enter the complete molecular equation that demonstrates how this buffer neutralizes added acid (hcl)(NaOH) .

Answers

Answer 1

The salt solution has served as a buffer system, preventing pH changes caused by the addition of acid or base to the solution.

Since the hydrogen ion is a component of the acid, it reacts with the base to produce salt, which prevents the pH from changing too much.

The buffer solution's acid addition has been specified as:

\(HCl +NH_{3} > > > NH_{4} Cl\)

To prevent the pH from changing, the base addition to the buffer combines with the acid component to create salts.

Following are the instructions for adding the base, NaOH, to the buffer solution:

\(NaOH + NH_{4} ^{+} > > > > > Na^{+}+ NH_{3}+ H_{2}O\)

A buffer solution is an aqueous mixture of a weak acid and either its conjugate base or the base itself. When a modest amount of a strong acid or base is applied to it, the pH hardly changes at all.

For more information on buffer solution kindly visit to

https://brainly.com/question/15709146

#SPJ4


Related Questions

a weather balloon is inflated to a volume 2.2 10square3 L with 374g of helium. what is the density of helium in grams per liter

Answers

Answer:

Density = 0.17 g/L

Explanation:

It is given that,

Volume of the inflated balloon filled with Helium, \(V=2.2\times 10^3\ L\)

Mass, m = 374 g

We need to find the density of helium. It is equal to its mass per unit volume. It can be given by :

d =m/V

\(d=\dfrac{374\ g}{2.2\times 10^3\ L}\\\\=0.17\ g/L\)

So, the density of helium in the balloon is 0.17 g/L.

What does the rate law tell you about a reaction?
A. How the concentration of the reactants affects the rate of a
reaction
B. How temperature affects the rate of a reaction
C. How the equilibrium constant is related to the rate of a reaction
D. How the rate of a reaction affects the total time of a reaction

Answers

Answer:

A. How the concentration of the reactants affects the rate of a reaction

Explanation:

Let's consider a generic reaction.

A + B ⇒ Products

The generic rate law is:

rate  = k × [A]ᵃ × [B]ᵇ

where,

rate: rate of the reaction[A] and [B]: molar concentrations of the reactantsk: rate constanta and b: reaction orders

As we can see, the rate law shows how the concentration of the reactants affects the rate of a reaction.

Energy is released when new bonds are formed.
(true of false btw)

Answers

true bc energy releases new bond

Answer:

False. Energy can only be released when bonds are broken. consider the result when atoms are tron appart.

What are the biggest challenges when it comes to recycling Polyolefins for Mechanical Recycling.

Answers

Answer:

The use of post-consumer polyolefins is increasing due to the pledges of multiple organizations to use higher concentrations of recycled materials in packaging. However, direct food contact applications are challenging with various regulations around the world mandating minimum safety requirements, which is often determined by the condition of use (microwave, cold storage) and food type (fatty, aqueous, dry). This article reviews different predictive models that have been developed to study contaminant migration from packaging to food contact articles. It also examines multiple techniques and methods that have been employed to quantify and assess to the safety of recycled materials (e.g., United States and Europe) which serve as a base for the regulatory framework for many other countries. The presence of different contaminants during polymer processing is also discussed due to potential problems from the presence of harmful compounds affecting human health or degradation of material properties.

An aqueous sodium chloride solution is made using 148g of sodium chloride diluted to a total solution volume of 1,490mL. Calculate the molality of the solution. Do not include units in your answer​

Answers

The molality of the solution is 1.89 mol/kg

What is molality?

Molality is defined as the number of moles of solute per kilogram of solvent. To calculate the molality of the aqueous sodium chloride solution, we need to first calculate the number of moles of sodium chloride in the solution, and then determine the mass of water in the solution.

