To calculate the amount of \(KCIO_{3}\) that must be reacted to transfer -34.2 kJ of heat, we can use the balanced chemical equation and the given ∆H value: 0.764 moles of \(KCIO_{3}\) must be reacted to transfer -34.2 kJ of heat.
2 \(KCIO_{3}\)(s) → 2 KCl(s) + 3 O2(g) ∆H = -89.4 kJ
We can see from the balanced equation that for every 2 moles of \(KCIO_{3}\) reacted, -89.4 kJ of heat is transferred. To determine the amount of \(KCIO_{3}\) needed to transfer -34.2 kJ of heat, we can set up a proportion:
2 moles \(KCIO_{3}\) / -89.4 kJ = x moles \(KCIO_{3}\) / -34.2 kJ
Solving for x, we get:
x = (2 moles \(KCIO_{3}\) / -89.4 kJ) x (-34.2 kJ) = 0.764 moles \(KCIO_{3}\)
Therefore, 0.764 moles of \(KCIO_{3}\) must be reacted to transfer -34.2 kJ of heat.
Learn more about chemical equation
https://brainly.com/question/19626681
#SPJ4
Problem: Co3+ | Co2+ and Ni2+ | NiAnode?Cathode?(You need to use Reference Table B-16.)a. Co2+b. can't answerc. Ni2+d. Nie. Co3+
Answer:
- Anode: Co3+ | Co2+
- Cathode: Ni | Ni2+
Explanation:
The anode is where oxidation reaction occurs, and the cathode is where reduction reaction occurs.
From the table of reduction potencials, we find that:
- Co reaction:
\(\begin{gathered} Co^{3+}+2e^-\rightarrow Co^{2+} \\ E=1.81\text{ }V \end{gathered}\)- Ni reaction:
\(\begin{gathered} Ni\rightarrow Ni^{2+}+2e^- \\ E=-0.250\text{ V} \end{gathered}\)Now, to find out which one is the anode and which one is the cathode, it is necessary to compare the reduction potencials.
The reaction of Ni have negative potentials, so Ni will be the anode and Co will be the cathode.
Consider the Bohr model of the atom Which transition would correspond to the highest frequency of light emitted? Select one: n=1 to n=5 n=4 to n=1 n=6 to n=10 n=2 to n=6 n=6 to n-3
The transition corresponding to the highest frequency of light emitted is E. n=6 to n=3. This is because the frequency of light emitted is proportional to the difference in energy between the initial and final states.
According to the Bohr model, as the energy of the orbit increases, the radius of the orbit increases, and therefore the energy difference between two adjacent orbits increases. Thus, n=6 to n=3 has the greatest energy difference, and therefore the highest frequency of light emitted.
To better understand this concept, we can consider the relationship between the energy of the orbit and its radius. According to the Bohr model, the energy of an electron in an orbit of radius r is given by: E=-2.18x10^-18/r, where r is measured in meters. Thus, when the radius of the orbit increases, the energy of the orbit increases, and therefore the energy difference between two adjacent orbits increases. As a result, the frequency of light emitted increases.
In conclusion, the transition corresponding to the highest frequency of light emitted is n=6 to n=3. This is because the energy difference between these two orbits is the greatest and therefore the frequency of light emitted is the highest. Therefore the correct option is E
The complete question is :
Consider the Bohr model of the atom Which transition would correspond to the highest frequency of light emitted? Select one:
a. n=1 to n=5
b. n=4 to n=1
c. n=6 to n=10
d. n=2 to n=6
e. n=6 to n=3
Know more about Bohr model here:
https://brainly.com/question/29400473
#SPJ11
What type of bond is formed between sodium and sulfur
Answer:
The Bond would Be ionic
Explanation:
Thier electronegativites are way to differnt so Sulfur would steal from Sodium
How many moles of glucose, C6H12O6, are in a sample which weighs 75.5 g? (Hint: your answer needs to be less than the 1 mole b/c you're asked about the mole equivalent of 75.5g, which is less than 1 mole of glucose)
There are 0,419 moles of glucose in a sample that weights 75.5g.
