IDEAL GAS LAW
PV = nRT
lentify each variable. Use a "?" for the unknown.
nvert units as needed to match the ideal gas law constant (R). Solve.
P=
1=
1=
R=
|=
000
.0821 atm L
mol. K
At what temperature (in K)
will 6.5 moles of gas
occupy 1.7 L at 1.3 atm?
Answer
TYPE
2 pts
Teameark Tool

IDEAL GAS LAWPV = NRTlentify Each Variable. Use A "?" For The Unknown.nvert Units As Needed To Match

Answers

Answer 1

6.5 moles of gas occupy 1.7 L at 1.3 atm at a temperature of 4.17K.

Ideal gas law is as follows:

PV = nRT

where,

P = Pressure = 1.3 atm

V = Volume = 1.7 L

n = No. of moles = 6.5 moles

R = gas constant = 0.0821 atm L / (mol K)

T = Temperature =?

Substituting the values in the ideal gas law equation to find the temperature, we get,

PV = nRT

1.3 * 1.7 = 6.5 * 0.0821 * T

2.21 = 0.53 * T

∴ T = 2.21/0.53

T = 4.17 K

At temperature 4.17K, 6.5 moles of gas occupy 1.7 L at 1.3 atm.

To learn more about ideal gas law,

brainly.com/question/13821925


Related Questions

NO + H2-> N2 + H2O
Balance equation?

Answers

Answer:

2NO + 4H-> N2 + 2 H2O

Explanation:

Both sides must be equal. :)

How many atoms of germanium are in 1.65 moles ge

Answers

Answer: The number of atoms in 1.65 moles of  Germanium is 9.9433 * 10^23 atoms of Ge.

Explanation:

The number of atoms or molecules in one mole of a substance, is 6.022 * 10^23 which is Avogadro's number.

1 mole of Ge = 6.022 * 10^23 atoms of Ge.

1.65 moles of Ge =1.65*6.022*10^23 atoms of Ge .

Therefore, The number of atoms in 1.65 moles of  Germanium is 9.9433 * 10^23 atoms of Ge.

To learn more about the number of atoms of ge in 1.65 moles.

https://brainly.com/question/28029386

how many grams of Fe are produced from 92.5g of FeO given the following reaction

Answers

The mass(in grams) of iron, Fe produced from the 92.5g of iron (ii) oxide, FeO is 71.9 grams

How do i determine the mass of Fe produced?

The mass of Fe produced from the 92.5g of iron (ii) oxide, FeO can be obtained as follow:

2FeO → 2Fe + O₂

Molar mass of FeO = 71.85 g/molMass of NH₃ from the balanced equation = 2 × 71.85 = 143.7 g Molar mass of Fe = 55.85 g/molMass of Fe from the balanced equation = 2 × 55.85 = 111.7 g

From the balanced equation above,

143.7 g of FeO reacted to produce 111.7 g of Fe

Therefore,

92.5 g of Fe will react to produce = (92.5 × 111.7) / 143.7 = 71.9 g of Fe

Thus, the mass of Fe produced from the reaction is 71.9 grams

Learn more about mass produced:

https://brainly.com/question/9526265

#SPJ1

Complete question:

How many grams of Fe are produced from 92.5 g of FeO given the following reaction 2FeO → 2Fe + O₂

What are the outcomes of the ice cap melting? Choose all that apply.


1. Light cannot be reflected back to the atmosphere


2. Sea level rises


3. Absorption of solar radiation leads to increase in ocean temperature


4. Ocean remains unaffected

Answers

Answer:

2. sea level rises sorry if it's wrong

Exit ticket question for Chemistry.

Exit ticket question for Chemistry.

Answers

Answer:

Explanation:

uhhhhhhh i dont know look it up

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Which letter represents the reactants in this reaction?
Which letter represents the products in this reaction?
Which letter represents the activated complex (transition state) in this reaction?
Which letter represents the activation energy in this reaction?
Is this reaction endothermic or exothermic?

Which letter represents the reactants in this reaction?Which letter represents the products in this reaction?Which

Answers

Reactants are the initial substances in a reaction that go through a chemical transformation to create a product.

Thus, Only in the presence of favourable conditions will reactants undergo chemical reactions. Many reactions occur during the cooking of gumbo, but I'll focus on one of the first ones to highlight a favourable circumstance: the caramelization of onions.

