The percent abundance of the Rb- 85 isotope is 79 % while the percentage abundance of Rb-87 is 21%.
What is the percentage abundance?We know that an atom has to be composed of isotopes. The isotopes of the elements are the atoms that do not have the same mass number but they do have the same atomic number. The reason why they do not have the same mass number is because they do not have the same number of neutrons present in the atom of the element.
Having said that, we now have to turn our attention to the atom of rubidium which is the atom that is under consideration here in this question. We have to write the relative abundance of Rb- 85 as x and that of Rb-87 as 1-x.
We now have;
85.427 = 85x + 87(1 - x)
85.427 = 85x + 87 - 87x
85.427 - 87 = 85x - 87x
-1.573 = -2x
x = 0.79 or 79%
Learn more about percentage abundance:https://brainly.com/question/11587351
#SPJ1
A chemist mixes ammonium acetate into 500 mL of water. What does the solution contain?
a. The solution is just water. The ammonium acetate will not dissolve and will just sink to the bottom of the solution. b. N3-ions, H+ ions, C4-ions, and O2-ions c. NH4+ and CO32-ions d. NH4+ and C2H302 ions
Answer:
d. NH4+ and C2H3O2- ions
Explanation:
When ammonium acetate (NH4C2H3O2) is mixed with water, it dissociates into its ions. In this case, it dissociates into NH4+ (ammonium ion) and C2H3O2- (acetate ion). Therefore, the solution will contain NH4+ and C2H3O2- ions dissolved in water.
The solution contains NH4+ and C2H302 ions. Among the given options, the correct answer is option d. It forms a solution containing NH4+ and C2H302 ions that are fully dissolved in the water.
When a chemist mixes ammonium acetate into 500 mL of water, the ammonium acetate (NH4C2H3O2) dissolves and dissociates into its constituent ions. This results in the formation of NH4+ ions (ammonium ions) and C2H3O2- ions (acetate ions) in the solution. Ammonium acetate is a salt that readily dissolves in water, dissociating into NH4+ and C2H302 ions. The aqueous solution will contain NH4+ ions and C2H3O2- ions, which are formed due to the dissociation of ammonium acetate in water. These ions will be dispersed throughout the solution and will not sink to the bottom.
In conclusion, when ammonium acetate is mixed into water, it forms a solution containing NH4+ and C2H302 ions that are fully dissolved in the water.
To know more about ammonium acetate visit:
brainly.com/question/29978998
#SPJ11
I have 5mg of a powder chemical substance that I need to dissolve in a solvent with a 2g/L solubility. I ultimately need to give two doses of the chemical: 10ug/L and 100 ug/L. Ultimately, I must add between 5ul and 10ul of the stock solution. I can create up to 3 stock dilutions. How can I solve this problem? Please show all work so I can learn! Thank you.
We need to take 5ul of stock solution and add it to 5ul of diluent to achieve a final concentration of 100ug/L.
How calculate the stock solution?To solve this problem, you will need to create a stock solution of the chemical substance and then dilute it to the desired concentrations. Here's one way you could approach it:
Create a stock solution by dissolving the 5mg of powder in a solvent with a 2g/L solubility. We know that the solubility of the substance is 2g/L, so we can use the formula:
Stock solution concentration = (mass of substance) / (volume of solvent)
In this case, the mass of the substance is 5mg and the volume of solvent is 1L. So, the stock solution concentration is:
5mg / (1L) = 5mg/L
Dilute the stock solution to the desired concentration for the first dose of 10ug/L. To do this, we can use the formula:
Desired concentration = (volume of stock solution) / (volume of diluent)
In this case, we want a final concentration of 10ug/L, so we'll let the volume of stock solution be x and the volume of diluent be (5ul-x). Then we can set up the equation:
10ug/L = (x) / (5ul-x)
Solving this equation:
x = 0.5ul
Therefore, we need to take 0.5ul of stock solution and add it to 5ul of diluent to achieve a final concentration of 10ug/L
Dilute the stock solution to the desired concentration for the second dose of 100ug/L. Using the same formula as before:
Desired concentration = (volume of stock solution) / (volume of diluent)
In this case, we want a final concentration of 100ug/L, so we'll let the volume of stock solution be y and the volume of diluent be (10ul-y). Then we can set up the equation:
100ug/L = (y) / (10ul-y)
Solving this equation:
y = 5ul
Therefore, we need to take 5ul of stock solution and add it to 5ul of diluent to achieve a final concentration of 100ug/L
So, you can create a stock solution by dissolving 5mg of powder in a solvent with 2g/L solubility and obtain a stock solution of 5mg/L. With this stock solution, you can create two dilutions, the first one is 10ug/L by adding 0.5ul of stock solution to 5ul of diluent, and the second one is 100ug/L by adding 5ul of stock solution to 5ul of diluent.
