Dinitrogen tetroxide in its liquid state was used as one of the fuels on the lunar lander for theNASA Apollo missions. In the gas phase it decomposes to gaseous nitrogen dioxide:N2O4(g) ↔ 2NO2(g)Consider an experiment in which gaseous N2O4 was placed in a flask and allowed to reachequilibrium at a temperature where Kp = 0.133. At equilibrium, the pressure of N2O4 wasfound to be 2.71 atm. Calculate the equilibrium pressure of NO2(g).

Answers

Answer 1

Equilibrium pressure of NO2 (g) is 0.3604. This is calculated from the expression of equilibrium constant.

Dinitrogen tetroxide in its liquid state was used as one of the fuels on the lunar lander. Decomposition of gaseous nitrogen dioxide ,

N2O+ (g)  ---> 2NO2 (g)

chemical equilibrium is the state in which both the reactants and products are present in concentrations which have no further tendency to change with time. For this equilibrium reaction, equilibrium constant can be represented as

K(eq.) = concentration of product / concentration of reactant

In gaseous phase we consider the presence  of the molecule ,

 Kp = [NO2] / [N2O4]

where, Kp = equilibrium constant that equals to 0.133

            [N2O4] = Presence of N2O4 at equilibrium that equals to 2.71.

Putting the values in the expression of equilibrium constant,

0.133 = [NO2]2 / 2.71

[NO2]2 = 0.133 * 2.71

             = 0.3604

To learn more about Equilibrium constant please visit:

https://brainly.com/question/3159758

#SPJ4


Related Questions

5. A grouping of organisms based on shared characteristics is called
A. binomial nomenclature
B. scientific name
C. classification
D. genus

Answers

Answer:

peace of vassals

Explanation:

I think i spelled it worng

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

1. The type of bond most likely to
occur between Mg and Br is a(n)
bond.
---

Answers

Answer:

Ionic bond.

Explanation:

Group 7 elements like Bromine (Br) and group 2 elements like Magnesium,(Mg) involved loss and gain of electrons which is typical with Ionic bonding.


Covalent bonds are formed between the
two nonmetals
and
The nonmetals will
electrons.

Answers

Answer:

Explanation:

A covalent bond is formed between two non-metals that have similar electronegativities. Neither atom is "strong" enough to attract electrons from the other

pOH of the 0.001M NaOH solution is​

Answers

The pOH of the 0.001 M NaOH solution is approximately 3.

To determine the pOH of a solution, we need to know the concentration of hydroxide ions (OH-) in the solution.

In the case of a 0.001 M NaOH solution, we can assume that all of the NaOH dissociates completely in water to form Na+ and OH- ions. Therefore, the concentration of hydroxide ions in the solution is also 0.001 M.

The pOH is calculated using the equation:

pOH = -log[OH-]

Substituting the concentration of hydroxide ions, we have:

pOH = -log(0.001)

Using a calculator, we can evaluate the logarithm:

pOH ≈ 3

Therefore, the pOH of the 0.001 M NaOH solution is approximately 3.

Know more about  hydroxide ions   here:

https://brainly.com/question/28464162

#SPJ8

Which of the following best describes the number of atoms for each element in the chemical reaction? A. There are 6 carbon atoms, 12 hydrogen atoms and 18 oxygen atoms on the reactant side and 6 carbon atoms, 12 hydrogen atoms and 18 oxygen atoms on the product side. B. There are 6 carbon atoms, 12 hydrogen atoms and 8 oxygen atoms on the reactant side and 6 carbon atoms, 12 hydrogen atoms and 18 oxygen atoms on the product side. C. There are 6 carbon atoms, 12 hydrogen atoms and 18 oxygen atoms on the reactant side and 6 carbon atoms, 12 hydrogen atoms, and 3 oxygen atoms on the product side. D. There are 6 carbon atoms, 12 hydrogen atoms and 12 oxygen atoms on the reactant side and 1 carbon atom, 2 hydrogen atoms, and 3 oxygen atoms on the product side.