Our taste senses cannot perceive the big sug1ar molecules found in raw onions. To release the sweet flavour of onions, these big sugars must be heated to break down into smaller reactants.

The pyrolysis of sugars is the technical term for this procedure. The ideal circumstance necessary for onions to caramelize is products.

Thus, Reactants are the initial substances in a reaction that go through a chemical transformation to create a product.

Learn more about Products, refer to the link:

https://brainly.com/question/31859289

#SPJ1

Which animal is a primary consumer?
brown lemming
short tailed weasel
snowy owl
lichen

Which animal is a primary consumer?brown lemmingshort tailed weasel snowy owllichen

Answers

Snowy Owl i Think  or weasel

Zoe left her water bottle capped and in her bedroom. She came back some time later to realize that the bottle was “sweating” and left a ring of liquid on her nightstand


Explain thoroughly the science behind why Zoe’s water bottle is sweating

Answers

Answer:

Condensation

Explanation:

Zoe is quite keen to have noticed what we call condensation. Air contains many components, one of those being water vapor. Like how sugar is soluble in water, water can be said to be "soluble" in air. Water will evaporate into the air to a certain extent. The higher the temperature of the air, the more water the air can hold. If the air has more water that it can hold (potentially because of a temperature decrease), the extra water will come out of the air. Zoe's water bottle was cold, and because the air around Zoe's bottle had cooled down, the air can not hold as much water as it could when it was warm, so the air deposited the extra water in the form of liquid water onto the bottle, giving the illusion that her bottle was sweating.

Strontium-90, a radioactive isotope with applications in medicine, has a half-life of approximately 30 years. Out of a 100-gram sample, approximately how much remains after 170 years? 2 grams 8 grams 17 grams 81 grams

Answers

There are 2 grams remain

Further explanation

Given

t1/2 = 30 years

t = 170 years

No = 100 g

Required

Remaining sample

Solution

General formulas used in decay:  

\(\large{\boxed{\bold{N_t=N_0(\dfrac{1}{2})^{t/t\frac{1}{2} }}}\)

Input the value :

\(\tt Nt=100.\dfrac{1}{2}^{170/30}\\\\Nt=1.969\approx 2~grams\)

How did the discovery of radioactive decay invalidate many of the early models

Answers

When the radioactive decay happens it puts off heat, the hear wasn’t accounted for

Suppose you work at a theme park. Your supervisor wants you to make a sign displaying the maximum weight that a roller coaster train can carry. Your supervisor knows that the maximum weight is 1686.5 kg. However, he wants the sign to be quickly understood and tells you to make a sign that says: Maximum Weight 1700 kg. How could the lack of precision in this example cause problems?

Answers

Answer:

amusement parks. Each day, we flock by the millions to the nearest park, paying a sizable hunk of money to wait in long lines for a short 60-second ride on our favorite roller coaster. The thought prompts one to consider what is it about a roller coaster ride that provides such widespread excitement among so many of us and such dreadful fear in the rest? Is our excitement about coasters due to their high speeds? Absolutely not! In fact, it would be foolish to spend so much time and money to ride a selection of roller coasters if it were for reasons of speed. It is more than likely that most of us sustain higher speeds on our ride along the interstate highway on the way to the amusement park than we do once we enter the park. The thrill of roller coasters is not due to their speed, but rather due to their accelerations and to the feelings of weightlessness and weightiness that they produce. Roller coasters thrill us because of their ability to accelerate us downward one moment and upwards the next; leftwards one moment and rightwards the next. Roller coasters are about acceleration; that's what makes them thrilling. And in this part of Lesson 2, we will focus on the centripetal acceleration experienced by riders within the circular-shaped sections of a roller coaster track. These sections include the clothoid loops (that we will approximate as a circle), the sharp 180-degree banked turns, and the small dips and hills found along otherwise straight sections of the track.

Answer: well, for starters the maximum weight of the cart does say 1686.5kg n u decided to raise the weight by les jus say 14 kg, well that extra 14 kg might be the reason the whole cart accidently tips when it makes a sharp turn, n that's what well cause a problem

Explanation: im n k12 2 so i should know

Question 2
The volume of a gas-filled balloon is 20.0 L at 60 atm pressure. What volume in liters will the balloon have at 30 atm?

