Hey....Tell me


What is the molecular weight of carbon dioxide??


follow me....​

Answers

Answer 1

Answer:

44 g/mol

Explanation:


Related Questions

What information does Gibbs free energy give about a reaction?
A. It tells how quickly the reaction will proceed to equilibrium.
B. It tells if the reaction will proceed spontaneously or not.
C. It tells what the most stable forms of the products are.
D. It tells what the activation energy of the forward reaction is.

Answers

Answer: b

Explanation:

The octet rule states that atoms tend to gain, lose, or share electrons in order to acquire a full
set of valence electrons. Which type of model could be used to demonstrate this process?

Answers

Explanation:

The octet rule states that atoms tend to form compounds in ways that give them eight valence electrons and thus the electron configuration of a noble gas. ... Atoms of nonmetals tend to gain electrons in order to fill their outermost principal energy level with an octet.

Describe the similarities and the differences between a 2s orbital and 3s orbital.​

Answers

Answer:

the 3s orbital can hold more electrons than the 2s orbital. the 3s orbital has a different shape than the 2s orbital. the 3s orbital has a different orientation in space than the 2s orbital. the phrase "ground state electron configuration" means only one excited state has electrons.

Explanation:

the 3s orbital can hold more electrons than the 2s orbital. the 3s orbital has a different shape than the 2s orbital. the 3s orbital has a different orientation in space than the 2s orbital. the phrase "ground state electron configuration" means only one excited state has electrons.

What is rent? A. The amount you spend on needs each month B. The amount you pay to purchase a house C. The amount you pay to live in a space such as an apartment D. The amount you pay for electricity and water

Answers

C. The amount you pay to live in’s space such as a apartment
the answer is c because that is right and the other person said

40 grams of KCl are dissolved in 100 mL of water at 45C.
How many additional grams of
KCI are needed to make the solution saturated at 80 C?

Answers

40 grams of KCl are dissolved in 100 mL of water at 45C. 5g of  additional grams of KCI are needed to make the solution saturated at 80 C as the solubility of KCl is 45g/ml

A uniform combination of a number of solutes within a solvent is referred to as a solution. One frequent illustration of a Solution is adding sugar cubes into your cup of tea and coffee. Solubility is the quality that makes sugar molecules more soluble.

In water, potassium chloride (KCl) dissolves. Its water solubility, like that of all other solutes, depends on temperature. The solubility of a salt increases as the solvent's temperature rises. This is fairly simple to experience with sugar. 40 grams of KCl are dissolved in 100 mL of water at 45C. 5g of  additional grams of KCI are needed to make the solution saturated at 80 C as the solubility of KCl is 45g/ml.

To know more about solubility, here:

https://brainly.com/question/29661360

#SPJ1

Which of the following should be measured with a meter stick, not a tape measure?
A.
the length of ribbon needed to tie around a vase
B.
the size of a student's waist
C.
the distance from the ground to the top of a ramp
D.
the circumference of an orange

Answers

Answer:

C

the distance from the ground to the top of a ramp

2. A girl on a bike is accelerating at a rate of 5 m/s2 and has a total mass of 60 kg. How much force is the girl applying to her bike to move at this rate? *​

Answers

Answer:

300N................

Explanation:

F=ma

m=60

a=5

2A+3B⟶4Y+5Z how many moles of Z with excess B
1.10 mol A

Answers

The given reaction is a balanced chemical equation, where 2 moles of A and 3 moles of B react to form 4 moles of Y and 5 moles of Z.

Given that there is 1.10 mol of A, we can use the stoichiometry of the reaction to determine the amount of B present. Using the coefficient of A in the balanced equation, we know that for every 2 moles of A, there must be 3 moles of B. Therefore, the amount of B present is 1.10 mol A * (3 mol B / 2 mol A) = 1.65 mol B.

Since there is an excess of B, we can use the balanced equation to determine the amount of Z produced. Using the coefficient of B in the balanced equation, we know that for every 3 moles of B, 5 moles of Z are produced. Therefore, the amount of Z produced is 1.65 mol B * (5 mol Z / 3 mol B) = 2.75 mol Z.

I need help with this pls

I need help with this pls

Answers

Answer:

\(1)20 \\ 2)13 \\ 3)82 \\ 4)56 \\ 5)26 \\ 6)1 \\ hope \: it \: helps \\ plzzz \: mark \: it \: as \: brainliest...\)

what percentage of oxygen is attributed fossil fuel combustion


A.43%


B.77%


C.4%


D.17%

Answers

Answer:

C. 4%

Explanation:

The answer is 4%

Tiana is a chemist who is making a chemical to add to swimming pools in order to make the water safer. she mixed two solid substances together in a sealed container. the diagram above shows the repeating groups of atoms that make up the two starting substances. After mixing, Tiana found two liquid substances in the sealed container. (Nothing had escaped.) Which of the diagrams to the left shows the repeating groups of atoms that make up the ending substances?

