Given the following homogeneous second order linear equation: 4d²y/dx² + 3dy/dx² - 10y = 0 a) Write down the Auxiliary Equation. b) Evaluate the Roots of Auxiliary Equation. c) Evaluate the Complementary Function. 

Answers

Answer 1

The auxiliary equation is 4r² + 3r - 10 = 0. The roots of the auxiliary equation are r₁ = 5/4 and r₂ = -2. The complementary function is y_c = C₁e^(5/4x) + C₂e^(-2x).

a) The auxiliary equation can be obtained by replacing d²y/dx² with r² and dy/dx with r in the equation. Thus, the auxiliary equation is 4r² + 3r - 10 = 0.

b) To find the roots of the auxiliary equation, we can solve the quadratic equation 4r² + 3r - 10 = 0. We can use the quadratic formula: r = (-b ± √(b² - 4ac)) / (2a). Plugging in the values a = 4, b = 3, and c = -10, we get r = (-3 ± √(3² - 4(4)(-10))) / (2(4)). Simplifying further, we have r = (-3 ± √(9 + 160)) / 8, which becomes r = (-3 ± √169) / 8. This gives us two roots: r₁ = (-3 + 13) / 8 = 10 / 8 = 5/4, and r₂ = (-3 - 13) / 8 = -16 / 8 = -2.

c) The complementary function is given by y_c = C₁e^(r₁x) + C₂e^(r₂x), where C₁ and C₂ are constants. Plugging in the values of r₁ and r₂, the complementary function becomes y_c = C₁e^(5/4x) + C₂e^(-2x).

In summary, the auxiliary equation is 4r² + 3r - 10 = 0. The roots of the auxiliary equation are r₁ = 5/4 and r₂ = -2. The complementary function is y_c = C₁e^(5/4x) + C₂e^(-2x).

Learn more about quadratic formula here:

https://brainly.com/question/22364785

#SPJ11


Related Questions

HELP I WILL GIVE BRAINIEST

HELP I WILL GIVE BRAINIEST

Answers

Answer:

13.7

Step-by-step explanation:

It forms a triangle.

They are trying to find the height, cause they say the east-bound car went east so that makes the bottom of the triangle, the width. They also give is the distance in between both cars so that's the hypotenuse so let's set up the equation...

15² - 6² = 189

now we square root it

√189 = 13.7

 

how to calculate marginal pmf

Answers

To calculate marginal PMF (Probability Mass Function), you need to follow these steps:determine the joint PMF of the two random variables X and Y, find the marginal PMF of X,and Y and finally calculate the marginal probabilities

1. First, determine the joint PMF of the two random variables X and Y. This can be done by multiplying the probabilities of the two variables for each possible outcome.
2. Next, to find the marginal PMF of X, you need to sum the joint PMF over all possible values of Y. This can be done using the formula: P(X=x) = ∑ P(X=x, Y=y).
3. Similarly, to find the marginal PMF of Y, you need to sum the joint PMF over all possible values of X. This can be done using the formula: P(Y=y) = ∑ P(X=x, Y=y).
4. Finally, you can use the marginal PMFs to calculate the marginal probabilities of each outcome for X and Y.

So, the marginal PMF can be calculated by summing the joint PMF over all possible values of the other variable.

Learn more about Probability Mass Function:https://brainly.com/question/24074392

#SPJ11

A rectangular pyramid fits exactly on top of a rectangular prism. The prism has a length of 18 cm, a width of 6 cm, and a height of 9 cm. The pyramid has a height of 15 cm. Find the volume of the composite space figure.

How am I supposed to know I need an explanation or answer. Thanks!

Answers

The required volume of the given composite space figure is 1512 \(cm^3\).

Given that, the rectangular pyramid fits exactly on top of a rectangular prism. The length of the prism is 18 cm, width is 6 cm and height is 9 cm. The length of the pyramid is 18 cm, width is 6 cm and height is 15 cm.

To find the volume of the composite figure formed by the rectangular pyramid on top of the prism, find the volume of prism and pyramid and then add it .

The volume of the prism is given by V1 = length × width × height.

The volume of the pyramid is given by V2 = length × width × height.

The volume of the composite figure is V = V1 +V2.

By using the given data and formula, find the volume of the prism,

Volume of prism V1 = length × width × height.

Volume of prism V1 = 18 × 6 × 9.

Thus, Volume of prism V1 = 972 \(cm^3\) .

By using the given data and formula, find the volume of the pyramid,

Volume of pyramid V2 = (length × width × height)/3.

Volume of pyramid V2 = (18 × 6 × 15)/3.

