concentration of X and Y are varied in three trials and the corresponding Initial rate is measured.

In the first trial, [X] = 0.01 M and [Y] = 0.015 M, and the initial rate of the reaction is 7.83x10-5 M/s.

In the second trial, [X] = 0.01 M and [Y] = 0.03 M, and the initial rate of the reaction is 3.13x104 M/s.

In the third trial, [X] = 0.02 M and [Y] = 0.015 M, and the initial rate of the reaction is 1.57x10 M/s.

Given the data, the rate law for this reaction is OR = KX²M. This is because when the concentration of X is doubled, the rate of the reaction is quadrupled, which is consistent with a rate law of the form OR = k[X]^2.

8.0g of certain gas occupies 5.6 L at STP.
A) How many moles of gas are present?
B) What is the molar mass of the gas?
C) What is the common atmospheric gas was collected?

Answers

Answer:

A) Using the ideal gas law, we can calculate the number of moles of gas present:

```

PV = nRT

```

where:

* P = pressure (atm) = 1 atm

* V = volume (L) = 5.6 L

* n = number of moles of gas

* R = ideal gas constant = 0.08206 L atm / mol K

* T = temperature (K) = 273.15 K

Solving for n, we get:

```

n = (P * V) / RT

```

```

n = (1 atm * 5.6 L) / (0.08206 L atm / mol K * 273.15 K)

```

```

n = 0.25 mol

```

Therefore, there are 0.25 moles of gas present.

B) The molar mass of the gas can be calculated by dividing the mass of the gas (8.0 g) by the number of moles of gas (0.25 mol):

```

Molar mass = Mass / n

```

```

Molar mass = 8.0 g / 0.25 mol

```

```

Molar mass = 32 g/mol

```

The molar mass of the gas is 32 g/mol.

C) The common atmospheric gas with a molar mass of 32 g/mol is oxygen (O2). Therefore, the gas that was collected is oxygen.

Explanation:

Is the ethane molecule more or less polar than water? Why or why not?

Answers

Answer: Less

Explanation:

Ethane is a non-polar molecule while water is a polar molecule

balance and identify the type of rxn
_H2O+ _SO3 _H2SO4

Answers

To balance the equation and identify the type of reaction, let's start by assigning coefficients to each compound: 2H2O + 1SO3 -> 1H2SO4

To balance the equation, we need to ensure that the number of atoms on both sides is the same. Here, we have two hydrogen (H) atoms on the left side and two on the right side, so hydrogen is already balanced.

We have two oxygen (O) atoms on the left side and four on the right side, so we need to balance oxygen by adding a coefficient of 2 in front of the water molecule:

2H2O + 1SO3 -> 1H2SO4

Now the equation is balanced with two hydrogen, four oxygen, and one sulfur (S) atom on both sides.

The type of reaction represented by this equation is a combination or synthesis reaction. In a combination reaction, two or more substances combine to form a new compound. In this case, water (H2O) and sulfur trioxide (SO3) combine to form sulfuric acid (H2SO4).

For more such questions on compound visit:

https://brainly.com/question/29108029

#SPJ8

Whose atomic theory explains how atoms emit (release) and absorb light?
O Bohr's
O Dalton's
O Rutherford's
O Thomson's

Answers

Answer:

Bohr's model of hydrogen atom

I hope this answer is correct

Answer:

Bohr's

Explanation:

Which of following compounds can be converted into a cyclic acetal upon treatment with ethylene glycol and an acid catalyst (and removal of water)? Select all that apply. А B OH с os D OH D о ОН E OCH, F H

Answers

After being treated with ethylene glycol and an acid catalyst, A, C, D, and E can be transformed into a cyclic acetal (and removal of water).

Compounds B, D and E contain the necessary carbonyl groups to form the acetal. Compound A contains an alcohol group, which can be converted into a carbonyl group by oxidation. Compound F does not contain any carbonyl groups and cannot be converted into a cyclic acetal.A cyclic acetal is an organic compound with a three atom ring containing two oxygen atoms connected by a single bond and an oxygen-alkyl group connected by a double bond. It is a type of cyclic ether and is produced from the reaction of an alcohol with an aldehyde. The reaction involves the formation of a hemiacetal, which then undergoes a dehydration reaction to form the cyclic acetal. The ring structure of the cyclic acetal makes it more stable than the open-chain acetal, allowing it to be used as a protecting group in organic synthesis.

learn more about cyclic acetal Refer:brainly.com/question/15408227

#SPJ4

Which of following compounds can be converted into a cyclic acetal upon treatment with ethylene glycol

how does mercury differ from other metals?
a.it is not a solid under normal conditions
b. it does not conduct electricity
c. it does not chemically react with other elements
d. it is not lustrous

Answers

a, because it is one of only a few on the periodic table that are liquid at room temperature and normal pressure

A reaction is found to have an activation energy of 38.0 kJ/mol. If the rate constant for this reaction is 1.60 × 102 M-1s-1 at 249 K, what is the rate constant at 436 K?