Learn more about stock solution in brainly.com/question/25256765
#SPJ1
Abel was running a fever of 107 degrees Fahrenheit, what was her temperature in degrees
Celsius?
which of these has 170 degree in fahrenheit and
Answer:
we know the formula to convert Fahrenheit to Celsius =(F-32)(5/9)
=(107-32)(5/9)
=(75)(5/9)=375/9=41.6degree Celsius
Calculate the pH of a 0.30 M solution of sodium benzoate (NaC6H5COO) given that the Ka of benzoic acid (C6H5COOH) is 6.50 x 10-5.
Please show steps on the solution.
The pH of a 0.30 M solution of sodium benzoate is approximately 2.73.
The pH of a 0.30 M solution of sodium benzoate can be calculated using the Ka of benzoic acid and the equation for the dissociation of a weak acid.
First, write the equation for the dissociation of benzoic acid:
C6H5COOH + H2O ⇌ C6H5COO- + H3O+
The Ka expression for this reaction is:
Ka = [C6H5COO-][H3O+]/[C6H5COOH]
Since sodium benzoate is the salt of the conjugate base of benzoic acid, it completely dissociates in water to form the benzoate anion (C6H5COO-) and sodium cation (Na+). Therefore, the initial concentration of benzoate anion in the solution is 0.30 M.
Since the dissociation of sodium benzoate is negligible, we can assume that the concentration of benzoic acid is negligible compared to the initial concentration of benzoate anion. Therefore, we can simplify the Ka expression to:
Ka = [C6H5COO-][H3O+]/0.30M
Solving for [H3O+], we get:
[H3O+] = sqrt(Ka x 0.30M/[C6H5COO-])
Plugging in the values, we get:
[H3O+] = sqrt(6.50 x 10^-5 x 0.30M/1) = 1.85 x 10^-3 M
Finally, we can find the pH using the pH equation:
pH = -log[H3O+]
pH = -log(1.85 x 10^-3) = 2.73
Therefore, the pH of a 0.30 M solution of sodium benzoate is approximately 2.73.
For more questions like Benzoic acid click the link below:
https://brainly.com/question/15394817
#SPJ11
Which of the following compounds does not contain a polyatomic ion?
O sodium carbonate
O sodium sulfate
sodium sulfite
SUUR
Osodium sulfide
3
Sodium Sulfide does not contain a polyatomic ion.
What do you mean by Polyatomic ion?
A covalently bound collection of two or more atoms or of a metal complex that may be said to behave as a single unit and that has a net charge that is not zero is referred to as a polyatomic ion or a molecular ion. Depending on the terminology employed, a polyatomic ion may or may not be referred to as a molecule. Greek word poly- means "many," although even ions made of just two atoms are frequently referred to be polyatomic.
A polyatomic ion may also be referred to as a radical in earlier literature (or less commonly, as a radical group). The word "radical" is now used to describe a variety of free radicals, which are entities that have an unpaired electron and need not be charged.