Thus, Volume of pyramid V2 =  1620/3= 540 \(cm^3\) .

By using above volumes, find the volume of the composite figure.

V = V1 +V2.

V = 972 + 540.

V = 1512 \(cm^3\) .

Hence, the required volume of the given composite space figure is

1512 \(cm^3\)

Learn more about volume click here:
https://brainly.com/question/29753475

#SPJ1

The ratio of girls to boys in Liza’s classroom is 5 to 4. How many girls are in her classroom if there is a total of 27 students?

Answers

Answer:

Number of girls =  15

Step-by-step explanation:

girls : boys = 5 : 4

Number of girls = 5x

Number of boys = 4x

Total students = 27

5x +4x = 27

9x = 27

x = 27/9

x = 3

Number of girls = 5x = 5*3 = 15

30 POINTS!!, SHOW WORK The figure is a rhombus. Find the value of x.
a) x = 13
b) x = 12
c) x = 169
d) x = 119

30 POINTS!!, SHOW WORK The figure is a rhombus. Find the value of x.a) x = 13b) x = 12c) x = 169d) x

Answers

Answer:

x = 13

Step-by-step explanation:

The diagonals of rhombi are perpendicular and form a right angle at their intersection.  Furthermore, they bisect each other and create four congruent segment.  Thus, the measures of the other two sides of the triangle shared by x is 5 and 12.

Thus, x is the hypotenuse of the triangle and is opposite the right angle.

Since we have a right triangle, we can find x using the Pythagorean theorem, which is

a^2 + b^2 = c^2, where

a and b are the shorter sides called legs,and c is the longest side of the hypotenuse.

We plug in 5 and 12 for a and b, allowing us to solve for c (aka x):

5^2 + 12^2 = c^2

25 + 144 = c^2

169 = c^2

13 = c

Thus, x = 13 units

What is an equation of the line that passes through the points (-6,0) and (8,7)

please help! i will give brainliest!

Answers

Answer: y=1/2x+3

Step-by-step explanation:

y-0=1/2(x+6) : point-slope

x-2y=-6 : standard

Answer:

Step-by-step explanation: Plug coordinates into y=ax+b

Simultaneous equations

0=-6a+b

7=8a+b

so 7=14a

a=0.5

Then b=3

So y=0.5x+3

BRAINLIEST PLEASE THX

Please help, this assignment is 100 points and I don’t know the answer to this one

Please help, this assignment is 100 points and I dont know the answer to this one

Answers

Using the continuity concept, it is found that the discontinuities of the functions are given as follows:

f(x): x = -2.g(x): x = 4.

What is the continuity concept?

A function f(x) is continuous at x = a if it is defined at x = a, and:

\(\lim_{x \rightarrow a^-} f(x) = \lim_{x \rightarrow a^+} f(x) = f(a)\)

In a graph, a function is discontinuous at open intervals, with examples for this problem given by:

f(x): x = -2.g(x): x = 4.

For both functions, the lateral limits are the same, however, since the functions are not defined at these points, they have discontinuities.

More can be learned about the continuity of functions at https://brainly.com/question/24637240

#SPJ1

Jeremy stands so that his shadow and the shadow
cast by a flag pole end at the same point. If Jeremy is exactly
74 inches tall, what is the height of the flagpole in feet?

Answers

This suggests that the angle of the sun is such that the shadow of Jeremy and the shadow of the flagpole are not proportional. In this case, we cannot determine the height of the flagpole.

What are similar triangles?

Similar triangles are triangles that have the same shape but different sizes. Specifically, two triangles are similar if their corresponding angles are congruent (have the same measure) and their corresponding sides are in proportion (have the same ratios).

We can use similar triangles to solve this problem. Let's call the height of the flagpole "h" (in inches), and let's call the distance from the base of the flagpole to the point where the shadows meet "d" (in inches).

Since the shadows are the same length, we know that the ratio of the height of Jeremy to the distance from Jeremy to the point where the shadows meet is the same as the ratio of the height of the flagpole to the distance from the base of the flagpole to the point where the shadows meet. In other words:

74 / d = h / (d + h)

We can solve for "h" by cross-multiplying and simplifying:

74(d + h) = dh

74d + 74h = dh

h = (74d) / (d - 74)

Now we just need to substitute the given value of Jeremy's height (74 inches) for "d" and convert the result to feet:

h = (74 x 74) / (74 - 74)

h = 74 x 74 / 0

h = undefined

Therefore,  This suggests that the angle of the sun is such that the shadow of Jeremy and the shadow of the flagpole are not proportional. In this case, we cannot determine the height of the flagpole.