Question 3
8.00 L of gas at standard temperature and pressure (STP) is compressed to 3 L. What is the new pressure of the gas in atm?

Question 4
If a tennis ball has a pressure of 200 atm at a temperature of 27oC, what pressure in atm will the tennis ball have if the temperature of the gas increased to 77oC?


Question 5
Exactly 5.00 L of air at -23oC is warmed to 27o What is the new volume in liters if the pressure remains constant?


Question 6
The temperature inside my refrigerator is about 40 If I place a balloon in my fridge that initially has a temperature of 220 C and a volume of 0.5 liters, what will be the volume of the balloon in liters when it is fully cooled by my refrigerator?


Question 7
Some students believe that teachers are full of hot air. If I inhale 2.2 liters of gas at a temperature of 180 C and it heats to a temperature of 380 C in my lungs, what is the new volume of the gas in liters?


Question 8
Today, I forgot my soda in the trunk of my car. The initial pressure is 3 atm and it was a cool morning, at 15o By the afternoon, however, the temperature rose to 25oC. What is the pressure in atm inside the can?


please help me, im failing all my classes and really need some help with this. if i could give more than 100 i would

Answers

These questions all involve special cases of the ideal gas law, namely Boyle's, Charles', and Gay-Lussac's Laws. The ideal gas law relates together the absolute pressure (P), volume (V), the absolute temperature (T), and number of moles (n) of a gas by the following:

PV = nRT

where R is the universal gas constant.

The special cases of the ideal gas law are obtained by holding constant all but two of the variables of a gas.

Boyle's Law relates the pressure and volume of a given mass of gas at a constant temperature: PV = k or P₁V₁ = P₂V₂.

Charles' Law relates the volume and temperature of a given mass of gas at a constant pressure: V/T = k or V₁/T₁ = V₂/T₂.

Gay-Lussac's Law relates the pressure and temperature of a given mass of gas at a constant volume: P/T = k or P₁/T₁ = P₂/T₂.

Depending on what we're given and instructed to find in each question, we can figure out which law to use.

---

Question 2:

We are given the volume of a gas at some pressure, and we're to find the new volume of the gas at a different pressure. Here, we use Boyle's Law: P₁V₁ = P₂V₂ where P₁ = 60 atm, V₁ = 20.0 L, and P₂ = 30 atm. We want to find V₂, which we can determine by rearranging the equation into the form V₂ = P₁V₁/P₂. Note that pressure and volume are inversely related according to Boyle's Law; since we're decreasing the pressure, the new volume of the gas should be greater than the initial volume of 20.0 L.

V₂ = (60 atm)(20.0 L)/(30.0 atm) = 40.0 L.

So, at 30 atm, the balloon will have a volume of 40.0 L.

---

Question 3:

This is another Boyle's Law question. The standard pressure (our initial pressure) is 1 atm. Here, we are decreasing the volume of the gas, and we want to find the new pressure; the pressure of the gas should thus increase proportionally (the pressure will be greater than 1 atm). Rearranging Boyle's Law to solve for P₂, we get P₂ = P₁V₁/V₂.

P₂ = (1 atm)(8.00 L)/(3 L) = 2.67 atm.

So, the new pressure of the gas is 2.67 atm (or 3 atm if we're considering V₂ to comprise one significant figure).

---

Question 4:

Here, we are increasing the temperature of a gas at a known pressure, and we want to determine what the new pressure will be. This is a Gay-Lussac's Law question; from the law, we see that pressure and temperature are directly proportional. Since we're increasing the temperature of the gas, we should expect the pressure of the gas to be greater than the initial 200 atm. Gay-Lussac's Law rearranged to solve for P₂ gives us P₂ = P₁T₂/T₁. When working with gas laws, temperatures must be in Kelvin (°C + 273.15 = K). So, T₁ = 300.15 K, T₂ = 350.15 K, and P₁ = 200 atm.

P₂ = (200 atm)(350.15 K)/(300.15 K) = 233 atm.

So, if the temperature is increased from 27 to 77 °C, the pressure of the gas in the tennis ball will be 233 atm. Here, it's ambiguous how many sig figs to use; if we use one sig fig per P₁, then our P₂ would equal P₁, which I think would be an absurd for a question to ask for. I would stick with either 233 atm or 230 atm (following the two sig figs of the temperatures), or you may go with however you've been instructed.