Answers

Explanation:

chemical to add to swimming pools in order

to make the water safer. She mixed two solid

substances together in a sealed container.

The diagram above shows the repeating

groups of atoms that make up the two

starting substances.

After mixing, Tiana found two liquid

substances in the sealed container.

(Nothing had escaped.) Which of the

diagrams to the left shows the repeating

groups of atoms that make up the ending

substances?

Answer:

Where are the pictures????

Explanation:

Pewter is a solidified solution of tin and lead or tin and zinc. In both cases, tin is the main component. Which metal would you classify as the solute in each type of pewter?

Answers

Low quality pewter is tin, lead and a small amount of copper. In higher quality pewter, antimony or bismuth is used instead of lead. Pewter alloyed with antimony and bismuth can be polished to a bright, tarnish free finish. The alloying metals lower the melting temperature of tin, making it possible to cast molten alloy into detailed shapes.

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

calculate the ph at 25 c of a .33 m solution of sodium benzoate. note that benzoic acid is a weak acid with a pka of 4.2

Answers

Answer:

The pH at 25°C of 0.33M solution is 5.36.

Explanation:

Let us calculate -:

\(NaC_6H_5CO_2$\rightarrow$ salt of weak acid + sodium benzoate\)

pH of salt of weak acid and sodium benzoate is given by-

pH =\(7+\frac{1}{2}pk_a+\frac{1}{2}log (concentration of salt)\)  

concentration of salt = 0.33M

\(pK_a=4.2\)

\(pH = 7 +\frac{4.2}{2} +\frac{1}{2}log (0.33)\)

\(pH=7 +\frac{4.2}{2} + \frac{(-0.4815)}{2}\)

 pH   = 5.36

Hence , the answer is 5.36

What is the pCu of the resulting solution if 20.00 mL of 0.08 M EDTA (H4Y) is added to 15.00 mL of 0.10 M CuSO4 and buffered at pH 10? The Kf’ for complex CuY2- is 2.21 x 1018

Answers

Answer:

The answer is "5.4".

Explanation:

\(BoH + HCL =BCL +H_2o \\\\At eq \\\\N_1V_1=N_2V_2 \\\\v_2=20 \ ml\\\\[BCL]=\frac{20 \times 0.08}{20+20}=0.04\\\\pH = \frac{1}{2} [pkw - pk_b - \log e]\\\\pk_b = 2 pH - Pkw + \Log C\\\\pK_b=5.4\)

Brainliest will be rewarded!

Brainliest will be rewarded!

Answers

Option B, where [OH-] is 1.0 x 10-13 mol dm-³3, is the only one that can be considered basic. Therefore, Option B is the correct answer.

To determine whether a solution is basic or acidic at 25 °C, we can compare the concentration of hydroxide ions ([OH-]) with the concentration of hydronium ions ([\(H_3O\)+]). In a neutral solution, the concentrations of [\(H_3O\)+] and [OH-] are equal, resulting in a pH of 7.

Option A states that the concentration of [\(H_3O\)+] is 1.0 x 10-3 mol dm-3. Since [\(H_3O\)+] represents the concentration of hydronium ions, this solution would be acidic because the concentration of [\(H_3O\)+] is higher than [OH-], indicating an excess of hydronium ions.

Option B states that the concentration of [OH-] is 1.0 x 10-13 mol dm-³3. In this case, [OH-] is higher than [\(H_3O\)+], indicating an excess of hydroxide ions. Therefore, this solution would be considered basic.

Option C states that the solution has a pH of 4.00. A pH of 4.00 is below the neutral pH of 7, indicating an excess of hydronium ions and an acidic solution. Therefore, this option does not represent a basic solution.

Option D states that the concentration of [\(H_3O\)+] is 1.0 x 10-13 mol dm-3. Similar to Option A, this concentration of [\(H_3O\)+] indicates an acidic solution, not a basic one.

Option B

For more such question on basic visit:

https://brainly.com/question/29886197

#SPJ8

Answer:

D is the correct answer

Explanation:

In order for a solution to be basic at 25 C, the H+ concentration has to be less than the OH- concentration, and given that H+ times OH- is 10^-14, we deduce that H+ must be less than 10^-7 for the solution to be acidic. Thus, A can be eliminated, and so can C. With B, we calculate an H+ concentration of 0.1M, which also fails to be less than 10^-7
Thus, D is the correct answer and we can verify that as H+ is less than 10^-7.