Answers

The new rate constant is 1.5 * 10^6  M-1s-1 .

What is the rate constant?

In this case we know that we have to use the Arrhenius equation to find the rate constant at two different temperatures by the use of the formula;

ln(k2/k1) = -Ea/R(1/T2 - 1/T1)

k2 = Rate constant at  436 K

k1 = Rate constant at 249 K

T1 = initial temperature

T2  = final temperature

R = Gas constant

Ea = activation energy

Hence;

ln(k2/1.60 × 10^2) = -38 * 10^3/8.314(1/436 - 1/249)

ln(k2/1.60 × 10^2) =  -38 * 10^3/8.314(0.002 - 0.004)

ln(k2/1.60 × 10^2) =  9.14

k2/1.60 × 10^2 = e^ 9.14

k2 = e^ 9.14 * 1.60 × 10^2

k2 = 1.5 * 10^6  M-1s-1

Learn more about activation energy:https://brainly.com/question/11334504

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

CaCO3 reacts with HCI to produce carbon dioxide, water, and CaCl2. What volume of carbon dioxide forms when 0.525 g of calcium carbonate reacts at 101 kPa and 25°C?

Answers

The volume of carbon dioxide forms when 0.525 g of calcium carbonate reacts at 101 kPa and 25°C is equal to 0.128 L.

What is the ideal gas equation?

The ideal gas equation can be defined as an equation that describes the state of an ideal gas. The mathematical form of the ideal gas equation is as follows:

PV = nRT

Where n is the moles, R is the gas constant, V is the volume, and P is the pressure.

Given the reaction of HCl and calcium carbonate:

\(CaCO_3 +2HCl\longrightarrow CaCl_2 +CO_2 +H_2O\)

Given the mass of the calcium carbonate = 0.525 g

The moles of CaCO₃ = Moles of CO₂ = 0.525/100 = 0.00525

The temperature of the reaction, T =  25° C = 298 K

The pressure of the reaction, P = 1 atm

Fill in the values n, R, P, and T in the equation, and we get:

1 × V = 0.00525 × 0.082 × 298

V = 0.128 L

Learn more about ideal gas equation, here:

brainly.com/question/3637553

#SPJ1

help asap 100pts -

What mass of H2 is needed to react with 8.75 g of O2 according to the following equation:
O2(g) + 4H2(g) → 2H2O(g)?

O 0.547 g H₂
O 2.21 g H₂
O 4.38 g H₂
O 17.5 g H₂

Answers

To solve this problem, we need to use stoichiometry and the balanced equation for the reaction. From the balanced equation, we see that 4 moles of H2 are required to react with 1 mole of O2 to produce 2 moles of H2O.

1 mole O2 = 32 g O2

8.75 g O2 = 8.75 g / 32 g/mol = 0.2734 moles O2

Using the stoichiometry of the balanced equation, we can determine the moles of H2 needed to react with the given moles of O2:

0.2734 moles O2 × 4 moles H2 / 1 mole O2 = 1.0936 moles H2

Finally, we can convert the moles of H2 to grams using the molar mass of H2:

1.0936 moles H2 × 2 g/mol H2 = 2.1872 g H2

Therefore, the mass of H2 needed to react with 8.75 g of O2 is approximately 2.19 g H2 (to two significant figures).

So, the closest option is O 2.21 g H₂.

The decomposition of cyclohexane to benzene and Martialism is a high mass transfer limited period on the planet. The reaction will be carried out in a tubular reactor with an internal diameter of 5 cm and a length of 20 m; the pipes are filled with cylindrical pellets 0.5 cm in diameter and 0.5 cm in length. The pellets are only covered with the outer surface coating. The filled bed porosity is 40%. The inlet flow rate is 60 dm3/min.

Plot the tubular length vs. conversion graph when the inlet gas stream contains 5% cyclohexane and 95% hydrogen at 2 atm and 500°C. What would be the required tubular length for 99.9% conversion?