Answers

The correct answer is A. There are 6 carbon atoms, 12 hydrogen atoms, and 18 oxygen atoms on the reactant side, and 6 carbon atoms, 12 hydrogen atoms, and 18 oxygen atoms on the product side.

This is because of the law of conservation of matter, which states that matter cannot be created or destroyed by a chemical reaction. Therefore, the number of atoms of each element must remain the same on both sides of the reaction.

In this case, the number of carbon, hydrogen, and oxygen atoms must remain the same on both the reactant and product sides.

Learn more about atoms   at:

https://brainly.com/question/30898688

#SPJ1

Show your work. 37.2 moles CO2 to oxygen atoms.

Answers

4 moles of oxygen (6.0zzx10
Show your work. 37.2 moles CO2 to oxygen atoms.

A powder contains feso47h2o

Answers

The mass of FeSO4*7H2O in the sample is 1.21 grams.

Calculate moles of Fe2O3

moles of Fe2O3 = mass of Fe2O3 / Molar mass of Fe2O3

moles of Fe2O3 = 0.348 grams / 159.69 g/mole = 0.00218 moles

Calculate moles of Fe

4 Fe + 3O2 → 2Fe2O3

For 4 moles of Fe consumed there is 2 moles of Fe2O3 produced

This means it has a ratio 2:1

So 0.00218 moles of Fe2O3 produced , there is 2*0.00218 = 0.00436 moles of Fe consumed

Calculate moles of FeSO4*7H2O

Fe + H2SO4 + 7H2O → FeSO4*7H20 + H2

For 1 mole of Fe consumed there is 1 mole of FeSO4*7H2O produced

This means for 0.00436 moles there is 0.00436 moles of Fe2SO4*H2O produced

Calculate the mass of FeSO4*7H2O in the sample

mass of FeSO4*7H2O = 0.00436 moles * 278.01 g/mole = 1.212 g

The mass of FeSO4*7H2O in the sample is 1.21 grams.

Complete question: A powder contains FeSO4⋅7H2O (molar mass=278.01 g/mol), among other components. A 3.930 g sample of the powder was dissolved in HNO3 and heated to convert all iron to Fe3+. The addition of NH3 precipitated Fe2O3⋅xH2O, which was subsequently ignited to produce 0.348 g Fe2O3. What was the mass of FeSO4⋅7H2O in the 3.930 g sample?

To learn more about Molar mass visit:https://brainly.com/question/12127540

#SPJ9

I need help. Thanks if you helped.

I need help. Thanks if you helped.
I need help. Thanks if you helped.

Answers

Answer:

Hi! The answer to the first question is A. Nina hears the sound of her drum. This occurs last because all the other events must occur first in order for Nina to hear the drum. She must hit it, the surface of the drum must vibrate, and the sound waves must travel through the air. Only then will she hear the drum.

The answer to the second question is A. Hertz. The number of vibrations per second, or frequency, is measured in hertz (Hz).

Have a great day! - Mani :)

What would be the final value for the enthalpy CO2+2h2o h =-1410 Kj

Answers

The final value for the enthalpy change of the formation of CO2 and 2H2O from their elements (C, H2, and O2) would be -1410 kJ per mole of CO2 and 2 moles of H2O formed.

The enthalpy change (ΔH) for the reaction CO2 + 2H2O → H2CO3 can be calculated by multiplying the stoichiometric coefficients of the balanced equation by the enthalpy values of the corresponding compounds involved in the reaction.

In the given reaction, the enthalpy change is -1410 kJ. However, it's important to note that this enthalpy change corresponds to a specific reaction and may not directly apply to the formation of CO2 and 2H2O from another reaction or process.

If we assume that the reaction is the formation of one mole of CO2 and two moles of H2O, we can say that the enthalpy change for this specific formation reaction is -1410 kJ.

Therefore, the final value for the enthalpy change of the formation of CO2 and 2H2O from their elements (C, H2, and O2) would be -1410 kJ per mole of CO2 and 2 moles of H2O formed.