To calculate the amount in moles of glucose in 75.5g, we first need the molar mass of this compound. To calculate that I'll be using the following atomic mass values:
C: 12
H: 1
O: 16
To calculate the molar mass, we multiply the number of atoms by the respective atomic mass:
(6 * 12) + (12 * 1) + (6 * 16) = 180 g/mol
Since the molar mass is 180 g/mol, we know that each mol has 180 g of glucose:
1 mol glucose ---------- 180g glucose
x --------------------------- 75.5g glucose
Solving for x, we have x = 0.419 moles of glucose
Which of the following is an electrolyte?
a. PbCl2
b. MgS
c. HNO3
d. Al2(Cr2O7)3
Answer: A: PbCl2
Hope dis helps!
Which alcohol could be prepared by the greatest number of different combinations of Grignard reagents and carbonyl compounds (aldehydes, ketones, and/or esters)
The alcohol that could be prepared by the greatest number of different combinations of Grignard reagents and carbonyl compounds is the primary alcohol. This is because primary alcohols can be prepared by the reaction of Grignard reagents with aldehydes, ketones, and esters. Secondary alcohols can also be prepared by the reaction of Grignard reagents with ketones, but they cannot be prepared from aldehydes or esters. Tertiary alcohols, on the other hand, cannot be prepared by the reaction of Grignard reagents with carbonyl compounds at all. Therefore, the primary alcohol has the greatest number of possible combinations of Grignard reagents and carbonyl compounds for its synthesis.
The alcohol that can be prepared by the greatest number of different combinations of Grignard reagents and carbonyl compounds is a secondary alcohol. This is because secondary alcohols can be synthesized from both aldehydes and ketones through the reaction with Grignard reagents, providing a wide range of possibilities for varying the reactants.Grignard reagent is an organometallic compound that is commonly used in organic chemistry as a nucleophile. It is named after its discoverer, French chemist Victor Grignard.
Grignard reagents are formed by the reaction of an alkyl halide or an aryl halide with magnesium metal in the presence of anhydrous ether. The resulting compound is a highly reactive species that can react with a wide range of electrophiles, such as carbonyl compounds, to form a new carbon-carbon bond.
To know more about Grignard reagents visit:
https://brainly.com/question/30144052
#SPJ11
What process do orcas use oxygen for?
The process orcas uses the oxygen is from the blowholes. the blow holes are situated on the top of of the head and it uses oxygen from their.
The whales and the humans uses the lungs for the respiration or to get oxygen required for the breathing. the orcas uses the oxygen from the blow holes situated at the top of the head. The orcas lives under the water and when the orcas dive in the water they have ability to hold the breath for at the time . but this is not good for the health . it is be very stressful for the body.
Thus, the process do the orcas uses oxygen for the intake is the from the blow holes.
To learn more about orcas here
https://brainly.com/question/29784862
#SPJ4
What property of a metal does the image represent
Answer:
malleable
Explanation:
The image represent in malleable property of metal.
The image possibly represents the photoelectric effect of a metal, which is when it emits electrons after being exposed to electromagnetic radiation. Metals are also characterized by physical properties such as conductivity, malleability, metallic luster, and metallic bonding.
Explanation:Based on your question, the image possibly represents the photoelectric effect, a key property of metals. This phenomenon occurs when a metal surface exposed to electromagnetic waves of a certain frequency absorbs radiation and emits electrons. These emitted electrons are called photoelectrons. Metals can also exhibit free electron model behavior, where electrons freely roam within the metal structure.
Metals possess unique physical properties like conductivity, malleability, and metallic luster. Malleability refers to the metal's ability to deform without breaking, while conductivity refers to the metal's ability to transfer heat or electricity. A metallic luster gives metals their characteristic shiny appearance.
Finally, metals are also known for their metallic bonding—a unique force that holds together the atoms within a metallic solid. Metallic bonding gives rise to many useful and varied bulk properties of metals.
Learn more about Properties of Metals here:https://brainly.com/question/33514448
#SPJ2
Metalliods have _______ proporties of metals and non metals.
a
both
b
neither
c
different
Answer:
A both
Explanation:
hope this helped
The molecular mass of nicotine is 162.1 grams. Nicotine contains 74.0% carbon, 8.7% hydrogen, and 17.3% nitrogen. Determine it's molecular formula.
A). C10H14N2
B). C6H8N4
C). C5H7N
D). C3H6N
I give Brainliest! Please no links
Answer:D). C3H6N
Explanation:applesause
Aluminum metal reacts with solid sulfur to produce solid aluminum(III) sulfide.