---

Question 5:

This is a Charles' Law question; we're looking for the new volume of a gas when the temperature of the gas is increased. As was the case in Gay-Lussac's Law, the two parameters in Charles' Law—volume and temperature—are directly proportional. Since the temperature of the gas is increased, we should expect the new volume of the gas to also increase (V₂ will be greater than 5.00 L). Temperatures should be in Kelvin.

V₂ = V₁T₂/T₁ = (5.00 L)(300.15 K)/(250.15 K) = 5.99 L.

---

Question 6:

Another Charles' Law question. As with question 5, we want to find the new volume of the gas after a change in temperature. This time, the final temperature is lower than the initial temperature, so we should expect that V₂ will be less than the initial 0.5 L. Again, temperatures in Kelvin.

V₂ = V₁T₂/T₁ = (0.5 L)(313.15 K)/(493.15 K) = 0.317 L.

So, the volume of the balloon when it is fully cooled by your refrigerator will be 0.317 L.

---

Question 7:

This is yet another Charles' Law question, and, again, we are solving for V₂ after a change in temperature. Since the final temperature is greater than the initial temperature, V₂ should be greater than 2.2 L. Again, the temperatures should be in Kelvin.

V₂ = V₁T₂/T₁ = (2.2 L)(653.15 K)/(453.15 K) = 3.17 L.

The new volume of the gas is 3.17 L ≈ 3.2 L (two sig figs).

---

Question 8:

We return to Gay-Lussac's Law here; pressure and temperature are directly proportional, and the temperature of the gas is increased. Thus, P₂ should be greater than 3 atm. Again, remember that temperatures must be in Kelvin.

P₂ = P₁T₂/T₁ = (3 atm)(298.15 K)/(288.15 K) = 3.1 atm.

So, the pressure inside the can after the temperature rise is 3.1 atm. Not a big increase, but an increase nonetheless.

how would you classify the material gallium phosphide? how would you classify the material gallium phosphide? (a) metal (b) ceramic (c) semiconductor a composite of a

Answers

The material gallium phosphides is a wide bandgap semiconductor. Option c is the correct answer.

In this instance, only the absorption of photons with energy hv close to the bandgap W is capable of causing the transition from the maximum of the valence band to the minimum of the conductive band.

The atomic semiconductors Si and Ge are two of the indirect materials that have been investigated the most. Since both of these materials contain indirect band gaps, an indirect exciton is the lowest energy electronic state.

A wide bandgap semiconductor with a cubic crystal structure and an indirect bandgap structure, gallium phosphonide (by crystallisation) has an indirect band gap of 2.24 eV at ambient temperature.

To know more about the gallium phosphides, here

brainly.com/question/13032253

#SPJ4

--The complete question is, How would you classify the material gallium phosphide? (a) metal (b) ceramic (c) semiconductor--

What physical property is characteristic of all of the elements in the group located in the rightmost column of the periodic table?

Answers

gas state at room temperature.

The physical property that is characteristic of all of the elements in the group located in the rightmost column of the periodic table is the gaseous state at room temperature.

What are Physical properties?

Physical properties may be defined as those properties of matter that do not involves any chemical manifestation or appearance within the element. These properties are measurable and state the alteration between momentary states. Some examples of physical properties are as follows:

Physical appearance or color.Hardness of elementDensity.Melting and boiling points.Electrical conductivity.

The groups located in the rightmost column of the periodic table are known as the halogens and the noble gases. These elements are typically gaseous in phase at room temperature. Apart from this, halogens also have high electronegativities because these elements have seven electrons in their valence electrons.

Therefore, the gaseous state at room temperature is the physical property that is characteristic of all of the elements in the group located in the rightmost column of the periodic table.

To learn more about the Modern periodic table, refer to the link:

https://brainly.com/question/15987580

#SPJ6

What is the energy of an X-ray with a frequency of 6.35 x 108 Hz?


Answers

Answer:

3x10 16hz 16 small above 10

Explanation:the frequency of any wave is (wave speed)/(wavelength)

The speed of light is 3x10 m/s. that's 30 million quartz

-Convert 6.02 x 1020 formula units of MgCl₂ to mol of MgCl₂:​

Answers

6.02 x \(10^{20\) formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

To convert formula units of MgCl₂ to moles of MgCl₂, we need to use Avogadro's number, which relates the number of formula units to the number of moles.