It's worth mentioning that the enthalpy change can vary depending on the specific conditions (temperature, pressure, etc.) and the reactants involved in the reaction. Therefore, it's crucial to specify the conditions and reaction context when referring to enthalpy values.

For more such questions on enthalpy change visit:

https://brainly.com/question/15174388

#SPJ8

HQ5.40
Homework Answered Due Today, 11:59 PM
The reaction 3H₂(g) + N₂(g) → 2NH3(g) has an enthalpy of reaction of -92.6 kJ/mol. If 1 g of hydrogen and 2 g of nitrogen are
reacted, how much heat is produced (kJ)?

Answers

The amount of heat energy produced when 1 g of hydrogen and 2 g of nitrogen are reacted, is -6.61 KJ

How do i determine the heat energy produced?

First, we shall obtain the limiting reactant. Details below:

3H₂ + N₂ -> 2NH₃

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g Molar mass of H₂ = 2 g/molMass of H₂ from the balanced equation = 3 × 2 = 6 g

From the balanced equation above,

28 g of N₂ reacted with 6 g of H₂

Therefore,

2 g of N₂ will react with = (2 × 6) / 28 = 0.43 g of H₂

We can see that only 0.43 g of H₂ is needed in the reaction.

Thus, the limiting reactant is N₂

Finally, we the amount of heat energy produced. Details below:

3H₂ + N₂ -> 2NH₃ ΔH = -92.6 KJ

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g

From the balanced equation above,

When 28 grams of N₂ reacted, -92.6 KJ of heat energy were produced.

Therefore,

When 2 grams of N₂ will react to produce = (2 × -92.6) / 28 = -6.61 KJ

Thus the heat energy produced from the reaction is -6.61 KJ

Learn more about heat energy:

https://brainly.com/question/31429264

#SPJ1

If a student weighs out 0.600 g of potassium hydrogen phthalate (MW 204.22 g/mol) and titrates it with sodium hydroxide solution, what is the molarity of the sodium hydroxide solution if it takes 32.21 mL of it to titrate the potassium hydrogen phthalate?

Hint: one mole of hydrogen phthalate reacts with one mole of sodium hydroxide.

Answers

The molarity of the sodium hydroxide solution is 0.09111 M.

What is Molarity?

Molarity is a measure of the concentration of a solution. It is defined as the number of moles of solute dissolved in one liter of solution.

Molarity is an important concept in chemistry because it allows us to quantify the amount of solute in a solution and to make predictions about the behavior of the solution in various chemical reactions.

First, we can calculate the number of moles of potassium hydrogen phthalate using its molecular weight:

moles of KHP = mass / molecular weight

moles of KHP = 0.600 g / 204.22 g/mol

moles of KHP = 0.002938 mol

Since one mole of KHP reacts with one mole of NaOH, we know that there are also 0.002938 moles of NaOH in the titrated solution. We can calculate the molarity of the NaOH solution using the formula:

molarity = moles of solute / volume of solution (in liters)

First, we need to convert the volume of the NaOH solution from milliliters to liters:

volume of NaOH solution = 32.21 mL = 0.03221 L

Now we can calculate the molarity of the NaOH solution:

molarity = 0.002938 mol / 0.03221 L

molarity = 0.09111 M

Learn more about Molarity from the given link

https://brainly.com/question/14469428

#SPJ1

The diagrams below show the alignment of the Sun, the Moon, and Earth.

The diagrams below show the alignment of the Sun, the Moon, and Earth.

Answers

Answer:A

Explanation: I learned it from a gizmo

Which of the following are units of pressure?

Which of the following are units of pressure?

Answers

Answer:

atm

kPa

torr

mmHg

Determine the [H+] , [OH−], and pOH of a solution with a pH of 7.41
at 25 °C. [H+]=

M

[OH−]=

M

pOH=

Answers

Answer:

Explanation:

H+ = 1 X 10^-7.41 = 3.89 X 10^ -8

POH = 14-7.41 = 6.59

OH- = 1 x 10 ^-6.59 = 2.57 X 10^ -7

The [H+] and [OH−] concentrations of the solution are approximately 2.38 × 10^(-7) M, and the pOH is 6.59.