The chemical equation when aluminum metal reacts with solid sulfur to produce solid aluminum(III) sulfide would be \(2Al (s) + 3S (s) -- > Al_2S_3 (s)\)
Chemical equationThe reaction between aluminum metal and solid sulfur to produce aluminum (III) sulfide would be as follow:
The chemical symbol of aluminum metal = Al
The chemical symbol of sulfur = S
Aluminum has a valence electron of 3 while sulfur has a valance electron of 2. In order to form a bond between them, the valence electron of one becomes the subscript of the other. In other words, aluminum receives the valence of sulfur (2) while sulfur receives the valence of aluminum (3). Thus:
\(2Al +3 S --- > Al_2S_3\)
When all the phases are considered, the equation becomes: \(2Al (s) + 3S (s) -- > Al_2S_3 (s)\)
More on chemical equations can be found here: https://brainly.com/question/12047033
#SPJ1
Aluminum metal reacts with solid sulfur to produce solid aluminum(III) sulfide. Express your answer as chemical equations. identify all the phases in your answer.
what is the realationship between chemicals and cancer
Answer:
Explanation:
"An early link between cancer and a chemical was found in the late 1700s. An English physician noted that a large number of chimney sweeps had cancer of the scrotum due to exposure to soot, which contains chemicals known as polycyclic aromatic hydrocarbons. Since then, many more chemicals have been identified as known or suspected causes of cancer. "
Answer:
Chemical cause cancer
Explanation:
3. The total pressure of helium and Argon gas in a closed cylinder is 3.0 atm. If the partial pressure of the Argon is 0.365 atm, what is the partial pressure of the helium?
Illustrate Your Answer To Each Question With Suitable Diagrams Or With A Numerical Example. Plan Your Answer To Approximately 100 - 200 Words And 35 Minutes Per Question. How Would The Presence Of Long Covid* Around The World Affect GDP Growth, Global Imbalance, And Inflation In The Short Run And In The Long Run? Briefly Outline The Ideas Behind Your
COVID is a condition that occurs when individuals continue to have symptoms or develop new ones after recovering from COVID-19.
In addition to affecting human health, the presence of Long COVID can also have economic impacts, particularly on GDP growth, global imbalance, and inflation.
This essay will outline how Long COVID can affect the economy in both the short and long term. Short-term impact of Long COVID on GDP growth, global imbalance, and inflation In the short term, Long COVID's presence is likely to have a negative impact on GDP growth.
In the immediate aftermath of a pandemic, many people may not have the confidence to return to work, travel, or participate in other activities. As a result, there may be a reduction in demand for goods and services, which can lead to a decrease in GDP growth.
In addition, businesses may face additional costs related to employee absenteeism and illness, which can further harm GDP growth. Long COVID can also lead to global imbalances, particularly in countries where the virus is prevalent.
For example, if a significant portion of a country's population is experiencing Long COVID, this can lead to a reduction in exports, as businesses may not be able to produce or deliver goods and services as efficiently.
This can lead to an increase in imports, which can contribute to a trade deficit and further harm the economy. Finally, Long COVID can lead to inflation in the short term, particularly if supply chains are disrupted.
As businesses face increased costs related to employee absenteeism and illness, they may need to increase prices to maintain profitability.
In addition, if supply chains are disrupted due to Long COVID, businesses may need to pay more for raw materials and other inputs, which can lead to an increase in prices. Long-term impact of Long COVID on GDP growth, global imbalance, and inflation In the long run, Long COVID's impact on the economy is less clear.
Some economists argue that the long-term impact of Long COVID on the economy will be minimal, particularly if effective treatments and vaccines are developed.
These individuals argue that the negative short-term impacts of Long COVID on the economy will be offset by increased spending in the future, as people resume normal activities.
Others argue that Long COVID's impact on the economy will be more significant, particularly if individuals continue to experience symptoms and are unable to return to work.
These individuals argue that Long COVID could lead to a reduction in human capital, as people may not be able to participate in the labor market as efficiently. This could lead to a reduction in productivity and harm GDP growth.
Similarly, Long COVID could contribute to global imbalances in the long term, particularly if it continues to be prevalent in certain countries. If a significant portion of the population is unable to participate in the labor market, this can lead to a reduction in exports and a trade deficit.