To learn more about Similar triangles from given link.

https://brainly.com/question/29191745

#SPJ1

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:

cos(A-B)=cosACosB+sinAsinB


find cos(A-B)

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant

Answers

Using trigonometric identity, cos(A-B) is:

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

How to find cos(A-B) using the trigonometric identity?

Trigonometry deals with the relationship between the ratios of the sides of a right-angled triangle with its angles.

If sin A = 1/3 and A terminates in Quadrant 1. All trigonometric functions in Quadrant 1  are positive

sin A = 1/3 (sine = opposite/hypotenuse)

adjacent = √(3² - 1²)

               = √8 units

cosine = adjacent/hypotenuse. Thus,

\(cos A = \frac{\sqrt{8} }{3}\)

If cos B = 2/3 and B terminates in Quadrant 4.

opposite = √(3² - 2²)

                = √5

In  Quadrant 4, sine is negative. Thus:

\(sin B = \frac{\sqrt{5} }{3}\)

We have:

cos(A-B) = cosA CosB + sinA sinB

\(cos (A-B) = \frac{\sqrt{8} }{3} * \frac{2}{3} + \left \frac{1}{3} * \frac{\sqrt{5} }{3}\)

\(cos (A-B) = \frac{2\sqrt{8} }{9} + \left\frac{\sqrt{5} }{9}\)

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

Learn more about Trigonometry on:

brainly.com/question/11967894

#SPJ1

For all integer values of x and constant k, if (x+6)(x+k)=x^2+14x+48, what is the value of k?

Answers

Answer:

  8

Step-by-step explanation:

The product of terms on the left of the equal sign is ...

  (x+6)(x+k) = x^2 +(6+k)x +6k

So, you have two clues to the value of k. The coefficient of x must match, and the constant must match.

  6+k = 14   ⇒   k = 8

  6k = 48   ⇒   k = 8

The value of k is 8.

Please❤️!!!!!!!!!!!!!

Please!!!!!!!!!!!!!

Answers

Answer: Hopeful (C) or Happy (D)

Step-by-step explanation:

It's saying a women walked into the room with joy as she's telling her plans.

Hopeful means feeling or inspriring optimism about a futer event.

Happy means feeling pleasure or cheerful.

Three vertices of a parallelogram are (4,7), (7,7), and (9,2). Where should the next points be to graph a parallelogram.

Answers

Plotting the points into the rectangular coordinate system :

The next point should be in the same level as the point (9, 2)

The measurement of top and bottom side must be the same.

By counting, the measurement of top is 3, so the bottom must be 3 also.

Counting 3 units to the left of (9, 2), we will get the point (6, 2)

The answer is (6, 2)

Three vertices of a parallelogram are (4,7), (7,7), and (9,2). Where should the next points be to graph

Let Y1,Y2, . . . , Yn denote a random sample from a population with pdf f(y|θ)=(θ+1)yθ, 0−1.a. Find an estimator for θ by the method of moments. b. Find the maximum likelihood estimator for θ.

Answers

a. Method of Moments:

To find an estimator for θ using the method of moments, we equate the sample moments with the population moments.

The population moment is given by E(Y) = ∫yf(y|θ)dy. We need to find the first population moment.

E(Y) = ∫y(θ+1)y^θ dy

= (θ+1) ∫y^(θ+1) dy

= (θ+1) * (1/(θ+2)) * y^(θ+2) | from 0 to 1

= (θ+1) / (θ+2)

The sample moment is given by the sample mean: sample_mean = (1/n) * ∑Yi

Setting the population moment equal to the sample moment, we have:

(θ+1) / (θ+2) = (1/n) * ∑Yi

Solving for θ, we get:

θ = [(1/n) * ∑Yi * (θ+2)] - 1

θ = [(1/n) * ∑Yi * θ] + [(2/n) * ∑Yi] - 1

θ - [(1/n) * ∑Yi * θ] = [(2/n) * ∑Yi] - 1

θ(1 - (1/n) * ∑Yi) = [(2/n) * ∑Yi] - 1

θ = ([(2/n) * ∑Yi] - 1) / (1 - (1/n) * ∑Yi)

Therefore, the estimator for θ by the method of moments is:

θ_hat = ([(2/n) * ∑Yi] - 1) / (1 - (1/n) * ∑Yi)

b. Maximum Likelihood Estimator (MLE):

To find the maximum likelihood estimator (MLE) for θ, we need to maximize the likelihood function.

The likelihood function is given by L(θ) = ∏(θ+1)y_i^θ, where y_i represents the individual observations.