The molar mass of sodium chloride (NaCl) is 58.44 g/mol. Therefore, the number of moles of NaCl in the solution is:

148 g / 58.44 g/mol = 2.53 mol

The mass of water in the solution is the total mass of the solution minus the mass of the solute:

Mass of water = Total mass of solution - Mass of NaCl

Mass of water = 1490 mL x 1 g/mL - 148 g

Mass of water = 1342 g

The mass of water in kilograms is:

Mass of water (kg) = 1342 g / 1000 g/kg = 1.342 kg

Therefore, the molality of the solution is:

Molality = 2.53 mol / 1.342 kg ≈ 1.89 mol/kg

Learn more about molality here : brainly.com/question/6532653

#SPJ1

What type of bonding would be expected in argon?

Answers

Answer:

Argon is a member of the noble gas family of elements. This means that it already has eight valence electrons in its outermost shell. Because of this, Ar rarely bonds with other atoms to form compounds

Explanation:

Determine the number of moles within a sample of 10g of propane(C3H8). Round your answer to 2 decimal places with proper units.

Answers

Given :

10 gram sample of propane( C₂H₈ ).

To Find :

The number of moles of propane in given sample.

Solution :

Molecular mass of propane, M = (2 × 12) + ( 1 × 8 ) gram/mol

M = 32 gram/mol

We know, number of moles is given by :

Number of moles, n = m/M

n = 10/32 mol

n = 0.3125 mol

Therefore, number of moles in given sample is 0.3125 mol.

This is due tomorrow please help!

This is due tomorrow please help!

Answers

Answer:

Normal Fault -> Tension

Reverse Fault -> Compression

Strike-Slip Fault -> Shearing

Explanation:

Normal Fault -> Tension

[] A normal fault is when the walls are being pulled apart and is caused by tension

[] Example:

         <-       ->

Reverse Fault -> Compression

[] A reverse fault is when the walls are being pushed together and is caused by compression

[] Example:

         ->        <-

Strike-Slip Fault -> Shearing

[] A strike-slip fault is when the walls are being pushed apart in parallel directions and is caused by shearing

[] Example:

         /\         \/

Note: The page you provided also gives the answers for this specific question.

Have a nice day!

     I hope this is what you are looking for, but if not - comment! I will edit and update my answer accordingly. (ノ^∇^)

- Heather

what is empirical formula ?Meaning of empirical formula

Answers

Answer: empirical formula of any compound is the simplest proportion of elements in that compound (i.e. the composition of elements in compound is in simplest ratio ) .It does not provide actual formula of any compound.

molecular formula=n-factor * empirical formula

molecular formula - C6H12O6 (glucose)

empirical formula - CH2O

C6H12O6 * CH2O

what is empirical formula ?Meaning of empirical formula

Predict and explain the structure of the major and minor products when hydrogen bromide is added to 2-methylbut-2- ene, (Ch3)2CCHCH3
Pls help with homework!!!!

Answers

When hydrogen bromide (HBr) is added to 2-methylbut-2-ene ((CH3)2CCHCH3), an electrophilic addition reaction takes place, where the π bond of the alkene is broken, and the hydrogen and bromine atoms are added to the resulting carbocation.

The reaction proceeds through a Markovnikov addition, where the hydrogen atom attaches to the carbon atom with the greater number of hydrogen atoms.

In this case, the initial addition of HBr to 2-methylbut-2-ene leads to the formation of a primary carbocation, as the positively charged carbon atom only has one alkyl group attached to it. The primary carbocation is relatively unstable, and it can undergo a rearrangement to form a more stable secondary carbocation.

The major product that is typically obtained is the 2-bromo-2-methylbutane. The hydrogen atom from HBr adds to the carbon with three hydrogen atoms (the more substituted carbon), resulting in the formation of a secondary carbocation.

On the other hand, a minor product is also formed, which is 3-bromo-2-methylbutane. This product arises from the addition of HBr to the primary carbocation, which is less stable. Although the primary carbocation is less favored, it can still be formed and lead to the formation of the minor product.