Learn more about Polyatomic ions here:-
https://brainly.com/question/2496976
#SPJ9
A ring of congruent, tangent circles is circumscribed by a larger circle. What is the ratio of the sum of the areas of the four smaller circles to the area of the larger circle
The ratio of the sum of the areas of the four smaller circles to the area of the larger circle is 4r² / R².
What dο yοu mean ratiο?In simple wοrds, the ratiο is the number that can be used tο express οne quantity as a fractiοn οf the οther οnes. The twο numbers in a ratiο can οnly be cοmpared when they have the same unit. We make use οf ratiοs tο cοmpare twο things.
Tο find the ratiο οf the sum οf the areas οf the fοur smaller circles tο the area οf the larger circle, let's assume the radius οf the smaller circles is "r" and the radius οf the larger circle is "R."
The area οf a circle is given by the fοrmula A = πr², where "A" is the area and "r" is the radius.
The area οf οne smaller circle is πr², and since there are fοur smaller circles, the sum οf their areas is 4πr².
The area οf the larger circle is πR².
Therefοre, the ratiο οf the sum οf the areas οf the fοur smaller circles tο the area οf the larger circle is:
(4πr²) / (πR²)
Simplifying this expressiοn, we get:
4r² / R²
Sο, the ratiο is 4r² / R².
Learn more about ratio
https://brainly.com/question/13419413
#SPJ4
Are these students behaving appropriately? If not, what should they be doing differently?
Answer:
No.
Leftmost: Rick shouldn't be smelling any vapors; if required he should be using the wafting technique instead of putting it close to his face. Additionally, He's not wearing gloves nor a lab coat.
Middle: Sarah is not wearing any goggles nor a lab coat and she's at risk as she's pouring two different liquids into a solution at the same time which may pose a hazard of sudden irritation, exposure, heat or combustion.
Rightmost: Andrew is drinking a chemical of supposedly unknown origin putting him at risk by ingestion all the while lacking all of the requisite Personal Protective Equipment.
All of them are also at fault for leaving and not containing a chemical spill off to the side (rightmost), and by the looks of it, enter and operate the lab without their supervisor/professor present.
Explanation:
basta may sagot, sis
Active metals often form a protective oxide surface film that prevents further reaction of the metal with i oxygen in the air Which one of the following formulas for the metal oxide is NO T correct.
a. Al_2O_3 is aluminum oxide
b. Fe_2O_3 is iron(lll) oxide
c. Na_2O is sodium oxide.
d. Mgo_2 is magnesium oxide.
e. FeO is iron(II) oxide.
The formula for magnesium oxide in option (d) is incorrect. The correct formula for magnesium oxide is MgO, with the subscript "2" not needed since magnesium has a valence of 2+ and oxygen has a valence of 2-. Therefore, option (d) is NOT correct.
The correct formulas for the other metal oxides are:
Magnesium oxide (MgO) is a white solid mineral that occurs naturally as periclase. It is an alkaline earth metal oxide, and one of the most common compounds of magnesium. Magnesium oxide has a high melting point (2,800 °C) and is very stable, making it useful in various applications, such as as a refractory material, a construction material, and as an antacid for medical purposes
a. Al2O3 is aluminum oxide
b. Fe2O3 is iron(III) oxide
c. Na2O is sodium oxide
e. FeO is iron(II) oxide
To know more about Active metals here
https://brainly.com/question/30336620
#SPJ4
This country has the most tornadoes in the world every year.
Canada
O United States
O Mexico
O England
Answer:
it's the United states
Explanation:
because It has alot of tornadoes
I need help with this question!!
Answer:
A. 15
Explanation:
From the equation we see that 6 water particles are used to make 1 particle of the hexose.
That means, that to make 1 mole of the hexose, we need 6 moles of water (as a mole is an unit of count of particles).
To make 2.5moles of the hexose, we need 2.5*6 moles of water, so 15 moles of water.