For cyclohexane diffusion in hydrogen, use the Fuller, Schettler, and Giddings Correlation given below.

The decomposition of cyclohexane to benzene and Martialism is a high mass transfer limited period on

Answers

The required tubular length for 99.9% conversion is 116.84 meters.

On Earth, the rate at which cyclohexane reacts with benzene and methylcyclopentane is constrained by high mass transfer.

A tubular reactor with an internal diameter of 5 cm and a length of 20 m will be used to conduct the reaction, and cylindrical pellets with dimensions of 0.5 cm in diameter and 0.5 cm in length will be placed within the reactor's pipes.

Only the exterior surface of the pellets are coated.

The packed bed has a 40% porosity and a 60 dm3/min intake flow rate.

When the intake gas stream includes 5% cyclohexane and 95% hydrogen at 2 atm and 500°C, the tubular length vs. conversion graph should be drawn.

The graph may be used to identify the minimum length of tube necessary for 99.9% conversion.

For cyclohexane diffusion in hydrogen, the Fuller, Schettler, and Giddings Correlation is as follows:

a = 0.8854,

b = 1.764102,

C = 6.0231023.

The tube length vs. conversion graph may be displayed at 2 atm and 500°C when the incoming gas stream includes 5% cyclohexane and 95% hydrogen.

The following equation may be used to determine the rate of reaction:

ra=2.31011 exp[-88580/RT]C_A(1X)/3

The mole balancing equation for an isothermal tubular reactor is given as

dX/dL = -ra/C A,

where X is the conversion and L is the length.

To determine the length of the tubular reactor needed for a specific conversion X, we can integrate the aforementioned equation from X = 0 to X = X.

We must numerically calculate the following equation to obtain the necessary tube length for 99.9% conversion:

∫0.999L0−ra/CA 

dL=0.999XEq L 

for X=0.999

After rearranging the equation above, we get:

0.999L0ra/CA

dL=XX Eq

The aforementioned equation is integrated to give us

L = 116.84 m.

Therefore, the required tubular length for 99.9% conversion is 116.84 meters.

For such more questions on length

https://brainly.com/question/13253944

#SPJ8

Give two industrial uses of water​

Answers

Answer:

Explanation:

i) in keeping industrial machine cool

ii) in textile inustries for dying clothes

g The atomic mass of an element is equal to ________. The atomic mass of an element is equal to ________. its mass number one-twelfth of the mass of a carbon-12 atom a weighted average mass of all of the naturally occurring isotopes of the element its atomic number the average mass of all of the naturally occurring isotopes of the element

Answers

Answer:

Total numbe of protons and neutrons in a single atom of that element

Explanation:

Hello,

I'll answer the question by filling in the blank spaces

"The atomic mass of an element is equal to the total number of proton and neutron in a particular atom of the element. The atomic mass of an element is equal to the atomic weight. Its mass number one-twelfth of the mass of carbon-12 atom a weighted mass of all naturally occurring isotopes of the elements. Its atomic mass is the average mass of all the naturally occurring isotopes of the element."

The atomic mass of an element is the total number of protons and neutrons in a single atom of that element.

The atomic mass of an element is equal to a weighted average mass of all of the naturally occurring isotopes of the element. The correct answer is option 2.

Isotopes are elements with the same number of protons (atomic number) but differing numbers of neutrons (mass number).

Most elements exist in nature as a mixture of isotopes, each with a different mass number and abundance. The atomic mass of an element is computed by adding the masses of all isotopes, multiplying by their relative abundance, and dividing by the total abundance of all isotopes.

This gives a weighted average mass that corresponds to the normal mass of an element's atom in nature.

Therefore, the correct answer is option 2. to a weighted average mass of all of the naturally occurring isotopes of the element.

Learn more about isotopes here:

https://brainly.com/question/27475737

#SPJ6

In order to understand how digestion of nutrients occurs, or how nutrients are used to provide cellular energy, it is necessary to understand
Multiple Choice

anatomy
radioactivity
chemistry
cytology

Answers

In order to understand how digestion of nutrients occurs, or how nutrients are used to provide cellular energy, it is necessary to understand C. chemistry.

What is chemistry ?

Chemistry is the branch of science that deals with the composition, properties, and interactions of matter. In the context of digestion and cellular energy, chemistry is essential because it provides the foundation for understanding the chemical reactions that occur within the body.

For example, the digestion of nutrients involves the breakdown of complex molecules such as carbohydrates, proteins, and fats into simpler molecules that can be absorbed and utilized by the body.