In summary, the addition of HBr to 2-methylbut-2-ene yields two products: the major product is 2-bromo-2-methylbutane, resulting from the addition of HBr to the more stable secondary carbocation, and the minor product is 3-bromo-2-methylbutane, originating from the less stable primary carbocation.

For more such questions on  electrophilic addition visit:

https://brainly.com/question/9643304

#SPJ8

What does voltage describe?

Answers

The Voltage is the pressure from the electrical circuit of the power source that passes the current.

The Voltage is defined as the pressure from the electrical circuit of the power source that will passes the charged electrons that is the current through the conducting loop, it will enable them to do work  because of the illuminating the light. The in simple terms is : voltage = pressure, and it is denoted as the volts and the symbol is the V.

The voltage is described as the force that causes the flow of the charged particles. The Voltage is also called as the electromotive force.

To learn more about voltage here

https://brainly.com/question/13177389

#SPJ1

Assess the possibility that Earth will soon enter another ice age.


Answer in paragraph form using 5-7 complete sentences.

please answer quickly asap please i beg.
5 stars please. and brainliest

Answers

Answer:

Even in the absence of human-induced climate change, it is unlikely that ice sheets would build up in the next several thousand years, and the current interglacial climate (a period of time with low ice volume) would likely continue for another 50,000 years, making this an unusually long interglacial period. "There's no chance of us going into an ice age now because the greenhouse gases we've put into the atmosphere during the industrial era have warmed the earth." Although scientists cannot say we have definitely prevented the next ice age, it's certainly accepted that humans have had a significant part to play. When plate-tectonic movement causes continents to be arranged such that warm water flow from the equator to the poles is blocked or reduced, ice sheets may arise and set another ice age in motion.

Explanation:

SOME PEOPLE PLACE GLOW STICKS IN
THE FREEZER TO MAKE THEM LAST
LONGER. WHY DO YOU THINK THIS
WORKS?

Answers

The reason an activated glow stick lasts longer in colder temperatures is because the colder temperatures slow down the chemical reaction. By placing a glow stick in the freezer you freeze the chemicals, slowing the reaction right down.

A regulation NBA basketball has a volume of 449 cubic inches. What is the volume of the basketball in mL?

Answers

The volume in milliliters is 7357.8 mL.

What is a conversion factor?

The term conversion factor refers to the factor that could be used to express the measurement in one unit conveniently in a different unit. This is very important to ensure that the meaning of the measurement can easily be grasped and adapted to different settings.

Now we have the volume of the ball as 449 cubic inches and we know that;

1 cubic inch = 16.3871 milliliter

449 cubic inches =  449 cubic inches * 16.3871 milliliter /1 cubic inch

= 7357.8 mL

Learn more about conversion factor:https://brainly.com/question/20822566

#SPJ1

A 10 mL graduated cylinder has tick marks at 1 mL and 1.1 mL. How many digits after the decimal should a measurement of volume in this cylinder have? A. 3 B. 4 C. 1 D. 2

Answers

d. 2

you can estimate to the hundredths place because it goes from 1 to 1.1.

What is the only thing in this list that is NOT in our solar system?
Dust
Interplanetary gas
The "space" in between
Comets
Meteors
Other Stars
Moons
The Sun
8 planets
Dwarf planets
Asteroids

Answers

The only thing in the list that is NOT in our solar system is "Other Stars."

The solar system is made up of a star, the Sun, and all the objects that orbit around it, including eight planets, dwarf planets, moons, asteroids, comets, interplanetary gas, dust, and the space in between. However, stars are massive, luminous objects that exist outside of our solar system, in other galaxies. They are made up of hot gases, primarily hydrogen and helium, and produce energy through nuclear fusion reactions.

There are billions of stars in the universe, and they exist in various shapes, sizes, and colors. Although stars are not part of our solar system, they play a crucial role in the formation and evolution of galaxies, and their study can help us understand the universe's composition, structure, and history.