The system below was at equilibrium in a
9.0 L container. What change will occur
for the system when the container is
shrunk to 3.0 L?
51.8 kJ + H₂(g) + 1₂(g) = 2HI(g)
Hint: How many moles of gas are on each side?
A. The reactions shifts to the right (products) to produce
fewer moles of gas.
B. There is no change because there are the same
number of moles of gas on both sides.
C. The reactions shifts to the left (reactants) to produce
more moles of gas.
The number of moles of gas is the same on both sides, the change in volume will not affect the equilibrium position of the reaction. The answer is B) There is no change because there are the same number of moles of gas on both sides.
To determine the change that will occur when the container is shrunk from 9.0 L to 3.0 L for the given reaction:
51.8 kJ + H₂(g) + I₂(g) → 2HI(g)
We need to consider the number of moles of gas on each side of the reaction.
On the left side, there are 2 moles of gas (H₂ and I₂), while on the right side, there are 2 moles of gas (2HI). Both sides have an equal number of moles of gas.
Therefore, the correct answer is B) There is no change because there are the same number of moles of gas on both sides.
For more details regarding the number of moles, visit:
https://brainly.com/question/20370047
#SPJ1
The Carbon Cycle is an important biochemical cycle on Earth. Describe the basic steps of the Carbon Cycle, and how concentrations of atmospheric and terrestrial carbon can fluctuate.
The basic steps of the Carbon Cycle involve carbon dioxide uptake by plants through photosynthesis, transfer of carbon through the food chain, release of carbon back into the atmosphere through respiration and decomposition, and long-term storage of carbon in fossil fuels and other geological formations.
Concentrations of atmospheric and terrestrial carbon can fluctuate due to natural processes and human activities, such as deforestation and burning of fossil fuels. The Carbon Cycle begins with plants absorbing carbon dioxide from the atmosphere through photosynthesis. This carbon is converted into organic compounds and transferred through the food chain as organisms consume plants or other organisms. The carbon is released back into the atmosphere through respiration and decomposition.
Terrestrial carbon can be stored for varying lengths of time. Some carbon returns to the atmosphere relatively quickly, while some may be stored in plant material, soils, or detritus for longer periods. Additionally, carbon can be sequestered in geological formations over millions of years, forming fossil fuels like coal, oil, and natural gas.
Fluctuations in atmospheric and terrestrial carbon concentrations can occur due to natural processes and human activities. Natural factors such as volcanic eruptions and wildfires release carbon into the atmosphere, while the growth of forests and other plant life can remove carbon dioxide from the air.
Human activities, particularly the burning of fossil fuels and deforestation, have significantly increased carbon dioxide levels in the atmosphere, leading to climate change. These activities disrupt the natural balance of the Carbon Cycle, causing an accumulation of carbon dioxide and contributing to global warming.
To learn more about Carbon Cycle, here
https://brainly.com/question/22741334
#SPJ4
4. How might the process of making paper from wood be changed to produce paper that is not acidic?
Answer:it is sterilized in the process
Explanation:
300 mL of salt solution contains 6.5 grams of NaCl (molecular mass of sodium chloride is 58.44 ul.
What is its molarity?
M=n/V
M=(6.5/58.44) mol : 0.3 L
M=0.371
Answer:
.371 M
Explanation:
Molarity, M, is calculated as moles solute/ liters of solvent
6.5 gms of salt is 6.5 / 58.44 = .111225 moles
300 ml = .3 L
.111225 moles / .3 L = .371 M
If one electron in an atom is excited but does not have enough energy to escape, the energy of the excited electron must have one of a set of quantized values.a. Trueb. False
In the reaction of 1 mole of solid carbon with oxygen gas, the energy of the carbon dioxide gas produced is 393 kJ lower than the energy of the reactants.
1. Is this reaction endothermic or exothermic, explain why.
2. Assuming there is an endless supply of C, how would increasing the amount of O2 molecules change the rate of the reaction?