Find out more on chemistry at https://brainly.com/question/2460378

#SPJ1

A group of students is investigating how a force applied to an object affects the motion of that object. The diagram shows the setup for the investigation. To create a force, the students add a weight to the weight holder and observe whether the cart moves. The students repeat this step five times, using a different amount of weight each time. Identify the independent and dependent variables of this investigation.

Answers

Answer:

87 is the wight of the hight

Explanation:

What is the molar concentration of Zn2+ ions in a solution, if the electrode potential value is 59mV less than the standard electrode potential value at 298 K?

Answers

Molar concentration of Zn2+ions in a solution is 3.481 mol/lit

The electrode potential value is 59mV

Temperature=298k

What is electrode potential?

It is a force of galvanic cell. basically it is the difference between an electrolyte and electrode.

equation formed- Zn → Zn2+ + 2e

              from Nernst equation-

E=E cell - 0.059 log [Zn2+]

[zn2+]=3.481 mol/lit

hence, Molar concentration of Zn2+ions in a solution is 3.481 mol/lit

Learn more about electrode potential here:

https://brainly.com/question/15417662

#SPJ10

The sp of strontium carbonate, SrCO3, is 5.60×10−10 . Calculate the solubility of this compound in g/L.

Answers

Answer:

3.50 × 10⁻³ g/L

Explanation:

Step 1: Make an ICE chart for the solution of SrCO₃

"S" represents the molar solubility.

         SrCO₃(s) ⇄ Sr²⁺(aq) + CO₃²⁻(aq)

I                             0               0

C                           +S              +S

E                             S               S

The solubility product constant (Ksp) is:

Ksp = [Sr²⁺] [CO₃²⁻] = S²

S = √Ksp = √5.60 × 10⁻¹⁰ = 2.37 × 10⁻⁵ M

Step 2: Convert "S" to g/L

The molar mass of SrCO₃ is 147.63 g/mol.

2.37 × 10⁻⁵ mol/L × 147.63 g/mol = 3.50 × 10⁻³ g/L

you
12. Choose one famous MLK quote as
Favorite and explain why that is your
favorite?

Answers

“I have a dream”
One of MLK’s famous quotes, he says this while fantasizing of a reality where apartheid did not exist. He had a dream, and because he did, we could all too.

What is t in Cell 3, 7 and 5, 8 with the correct units?

Answers

A healthy T cell count is defined as 500–1,600 T cells per cubic millimeter of blood (cells/mm3), according to HIV.gov.

What is t in Cell 3, 7 and 5, 8 with the correct units?

In cell C1, enter a number, such as 5. Then type another number, such as 3, in D1. To begin the formula, enter an equal sign (=) in cell E1. Type C1+D1 after the equal sign.

The cell-permeant Cell Event TM Caspase-3/7 Green Detection Reagent is a four-amino acid peptide (DEVD) coupled to a nucleic acid-binding dye. The proteins caspase-3 and caspase-7 are active during apoptosis and are able to break the DEVD peptide's caspase 3/7 recognition sequence.

Learn more about  T cell,

https://brainly.com/question/27459085

#SPJ1

What is the pH of a 0.0046 M nitric acid solution

Answers

Answer: 2.34

Explanation:

pH= -log (H+)

H+ is the acid's M

pH= -log (0.0046) =2.34

An element has 2 stable isotopes. One has 13 amu and 1.07% abundant . The second has 12 amu and 98.93% abundant. What is the average atomic mass of the element

Answers

The average atomic mass of the element is 12.0107 amu.

To calculate the average atomic mass of the element in question, we can use the following formula:

average atomic mass = (mass of isotope 1 x abundance of isotope 1) + (mass of isotope 2 x abundance of isotope 2)

where "mass of isotope 1" is the mass of the first stable isotope (13 amu in this case), "abundance of isotope 1" is the percentage of that isotope in the element (1.07% in this case), "mass of isotope 2" is the mass of the second stable isotope (12 amu in this case), and "abundance of isotope 2" is the percentage of that isotope in the element (98.93% in this case).

Substituting the given values in the formula, we get:

average atomic mass = (13 amu x 1.07%) + (12 amu x 98.93%)

average atomic mass = (0.1391 amu) + (11.8716 amu)

average atomic mass = 12.0107 amu

Therefore, the average atomic mass of the element is 12.0107 amu.