To learn more about  solar system here

https://brainly.com/question/18365761

#SPJ1

871g of sodium chloride is how many moles

Answers

Answer:

14.9 mol

Explanation:

To find the number of moles in a given mass of a sample of sodium chloride (NaCl), we can multiply the number of grams in the sample by the molar mass of sodium chloride, which is 58.44 g/mol.

871 g × (1 mol / 58.44 g)

= 871/58.44 mol

14.9 mol

Note that we rounded to 3 significant figures in the final answer because that is how many significant figures were given in the mass measurement of the sodium chloride sample.

A 3.69 g
sample of a compound consisting of carbon, hydrogen, oxygen, nitrogen, and sulfur was combusted in excess oxygen. This produced 2.08 g
CO2
and 1.28 g
H2O
. A second sample of this compound with a mass of 4.65 g
produced 4.77 g
SO3
. A third sample of this compound with a mass of 8.62 g
produced 3.48 g
HNO3
. Determine the empirical formula of the compound. Enter the correct subscripts on the given chemical formula.

Answers

The empirical formula of the compound is C₂H₁₆S₂N₃O.

What is the empirical formula of the compound?

The moles of each element is as follows::

For CO₂:

Carbon (C) has a molar mass of 12.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of C in CO₂ = 2.08 g / 12.01 g/mol = 0.173 moles

Moles of O in CO₂ = 2.08 g / 16.00 g/mol = 0.130 moles

For H₂O:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in H₂O = 1.28 g / 1.01 g/mol = 1.27 moles

Moles of O in H₂O = 1.28 g / 16.00 g/mol = 0.080 moles

For SO₃:

Sulfur (S) has a molar mass of 32.06 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of S in SO₃ = 4.77 g / 32.06 g/mol = 0.149 moles

Moles of O in SO₃ = 4.77 g / 16.00 g/mol = 0.298 moles

For HNO₃:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Nitrogen (N) has a molar mass of 14.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in HNO₃ = 3.48 g / 1.01 g/mol = 3.45 moles

Moles of N in HNO₃ = 3.48 g / 14.01 g/mol = 0.248 moles

Moles of O in HNO₃ = 3.48 g / 16.00 g/mol = 0.217 moles

The simplest whole-number ratio of the elements will be:

Carbon: 0.173 moles / 0.080 moles ≈ 2.16

Hydrogen: 1.27 moles / 0.080 moles ≈ 15.88

Sulfur: 0.149 moles / 0.080 moles ≈ 1.86

Nitrogen: 0.248 moles / 0.080 moles ≈ 3.10

Oxygen: 0.080 moles / 0.080 moles = 1

Therefore, the empirical formula is C₂H₁₆S₂N₃O.

Learn more about empirical formulas at: https://brainly.com/question/1603500

#SPJ1

Calculate the [H3O+] of 0.10 M HNO2 at equilibrium. Given: Ka = 4.46 × 10-4.

Answers

Answer:

0.0067 mol/dm³

Explanation:

The [H3O+] of HNO2 can be found by using the formula

\([H_3O^{ + } ] = \sqrt{Kac} \)

Ka is the acid dissociation constant

c is the concentration of the acid

From the question we have

\([H3O^{ + } ] = \sqrt{4.46 \times {10}^{ - 4} \times 0.1} \\ = 0.006678...\)

We have the final answer as

0.0067 mol/dm³

Hope this helps you

What would be the effect on the calculated ration (Cu/Fe) if some iron filings had been spilt? Explain.

Answers

The effect on the calculated ration (Cu/Fe) if some iron filings had been spilt is that it would cause an increase in the amount of iron present in the solution.

Iron fillings explained

If some iron filings had been spilled into the copper solution during the preparation of the sample in a Cu/Fe ratio analysis, it would cause an increase in the amount of iron present in the solution. This increase in the amount of iron would cause the calculated Cu/Fe ratio to be lower than it should be, since the numerator (Cu) would remain the same, while the denominator (Fe) would increase.