Avogadro's number (NA) is approximately 6.022 x 10^23 formula units per mole.

Given that we have 6.02 x 10^20 formula units of MgCl₂, we can set up a conversion factor to convert to moles:

(6.02 x 10^20 formula units MgCl₂) * (1 mol MgCl₂ / (6.022 x 10^23 formula units MgCl₂))

The formula units of MgCl₂ cancel out, and we are left with moles of MgCl₂:

(6.02 x 10^20) * (1 mol / 6.022 x 10^23) = 0.1 mol

Therefore, 6.02 x 10^20 formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

It's important to note that this conversion assumes that each formula unit of MgCl₂ represents one mole of MgCl₂. This is based on the stoichiometry of the compound, where there is one mole of MgCl₂ for every one formula unit.

Additionally, this conversion is valid for any substance, not just MgCl₂, as long as you know the value of Avogadro's number and the number of formula units or particles you have.

For more such questions on MgCl₂ visit:

https://brainly.com/question/26311875

#SPJ8

C c Why did they work an average brightness for each length of graphite tested?​

Answers

An average brightness was calculated for each length of graphite tested to get a better understanding of the relationship between the length of the graphite and the brightness of the line it produced.

What is the use of graphite?

Graphite has many uses in various industries. Some of its uses include: Pencils, Lubricants, Refractories, Batteries, Electrodes, Nuclear reactors, Aerospace industry.

By calculating the average, it is possible to see if there is a trend in the data and if longer or shorter lengths of graphite produce brighter or duller lines. This information can be useful in determining the best length of graphite to use for a particular task or project.

Find out more on graphite here: https://brainly.com/question/27860158

#SPJ1

determine the number of grams of carbon 3.14x 1023 atoms of carbon

Answers

Answer:

6.26 g C

General Formulas and Concepts:

Math

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Chemistry

Atomic Structure

Reading a Periodic TableMolesAvogadro's Number - 6.022 × 10²³ atoms, molecules, formula units, etc.

Stoichiometry

Using Dimensional AnalysisExplanation:

Step 1: Define

[Given] 3.14 × 10²³ atoms C

[Solve] grams C

Step 2: Identify Conversions

Avogadro's Number

[PT] Molar Mass of C - 12.01 g/mol

Step 3: Convert

[DA] Set up:                                                                                                      \(\displaystyle 3.14 \cdot 10^{23} \ atoms \ C(\frac{1 \ mol \ C}{6.022 \cdot 10^{23} \ atoms \ C})(\frac{12.01 \ g \ C}{1 \ mol \ C})\)[DA] Multiply/Divide [Cancel out units]:                                                         \(\displaystyle 6.26227 \ g \ C\)

Step 4: Check

Follow sig fig rules and round. We are given 3 sig figs.

6.26227 g C ≈ 6.26 g C

I think it would be 6.26 g

How many moles are in 45 g of HF

Answers

Answer:

2.25 mol

Explanation:

45 g HF x (1 mole HF/ 20.01 g)

20.01 comes from adding the molar mass of H and the molar mass of F

I just need the balanced redox equation for the cell using the oxidation and reduction half reactions. PLEASE AND ILL MARK BRAINLIEST!

I just need the balanced redox equation for the cell using the oxidation and reduction half reactions.

Answers

Answer: For the balanced redox equation, you should add the half reactions.

Like this.

Explanation:

Was it helpful? Or do you need different answer?

I just need the balanced redox equation for the cell using the oxidation and reduction half reactions.

How many grams of aluminium were used to prepare 20g of potassium alum if the percent yield was 81.5%?​

Answers

Answer: 16.3 g.

Explanation:

Because of increasing evidence of damage to the ozone layer, chlorofluorocarbon (CFC) production was banned in 1996. However, many older cars still have air conditioners that use CFC-12 (CF2Cl2). These air conditioners are recharged from stockpiled supplies of CFC-12. Suppose that 100 million automobiles each contain 1.0 kg of CFC-12 and leak 24 % of their CFC-12 into the atmosphere per year.

How much chlorine, in kg , is added to the atmosphere each year due to these air conditioners?

Answers

The mass of chlorine is 9.9 * 10^6 kg.