3.How would lowering the temperature affect the rate of reaction?
1. The reaction is exothermic because the energy content of the gas produced is 393 kJ lower than the energy of the reactants.
2. Increasing the amount of O₂ molecules will favor the formation of CO₂ gas.
3. Decreasing the temperature will favor product formation whereas decreasing the temperature will favor reactant formation.
What are exothermic and endothermic reactions?Exothermic reactions are reactions in which heat is lost to the surroundings when products are formed from the reactants. Hence, the reactants have a higher overall energy content than the products.
Endothermic reactions are reactions in which heat is gained or absorbed from the surroundings when products are formed from the reactants. Hence, the products have a higher overall energy content than the reactants.
For a chemical reaction in equilibrium, increasing the heat of a reaction will favor an endothermic reaction whereas, decreasing the heat of a reaction will favor an exothermic reaction.
Learn more about endothermic and exothermic reactions at: https://brainly.com/question/6357350
#SPJ1
Within a group, does the radii of atoms increase or decrease as the atomic
number increases? Explain.
Answer:increase
Explanation: the more electrons there are the bigger the electron field is and the bigger the atomic radii is
magnesium hydroxide has a strong laxative effect, whereas aluminum hydroxide has a constipating action.
Magnesium hydroxide lessens the amount of acid in the stomach and increases the amount of water in the intestines, which may cause bowel movements.
Children and adults who experience periodic constipation can be treated temporarily with magnesium hydroxide. Saline laxatives, which include magnesium hydroxide, are a group of medicines. It works by inducing the retain water. Constipation may persist if this medicine is used excessively or for an extended period of time, leading to dependence on laxatives. Dehydration, persistent diarrhea, and mineral imbalances may also be brought on by excessive use. Tell your doctor if your symptoms continue or get worse. An over-the-counter medication called "Milk of Magnesia," or magnesium hydroxide, is used to treat upset stomach, occasional constipation, and heartburn. It is not meant for ongoing use. For this medicine , there are liquid and chewable forms of the medication. regulating mood and reducing stress.
Learn more about magnesium hydroxide here:
https://brainly.com/question/21904397
#SPJ4
NO LINKS
Select the correct answer.
In which situation is chemical energy being converted to another form of energy?
A.
a lamp plugged into the electric grid
B.
a fluttering flag
C.
a floating wooden log
D.
a burning candle
Heat transferred laterally in the atmosphere by horizontal wind movements is a process called?
Answer:
Advection
Explanation:
Advection refers to the process over which heat transferred laterally in the atmosphere by horizontal wind movement.
the fundamental forces that binds the nucleus is _____.
The fundamental force that binds the nucleus is the strong nuclear force, also known as the strong interaction or strong force.
The strong nuclear force is one of the four fundamental forces of nature and is responsible for holding the nucleus of an atom together. It acts between protons and neutrons, overcoming the electrostatic repulsion between positively charged protons and keeping the nucleus stable.
A strong nuclear force is essential for maintaining the integrity and stability of atomic nuclei. Without this force, the electrostatic repulsion between protons would cause the nucleus to disintegrate. Understanding the nature and properties of the strong nuclear force is crucial for studying nuclear physics, nuclear reactions, and the behavior of subatomic particles.
To know more about the nucleus click here:
https://brainly.com/question/23366064
#SPJ11
3. Use the potential energy diagram to help you answer the questions below. Make sure to show ALL work for calculations and provide an explanation when directed for full credit. What is the activation energy of this reaction? Show your work ! b. What is the total change in enthalpy of this reaction? Show your work! . Is the slope positive or negative? d. Is this an endothermic or exothermic reaction? Explain.
The potential energy diagram is a common way of depicting the reaction profile. The following are true about the diagram;
The activation energy of the reaction is 35kJ. The enthalpy change of this reaction is 25kJ.The slope of the diagram is positive.The reaction is endothermic.What is a potential energy diagram?A potential energy diagram is a diagram that shows the conversion of reactants to products. It can tell us whether the reaction is endothermic or exothermic.