For example, suppose a sample of copper was prepared for analysis with an expected Cu/Fe ratio of 3:1, and some iron filings were accidentally spilled into the solution. If the spilled iron filings caused the actual amount of iron in the sample to increase by 0.1 g, the calculated Cu/Fe ratio would be:

Cu/Fe = (mass of Cu / atomic mass of Cu) / (mass of Fe / atomic mass of Fe)

Assuming the mass of copper remained the same (i.e., there was no loss or contamination of copper), the new mass of iron in the sample would be:

mass of Fe = (original mass of Fe) + (mass of spilled Fe) = (mFe) + 0.1 g

Substituting into the equation:

Cu/Fe = (mass of Cu / atomic mass of Cu) / [(mFe + 0.1 g) / atomic mass of Fe]

Since the denominator is larger, the calculated Cu/Fe ratio would be smaller than the expected ratio of 3:1.

Therefore, any contamination or addition of substances in the sample would affect the accuracy of the analysis and could lead to erroneous results. It is important to follow proper laboratory techniques and protocols to minimize the risk of contamination and ensure the reliability of the analysis.

Learn more about iron fillings below.

https://brainly.com/question/7692322

#SPJ1

((Reuploaded)) Do all structural formulas for each amino acid have an amino group?

Answers

Answer:

All of the proteins on the face of the earth are made up of the same 20 amino acids. Linked together in long chains called polypeptides, amino acids are the building blocks for the vast assortment of proteins found in all living cells. All amino acids have the same basic structure

Magnesium phosphide (Mg3P2) is made when magnesium metal is heated with excess solid phosphorous (P4). What mass of the excess reagent is left over, when 8.00 g of magnesium is heated with 8.00 g of solid phosphorous?


Mass of excess reagent remaining after completion of reaction

Answers

The mass of the excess reagent remaining after completion of reaction, given that 8 g of magnesium is heated with 8 g of phosphorous is 0.98 g

How do i determine the mass of the excess reagent remaining?

First, we shall obtain the mass of the excess reagent that reacted. This is shown below:

6Mg + P₄ -> 2Mg₃P₂

Molar mass of Mg = 24.3 g/molMass of Mg from the balanced equation = 6 × 24.3 = 145.8 g Molar mass of P₄ = 124 g/molMass of P₄ from the balanced equation = 1 × 124 = 124 g

From the balanced equation above,

145.8 g of Mg reacted with 124 g of P₄

Therefore,

8 g of Mg will react with = (8 × 124) / 145.8 = 7.02 g of P₄

Finally, we shall obtain the mass of the excess reagent remaining after the reaction. Details below:

Mass of excess reagent, P₄ given = 8.00 gMass of excess reagent, P₄ that reacted = 7.02 gMass of excess reagent, P₄ remaining =?

Mass of excess reagent, P₄ remaining = Mass given - mass reacted

= 8 - 7.02

= 0.98 g

Thus, the mass of the excess reagent remaining after the reaction is 0.98 g

Learn more about mass of excess reagent:

https://brainly.com/question/29117366

#SPJ1

Mercury'II'oxide'decomposes'to'produce'mercury'and'oxygen

Answers

Answer:

The chemical equation for the decomposition of mercury(II) oxide is:

2HgO(s) → 2Hg(l) + O2(g)

This means that when solid mercury(II) oxide (HgO) is heated, it breaks down into liquid mercury (Hg) and gaseous oxygen (O2). The reaction is a decomposition reaction because one reactant (HgO) is broken down into two products (Hg and O2). This reaction is also exothermic, meaning that it releases heat.

Explanation:

The Ksp for LaF3 is 2 x 10^-19. What is the solubility of LaF3 in water in moles per liter?

Answers

The solubility of\(LaF_3\) in water is 3.04 x 10^-6 mol/L.

The solubility of \(LaF_3\) in water can be determined using the Ksp expression:

\(Ksp = [La^{3+}][F^-]^3\)

Where \([La^{3+}]\)and \([F^-]\) are the molar concentrations of the \(La^{3+}\) and \(F^-\) ions in the solution.