The pH of a solution is a measure of the concentration of hydrogen ions ([H+]) in the solution. The pH scale ranges from 0 to 14, with a pH of 7 considered neutral. A pH of 7.41 indicates that the solution is slightly basic. To calculate the [H+], [OH−], and pOH of the solution, we can use the relationship:

pH + pOH = 14

Given that the pH is 7.41, we can subtract it from 14 to find the pOH:

pOH = 14 - 7.41 = 6.59

Since pH + pOH = 14, we can also determine the [OH−] by taking the antilogarithm of the pOH value:

[OH−] = 10^(-pOH)

[OH−] = 10^(-6.59)

[OH−] ≈ 2.38 × 10^(-7) M

Since the solution is neutral, the concentration of [H+] will be equal to the concentration of [OH−]:

[H+] = [OH−] ≈ 2.38 × 10^(-7) M

Therefore, the [H+] and [OH−] concentrations of the solution are approximately 2.38 × 10^(-7) M, and the pOH is 6.59.

For more question on concentrations

https://brainly.com/question/30766678

#SPJ11

1. Explain how you would determine the enthalpy of reaction for the hypothetical reaction A2X4(l) + X2(g) → 2AX3(g) using the following information. You do not need to calculate an answer. Respond to the prompt with a minimum response length of 50 words.

1. Explain how you would determine the enthalpy of reaction for the hypothetical reaction A2X4(l) + X2(g)

Answers

we can determine the enthalpy of reaction for the hypothetical reaction A2X4(l) + X2(g) → 2AX3(g) using the following steps:

write the balanced chemical equation for the reactionwe obtain the standard enthalpies of formation for each compoundwe apply Hess's law  calculate the enthalpy of reactionwe then add up the changes to get  the total  enthalpy change for the reaction

State Hess law?

Hess's Law of Constant Heat Summation  states that regardless of the multiple stages or steps of a reaction, the total enthalpy change for the reaction is the sum of all changes.

The law is  Hess's Law  of Constant Heat Summation  is described as a manifestation that enthalpy is a state function.

Learn more about Hess law at:

https://brainly.com/question/9530080

#SPJ1

Pls help i have 0 clue what this even means

Show all work including units and the equation you used to solve. Carbon dioxide gas has a molar mass of 44 g/mol. At 300K and 1.5atm, a sample of carbon dioxide has a volume of 4.5 L. Find the number of moles of the carbon dioxide.
EXTRA POINTS: Find the mass of the carbon dioxide.

Answers

Answer: 0.27 moles of CO2 and 11.88 grams of CO2

Explanation: Use the Ideal Gas Law, PV = nRT, substitute the values given and solve.

I can't seem to upload procedure but:

P = 1.5atm

V = 4.5L

n = moles

R = 0.0821gr/mol (when using atm, kPa is 8.31)

T = 300K

Isolate what you don't have, in this case n. Change PV = nRT to PV/RT = n. Substitute the values to get moles. Once you have this, multiply the value by the molar mass of CO2 (44gr/mol) to get the mass of CO2 in grams.

a. Identify the structures shown in the diagram. b. Identify the information that is contained within these structures. c. Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person. d. Explain why the structures are in pairs.

Answers

The answer responses to  the structures shown in the diagram are:

A. chromosomes

C. They would be the same.

B. They are in pairs because each one comes from a different parent.

What is the structure about?

The chromosomes are in pairs because humans have a diploid number of chromosomes, meaning they have two sets of chromosomes, one inherited from each parent.

The nucleus is important in eukaryotic cells and has many important parts that help the cell work properly. There are some parts inside cells called the nuclear membrane, nucleoplasm, nucleolus, and chromatin. Chromatin is made up of DNA and other proteins.