To simplify the calculation, we can take the logarithm of the likelihood function and maximize the log-likelihood instead. The log-likelihood function is given by:

ln(L(θ)) = ∑ln((θ+1)y_i^θ)

= ∑(ln(θ+1) + θln(y_i))

= nln(θ+1) + θ∑ln(y_i)

To find the maximum likelihood estimator, we take the derivative of the log-likelihood function with respect to θ and set it equal to zero:

d/dθ [ln(L(θ))] = n/(θ+1) + ∑ln(y_i) = 0

Solving for θ, we get:

n/(θ+1) + ∑ln(y_i) = 0

n/(θ+1) = -∑ln(y_i)

θ + 1 = -n/∑ln(y_i)

θ = -1 - n/∑ln(y_i)

Therefore, the maximum likelihood estimator for θ is:

θ_hat = -1 - n/∑ln(y_i)

Learn more about function here: brainly.com/question/32386236

#SPJ11

Here is a rectangle with length 5 units and width 2 units.

1. What is the area of the rectangle?

2. Dilate rectangle ABCD from point A by a scale factor of 2. Calculate the area of the image.

3. Dilate rectangle ABCD from point A by a scale factor of 3. Calculate the area of the image.

Here is a rectangle with length 5 units and width 2 units.1. What is the area of the rectangle?2. Dilate

Answers

The area of the rectangle is 10 square units.If the rectangle is dilated from point A by a scale factor of 2, the area of the image is 40 square units.If the rectangle is dilated from point A by a scale factor of 3, the area of the image is 90 square units.What is scale factor?

This refers to the ratio between the scale of a given original object and a new object. It is its representation but of a different size (bigger or smaller). For example, if we have a rectangle of sides 2 cm and 4 cm, we can enlarge it by multiplying each side by a number, say 2.

Solving for the area and scale factor we have:

L= 5 units

W = 2 units

The area of the rectangle =L * W

A = (5 x 2)

A = 10 square units.

If the rectangle is dilated from point A by a scale factor of 2, the area of the image:

A= (Scale factor of  L * W)*  L * W

= (2 x 2 x 5 x 2)

A = 40 square units.

If the rectangle is dilated from point A by a scale factor of 3, the area of the image is:

A= (Scale factor of  L * W)*  L * W

= (3 x 3 x 5 x 2)

A= 90 square units

Learn more about area on

https://brainly.com/question/29082330

#SPJ1

4. A parking lot of rectangular shape has a perimeter of 420m. The width is three-fourths

of the length. What are the dimensions of the parking lot? Sketch the rectangle and show

all steps.

Answers

Answer:

Width: 90m

Length: 120m

Step-by-step explanation:

Width = 3/4x

Length = x

2(3/4x) + 2x = 420m

6/4 x + 2x = 420m. (6/4 + 2 = 7/2)

7/2x = 420m

7x = (420)*(2)

x = 840/7 = 120

Width = (120)*(3/4) = 90

Length: 120

2(90)+2(120)= 420m

Y=5x if 5 is the input what is the output

Answers

Answer:

25

Step-by-step explanation:

When we say input, we typically mean what we put in and in this case it is likely "x". Y is the output we get after we input the desired number.

So if I replace the x with "5" like the question asks me to do, I get

y = 5 (5)

y= 25

So my output is 25.

Please help! I WILL GIVE BRAINLIEST TO WHOEVER GIVES THE CORRECT ANSWER FIRST!!!!!!!

It takes pump A 2 hours less time that pump B to empty a swimming pool. Pump A is started at 8:00 a.m. and pump B is started at 10:00 a.m. At 12:00 p.m. 60% of the pool is empty when pump B broke down. How much time after 12:00 p.m. would it take pump A to empty the pool?

Answers

Answer:

HERE YOU GO

Step-by-step explanation:

x2 - 4x + 2 + y2 - 4y + 2 = 4 : expand equation of first circle

x2 - 2x + 1 + y2 - 2y + 1 = 4 : expand equation of second circle

-2x - 2y - 6 = 0 : subtract the left and right terms of the above equations

y = 3 - x : solve the above for y.

2x2 - 6x + 1 = 0 : substitute y by 3 - x in the first equation, expand and group like terms.

(3/2 + √(7)/2 , 3/2 - √(7)/2) , (3/2 - √(7)/2 , 3/2 + √(7)/2) : solve the above for x and use y = 3 - x to find y.

Answer:

5/3 hours   or 1 hour and 40 minutes

Step-by-step explanation:

I need help like asap

I need help like asap

Answers

From two pints (4 cups) of milk, you can make 12 servings.

To find the number of servings that can be made from two pints of milk, we first need to convert the given measurements into cups.