Total mass of CFC = M(CFC) * number of cars = 1.0 kg * 1.00 * 10^8

= 1.00 * 10^8 kg

Mass of the leaked CFC ;

% leaked = m(leaked) *100 / m(total)

m(leaked) = o.24 * 1.00 * 10^8 kg

m(leaked) = 2.4 * 10^6 kg

Now no. of moles of CFC:

n(CFC) = m(CFC) / MM(CFC) = 2.4 * 10^9 g / 170.92 g/mol = 0.014 * 10^9 mol

= 1.4 * 10^7 mol

No. of moles of chlorine ;

n(Cl) = n(CFC)*2

= 1.4  * 10^7 mol *2

= 2.8 * 10^7 mol

Now at last the mass of the chlorine :

m(Cl) = n(Cl) * MM(Cl)

= 2.8 * 10^7 mol * 35.453 g/mol

= 99.2 * 10^10 g

Mass of Cl = 9.9 * 10^6 Kg

To know more about chlorofluorocarbon (CFC) here :

https://brainly.com/question/14464840?referrer=searchResults

#SPJ1

Suppose a solution has a density of 1.87 g/mL. If a sample has a mass of 17.5 g the volume of the sample in mL is what?

Answers

The volume of the sample in mL is 9.36 mL.

We can use the formula:

Density = Mass/Volume

Rearranging the formula gives:

Volume = Mass/Density

Substituting the given values gives:

Volume = 17.5 g / 1.87 g/mL = 9.36 mL.

Write the acid-base reaction that occurs between HF and water . Identify the acid , base , conjugate acid, and conjugate base

Answers

The conjugate acid-base pairs are ( HF, F⁻) and ( H₂O, H₃O⁺ )

What is conjugate acid base pair?

A conjugate acid-base pair, as defined by Bronsted-Lowry, consists of two compounds that are distinct only in that they contain a proton (H⁺). The addition of a proton to a base results in the formation of a conjugate acid, while the removal of a proton from an acid result in the formation of a conjugate base.

The reaction becomes:

HF + H₂O → H₃O⁺ + F⁻

The conjugate acid-base pairs are ( HF, F⁻) and ( H₂O, H₃O⁺ )

Here,

F⁻ to HF is conjugate acid.H₃O⁺ to H₂O is conjugate base.HF to F⁻ is conjugate base.H₂O to H₃O⁺ is conjugate acid.

To know more about conjugate acid-base refer to:

https://brainly.com/question/22514615

#SPJ1

help ASAP 100 POINTS AND BRAINLEST IF CORRECT! Classification Activity Worksheet
Instructions: Read each myth (untruth). Reword it to make a factual statement. Then, give two to three reasons why the myth is untrue. Use complete sentences and support your answer with evidence, using your own words.

For example:
Myth: A dead organism is the same as a nonliving thing in science.
Fact: A dead organism is not the same as a nonliving thing in science.
Evidence: (You can find evidence in Lesson 5.03. Explain why this evidence supports the fact statement.)

Myth: A dead organism is the same as a nonliving thing in science.
Fact:
Evidence:


Myth: The Linnaeus system of classification will always stay the same.
Fact:
Evidence:


Myth: Tigers and goldfish are not related.
Fact:
Evidence:


Myth: An organism's kingdom only describes physical characteristics.
Fact:
Evidence:


Myth: Mammals and plants don't belong in the same domain.
Fact:
Evidence:

Your Turn
Come up with another myth about the classification of organisms. Then, give two to three reasons why the myth is untrue. Use complete sentences and support your answer with evidence, using your own words.

Your myth:
Fact:
Evidence:

Answers

As per questions,

Myth: A dead organism is the same as a non-living thing in science.

Fact: A dead organism is not the same as a non-living thing in science.

Evidence: A dead organism means that it was once alive, whereas a non-living thing has never been alive.

Myth: The Linnaeus system of classification will always stay the same.

Fact: The Linnaeus system of classification will pass on .

Evidence: Its new species are being found. Also, Carl Linnaeus came up with a sequential classification of living organism under different taxons namely Kingdom, phylum, class, order, family, genus and species.

Myth: Tigers and goldfish are not related.

Fact: Tigers and goldfish are related

Evidence: They fall into the same category of vertebrates, which means that both creatures have spines, and internal bone structure.

Myth: An organism's kingdom only describes physical characteristics.

Fact: An organism's kingdom not only describes physical characteristics.