Note: I do not know why my previous answer was deleted for "being incorrect", and i'm not sure how the incorrect answer was "expert verified", but I am as certain that D is the correct answer as i am sure of 3*(4+5-1) being equal to 24.

In the graphic,
X represents which element?
40
20

In the graphic,X represents which element?4020

Answers

Answer:Ca

Explanation:

Stote 4 ways in which excesine alcohol conscuption is
harmful to humans​

Answers

Answer:

An addiction could occur, maybe an overdose?, this could lead to death and maybe you would do unreasonable things which could get you fined or arrested.

Explanation:

Answer:

Excessive alcohol is harmful because you could get addicted.Alcohol can affect your nervous system.Your sugar levels will not be good.Parts of your body and organs will become inflamed.You can get a larger amount of muscle cramps.Also you will not be able to get enough vitamins in your body.Accidents that lead to deaths could occur.You would do crazy actions with things such as theft or breaking into a house which could get you fined or arrested.Too much alcohol can lead to high blood pressure, disease and even strokes.You can have birth defectsWith excessive alcohol you can get osteoporosis.You can also get your immune system weakened.Finally, alcohol can lead to cancer.

Hope this helped,

Kavitha

Precipitation that falls into rivers lakes and streams is called

Answers

Answer:

a runoff

Explanation:

if you start with 55.5 mL of 1.30 M HG and you dilute it due to 188.5 mL what is the new molarity

Answers

Answer:

\(\huge\boxed{\sf M_2 \approx 0.38 \ M}\)

Explanation:

Given data:

Initial volume = \(V_1\) = 55.5 mL

Initial Molarity = \(M_1\) = 1.3 M

Final volume = \(V_2\) = 188.5 mL

Required:

Final Volume = \(V_2\) = ?

Formula:

\(M_1V_1 = M_2V_2\)

Solution:

Put the given data.

Finding new molarity.

\((55.5)(1.3)=(188.5)(M_2)\\\\72.15 = 188.5 (M_2)\\\\Divide \ both \ sides\ by \ 188.5\\\\72.15/188.5 = M_2\\\\M_2 \approx 0.38 \ M\\\\\rule[225]{225}{2}\)

write an apology letter to your principal telling him why you were not in the mathematics competition.in 4000 words​

Answers

OK now that’s a lot to ask for but if you want someone to actually do that you’re gonna need a lot more points

HELPPPP FASTTTTTTT



An inflated balloon is left outside overnight. It has a volume of 1.7 4 L when the temperature is 20.2 degC and the pressure is 1.02 atm. At what temperature will the balloon have a volume of 1.56 L if the pressure falls to 0.980 atm?

What gas law will you use to solve this problem?
options
A. boyles gas law
B. charles gas law
C. Gay lussacs gas law
D. combined gas law
E. ideal gas law
What is your reason for choosing the gas law?
options
A.moles are in the problem
B. there are 2 variables that are changing
C. there are 3 variables that are changing
In this problem, is the volume increasing or decreasing?
What is the unknown that you are solving for?
options.
A.T1
B.T2
What temperature will you use in your calculations?
A. 20.2 degc
B. 273 k
C. 293.2 K
What is the final temperature after the volume and pressure decrease in this problem?
options.
A. 253k
B. 314k
C. 353 K

Answers

Explanation:

1.The gas law that we will use to solve this problem is the combined gas law.

2.We will choose the combined gas law because there are three variables that are changing in this problem: volume, pressure, and temperature.

3The volume is decreasing in this problem, from 1.74 L to 1.56 L.

The unknown that we are solving for is T2, the temperature at which the balloon will have a volume of 1.56 L.

4We will use the temperature in Kelvin for our calculations. To convert from Celsius to Kelvin, we add 273.15 to the Celsius temperature. Therefore, the temperature we will use in our calculations is 293.35 K (20.2°C + 273.15).

5To find the final temperature, we can use the combined gas law equation:

(P1 x V1)/T1 = (P2 x V2)/T2

where P1 = 1.02 atm, V1 = 1.74 L, T1 = 293.35 K, P2 = 0.980 atm, and V2 = 1.56 L.

Substituting the values into the equation and solving for T2, we get:

T2 = (P2 x V2 x T1)/(P1 x V1)

= (0.980 atm x 1.56 L x 293.35 K)/(1.02 atm x 1.74 L)

= 268.06 K

Therefore, the final temperature after the volume and pressure decrease is 268.06 K, which is approximately 253 K (option A).

