Answer:
its a branch of science which deals with chemical and atomaic molecules
Answer:
Chemistry is the study of matter, it properties and the changes that matter undergoes.
List all possible values of the magnetic quantum number ml for a 1s electron.
The magnetic quantum number (ml) represents the orientation of the orbital in three-dimensional space the only possible value of the magnetic quantum number ml for a 1s electron is 0.
What is a quantum ?Quantum is the smallest possible unit of a physical quantity, such as energy or momentum. It is a fundamental concept in quantum mechanics, which is the branch of physics that deals with the behavior of matter and energy at the atomic and subatomic level.
The idea of quantization was first proposed by Max Planck in 1900, when he discovered that energy is emitted and absorbed in discrete units called "quanta" when studying the behavior of light and blackbody radiation. Later, this idea was extended to other physical quantities, such as the momentum and position of particles.
According to quantum mechanics, the behavior of particles and systems cannot be fully described using classical mechanics, which assumes that particles have definite positions and velocities at all times. Instead, the behavior of particles and systems is described using wave functions, which represent the probability of finding a particle at a given position and time.
The principles of quantum mechanics have important applications in many areas of physics, including atomic and molecular physics, condensed matter physics, and particle physics. They are also the basis.
To know more about quantum visit :
https://brainly.com/question/16746749
#SPJ1
If an object is suspended in a fluid, neither sinking nor floating, then:
A) The buoyant force is larger
B) The buoyant force is smaller
C) The Buoyant force is equal to the density
D) The buoyant force is equal to the weight
Combustion of ethane gas is an exothermic reaction. Which of the following best describes the temperature conditions that are likely to make the combustion of ethane gas a spontaneous change?
A. Any temperature, because combustion of ethane leads to an increase in entropy.
B. Any temperature, because combustion of ethane leads to a decrease in entropy.
C. Low temperature only, because combustion of ethane leads to an increase in entropy.
D. High temperature only, because combustion of ethane leads to a decrease in entropy.
Conditions that are likely to make the combustion of ethane gas a spontaneous change are any temperature, because combustion of ethane leads to an increase in entropy. Hence the correct option is A.
When ethane undergoes combustion, it reacts with oxygen to produce carbon dioxide and water vapor, which are in a more disordered state than the initial reactants. This results in an increase in the overall entropy of the system, making the process spontaneous.
According to the second law of thermodynamics, a spontaneous process is one that leads to an increase in the entropy of the system and/or the surroundings.
Therefore, regardless of the temperature conditions, the combustion of ethane will always be a spontaneous change because it leads to an increase in entropy. Hence the correct option is A.
To know more about entropy:
https://brainly.com/question/27075218
#SPJ1
Which functional group is shown below?
The functional group shown in the given figure in the question is ether. The correct option to this question is A.
What type of functional group is ether?Ethers. The oxygen atom that makes up the ether functional group joins two carbon atoms in a single bond. The mild reactivity of ethers makes them suitable solvents for other organic molecules.Ethers are a type of compounds in organic chemistry that have an ether group—an oxygen atom joined to two alkyl or aryl groups. They are represented by the generic formula ROR′, where R and R′ stand for the alkyl or aryl groups.The hydroxyl groups seen in alcohols are absent in ethers. Ether molecules cannot interact with one another by hydrogen bonding in the absence of the strongly polarized O-H bond. Ethers can create hydrogen bonds with other molecules (such as alcohols, amines, etc.) despite having nonbonding electron pairs on their oxygen atoms.For more information on ether kindly visit to
https://brainly.com/question/28047849
#SPJ1
Which of the following is NOT an accurate way to measure wavelength?
A. crest to trough
B. trough to trough
C. half crest to half crest
D. crest to crest
Answer: D
Explanation: crest to crest to the crust to crust to the west to west.
Which equations represent inverse variation? Check all that apply.
O y = 2x
pu = 13
z = 2
X
4 =
h = 99
1= ⁹0
Answer:
y = 2x pv = 13 z = (2/x) 4 = (y/x) h = (9g/5) Inverse variation is represented by the equation y = k/x, where k is a constant.