Given that 1 pint is equal to 2 cups, we can determine that two pints would be 2 pints * 2 cups/pint = 4 cups of milk.

The recipe states that 3 cups of milk are required to make 9 servings. This implies that each serving needs 3 cups / 9 servings = 1/3 cup of milk.

To determine the number of servings that can be made from 4 cups of milk, we divide the total amount of milk by the amount of milk required per serving:

4 cups / (1/3 cup per serving) = 4 cups * (3/1) = 12 servings.

For more questions on pints

https://brainly.com/question/27434208

#SPJ8

The coordinates of the four vertices of quadrilateral ABCD are listed below
4
• A(-3,3)
.
.B(2,6)
. C(5, 1)
. D(-5,-5)
Which statement proves whether or not this quadrilateral is a rectangle?
OA
The slope of CD is-
rectangle
OB The slope of AB is
-5-1
-5-5
OD. The slope of AB is
6-3
2-(-3)
3
5
6-3
2-(-3)
3
and the slope of DA IS
OC. The slope of BC is and the slope of CD is
rectangle
3-(-5)
-3-(-5)
and the slope of BC is These two segments are perpendicular, so the shape is a rectangle.
These two segments are not perpendicular, so the shape is not a
These two segments are not perpendicular, so the shape is not a
and the slope of CD is-7
These two segments are perpendicular, so the shape is a rectangle.

The coordinates of the four vertices of quadrilateral ABCD are listed below4 A(-3,3)..B(2,6). C(5, 1).

Answers

For the quadrilateral ABCD the statement which proves that this quadrilateral is not a rectangle is (a) The slope of CD is "(-5-1)/(-5-5) = 3/5", and the "slope of DA is [3-(-5)]/[-3-(-5)] = 8/2", these "two-segments" are not perpendicular , so the shape is not a rectangle;

The coordinates of the "four-vertices" of the quadrilateral ABCD are :

A(-3,3), B(2,6), C(5, 1), D(-5,-5);

To prove whether the quadrilateral is a rectangle or not, we need to show that its adjacent sides are perpendicular and its diagonals are congruent.

In this question, we are given the coordinates of the four vertices of the quadrilateral.

To determine if it's a rectangle, we use the slope formula to find the slopes of the sides of the quadrilateral. If slopes of adjacent sides are "negative-reciprocals" of each other, then they are perpendicular. If the slopes of the diagonals are equal, then they are congruent.

Using the given coordinates, we find that the slope of CD is = (-5-1)/(-5-5) = 3/5, and

The slope of DA is = [3-(-5)]/[-3-(-5)] = 8/2. These two slopes are not negative reciprocals of each other, so CD and DA are not perpendicular.

So, the quadrilateral is not a rectangle.

Therefore, the correct option is (a).

Learn more about Slope here

https://brainly.com/question/29149364

#SPJ1

The given question is incomplete, the complete question is

The coordinates of the "four-vertices" of the quadrilateral ABCD are :

A(-3,3), B(2,6), C(5, 1), D(-5,-5);

Which statement proves whether or not this quadrilateral is a rectangle?

(a) The slope of CD is (-5-1)/(-5-5) = 3/5, and the slope of DA is 3-(-5)/-3-(-5)=8/2, these two segments are not perpendicular , so the shape is not a rectangle;

(b) The slope of AB is (6-3)/(2-(-3) = 3/5, and slope of BC is (6-1)/(2-5) = -5/3, these two segments are perpendicular , so the shape is a rectangle;

(c) The slope of BC is (6-1)/(2-5) = -5/3, and slope of CD is (-5-1)/(-5-5) = 3/5, these two segments are not perpendicular, so the shape is not a rectangle;

(d) The slope of AB is (6-3)/(2-(-3) = 3/5, and slope of CD is (-5-1)/(-5-5) = 3/5, these two segments are perpendicular , so the shape is a rectangle;

Solve for x in a right triangle (show work)

Solve for x in a right triangle (show work)

Answers

Answer:

35.09°

Step-by-step explanation:

You can use cos theta to find the value of x.

Let us solve now.

They have already given the lengths of the hypotenuse and adjacent.

Hypotenuse = 33

Adjacent = 27

Let us solve now.

Cos x = Adjacent ÷ Hypotenuse

Cos x = 27 ÷ 33

Cos x = 0.8181

x = Cos⁻¹ 0.8181

x = 35.09°

Hope this helps you :-)

Let me know if you have any other questions :)

Solve for x in a right triangle (show work)

I KNOW THIS IS KIND OF ALOT BUT PLEASE HELP
Billy and Tom are out to dinner. Their bill comes to a total of $100. They have a 15% off coupon but tax and tip must also be included. The tax is 6% and is applied before the 20% tip. If Billy and Tom want to split the bill, how much will they each have to pay?