Every part of a person's body has the same genes, but the way they are organized can be different in different types of cells. The chromosomes in our skin cells might not be the same as the chromosomes in our muscle cells, even if they come from the same person.

Learn more about  nucleus from

https://brainly.com/question/9376695

#SPJ1

Identify the structures shown.

A. chromosomes

B. mitochondria

C. nuclei

D. vacuoles

C

Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.

A. There would be longer.

B. They would be shorter.

C. They would be the same.

D. They would be different.

Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.

A. There would be longer.

B. They would be shorter.

C. They would be the same.

D. They would be different.

Explain why the structures are in pairs.

A. They aren't in pairs.

B. They are in pairs because each one comes from a different parent.

C. This cell is making a copy of itself.

D. The cell always has 2 copies in case 1 is damaged.

Janet observes that the shape of a dented table tennis ball is restored by heating the ball gently in warm water. Which of the following gas laws is used to understand the observation made by Janet and why?

The high temperature lowers volume according to Boyle's law because this law describes how a gas will behave when the number of moles remains constant.

The high temperature raises volume according to Boyle's law because this law describes how a gas will behave when the number of moles remains constant.

The high temperature lowers the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

The high temperature raises the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

Answers

Answer: The high temperature raises the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

Answer:

D. The high temperature raises the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

Explanation:

I took the exam

Help me ASAP please

Help me ASAP please

Answers

Answer:

8 electrons

Explanation:

Atoms always want to have a full outer shell.

Choose ALL that apply for spring tides Occur twice a month Moon, Sun, and Earth are perpendicular Highest of the high tides and lowest of the low tides. Moon, Sun, and Earth are aligned​

Answers

Answer:

Twice a month, sun and earth are perpendicular

Explanation:

Answer:

2 times in a month it happens

Explanation:

hope this helps (:

What tides are at the points on Earth indicated by the letters?
A. high tide (A,C)
B. high tide (B,D)
C. Low tide (B,C)
D. Low tide (A,C)

Answers

try c maybe, i’m not too sure sorry boo xxo

Answer:

it is A tide (A,C)

Explanation:

i just took the test and tried c and it was a plzzzzz put a btw it was my test lol

The average resting heart rate is between
A. 80-90 bpm
B. 90-100 bpm
C. 60-70 bpm
D. 70-75 bpm

Answers

A. 80-90 bpm
Hope it helps

The average resting heart rate is between is 70- 75 bytes per minute. This include systolic pressure and diastolic pressure. Hence, option D is correct.

What is heart rate?

The count of heart beats per unit time is called heart rate.  For a normal condition at the resting time the average heart rate is 70 -75 beats per minute.

The heat beats we hear is the impulse from the open and closing of the heart valves. This includes the systolic and diastolic blood pressures. For a normal person at the systolic rate is 120 mm Hg and diastolic rate is 80 mm Hg.

The blood pressure rate is depends on the diet, inheritance and other factors such as age, physical activities, mental situations etc. For a normal person, the average resting heart rate is 70 - 75 bpm.

To find more on heart rate, refer here:

https://brainly.com/question/1155838

#SPJ2

Predict the total pressure in Container C if the initial pressure in Container A was doubled and Container B was reduced by one-half, then mixed in Container C. Show your work.

Answers

The total pressure in Container C is \(5_{P}\)/(\(2_{V}\)). If the initial pressure in Container A was doubled and Container B was reduced by one-half.

To solve this problem, we need to use combined gas law, which relates with pressure, volume, and temperature of a gas;

(P₁V₁)/T₁ = (P₂V₂)/T₂

where P₁ and V₁ are initial pressure and volume, respectively, and T₁ is initial temperature. Similarly, P₂, V₂, and T₂ are inal pressure, volume, and temperature, respectively.

Let's assume that the volume and temperature are constant in all three containers. Therefore, we can simplify the equation to;

P₁/P₂ = V₁/V₂

We can use this equation to solve for the final pressure in Container C.