Finally, Long COVID could contribute to inflation in the long term, particularly if it leads to a reduction in productivity. If businesses are unable to produce goods and services as efficiently due to Long COVID, this can lead to an increase in prices over time.
In conclusion, the presence of Long COVID can have a significant impact on the economy in both the short and long term. While the short-term impact may be more significant, the long-term impact of Long COVID is still uncertain and will depend on a variety of factors, including the effectiveness of treatments and vaccines.
To know more about pandemic visit;
https://brainly.com/question/28941500
#SPJ11
Long Covid is when people have continued symptoms or health difficulties after recovering from Covid-19.
Long Covid* can affect GDP growth, global imbalances, and inflation in the short and long term.
Long Covid may hurt the economy temporarily. Long Covid can impair productivity and labour force participation. This can lower GDP and economic output. Long Covid treatment expenses can strain healthcare systems and raise inflationary pressures.
Countries with a higher prevalence of Long Covid may have a bigger load on their healthcare systems and workforce, which may aggravate economic inequities. Long Covid may worsen global inequities in countries with poor resources or healthcare facilities.
Long Covid has long-term effects. Long-term health issues can impair productivity and make returning to work difficult, lowering GDP growth. Long-term healthcare costs with Long Covid may increase government deficits and debt.
Long Covid may increase cost-push inflation. Healthcare costs, such as treatment and rehabilitation, can raise medical product and service prices. Inflationary pressures reduce consumers' purchasing power and corporate profitability, hurting the economy.
Long Covid can have complex impacts on GDP growth, global imbalances, and inflation in the short and long term. These implications will depend on Long Covid's severity and persistence, healthcare responses, and pandemic-related economic policy.
Learn more about Covid, here:
https://brainly.com/question/33542531
#SPJ4
Noble gasses are generally
Noble gases have completely filled electronic configuration. Therefore, noble gases or group 18 elements are inert in nature.
What are noble gases?Noble gases are 18th group elements in periodic table. They are all having complete filled electronic configuration. The group members are helium, neon, argon, krypton, xenon and radon.
All these elements are existing in gaseous state and they are unreactive. Atoms become reactive when they have extra electrons or are deficient of electrons. Thus to achieve octet, they bond with other atoms.
In the case of noble gases, the valence shell is already achieved octet and no need of lose or gain of electrons. Thus, they are generally inert.
To find more on noble gases, refer here:
https://brainly.com/question/11764545
#SPJ1
when energy is absorbed in process, which type of reaction is it?
An endothermic reaction is one in which energy is absorbed by a chemical process.
What is an endothermic reaction?An endothermic reaction is a chemical process in which energy heat, light, or other types of energy is absorbed from the environment. The products of the process store this energy, which raises their potential energy. The reaction mixture's temperature drops as a result.
The reaction mixture's temperature drops as a result. A positive H (change in enthalpy), which indicates that heat is absorbed by the system during the reaction, is frequently used to identify endothermic reactions. Endothermic processes include photosynthesis, burning, and the dissolution of certain materials in water. Numerous natural and commercial processes depend heavily on endothermic reactions.
Endothermic processes include photosynthesis, burning, and the dissolution of certain materials in water. Numerous natural and commercial processes depend heavily on endothermic reactions.
To know more about endothermic reaction, visit:
https://brainly.com/question/23184814
#SPJ4
please help 100 points!
Balanced chemical equation: 2H2 + O2 → 2H2O
The limiting reagent will be H2
All 10.39 mol of H2 will be used up produce 10.39 mol of H20
The excess reagent will be O2 and there will be 5.78 mols left over
Explanation:
The balance chemical equation is
2H2+O2—>2H2O
The limiting reactant is found by dividing the moles of each reactant by its coefficient
For H2=10.39/2=5.195
For O2=16.17/1= 16.17
Since H2 has the smaller value it’s the limiting reactant
The mass of the maximum amount of H2O is found by using the formula
moles= mass/molar mass
solving for mass gives
mass= moles*molar mass
(molar mass of H2O= 18g/mol)
mass= 5.195*18=93.51grams of H2O
tate whether the following changes are physical or chemical for rancidipication fixation of water 2 tearing of paper 3 rusting of iron 4 electrolysis of water
Answer: Physical change : tearing of paper, fixing of wtaer
Chemical change: rusting of iron , electrolysis of water, Rancidification
Explanation:
Physical change is a change in which there is no rearrangement of atoms and thus no new substance is formed. There is only change in physical state of the substance.