1. How much is their bill after the coupon has been applied?
2. With the coupon applied, what is their new total (including the tax)?
3. With their new total, Billy and Tom can now determine the tip for their server. What is the final total, including the tip?
4. What will Billy and Tom each have to pay to split the bill evenly?

Please answer labeled with numbers! thankyou!

Answers

Answer:

1. $85

2. $90.10

3.$108.12

4.$54.06

Step-by-step explanation:

100-15=85 (15% of 100 is 15)

6 percent of 85 is 5.10. So 85 + 5.10=90.10

20 percent of 90.10 is 18.02. So add that to the total. 90.10+18.02=108.12

Now divide by 2 to get how much they each will pay 108.12/2 = 54.06

Percentage of students admitted into three universities are given as 20%, 30%, 40% respectively. Probabilities that a student admitted in these
universities getting placements are given by 0.3, 0.5, and 0.6 respectively. Find the probability that a student from these universities getting
placement.

Answers

the probability that a student from these universities gets a placement is 0.45 or 45%.

To find the probability that a student from these universities gets a placement, we need to calculate the weighted average of the placement probabilities based on the admission probabilities.

Let's denote the admission probabilities as P(A1), P(A2), and P(A3) for universities 1, 2, and 3, respectively. Similarly, let's denote the placement probabilities as P(P1), P(P2), and P(P3) for universities 1, 2, and 3, respectively.

The probability of a student getting placement can be calculated as:

P(Placement) = P(A1) * P(P1) + P(A2) * P(P2) + P(A3) * P(P3)

Given that P(A1) = 0.20, P(A2) = 0.30, P(A3) = 0.40, P(P1) = 0.3, P(P2) = 0.5, and P(P3) = 0.6, we can substitute these values into the equation:

P(Placement) = (0.20 * 0.3) + (0.30 * 0.5) + (0.40 * 0.6)

P(Placement) = 0.06 + 0.15 + 0.24

P(Placement) = 0.45

To know more about equation visit:

brainly.com/question/14686792

#SPJ11


In the equation a= 3/b is a positive, real number. As the
value of b is increased so it becomes closer and closer to
infinity, what happens to the value of a ?

Answers

Answer:

The value of a tends to zero

Step-by-step explanation:

Given the expression a = 3/b

as the denominator of the of the expression b increases the value of the output is known to be decreasing. if the value of b now goes so large to become an infinite, value then the value of a will goes to zero as shown;

If b = ∞

a = 3/∞

a = 0

Note that for any constant value a, the ratio a/∞ will always tends to zero

What is ""house flipping?""
a. the process of transferring ownership of a house from one person to another.
b. the process of buying a house with the intention of selling it for a profit after only a short time.
c. the process of two people exchanging the titles to their properties.
d. the process of a house’s market price rapidly fluctuating. please select the best answer from the choices provided a b c d

Answers

house flipping is the buying of a house for a low price with the intention of reselling it for a profit after a short period of time.

Buyers that acquire distressed houses, patch them up, and then resell them for a profit are included. These properties are often found through foreclosures, bank short sales, or property auctions.

To be successful at real estate flipping, you must be able to manage your money properly and invest in inexpensive homes. These are generally properties that need a lot of attention.

Following that, you'll need to spend on modifications that will boost the resale value of the house and draw the attention of a possible buyer. When the improvements are finished, you must list and advertise the home.

Learn more about house flipping here: https://brainly.com/question/7976922

#SPJ4

Velocity is measuring distance per unit of time.



True

False

Answers

Answer:

\(false \\ velocity \: is \: the \: displacement \: per \: \\ unit \: time \\ thank \: you\)

A machine used to fill cans of Campbell’s tomato soup (low salt) has the following characteristics: µ = 12 ounces and s = .5 ounces.
a. Depict graphically the sampling distribution of all possible values of , where is the sample mean (point estimator) for 30 cans selected randomly by a quality control inspector.
b. What is the probability of selecting a sample of 36 cans with a sample mean greater than 12.2 ounces?

Answers

1. The x-axis represents the sample mean (\(\bar x\)), and the y-axis represents the probability density.

2. The probability represents the area under the standard normal curve to the right of z = 2.197.

What is probability?

Probability is a way to gauge how likely something is to happen. Many things are difficult to forecast with absolute confidence. Using it, we can only make predictions about the likelihood of an event happening, or how likely it is.

a. To depict the sampling distribution of all possible values of the sample mean, we can use a probability distribution graph, specifically a normal distribution graph.