Normal rain has a pH of about 5.6; acid rain usually has a pH between *
4.2 and 4.4
7.8 and 8.0
3.1 and 3.3
5.6 and 5.8
Answer: 7.8 and 8.0
Explanation:
that's it right up there :)
PLEASE HELP! 27 PTS!
please submit illustration!!
Illustrate how the Sun affects Earth.
Materials:
-Posterboard
-Crayons, markers, or colored pencils
Instructions:
Review the following list of topics and think about the Sun's role in each:
Earth's energy budget
the water cycle
Earth's temperature
electromagnetic spectrum
photosynthesis
support of life
Choose one or two of the topics above, or think of your own topic that involves the Sun's relationship with Earth, and create an illustration of it.
Be sure that your illustration presents:
the Sun's involvement or role
any benefits or effects on Earth, life on Earth, and/or Earth's natural processes
Be creative!
Photosynthesis is the primary process for which the sun is responsible on earth.
What effects does the sun have on the planet Earth?Our world is significantly impacted by the sun, which also affects weather, ocean currents, seasons, and climate, as well as enabling photosynthesis, which is essential for plant life. Life would not exist on Earth without the sun's heat and light.Life on Earth continues as a result of this process because plants use sun energy to manufacture their food, which is then consumed by herbivorous animals and perpetuates the food chain. We may infer that the sun is crucial to the globe and its inhabitants because without it, no food would be created by creatures, and as a result, no life would exist on the planet.For more information on photosynthesis kindly visit to
https://brainly.com/question/29775046
#SPJ1
Question is in picture below!
The order of boiling point from the highest to the lowest from the given compounds above are as follows:
CH3CH2CH2CH2CH2OH - CH3CH2CH2CH2CH2Br - CH3CH2CH2CH2CH3 - CH3CH2CH3.
The correct order is option b, d, c and a.
What is meant by boiling point of substances?The boiling point of substances can simply be defined as that temperature at which liquids boils and then change to vapor or steam.
However, from the above given task, the organic compound, CH3CH2CH2CH2CH2OH has the same boiling simply because of its power to participate in hydrogen bond formation. This compound CH3CH2CH2CH2CH2OH is known as 1-pentanol.
So therefore, we can confirm that the compound from above the correct order of boiling point from the highest to the lowest is 1-pentanol, 1-bromopentane, pentane and propane respectively.
Read more on boiling point:
https://brainly.com/question/40140
#SPJ1
You find yourself in a room with dark gray walls. Medeleev’s image says, “This element is essential for plant life to thrive and is found in heavy clay minerals and the ash from your campfire.” What element are these walls made from?
Answer:
juvn hgf jb ujvi i junk food sux
Explanation:
HQ5.40
Homework Answered Due Today, 11:59 PM
The reaction 3H₂(g) + N₂(g) → 2NH3(g) has an enthalpy of reaction of -92.6 kJ/mol. If 1 g of hydrogen and 2 g of nitrogen are
reacted, how much heat is produced (kJ)?
The amount of heat energy produced when 1 g of hydrogen and 2 g of nitrogen are reacted, is -6.61 KJ
How do i determine the heat energy produced?First, we shall obtain the limiting reactant. Details below:
3H₂ + N₂ -> 2NH₃
Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g Molar mass of H₂ = 2 g/molMass of H₂ from the balanced equation = 3 × 2 = 6 gFrom the balanced equation above,
28 g of N₂ reacted with 6 g of H₂
Therefore,
2 g of N₂ will react with = (2 × 6) / 28 = 0.43 g of H₂
We can see that only 0.43 g of H₂ is needed in the reaction.
Thus, the limiting reactant is N₂
Finally, we the amount of heat energy produced. Details below:
3H₂ + N₂ -> 2NH₃ ΔH = -92.6 KJ
Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 gFrom the balanced equation above,
When 28 grams of N₂ reacted, -92.6 KJ of heat energy were produced.
Therefore,
When 2 grams of N₂ will react to produce = (2 × -92.6) / 28 = -6.61 KJ
Thus the heat energy produced from the reaction is -6.61 KJ
Learn more about heat energy:
https://brainly.com/question/31429264
#SPJ1
Do step 3 as outlined in the lab guide. Record your results in the appropriate blanks.