Example: tearing of paper, fixing of wtaer
Chemical change is a change in which there is rearrangement of atoms and thus new substance is formed. There may or may not be a change in physical state.
Example: rusting of iron , electrolysis of water, Rancidification
Why do elements form an ionic bond
Answer:
none of the above
Explanation:
Calculate the fraction of m2 that remains in the aqueous phase, , if 125 ml of 0. 10 μm m2 is extracted once with 15. 0 ml of 0. 42 mm l− at ph 3. 0?
The fraction of m2 that remains in the aqueous phase is approximately 0.00198.
To calculate the fraction of m2 that remains in the aqueous phase, we need to consider the concentrations and volumes of the solutions involved in the extraction process.
Given:
Initial volume of m2 solution = 125 ml
Concentration of m2 solution = 0.10 μm
Volume of extracting solution = 15.0 ml
Concentration of extracting solution = 0.42 mm
pH of the system = 3.0
First, we need to convert the concentration units to the same system. Since both the m2 solution and the extracting solution are in different concentration units (μm and mm, respectively), we need to convert them to a common unit. Let's convert both to micromolar (μm) for consistency.
Concentration of m2 solution = 0.10 μm
Concentration of extracting solution = 0.42 mm = 420 μm
Next, we can calculate the moles of m2 in each solution using the formula:
moles = concentration (in μm) × volume (in ml)
moles of m2 in the m2 solution = 0.10 μm × 125 ml = 12.5 μm·ml
moles of m2 in the extracting solution = 420 μm × 15.0 ml = 6300 μm·ml
Now, let's calculate the total moles of m2 present in the system:
total moles of m2 = moles in m2 solution + moles in extracting solution
= 12.5 μm·ml + 6300 μm·ml
= 6312.5 μm·ml
Finally, we can calculate the fraction of m2 remaining in the aqueous phase by dividing the moles of m2 in the m2 solution by the total moles of m2:
fraction of m2 remaining in aqueous phase = moles in m2 solution / total moles of m2
= 12.5 μm·ml / 6312.5 μm·ml
= 0.00198
Learn more about aqueous phase here:-
https://brainly.com/question/30892318
#SPJ11
A solution of sodium thiosulfate was standardized by dissolving 0.2742 g KIO3 (214.00 g/mol) in water, adding a large excess of KI, and acidifying with HCl. The liberated iodine required 18.12 mL of the thiosulfate solution to decolorize the blue starch/iodine complex. Calculate the molarity of the sodium thiosulfate solution.
The molarity of the sodium thiosulfate solution is 0.0354 M.
To solve this problem, we need to use the balanced equation for the reaction between KIO₃ and KI in acidic solution:
\(5IO_3^- + 5I^- + 6H^+\) → \(3I_2 + 3H_2O\)
From the problem, we know that 0.2742 g of KIO₃ was used, which is equivalent to:
0.2742 g / 214.00 g/mol = 0.00128 mol of KIO₃
Since KI was added in excess, all of the KIO₃ reacted to form iodine, which required 18.12 mL of the sodium thiosulfate solution to titrate. We can use the equation:
n(thiosulfate) = n(iodine)
where n represents the number of moles of the substance. Rearranging for the number of moles of thiosulfate:
n(thiosulfate) = n(iodine) = (0.00128 mol I2) / 2 = 0.00064 mol S₂O₃²⁻
Finally, we can calculate the molarity of the sodium thiosulfate solution using the volume of the solution used in the titration (18.12 mL or 0.01812 L):
M = n / V
M = 0.00064 mol / 0.01812 L
M = 0.0354 M
Therefore, the molarity of the sodium thiosulfate solution is 0.0354 M.
To know more about molarity, refer to the link below:
https://brainly.com/question/16587536#
#SPJ11
two conformations of the same disaccharide are shown on the right. the top conformation has a much lower free energy than the conformation on the bottom. why do you think this is the case?
The two conformations of the same disaccharide shown on the right likely differ in their free energy levels due to the arrangement and interactions of their constituent molecules. The top conformation, with a lower free energy, is likely more stable because of the formation of favorable interactions, such as hydrogen bonding, between the mono saccharide units, and a more optimal orientation of their functional groups.