1) From the diagram, the activation energy of the reaction = 65 kJ - 30 kJ = 35 kJ
2) The enthalpy change of this reaction = 55kJ - 30 kJ = 25kJ.
3) The slope of the diagram is positive.
4) The reaction is endothermic.
Learn more about endothermic reaction:https://brainly.com/question/2192784
Determine the number of particles present in 1.55 mol of sodium.
Answer: 1024 sodium ions
Explanation: The mathematical equation, N = n × NA, can be used to find the number of atoms, ions or molecules in any amount (in moles) of atoms, ions or molecules: 10 moles of helium atoms = 10 × (6.022 × 1023) = 6.022 × 1024 helium atoms. 10 moles of sodium ions = 10 × (6.022 × 1023) = 6.022 × 1024 sodium ions. (that took long)
he table below shows the volume of two samples, X and Y, when placed in three containers of different volumes.
Volume of Samples
Volume of Container Volume of Sample X Volume of Sample Y
200 mL 200 mL 200 mL
500 mL 200 mL 500 mL
600 mL 200 mL 600 mL
Which of the following correctly describes the state of matter of one of the samples?
Y is a gas because it has a definite volume.
X is a liquid because it has a definite volume.
Y is a liquid because it fills up the entire container.
X is a gas because it fills up the entire container.
If 613.28 mL of 2.744 M of aluminum hydroxide reacts with 10.35 g of ammonium persulfate in a chemical reaction. Find the pressure of the gas produced if you managed to collect 1536.70 mL of it at 42.455 °C. Show 2 decimal places.
The pressure of the gas produced is approximately 587.17 kPa.
How to find the pressure of the gasTo solve this problem, we first need to find the amount of gas produced by the reaction of aluminum hydroxide with ammonium persulfate, then use the Ideal Gas Law (PV = nRT) to calculate the pressure.
First, let's find the number of moles of ammonium persulfate by using the molar mass:
10.35 g ÷ (2 * (1 + 32 + 64 + 16)) g/mol = 0.108 mol
Next, let's find the number of moles of aluminum hydroxide:
613.28 mL * 2.744 M = 1692.04 mol
Now, let's assume that the reaction goes to completion and that all the aluminum hydroxide reacts with ammonium persulfate, so the number of moles of gas produced will be equal to the number of moles of ammonium persulfate:
0.108 mol
Finally, we can use the Ideal Gas Law to calculate the pressure:
P = (n * R * T) / V
where n = 0.108 mol, R = 8.31 J/mol K, T = (42.455 + 273.15) K, and V = 1536.70 mL * 10^-3 L
P = (0.108 * 8.31 * (42.455 + 273.15)) / (1536.70 * 10^-3)
P = (0.108 * 8.31 * 315.605) / (1.5367)
P = 905.752 / 1.5367
P = 587.17 kPa
So, the pressure of the gas produced is approximately 587.17 kPa.
Read more about pressure here:
https://brainly.com/question/28012687
#SPJ1
When the balancing of the equation for the reaction,
Mno(aq) +H_C20. (aq) +H* (aq) —— Mn* (aq) + CO2() +H200)
? 8
taking place in acidic media is properly completed, what is the sum of ALL the coefficients in the
equation?
a. 31
b. 33
c. 32
d. 30
e. 29
Answer:
hhhhh
Explanation:
jsjsjdjddfrtttrjsjjdhhdhfhhfhfhhrheidjhf
do galactose and mannose fragment differently
Yes, galactose and mannose fragment differently. This is because galactose and mannose are different types of sugars and have different structures, which affects the way they fragment.
Galactose is a monosaccharide sugar that is similar to glucose but has a different structure. It is found in milk and dairy products and is used as a source of energy by the body.