This means that on average, one atom of this element weighs 12.0107 atomic mass units (amu), which is slightly heavier than the most abundant isotope (12 amu) due to the presence of the less abundant isotope (13 amu). This concept is important in chemistry because the mass of atoms plays a crucial role in determining their chemical and physical properties. The knowledge of the average atomic mass of an element is important in a wide range of applications, including analytical chemistry, geochemistry, and nuclear physics.

Know  more about atomic mass here:

https://brainly.com/question/3187640

#SPJ11

145 mL of 0.108 M HNO3 is needed to neutralize 237 mL of RbOH of what concentration?

Answers

0.6 is probably the correct answer

With the given chemical compounds, what is the balanced chemical equation when lit with fire?

With the given chemical compounds, what is the balanced chemical equation when lit with fire?

Answers

Answer:

Russia es el mejor pais? Vladimir Putin, es el mejor presidente del mundo

134 grams of nitric acid is added to 512 grams of water. Calculate the molality of nitric acid.

Answers

Answer:   4.15234 m

512 g H2O * \(\frac{1 kg}{1000 g}\) = 0.512 kg H2O

Nitric Acid:  HNO3 = 1.008 + 14.007 + 3(15.999) = 63.012 g/mol

H = 1.008 g/mol

N = 14.007 g/mol

O3 = 3*15.999

134 g HNO₃ * \(\frac{mol}{63.012 g}\) = 2.126 mol

m = \(\frac{2.126 mol}{0.512 kg}\) = 4.15234 m

134 grams of nitric acid is added to 512 grams of water. Calculate the molality of nitric acid.

Answer:

0.004 m

Explanation:

Given data:

Mass of nitric acid = 132 g

Mass of water = 512 g

Molality of nitric acid = ?

Solution:

Formula:

Molality = number of moles of solute / mass of solvent in Kg

Number of moles of nitric acid:

Number of moles = mass/molar mass

Number of moles = 132 g/ 63.01 g/mol

Number of moles = 2.09 mol

Molality:

m = 2.09 mol / 512 Kg

m = 0.004 m

Please no links. Answer properly please and thank you. Perform the following mathematical operation and report the answer to the correct number of significant figures. 0.092/8.3

Please no links. Answer properly please and thank you. Perform the following mathematical operation and

Answers

i'm extremely sorry if this is wrong but i got 0.0110843 or as a fraction 23/2075 i'll write my work in the comments

The result of the mathematical operation 0.092 divided by 8.3 is 0.0111 (rounded to four significant figures).

When performing division, it is important to consider the significant figures in the numbers being divided. In this case, 0.092 has two significant figures, and 8.3 has two significant figures as well.

To determine the number of significant figures in the result, we look at the number with the least number of significant figures, which is 8.3 with two significant figures. Therefore, the result should be reported with the same number of significant figures.

Performing the division, we get 0.01108433735. However, since we need to round the answer to two significant figures, the final result is 0.0111.

To learn more about  mathematical operation  here

https://brainly.com/question/29635854

#SPJ2

Which of the statements below about buoyancy is true?
A.if the buoyant force is greater than the force of gravity,the object will sink
B.buoyancy is a force that acts on objects that are placed in a fluid
C.all objects that experience the force of buoyancy float
D.buoyancy pushes objects down in the same direction as gravity

(answer asap plz I will give brainliest to who helps me )​

Answers

Buoyancy is a force that acts on objects that are placed in a fluid is the correct answer
Let me know if I agit it!

Answer:

it's A. if the force of gravity is greater than the buoyant force, the object will sink.

Explanation:

just took the quiz on a p e x

PNS
Chemoto
P to explain the how density Can
Conversion factor
lobject
95
Convert
of 와
the
be used
the volume
of
object, and
and vise
to
mass​

Answers

Answer:

uhhhh rephrase that please lol

you would expect human red cells to shrink in which of the following solutions: 0.2m nacl 0.2m surcrose 0.2m urea

Answers

You would expect human red cells to shrink in  0.2 M NaCl. The correct answer is A.

Red blood cells have an ion concentration of roughly 300mM, or 300 milliosmolality. Essentially, it indicates that the concentration of all the dissolved ions in a red blood cell is roughly 300 mM, or 0.3M.

Where there is a higher concentration of water, it moves toward a lower concentration. Water flows from lower osmolarity to higher osmolarity, or put another way (since water is higher in concentration in a lower osmolarity solution).

Since a solution of 0.2M NaCl has an osmolarity of 0.4M, the water concentration in red blood cells is higher. This implies that the red blood cell will shrink and shrivel when water flows OUT of it.