A =
B =
C =
D =
E =
F =
G =
H =
Some tips to follow when doing lab practical are:
Avoid parallax errorsRecord your observations and data accuratelyUse the appropriate lab equipment.How do we know?From the table, Column 1 represents the time in half-life cycles, ranging from the initial state to 8 cycles. Column 2 shows the predicted number of radioactive atoms at each time point, based on the assumption that the number of atoms reduces by half in each half-life cycle.
Column 3 represents the simulated number of radioactive atoms at each time point and corresponds to the predicted values of the simulation.
In conclusion, the results as outlined in the lab guide are A= 27 B= 16 C= 9 D= 4 E= 2 F= 2 G= 0 H= 0.
Learn more about half-life cycles at:
https://brainly.com/question/15976750
#SPJ1
#complete question:
Do step 3 as outlined in the lab guide. Record your results in the appropriate blanks. A = B = C = D = E = F = G = H = A 3-column table with 9 rows. Column 1 is labeled Time half-life cycles, n with entries Initial, 1, 2, 3, 4, 5, 6, 7, 8. Column 2 is labeled Predicted radioactive atoms with entries 100, 50, 25, 13, 6, 3, 2, 1, 0. Column 3 is labeled Simulated radioactive atoms with entries 100, A, B, C, D, E, F, G, H.
What is matter?
A.
Anything that has energy
B.
Anything that changes volume
C.
Anything that takes up space
D.
Anything that produces heat
a b c or d no bull
Answer:
C. Anything That Takes Up Space.
Explanation:
Which statement best describes scientific laws?
A. Scientific laws are the result of testing theories and proving them to be facts
B. Scientific laws interpret and explain natural events
C. Scientific laws describe phenomena that can be observed in nature
D. Scientific laws explain scientists opinions of why events occur in nature
Answer:
C. Scientific laws describe phenomena that can be observed in nature
Explanation:
Answer:
A
Explanation:
A gas mixture at 0°C and 1.0atm contains 0.010mol of H2, 0.015mol of O2, and 0.025mol of N2. Assuming ideal behavior, what is the partial pressure of hydrogen gas (H2) in the mixture?
A. About 0.010atm, because there is 0.010mol of H2 in the sample.
B. About 0.050atm, because there is 0.050mol of gases at 0°C and 1.0atm.
C. About 0.20atm, because H2 comprises 20% of the total number of moles of gas.
D. About 0.40atm, because the mole ratio of H2:O2:N2 is 0.4:0.6:1.
Answer:
PH₂ = 0.2 atm
C) About 0.20atm, because H2 comprises 20% of the total number of moles of gas.
Explanation:
To determine the partial pressure of hydrogen gas (H2) in the mixture,
Partial pressure H₂ = Ptotal * xH₂
xH₂ = Mole fraction of H₂ = ∩H₂ / ( ∩H₂ + ∩O₂ + ∩N₂)
xH₂ = 0.01 / (0.01 + 0.015 + 0.025)
xH₂ = 0.01/0.05
xH₂ = 0.2
therefore
PH₂ = pT * xH₂
PH₂ = 1.0 atm * 0.2
PH₂ = 0.2 atm
so the correct option is C) About 0.20atm, because H2 comprises 20% of the total number of moles of gas.
The correct answer to the question is Option C. About 0.20 atm, because H₂ comprises 20% of the total number of moles of gas.
We'll begin by calculating the mole fraction of Hydrogen (H₂) in the mixture.
Mole of Hydrogen (H₂) = 0.01 mole
Mole of Oxygen (O₂) = 0.015 mole
Mole of Nitrogen (N₂) = 0.025 mole
Total mole = 0.01 + 0.015 + 0.025 = 0.05 mole
Mole fraction of Hydrogen (H₂) =?Mole fraction = mole of gas / total mole
Mole fraction of Hydrogen (H₂) = 0.01 / 0.05
Mole fraction of Hydrogen (H₂) = 0.2NOTE: The mole fraction of Hydrogen, H₂ (i.e 0.2) in the mixture is exactly 20%.