Since each \(LaF_3\) formula unit dissociates into one \(La^{3+}\) ion and three \(F^-\) ions, the molar solubility of \(LaF_3\) can be represented as x. Thus, the molar concentrations of \(La^{3+}\) and \(F^-\) ions in the solution can be written as x and 3x, respectively.

Substituting these values into the Ksp expression gives:

Ksp = x*(3x)^3 = 27x^4

Now, we can solve for x:

x = (Ksp/27)^(1/4)

= (2 x 10^-19 / 27)^(1/4)

= 3.04 x 10^-6 mol/L

For more question on solubility click on

https://brainly.com/question/24057916

#SPJ11

A mixture of 1.0 mol of He and 1.0 mol of Ne at STP are placed into a rigid container. Which of the following statements are true for the system? a. Both gases have the same molecular speed
b. All of the above are true c. Both gases contribute equally to the density of the mixture d. Both gases have the same average kinetic energy e. The mixture has a volume of 22.4L

Answers

The true statement is d. Both gases have the same average kinetic energy. Since the gases are at the same temperature in this situation, they will have the same average kinetic energy.

The average kinetic energy of a gas is determined by the temperature of the gas. The molecular speed of a gas is determined by the temperature of the gas and the mass of the gas molecules. Helium and neon have different atomic weights, so their molecular speeds will be different at the same temperature. The density of a gas is determined by the number of molecules and the volume they occupy. If the number of molecules of each gas is equal, but the atomic weights of the gases are different, then the density of the mixture will be different from the densities of the individual gases.

Learn more about volume, here https://brainly.com/question/30077698

#SPJ4

Which of the following reactions is balanced and shows incomplete combustion

Answers

The equation that can be said to show incomplete combustion is option A

What is incomplete combustion?

Unburned carbon particles and carbon monoxide (CO), as well as water vapor and other byproducts, are examples of incomplete combustion products that are produced when a fuel does not completely react with the oxygen that is present during the combustion process.

Complete combustion occurs when a fuel combines with oxygen in the presence of enough heat to produce the primary byproducts of carbon dioxide, water, and heat.

Learn  more about incomplete combustion:https://brainly.com/question/14335621

#SPJ1

Which portion of a molecule of F2O has partial positive charge?
Question 3 options:

A)

The F atoms

B)

The central O atom

C)

The partial charge on each atom is zero

D)

The partial charge on each atom is negative

Answers

The partial charges on each fluorine atom are negative. Option B) The central O atom is the correct answer. Option B

The partial charges in a molecule are determined by the electronegativity values of the atoms involved. Electronegativity is the ability of an atom to attract electrons towards itself in a chemical bond. In the case of \(F_2O\), fluorine (F) is more electronegative than oxygen.

Fluorine is the most electronegative element on the periodic table, meaning it has a high ability to attract electrons. Oxygen is also relatively electronegative but less so than fluorine. When fluorine atoms bond with oxygen, the shared electrons will be pulled more towards the fluorine atoms, creating a polar covalent bond.

In \(F_2O\), each fluorine atom will pull the shared electrons towards itself, resulting in a higher electron density around the fluorine atoms. This creates a region of partial negative charge around the fluorine atoms.

Conversely, the oxygen atom will have a region of lower electron density and, therefore, a partial positive charge. This is because the shared electrons spend more time around the fluorine atoms due to their higher electronegativity.

Option B

For more such question on partial charges visit:

https://brainly.com/question/29974793

#SPJ8


Use the ball and stick models above. If you had a gram of water and a gram of
oxygen, which substance would you have more particles of? Why? (Right or Wrong)

Answers

Answer:

When the weather is nice, many people begin to work on their yards and homes. For many projects, sand is needed as a foundation for a walk or to add to other materials. You could order up twenty million grains of sand and have people really stare at you. You could order by the pound, but that takes a lot of time weighing out. The best bet is to order by the yard, meaning a cubic yard. The loader can easily scoop up what you need and put it directly in your truck.