Urea 0.2M is a dissolved solute even though it is not ionic. Water will somewhat enter the red blood cell since it is less concentrated than the red blood cell. (assumes red blood cells with 0.3M osmolarity).

In a hypotonic condition, a red blood cell will enlarge and go through hemolysis (burst). A red blood cell will crenate and lose water when it is placed in a hypertonic solution (shrivel). Animal cells typically function best in an isotonic environment, in which the rate of water flow into and out of the cell is equal.

Learn more about red cell at https://brainly.com/question/22018705

#SPJ4

How do I become Walter White?!?!?​

Answers

First get a degree in chemistry,
Have a student named Jesse that failed
Past forward a bunch of time
Find Jesse again
Get an even
Then get all the materials to make drugs
Drive out to the middle of nowhere
Start cooking
Also have cancer, a person to sell the drugs too, a wife, a disabled son, be an alcoholic, smoke, be smart.
plastic surgery and dna transfer
Other Questions
what's you're favorite snack??? Strategic offensives should be based ona) the creation of high profits and the reduction of costs.b) satisfying employees and creating a stable work environment in order to increase long-term profits and reduce turnover.c) sizing up an organization's internal and external situation.d) those areas of strength where the company has its greatest competitive advantage over targeted rivals.e) implementing and executing chosen strategy efficiently and effectively. L33. Solve 41x - 7 + 12 = 28Solution(s). klingon widgets, incorporated, purchased new cloaking machinery five years ago for $15 million. the machinery can be sold to the romulans today for $14.3 million. klingons current balance sheet shows net fixed assets of $12 million, current liabilities of $840,000, and net working capital of $223,000. if the current assets and current liabilities were liquidated today, the company would receive a total of $1.05 million cash. There are seven people fishing at Lake Connor three have fishing license and four do not an inspector chooses to do two of the people are random what is the probability that the first person chosen does not have a license and the second one does which is in the hunders place 742.891 The following rates are quoted for euro in terms of US dollar ($) and C$ in terms of $ in New York: $/ = $1.1520 $/C$= $0.7520 (a) What are the (implied) quote for $ in terms of euro (i.e., /$) and for $ in terms of C$ (C$/$) in the above rates? (b) What is the cross rate for C$ in terms of (/C$) implied in the above rates? Which upcoming sequel will digitally de-age harrison ford for portions of the film?. Read the excerpt from The Odyssey.Said Odysseus:"Run then, while I hold them off with arrowsas long as the arrows last. When all are goneif I'm alone they can dislodge me."Based upon this excerpt, which trait has Odysseus learned as part of his transformation? because financial reports can be complex and use technical language, many financial reports today lack____ Many people experience hunger pangs at the sight of McDonald's golden arches. In the context of classical conditioning, the golden arches are a(n) ________ and the hunger pangs on seeing the arches are a(n) ________. Carbon dioxide is given off when gas, oil, and coal are burned.TrueFalse Nonverbal communication often happens without our control and knowledge; when this betrays our internal feelings, it is called ______.a. adageb. leakagec. prestiged. vantage Find the area of the figures. Identify the type of reaction:KBr + AgNO3 AgBr + KNO3Single ReplacementSynthesisDecompositionDouble Replacement A registered representative suggests and then implements a strategy in a client's portfolio. This strategy involves the RR coming up with certain determinations in relation to an appropriate distribution of investments in the client's account and the maintenance of this mix of investments over time. Which of the following most accurately describes the strategy that has been implemented? (A)The RR is using only a technical analysis approach to allocation. (B)The RR is using capital asset pricing model to determine allocation. (C)The RR is using a form of asset allocation for the client. (D)The RR is using a strategy purely focused on diversification for the client. in 1960 the population of Indonesia was 88 million. in 2010 the population of Indonesia was 242 million. *calculate the percentage increase from 1960 to 2010? *estimate the population in 2060 if the rate of increase doesn't change 20 points Use Pythagoras' theorem to work out theheight of the equilateral triangle below.Give your answer in centimetres(cm) Outdoor advertising on federally subsidized highways and interstates in the united states is legislated by the____ environmental protection law of 1955 federal trade commission act of 1934 federal communications controls act of 1971 highway beautification act of 1965 warren/magnuson highway act of 1986 for bonds issued at a discount or at a premium to face value, in each successive entry to recognize interest expense select one: a. both the discount and the premium amortizations will be lower b. the discount amortization will be lower and the premium amortization will be higher c. the discount amortization will be higher and the premium amortization will be lower d. both the discount and the premium amortizations will be higher