Given that the population mean (µ) is 12 ounces and the population standard deviation (s) is 0.5 ounces, and assuming that the sample size is sufficiently large (n = 30), we can use the Central Limit Theorem to approximate the sampling distribution of the sample mean as a normal distribution.

The mean of the sampling distribution (\(\mu_\bar x\)) will be the same as the population mean, which is 12 ounces.

The standard deviation of the sampling distribution (\(\sigma_\bar x\)) can be calculated using the formula \(\sigma_\bar x\) = s / √n, where s is the population standard deviation and n is the sample size. In this case, \(\sigma_\bar x\) = 0.5 / √30 ≈ 0.091 ounces.

Using these values, we can plot a normal distribution curve with the mean at 12 ounces and the standard deviation of 0.091 ounces. The x-axis represents the sample mean (\(\bar x\)), and the y-axis represents the probability density.

b. To find the probability of selecting a sample of 36 cans with a sample mean greater than 12.2 ounces, we need to calculate the area under the sampling distribution curve to the right of 12.2 ounces.

First, we need to standardize the value of 12.2 ounces using the formula z = (\(\bar x\) - \(\mu_\bar x\)) / \(\sigma_\bar x\), where \(\bar x\) is the given sample mean, \(\mu_\bar x\) is the mean of the sampling distribution, and \(\sigma_\bar x\) is the standard deviation of the sampling distribution.

In this case, \(\bar x\) = 12.2 ounces, \(\mu_\bar x\) = 12 ounces, and \(\sigma_\bar x\) = 0.091 ounces.

z = (12.2 - 12) / 0.091 ≈ 2.197

Now, we can find the probability using the standard normal distribution table or statistical software. The probability represents the area under the standard normal curve to the right of z = 2.197.

Learn more about probability on:

https://brainly.com/question/13604758

#SPJ4

A cylindrical container if radius 4 cm and height 15 cm is half filled with water. Find the volume of water in the container

Answers

Answer:

= 0.377 liters

= 377 mililiters

Step-by-step explanation:

Volume of a regular cylindrical container = л r ² h

л = 3.1416   (aprox,)

r = radius

h = height = 15cm (half filled) = 15/2 = 7.5cm

then:

Volume = 3.1416 * (4cm)² * 7.5cm

volume = 3.1416 * 16cm² * 7.5cm

volume =  377 cm³      (aproximadly)

1 cm³ = 0.001 liters

377 cm³ = 0.001*377 = 0.377 liters = 377 mililiters

Completing Proofs Involving Linear Pairs

Given: m ZELG = 124°

Prove: x = 28

Statements

Reasons

1. m ZELG = 124

1. given

2. m ZELD = 2x

2. given

H

L

3. ZELG and ZELD are

a linear pair

3. definition of a linear pair

(2x)

G

4. m ZELD + m ZELG = 180

4.

Ε

• F.

5. 2x + 124 = 180

5. substitution

Complete the steps in the two-column proof.

6.

6. subtraction property

7. x = 28

7. division property

Intro

Done

vity

Answers

Answer:

1. angle addition post

2. 2x=56

The corresponding angles of the lines solved and the value of x = 28°

What are angles in parallel lines?

Angles in parallel lines are angles that are created when two parallel lines are intersected by another line. The intersecting line is known as transversal line.

We can conclude three factors determining parallel lines ,

Alternate angles are equal

Corresponding angles are equal

Co-interior angles add up to 180°

Given data ,

Let the measure of ∠ELG = 124°

The measure of ∠ELD = 2x

∠ELG and ∠ELD are a linear pairs of angles

So , the measure of ∠ELG  + ∠ELD = 180°

On simplifying , we get

2x + 124° = 180°

Subtracting 124° on both sides , we get

2x = 56°

Divide by 2 on both sides , we get

x = 28°

Therefore , the value of x is 28°

Hence , the angle is x = 28°

To learn more about angles in parallel lines click :

https://brainly.com/question/27400033

#SPJ7

How do i find the slope

How do i find the slope

Answers

Answer:

y=1/2x

Step-by-step explanation:

Its a positive slope so you go up 2 then right 4

Answer:

slope = \(\frac{1}{2}\)

Step-by-step explanation:

Calculate the slope m using the slope formula

m = \(\frac{y_{2}-y_{1} }{x_{2}-x_{1} }\)

with (x₁, y₁ ) = (0,  0) and (x₂, y₂ ) = (6, 3) ← 2 points on the line

m = \(\frac{3-0}{6-0}\) = \(\frac{3}{6}\) = \(\frac{1}{2}\)

How many ways are there to distribute 10 distinct books to 10 children (one to a child) and then collect the books and redistribute them (one to a child) with each child getting a new book?