In addition, the lower free energy conformation could be attributed to a reduced level of steric hindrance, where the spatial arrangement of the atoms in the disaccharide allows for minimal clashes and more efficient packing of the molecule. This can lead to a more stable and energetically favorable structure.
Moreover, the stability of the top conformation may be further enhanced by the presence of intramolecular forces, such as van der Waals interactions and hydrophobic effects. These interactions can significantly contribute to the overall stability of the molecule and subsequently result in a lower free energy state.
In summary, the top conformation of the disaccharide likely has a lower free energy due to a combination of factors, including favorable interactions between the monosaccharide units, optimal orientation of functional groups, reduced steric hindrance, and the presence of intramolecular forces. These factors collectively contribute to a more stable and energetically favorable molecular structure.
for more such question on molecules
https://brainly.com/question/24191825
#SPJ11
Which one of the equations below is an exothermic reaction?
A) CO2 (g) - C(s) + O2 (g) AH = 394 kJ/mol
B) CaO (s) + H2O (D = Ca(OH)2 (aq) AH = -64
kJ/mol
C) C (s) + 2 F2 (g) - CF. (9) AH = 141.3
kJ/mol
2 NO (9) AH° = 180.6
D) N2 (g) + O2 (9)
kJ/mol
Answer:
B) CaO(s) + H2O(l) --> Ca(OH)2(aq)
Explanation:
This is the only reaction with a negative enthalpy value. Exothermic reactions have a negative enthalpy.
What is the difference between a continuous spectrum and a line spectrum? Give a source of each
kind of spectrum!
Do you have more gravity when your on the ground or in the air
The gravity force on an object from the Earth is the same regardless of whether the object is surrounded by air .
the Earth has an average gravitational force. Different locations on Earth have gravitational forces that are larger or smaller than average. This is because each location has more or less mass than the average
What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?
The balanced equation for this reaction is:
CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).Learn more about the condensation reaction:
brainly.com/question/6256866
#SPJ11
Please help
6.0 mol Al reacts with 4.0 mol O2 to
form Al2O3.
4AI + 302 → 2Al2O3
How many moles of Al2O3 form when
4.0 mol O2 reacts?
[?] mol Al2O3
The number of mole of Al₂O₃ formed when 4.0 moles of O₂ reacts, given the reaction is 2.67 moles
How do I determine the number of mole of Al₂O₃ formed?From the given stoichiometry of the reaction (i.e 6.0 moles of Al reacts with 4.0 moles of O₂ to form Al₂O₃), we can see that O₂ is the limiting reactant.
Knowing that O₂ is the limiting reactant we can easily determine the number of moles of Al₂O₃ formed when 4.0 moles of O₂ reacts as follow:
4Al + 3O₂ -> 2Al₂O₃
From the balanced equation above,
3 moles of O₂ reacted to produce 2 moles of Al₂O₃
Therefore,
4 moles of O₂ will react to produce = (4 moles × 2 moles) / 3 moles = 2.67 moles of Al₂O₃
Thus, we can conclude from the above calculation that the number of moles of Al₂O₃ formed is 2.67 moles
Learn more about number of mole:
https://brainly.com/question/23350512
#SPJ1
Answer: 2.67
Explanation:
Please help I'm struggling
What type of attractive force exists when two atoms form a temporary dipole or charge because of the movement of electrons?
Answer:
The correct option is A
Explanation:
The forces of attraction among the molecules or atoms of a substance are called inter molecular forces.
When two atoms gain temporary dipole and become polar for an instant the inter molecular forces of attraction between then are known as London dispersion forces.
London Dispersion Forces:
It is a type of inter molecular force that occurs when the electrons in two adjacent atoms are displaced in such a way that the atoms get some temporary dipoles, they attract each other through London dispersion forces. These inter molecular forces usually occur between non polar substances.
Answer: B intramolecular force
Explanation:
Which of the following is a measure of the amount of matter than object contained.
Weight
Mass
Volume
density
Answer:
weight = newton
mass = kilogram
volume = cubic meter
density = kilogram per cubic meter
Answer:
weight hghhiixjdhdhbdnfnfjfjjcndndnfmckkxkx
Which is the correct definition of electronegativity?
Answer:
Electronegativity is defined as the tendency of an atom participating in a covalent bond to attract the bonding electrons
Explanation:
Electronegativity increases and you go up and to the right, making fluorine the most electronegative element.