Avogadro’s Number

It certainly is easy to count bananas or to count elephants (as long as you stay out of their way). However, you would be counting grains of sugar from your sugar canister for a long, long time. Atoms and molecules are extremely small – far, far smaller than grains of sugar. Counting atoms or molecules is not only unwise, it is absolutely impossible. One drop of water contains about 10 22 molecules of water. If you counted 10 molecules every second for 50 years without stopping you would have counted only 1.6 × 10 10 molecules. Put another way, at that counting rate, it would take you over 30 trillion years to count the water molecules in one tiny drop.

Explanation:

choose all the following that are properties of gases

choose all the following that are properties of gases

Answers

Answer:

compressible.

definite volume.

low density.

indefinite shape.

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Other Questions
What are the terms in the expression 2d+7+5f Surveying assignmentTracing the historical developmentof surveying from the time ofantiquity to today, discuss therole surveying plays in land usemanagement. Revolutionary developments in manufacturing, transportation, and communication took place between 1790 and 1860. How did industrial development change the way Americans worked and lived?Can you please explain in 400 ish words 1) Delta-9 THC has low rates of dependency and can causehyperemesis syndrome.a) Trueb) False2) COVID-19 infection can lead to coagulopathies and thrombusformation.a) Trueb) False Corn is an example of which type of energy? a geothermal b biomass c solar d hydroelectric The ratio of boys to girls in a group is 2:1.If there are 22 more boys than girls how many people are there all together? Consider the rhombus above. What is the measure of angle BDA? (NOTE: not drawn to scale) Dan earns 7.70 per hour .how much will he earn for 5 hours work In a right triangle, a and b are the lengths of the legs and c is the length of the hypotenuse. If b=9 inches and c=10 inches, what is the perimeter? If necessary, round to the nearest tenth.Please help!!! Help me with the periodic table and balancing chemical equations, image attacked. Draw the vessel walls for each type of vessel and label tge layers.Define the function of each layer contractionary monetary policy causes the part 2 a. amount of government spending to increase. b. interest rate to increase. c. dollar value of real gdp to increase. d. price level to increase. This is 10 points plz help ( NO LINKS ) ( ONLY ANSWER THIS IF YOU HAVE AN EXPLANATION AND IF YOU KNOW WHAT THE ANSWER IS) label the 5' and 3' ends of the template and primer strands in this image, from left to right in the image. PLS HELP ILL MARK AS BRAINLESS What benchmark would you round the following mixed number to?*1 1/6 choices: 11/12,1,2,21/2 A 6.00-m long string sustains a three-loop standing wave pattern as shown. The wave speed is 2.00 102 m/s.What is the lowest possible frequency for standing waves on this string? The Homestead Act made it possible for millions of people to achieve the dream of acquiring immense a. wealth b. owning a farm c. living in a brick house d. moving to a big city. Determine the matrix which corresponds to the following linear transformation in 2-D: a counterclockwise rotation by 120 degrees followed by projection onto the vector (1.0). Express your answer in the form a b c d You must enter your answers as follows: .If any of your answers are integers, you must enter them without a decimal point, e.g. 10 .If any of your answers are negative, enter a leading minus sign with no space between the minus sign and the number. You must not enter a plus sign for positive numbers. .If any of your answers are not integers, then you must enter them with at most two decimal places, e.g. 12.5 or 12.34, rounding anything greater or equal to 0.005 upwards. .Do not enter trailing zeroes after the decimal point, e.g. for 1/2 enter 0.5 not 0.50. .These rules are because blackboard does an exact string match on your answers, and you will lose marks for not following the rules. Your answers: a:b:c:d: SOMEBODY PLEASE PLEASE HELP MEILL GIVE YOU 5 STARS, BRAINLIEST AND GIVE A HEART PLEASE HELP(Please make sure you answer Part B of the question and show your work!!)