The diagrams below show the alignment of the Sun, the Moon, and Earth.

The diagrams below show the alignment of the Sun, the Moon, and Earth.

Answers

Answer:A

Explanation: I learned it from a gizmo

11. How many 0.1-mg tablets will contain
the same amount of drug as 50 tablets,
each of which contains 0.025 mg of
the identical drug?

Answers

The amount of 0.1 mg tablets that will contain the same amount of drug as 50 tablets 12.5 tablets

How to determine the total amount of the 0.025 mg

We'll begin by calculating the the total amount of the 0.025 mg identical drugs. This is illustrated below:

Number of tablets = 50Amount per tablet = 0.025 mgTotal amount =?

Total amount = number × amount per tablet

Total amount = 50 × 0.025

Total amount = 1.25 mg

How to determine the number of 0.1 mg contained in 1.25 mg of drug

Haven obtain the total amount of the identical drugs, we shall determine the number of 0.1 mg present in the drug. Details below:

Total amount = 1.25 mgAmount per tablet = 0.1 mgNumber of tablets =?

Number of tablets = Total / amount per tablet

Number of tablets = 1.25 / 0.1

Number of tablets = 12.5

Thus, 12.5 tablets of 0.1 mg is present in the drug

Learn more about conversion:

https://brainly.com/question/2139943

#SPJ1

At 25 °C, only 0.0510 mol of the generic salt AB is soluble in 1.00 L of water.
What is the sp of the salt at 25 °C?
AB(s)↽−−⇀A+(aq)+B−(aq)

Answers

The value of the solubility product constant (Ksp) for the salt AB at 25°C is 2.60 x 10⁻³.

The solubility product constant (Ksp) is the equilibrium constant for the dissolution of a sparingly soluble salt in water. It is given by the expression Ksp = [A⁺][B⁻] where [A⁺] and [B⁻] are the molar concentrations of the cations and anions in solution, respectively.

In this case, the balanced equation for the dissolution of the salt AB is: AB(s) ⇌ A⁺(aq) + B⁻(aq) We know that at 25°C, only 0.0510 mol of the salt AB is soluble in 1.00 L of water. This corresponds to a molar solubility of

s = 0.0510 mol / 1.00 L = 0.0510 M

At equilibrium, the molar concentration of A⁺ and B⁻ will also be 0.0510 M. Therefore, the value of Ksp for the salt AB at 25°C can be calculated as: Ksp = [A⁺][B⁻] = (0.0510 M) * (0.0510 M) = 2.60 x 10⁻³.

To know more about solubility product:

https://brainly.com/question/30186409

#SPJ1

Describe what an Ionic Substance is....

Answers

Answer:

Ionic Substance is....

Explanation:

In chemistry, an ionic compound is a chemical compound composed of ions held together by electrostatic forces termed ionic bonding. The compound is neutral overall, but consists of positively charged ions called cations and negatively charged ions called anions.

Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H₂O). If 2.69 g
of water is produced from the reaction of 17.0 g of hydrobromic acid and 13.9 g of sodium hydroxide, calculate the percent yield of water.
Round your answer to 3 significant figures.

Answers

Answer:

70.95%

Explanation:

To calculate the percent yield of water in this reaction, we need to compare the actual amount of water produced to the theoretical amount of water that could be produced based on the amount of hydrobromic acid and sodium hydroxide used.

First, we need to determine the limiting reactant. The limiting reactant is the reactant that is completely consumed in the reaction, limiting the amount of product that can be formed.

To find the limiting reactant, we can use stoichiometry to calculate the amount of water that could be produced from each reactant, assuming they react completely. The balanced chemical equation for the reaction is:

HBr + NaOH → NaBr + H2O

From the equation, we can see that the mole ratio of HBr to H2O is 1:1, and the mole ratio of NaOH to H2O is 1:1. Therefore, the amount of water produced depends on the amount of HBr and NaOH present, and the reactant that produces less water is the limiting reactant.

Using the molar masses of the compounds, we can convert the masses of HBr and NaOH to moles:

moles of HBr = 17.0 g / 80.91 g/mol = 0.210 moles

moles of NaOH = 13.9 g / 40.00 g/mol = 0.348 moles

Based on the balanced chemical equation, the theoretical amount of water that could be produced from 0.210 moles of HBr is also 0.210 moles. The theoretical amount of water that could be produced from 0.348 moles of NaOH is also 0.348 moles.