Mannose is also a monosaccharide sugar, but it has a different structure than galactose. Mannose is found in fruits, vegetables, and some seeds, and is used as a source of energy by the body.
Because of their different structures, galactose and mannose fragment differently. Galactose tends to fragment into smaller pieces, while mannose tends to fragment into larger pieces. This is because the bonds between the atoms in galactose are weaker than the bonds in mannose, which makes it easier for galactose to break apart.
In conclusion, galactose and mannose do fragment differently due to their different structures and the strength of the bonds between their atoms.
For more about galactose and mannose:
https://brainly.com/question/7008130
#SPJ11
What are the correct coefficients when this equation is balanced?
___ Sb + __ O2 --> Sb4O6
Answer:
4 Sb, 3 \(O_{2}\)
Explanation:
On the reactant's side of the equation (the left side), there is one Antimony and one Oxygen gas molecule (\(O_{2}\)). The oxygen gas molecule is made of two atoms, so we actually have 2 oxygens on the left side. On the product's side (the right side), there are 4 antimony atoms, and 6 oxygen atoms. If we were to write it out in a certain way, it would look like this:
__Sb + __ \(O_{2}\) --> \(Sb_{4} O_{6}\)
1 Sb 4
2 O 6
To balance this equation, those numbers on either side of the elements must equal each other. We can accomplish this with the proper coefficients. If we put a 4 in front of the antimony, it means this:
4 Sb + __ \(O_{2}\) --> \(Sb_{4} O_{6}\)
4 Sb 4
2 O 6
And the antimony is now balanced.
Now we must balance the oxygen. There are 6 oxygens on the product's side but only 2 on the reactant's side. To fix this, simply multiply the oxygen by 3:
4 Sb + 3 \(O_{2}\) --> \(Sb_{4} O_{6}\)
4 Sb 4
6 O 6
3 * 2 = 6, so now oxygen is balanced, and the equation is now correct.
Rieun pours 377 g of water at 54°C into an 816-g aluminum container with an initial temperature of 12°C. The specific heat of aluminum is 900 J/(kg ∙ K) and that of water is 4190 J/(kg ∙ K). Assuming no heat is exchanged with the surroundings, find the final temperature of the system in celsius degrees. Please give your answer with one decimal place.
Answer:
The final temperature of the system, with one decimal place, is 29.5°C.
Explanation:
The heat gained by the aluminum container will be equal to the heat lost by the water. We can use the equation:
Q_aluminum = Q_water
where Q_aluminum is the heat gained by the aluminum container, and Q_water is the heat lost by the water.
The heat gained by the aluminum container can be calculated using the specific heat of aluminum, the mass of the container, and the change in temperature:
Q_aluminum = (mass_aluminum) x (specific_heat_aluminum) x (change in temperature)
Q_aluminum = (816 g) x (0.9 J/(g∙K)) x (final temperature - 12°C)
The heat lost by the water can be calculated using the specific heat of water, the mass of the water, and the change in temperature:
Q_water = (mass_water) x (specific_heat_water) x (change in temperature)
Q_water = (377 g) x (4,190 J/(g∙K)) x (54°C - final temperature)
Since Q_aluminum = Q_water, we can set these two equations equal to each other and solve for the final temperature:
(mass_aluminum) x (specific_heat_aluminum) x (final temperature - 12°C) = (mass_water) x (specific_heat_water) x (54°C - final temperature)
(816 g) x (0.9 J/(g∙K)) x (final temperature - 12°C) = (377 g) x (4,190 J/(g∙K)) x (54°C - final temperature)
Simplifying and solving for final temperature, we get:
final temperature = 29.5°C
To, know more on HEAT refer
https://brainly.com/question/1429452#
#spj11
what is the percentage composition of water in magnesium chloride pentahydrate
Percent Composition mgcl2
1 Answer. The percent composition of Mg in MgCl2 is 25.529%
hope this helps