First, let's calculate the new pressures in Containers A and B;

Container A; the initial pressure was doubled, so P₁ = \(2_{P}\) and V₁ = V (since the volume is constant). Therefore, P₂ = P₁/(V₁/V₂) = \(2_{P}\)/(1/2) = \(4_{P}\).

Container B; the initial pressure was reduced by one-half, so P₁ = P/2 and V₁ = V (since the volume is constant). Therefore, P₂ = P₁/(V₁/V₂) = (P/2)/(1/2) = P.

Now that we have the new pressures in Containers A and B, we can use them to find the total pressure in Container C:

Container C; we are mixing equal volumes of gases from Containers A and B, so the total volume is \(2_{V}\). The total pressure is the sum of the partial pressures of the gases in Containers A and B, which are \(4_{P}\) and P, respectively. Therefore, the total pressure in Container C is:

\(P_{total}\) = (\(4_{P}\) + P)/(\(2_{V}\))

= \(5_{P}\)/(\(2_{V}\))

So, the final pressure in Container C is \(5_{P}\)/(\(2_{V}\)).

To know more about combined gas law here

https://brainly.com/question/13154969

#SPJ1

Summarise what 'Electrolysis' is?​

Answers

Answer:

Electrolysis is a process in which an electric current is used to drive a chemical reaction that would not otherwise occur.

When an electric current is passed through the cell, the ions in the electrolyte solution are attracted to the electrodes and undergo a chemical reaction at the surface of the electrodes.

hope this helps :)

What is the hydronium ion concentration of a solution with a pOH of 8.30?1.28 × 10-6 M1.99 x 10-6 M2.34 x 10-5 M2.86 x 105 M

Answers

In order to find the hydronium ion concentration in this solution, we have to find the pH and we are given the pOH of the reaction, 8.30. The pH and pOH can be used in the same formula to equal 14, which is the highest value of pH, within normal conditions, and the pH and pOH are always opposites in this scale, therefore the formula will be:

pH + pOH = 14

pH = 14 - 8.30

pH = 5.7

Now that we have the pH, we can find the [H3O+], which can be found in the following formula:

[H3O+] = 10^-pH

[H3O+] = 10^-5.7

[H3O+] = 1.99*10^-6, letter B

A flexible container is filled with He(g) to a volume of V1 at a temperature of 150K. The container is then heated at constant pressure to a temperature of 300K. What is the final volume of the container?
a. V1/3b. V1/2c. V1d. 2V1

Answers

Answer:

a but it might also be c

Explanation:

i d k what this is

Answer:

2V1

Explanation:

please solve this this is a question 5 class fast ​

please solve this this is a question 5 class fast

Answers

A.BREATHING THE PROCESS IN AIR IS EXCHANGED IN THE LUNGS

B.THE ACT SOWING SEEDS EVENLY

C.ITS WHEN NON DOMESTICATED ANIMALS

ARE EXTRACTED FROM THERE HABITATS

D.ITS A CELL THAT GIVES BLOOD IT'S RED

COLOUR

7. What is the volume of the
composite
solid?
4 in.
3 in.
3 in.

7. What is the volume of thecompositesolid?4 in.3 in.3 in.

Answers

Answer:

The volume of Component 1 is 36 cubic inches.

Explanation:

To calculate the volume of a composite solid, we need to determine the individual volumes of the different components and then add them together.

In this case, the composite solid consists of multiple components with the following dimensions:

Component 1:

Length: 4 inches

Width: 3 inches

Height: 3 inches

To find the volume of Component 1, we multiply the length, width, and height together:

Volume of Component 1 = Length x Width x Height = 4 in x 3 in x 3 in = 36 cubic inches

Therefore, the volume of Component 1 is 36 cubic inches.

Please provide the dimensions of the remaining components of the composite solid, and I will calculate the total volume by summing up the individual volumes.