However, since the amount of water produced is given as 2.69 g, we need to convert this to moles:

moles of H2O produced = 2.69 g / 18.02 g/mol = 0.149 moles

To calculate the percent yield of water, we can use the formula:

percent yield = (actual yield / theoretical yield) x 100%

where actual yield is the amount of water produced (0.149 moles) and theoretical yield is the amount of water that could be produced based on the limiting reactant.

Since the reactant that produces less water is the limiting reactant, we need to compare the theoretical yield of water from both reactants, and the lower value will be the theoretical yield based on the limiting reactant.

The theoretical yield of water from HBr is:

0.210 moles of HBr x (1 mole of H2O / 1 mole of HBr) = 0.210 moles of H2O

The theoretical yield of water from NaOH is:

0.348 moles of NaOH x (1 mole of H2O / 1 mole of NaOH) = 0.348 moles of H2O

Since the theoretical yield of water from HBr is lower, it is the limiting reactant. Therefore, the theoretical yield of water is 0.210 moles.

Now we can calculate the percent yield of water:

percent yield = (actual yield / theoretical yield) x 100%

percent yield = (0.149 moles / 0.210 moles) x 100%

percent yield = 70.95%

Therefore, the percent yield of water is 70.95%.

6. A gas occupies a volume of 125.0 mL at 10.0C. At what temperature would the volume be 50.0 mL?

Answers

Answer:

V1= 125.0mL    125.0mL/10.0C=50.0mL/T2

T1= 10.0C         T2=(125.0mL/10.0C) X 50.0mL

V2= 50.0mL       T2= 625L

T2=?

Explanation:

I'm pretty sure about this It took me a while to get it but I already took the test

What formula do you use to calculated density?
O Volume X Mass = Density
O Volume + Mass = Density
O Mass + Volume= Density
Mass - (Volume) x Matter = Density
Cle

Answers

Answer:

7 AM was the first to be the best Friend and a friend and I have seen the target market share of a million dollars and Diamond.

Answer:Density, mass of a unit volume of a material substance. The formula for density is d = M/V, where d is density, M is mass, and V is volume. Density is commonly expressed in units of grams per cubic centimetre.

Explanation:

How can a scientist slow down the reaction rate?

Answers

Answer:

by keep gping

Explanation:

Answer:

need to do the opposite

Explanation:

Other Questions
According to the presenter, what percentage of people respond favorably to extra micronutrients? 0-5% 60-80% O 40-60% 80-100% O 0-20% Solve the system of linear equations: ts x - y = 2 4x + 2y = 44 x = y = according to erik erikson, who is most likely to suffer from loneliness? What are three responsibilities of the executive office?. What would happen to a glass of water placed in a closet for a few days? Why do you think this would happen? what should the nurse ask while assessing a latina woman with depression for the risk of self-harm? What does narrative writing communicate?A. InformationB. A storyC. DataD. Reports 30 POINTSWriting Prompt:In life people make critical choices that will have an impact on who they become as they get older. There are choices you have already made that have affected your life in significant ways.Write an essay discussing a critical choice you made and how it has impacted your life. The question is rewrite the sentence in the preterite. HELP ME Organize the steps of DNA replication....Two new copies of DNA are created, each containing one strand from the original DNA molecule.DNA Polymerase joins complementary nucleotides to the template strands:DNA Helicase "unzips" DNA breaking bonds between the 2 template strands,The newly created strands are "proof-read" for errors.DNA Polymerase attaches to cach exposed template strand. put it in order Does the graph of the function ever cross the x-axis? 5. A pole has to be erected at a point on the boundary of a circular park of diameter 13 metres insuch a way that the differences of its distances from two diametrically opposite fixed gates Aand B on the boundary is 7m. Is it possible to do so? If yes, at what distances from the two gatesshould the pole be erected? cellular-enabled tablets can increase data plan usage, but there are several ways to connect to the internet that will not result in increased data charges. some of these methods include: The political leaders in the elected colonial assemblies insisted that the assemblies possessed the same rights and powers in local affairs as ____________________ enjoyed in britain. A helicopter floats 120m above a helipad, a dog is 85m from the helipad, if the dog could fly, how far would it have to fly to get to helicopter? he earthworm has two types of heart: main and accessory. how many hearts does your earthworm appear to have and does it have a closed or open circulatory system? what is the importance of the speaker of the house you think you might have injured your back while assisting with a patient transfer. you should: Evaluate each expression given that a =-5, b=2 and c=1 evaluate expression 4a-b= Can someone tell me the answer to this please?????