Evidence: This is evident by that both plant and animal kingdom are classified on the basis of photosynthetic ability. Besides physical characteristics, it also describes its mode of nutrition and food characteristics.

Myth: Mammals and plants don't belong in the same domain.

Fact: Mammals and plants belong in the same domain.

Evidence: Plants have cells, nucleus, breathing and respiratory capabilities just like mammals.

---------------------------------------

Your myth: Animals are not related to humans.

Fact: Animals are indirectly related to humans.

Evidence: Humans possessess some unique features found in other species, hence, we are related to apes. At the known time, chimpanzees is our closest relative, and we share up to 98% of the DNA sequence with them.

a. Analysis of the potassium ion content in a food sample yielded the following data: % K: 3.09, 4, 2.775, 2.5, 3.80 Calculate the standard deviation of the sample. Show all calculations and indicate the answer to the correct amount of significant figures.​

Answers

The standard deviation of the sample is 0.579, rounded to the correct number of significant figures.

To calculate the standard deviation of the sample, we need to follow these steps:

Calculate the mean (average) of the data set.

To find the mean, we sum up all the data points and divide by the number of data points. Let's calculate it:

(3.09 + 4 + 2.775 + 2.5 + 3.80) / 5 = 16.165 / 5 = 3.233

Subtract the mean from each data point.

To do this, we subtract the mean (3.233) from each data point and square the result:

(3.09 - 3.233)^2 = 0.020049

(4 - 3.233)^2 = 0.586489

(2.775 - 3.233)^2 = 0.209025

(2.5 - 3.233)^2 = 0.537289

(3.80 - 3.233)^2 = 0.323329

Calculate the variance.

To find the variance, we sum up the squared differences from step 2 and divide by the number of data points:

(0.020049 + 0.586489 + 0.209025 + 0.537289 + 0.323329) / 5 = 1.676181 / 5 = 0.3352362

Take the square root of the variance to get the standard deviation.

√0.3352362 = 0.579 (rounded to three significant figures)

For such more questions on mean

https://brainly.com/question/1668275

#SPJ8

Metal plating is done by passing a current through a metal solution. For example, an item can become gold plated by attaching the item to a power source and submerging it into an Au³⁺ solution. The item itself serves as the cathode, at which the Au³⁺ ions are reduced to Au(s). A piece of solid gold is used as the anode and is also connected to the power source, thus completing the circuit. What mass of gold is produced when 15.1 A of current are passed through a gold solution for 31.0 min?

Answers

Answer:

172 g

Explanation:

Let's consider the reduction of Au³⁺ to Au.

Au³⁺(aq) + 3 e⁻ → Au(s)

In order to find the mass of gold produced, we will use the following relations.

1 min = 60 s1 A = 1 C/sThe charge of 1 mole of electrons is 96,468 C (Faraday's constant).1 mole of Au is deposited when 3 moles of electrons circulate.The molar mass of Au is 196.97 g/mol.

The mass of gold produced when 15.1 A of current are passed through a gold solution for 31.0 min is:

\(31.0min \times \frac{60s}{1min} \times \frac{15.1C}{s} \times \frac{1mole^{-} }{96,468C} \times \frac{3molAu}{1mole^{-} } \times \frac{196.97gAu}{1molAu} = 172 gAu\)

If a reaction starts with 30 grams of material, how many grams of material should be present at the end, according to the Law of Conservation of Mass. 

please help me​

Answers

If a reaction starts with 30 grams of material, the same amount of mass 30 grams of material should be present at the end, according to the Law of Conservation of Mass.

The law of conservation of mass states that no atoms are misplaced or made in a chemical reaction. as an alternative, the atoms be a part of collectively in distinctive methods to form merchandise.

The law of conservation of mass states that during a chemical reaction mass is neither created nor destroyed. for example, the carbon atom in coal turns into carbon dioxide when it's miles burned. The carbon atom changes from a stable structure to gas but its mass does not trade.

The law of conservation of mass states that depend cannot be created or destroyed in a chemical response. for example, when wooden burns, the mass of the soot, ashes, and gases equals the unique mass of the charcoal and the oxygen when it first reacted. So the mass of the product equals the mass of the reactant.

Learn more about Conservation of Mass here:-https://brainly.com/question/15289631

#SPJ1

What mass of glucose must be metabolized in order to produce 223 g of water? C6H12O6 + 6O2 → 6CO2 + 6H2O

Answers

371.4 g of glucose must be metabolized to produce 223 g of water.