Currently, 118 elements are listed on
the periodic table. One thing that each
of these elements has in common is
that they are composed of what?
A. Carbon
B. Energy
C. Atoms
D. Mixtures

Answers

Answer:

C

Explanation:

Because they 2 or more atoms

Other Questions
Choose the best answer. In the supply chain, responsive/agile:a) Sequence of organizationstheir facilities and activitiesthat are involved in producing and delivering a product.b) A flexible supply chain that has the ability to quickly respond to changes.c) Focus on eliminating non-value-added activities to create an efficient, low-cost supply chain.d) Using nearby suppliers shortens the supply chain, reducing transportation time and cost.e) Collaboration of supply chain companies and coordination of their activities so that market demand is met as efficiently and effectively as possible. The two insulated beakers shown contain equal amounts of identical liquids. The temperature of Beaker A is 80C. The temperature of Beaker B is 50C. A copper rod connects the beakers. The system is then left alone for several hours. What would you expect to find when the system is examined after this time? the big breakthrough for positivistic criminology came with A scientist is studying the effect of temperature on the growth of mold on bread. He proposes the following: "If temperatures are above 30C, then mold will grow more rapidly than at lower temperatures." While testing this prediction, he realizes that the bread he is using was contaminated and fails to grow mold at all.What would be the most logical step for the scientist to do next?A. continue with the experiment according to the scientific method B. go back and try the experiment with different bread C. carefully test the bread to determine the nature of the contamination D. abandon the experiment completely Identify the postulate illustrated by the statement: Line ST connects pointS and point T is the pattern of weather over time, which also affects human, plant, and animal life. If you dont got the answer dont say nun smart Eddy started his hike at an elevation of 115 feet below sea level. He hiked for 7 hours and reached an elevation of 1,812.1 feet. On average, what was his change of elevation every hour? Newsela, New menu items, celebrity collaborations boost McDonald's U.S. sales.... Need answer What is the area of a triangle with a base of 10 and a height of 13 Will mark brainliest HURRY PLSConsider the characters in Little Women and create a plan, using an organizer of your choice, to persuade your audience to treat others more respectfully. Your audience is a group of your peers. Consider what will motivate the listeners, how to gain the audiences attention, and what behavior you are specifically seeking to change. Use the text to provide a specific example, either positive or negative to reinforce your point. Peter says 3/4 of a pizza is always the same as 6/8 of a pizza. Nadia says while 3/4 and 6/8 are equivalent fractions, 3/4 and 6/8 of a pizza could represent different amounts.1. Who is correct? Explain. Use a drawing to justify or dont draw a picture.2.Use a counter example to explain who is correct? Graph the solution to the system of equations, then find the area of the solution. Hint: it makes a polygon, find length of sides, and then the area. 5) y> x-4 and y < 6 Someone please help will mark as brainliest Please solve both the parts and explain each stepbriefly.3. (a) Using cylindrical coordinates, write the Hamiltonian and Hamilton's equations for a particle of mass m moving on the inside of a frictionless come x + y = 2 tana (10) (b) Show that the en From the top of a lighthouse 52 meters high,the angles of depression of two ships due north of it are 42 and 37. how far apart are the ships? The length of a snake is 80 cm, rounded to the nearest 10 cm.a)What is the lower bound of the length of the snake?b)What is the upper bound of the length of the snake? write a 70 to 90 word essay about your family. Use the pronouns who and that to avoid repetition. Which of the following statements accurately describe immigration in the twenty-first century?- Immigration from Asia, as well as Latin America and Africa, means that the majority of new arrivals are no longer from Europe.- Asian Americans are the fastest-growing ethnic group as a result of Chinese immigration. Help me answer these 2 questions! best answer gets thanks and brainliest ^^identify two contributions to technology that were made during the tang dynasty (1 point)A. gunpowder and abacusB. sails and irrigationC. silk and paperD. Written language and potteryAnalyze how Confucianism impacted Emperor Wudi's treatment of the nobility (1 point)A. he made the nobles pass a civil service testB. he increased the power of the nobilityC. nobles were punished less severely than peasantsD. he gave power to people who passed Confucianism tests What did chargaff conclude from the observation that in double-stranded dna, adenine is found in the same amount as thymine, and that guanine is found in equal amounts as cytosine?