Answers

There are 10! (10 factorial) ways to initially distribute the 10 distinct books to the 10 children. When collecting the books and redistributing them, each child will receive a new book. Therefore, the number of ways to redistribute the books is also 10! (10 factorial).

Initially, there are 10 distinct books and 10 children. Each book can be given to any of the 10 children, so the first book has 10 choices, the second book has 9 choices (since one book has already been given away), the third book has 8 choices, and so on. This continues until the last book, which has only one choice. Therefore, the number of ways to initially distribute the books is calculated as 10 x 9 x 8 x 7 x 6 x 5 x 4 x 3 x 2 x 1, which is equal to 10!.

When the books are collected and redistributed, each child needs to receive a new book. Since all the books are distinct, each child has 10 options to choose from (excluding the book they already have). The second distribution is independent of the first distribution, so the number of ways to redistribute the books is again 10!. Therefore, the total number of ways to distribute and then redistribute the 10 distinct books to the 10 children, with each child getting a new book each time, is 10!.

Learn more about independent here:

https://brainly.com/question/31707382

#SPJ11

Other Questions
What are 3 purposes of monetary policy? Any basis of R4 contains 4 elements. Select one: O True O False in addition abo and rh, approximately ________ other erythrocyte antigen groups have been discovered. 7th grade math help me pleaseee symptoms for this hemorrhagic fever are fever, headache, joint and muscle aches, sore throat, and weakness. this followed by diarrhea, vomiting, and stomach pain. a rash, red eyes, hiccups and internal and external bleeding may be seen in some patients. what is this disease? Question 14 1 points Save Answer Match the name of the approach towards implementing a control plane with a description of how this approach works. v Per-router control plane. A. A typically) remote controller computes and installs forwarding tables in routers. ? Software-defined networking (SDN). B. An individual routing algorithm components in each and every router interact in the control plane C. The network operator installs forwarding tables using the Simple Network Management Protocols (SNMP). write a report on the solar system How important were the compositions of Palestrina during the Renaissance periodt. Which of the following statements is true?A. Quackery is the practice of dietetics without proper training and credentials.B. A nutritionalist has the same credentials as a registered dietitian nutritionist.C. In general, registered dietitian nutritionists are reliable sources of nutrition information.D. A person with a PhD has the proper training to be a registered dietitian nutritionist. The nurse obtains all of the following assessment data about a patient with deficient fluid volume caused by a massive burn injury. Which of the following assessment data will be of greatest concern?a.The blood pressure is 90/40 mm Hg.b.Urine output is 30 ml over the last hour.c.Oral fluid intake is 100 ml for the last 8 hours.d.There is prolonged skin tenting over the sternum. Please help me with this! _____ is the most direct way for a minority to block action in congress. Read the excerpt from the article Skara Brae:After the houses were built, the villagers furnished their homes with stone beds, one on each side of the door, a stone dresser, and a fireplace, or hearth. The hearth kept the home warm and allowed the inhabitants to cook their food.The people of Skara Brae then farmed the surrounding lands, with evidence suggesting that they grew barley and other grains. They kept cows and pigs, and they fished in the ocean for a good part of their diet.Select a detail from the excerpt from Skara Brae that demonstrates that it has a chronological text structure. The garbage helped to insulate and protect the homes. The hearth kept the home warm and allowed the inhabitants to cook their food. The people of Skara Brae then farmed the surrounding lands. They kept cows and pigs, and they fished in the ocean for a good part of their diet. electrons in core orbitals contribute significantly to bonding of molecules. group of answer choices true false given that an e2 reaction proceeds with anti periplanar stereochemistry, draw the products of each elimination. the alkyl halides in (a) and (b) are diastereomers of each other. how are the products of these two reactions related? when drawing alkene substituents, remember that it is preferable to draw them as regular lines than as dashes and wedges. What is the slope of the line that passes through the points (-10, -8) and(-8, -16)? Write your answer in simplest form. On January 1, 2017, Pennington Corporation purchased 30% of the common shares of Edwards Company for $180,000. During the year, Edwards earned net income of $80,000 and paid dividends of $20,000. Prepare the entries for Pennington to record the purchase and any additional entries related to this investment in Edwards Company in 2017. if u help me ill give u brainliest central plains joropo provides a good example of musical transculturation in that_______ 5. How many moles are there in 222.3 grams of Ca(OH)2? (1) 1.5 mol (3) 5.5 mol (2) 3.0 mol (4) 22.3 mol 5