What is the chemical equation for the complete combustion of glucose?

The balanced chemical equation for the complete combustion of glucose is:

C₆H₁₂O₆ + 6O₂ → 6CO₂ + 6H₂O

According to the equation, for every 1 mole of glucose consumed, 6 moles of water are produced.

The molar mass of glucose is:

6(12.01 g/mol) + 12(1.01 g/mol) + 6(16.00 g/mol) = 180.18 g/mol

To calculate the mass of glucose required to produce 223 g of water, we need to first convert the mass of water to moles:

223 g / 18.015 g/mol = 12.38 mol H₂O

Now we can use the mole ratio from the balanced equation to calculate the moles of glucose required:

1 mol glucose / 6 mol H₂O = x mol glucose / 12.38 mol H₂O

x = 2.06 mol glucose

Finally, we can calculate the mass of glucose:

mass = moles × molar mass

mass = 2.06 mol × 180.18 g/mol = 371.4 g

Therefore, 371.4 g of glucose must be metabolized to produce 223 g of water.

Learn more about glucose here:

https://brainly.com/question/30548064

#SPJ1

Other Questions
The table shows the cost of hiring a concrete mixer for up to 5 days.12Number of days3451945Cost in 3258 71The cost of hiring the concrete mixer is made upof a fixed charge and a daily charge.(1)(i) How much is the daily charge? (1)(ii) How much is the fixed charge? Tota a forecast that projects a companys sales is a(n):a. income statementb. balance sheetc. cash flow statementd. sales forecast Find the convexity of a seven-year maturity6.5% coupon bond selling at a yield to maturity of 8.8% annually. (do not round intermediate calculations. round your answer to 4 decimal places.) grizzly bears and polar bears have 74 chromosomes in a somatic cell, and giant panda bears only have 42 in their somatic cells. how many chromosomes are there in a sperm cell from each of the bears pictured above? (see worksheet for illustration) enry holds that directors are more the ""authors"" of a film than are the writers. to what film theory does he ascribe? a. grand theory b. medium essentialism c. medium specificity d. auteur theory\ The test scores of a group of students form a normal distribution with fl=54 and 0 = 10. If a sample of 16 students is selected from this population, between what average test scores will this group of students fall if their sample average is in the middle 95% of the population? Select one: a. The group of 16 students must have an average test score between 53.18 and 54.82. b. Cannot be determined from the information given. . None of the other choices is correct d. The group of 16 students must have an average test score between 51.93 and 56.07. e. The group of 16 students must have an average test score between 49.1 and 58.9. . write one word substitute Given this project and the requirement that the number of resources working on a task cannot be less than the number assigned to the task, answer the following question. If the tasks were placed in a serial relationship with Task 1 first and the others in numerical order, on what day would Task 3 be done? Group of answer choices day 18 day 3 day 10 day 9 a listening barrier that includes fear of misunderstanding or misrepresenting the spoken messages of others is called Macgregor's analysis in this passage is mostly focused on What is the primary purpose of the Supremacy Clausea. to outline why some powers must be implied rather than detailedb. to explain why state and federal powers are always kept equalc. to describe the relationship between federal and state powersd. to declare to American citizens the US is the supreme ruler Describe this sculpture. Explain why this sculpture is an example of objective art?. which group was the most important market segment for sport businesses at the turn of the 20th century? a) What is system analysis? Why system analysis is oftenconsidered as the most difficult phases may due to the difficultyin identifying users information needs. Give two (2) reasons tosupport th The graphs below have the same shape. What is the equation of the redgraph?5 Diarrhea can be a complication of tube feeding. What may contribute to the complication of diarrhea in a tube-fed client Find the value of x. Area of rectangle = 61Equation provided is: A(x) = 2x^2 - 5x The market risk premium is 9.0%, and the risk-free rate is 5.0%. If the expected return on a bond is 9.5%, what is its beta? Vincent has $82,044 in a savings account that earns 1% interest per year. The interest is not compounded. How much will he have in total in 1 year? suppose that shoe sizes of american women have a bell-shaped distribution with a mean of 8.04 and a standard deviation of 1.53 . using the empirical rule, what percentage of american women have shoe sizes that are less than 11.1 ?