Finally, we shall determine the partial pressure of Hydrogen, H₂. This can be obtained as follow:
Mole fraction of Hydrogen (H₂) = 0.2
Total pressure = 1 atm
Partial pressure of Hydrogen (H₂) =?Partial pressure = mole fraction × total pressure
Partial pressure of Hydrogen (H₂) = 0.2 × 1
Partial pressure of Hydrogen (H₂) = 0.2 atmFrom the calculations made above, we can see that the correct answer to the question is:
Option C. About 0.20 atm, because H₂ comprises 20% of the total number of moles of gas.
Learn more: https://brainly.com/question/15075781
A scientist claims to have discovered an element with 30 protons in its nucleus. He determines it has 60 electrons. Why is his information False?
A.The number of electrons is always equal to the number of protons in its outer shell.
B.The number of protons, the number of neutrons, and the number of electrons are always equal.
C.The number of electrons in an atom of an element is always the same as the number of protons in its nucleus.
D.The number of electrons in an atom of an element is always half of the number of the protons in its nucleus.
Answer:
the number of electrons in an atom of an element is always the same as the number of protons in its nucleus
The number of electrons in an atom of an element being always the same
as the number of protons in its nucleus is False.
What is an Electron?This is a sub-atomic particle which is negatively charged and is usually
involved in chemical reactions.
Electropositive elements donates electrons while electronegative
elements accepts electrons during chemical reactions which is why the
number of proton and electron aren't always the same.
Read more about Electrons here https://brainly.com/question/900457
The formula for water is H₂O meaning there are 2 Hydrogen atoms and 1 oxygen. What is the atomic mass of one molecule to the nearest hundredth?
A) 17.99
B) 16.99
C) 15.99
D) 18.99
\( { \bf\implies 17.99u}\)
Step-by-step explanation:We know that water is the combination of two hydrogen atoms and one oxygen atoms.To find atomic mass of water (\(\bf{H_2O}\))
Atomic mass of Hydrogen × 2 + Atomic mass of oxygen × 1We know that,
Atomic mass of Hydrogen = 1Atomic mass of Oxygen = 15.99\(\mapsto\)1 × 2 + 15.99 × 1
\(\mapsto\)2 + 15.99
\(\mapsto\) 17.99u Ans.
Additional information :Learn the Period table of Elements to solve this type of questions. It is very important. I attached the period table of elements. Learn it and you are able to solve it.
How do chemical reactions differ from nuclear reactions? (2 points) Chemical reactions involve electrons and protons, and nuclear reactions only involve protons. Chemical reactions involve changes in bonding, and nuclear reactions involve changes in an atom's nucleus. Chemical reactions involve forming bonds, and nuclear reactions involve breaking bonds. Chemical reactions involve sharing of electrons, and nuclear reactions involve the formation of ions.
Nuclear reactions include a change in the nucleus of an atom, which typically results in the production of a new element. Contrarily, chemical reactions only require the rearrangement of electrons and do not affect the nuclei; rather, they entail changes in bonding.
What is a nuclear reaction & a chemical reaction?
Nuclear fission or fusion processes were necessary for the synthesis of elements (decay). Atomic atoms' nuclei are the site of nuclear reactions, as the name suggests.Outside the atom's nucleus, in the electron cloud, chemical processes take to occur. The electromagnetic force is present during chemical processes. An atom's s and p subshells are where most chemical reactions take place. Valence electrons are those located in the outermost s and p subshells.Most of the operations we are acquainted with are powered by chemical reactions, including food digestion, and the conversion of carbohydrates into energy. Chemical processes lack the energy of nuclear reactions. In the atomic core, protons and neutrons participate in nuclear processes. Electrons orbit the nucleus during chemical reactions.Therefore it is concluded that option (B) is correct.
Learn more about the nuclear reaction here:
https://brainly.com/question/13315150
#SPJ1
Which statement describes the law of conservation of energy?
O All systems will exchange matter and energy with their surroundings.
O All systems can exchange energy, but not matter, with their surroundings.
O Energy cannot be created nor destroyed, but it changes from one form to another.
O Energy is destroyed in most chemical reactions when new products are formed.
Answer:
option C is the correct answer
Explanation:
that's the law of the conservation of energy itself
Option C: The statement that best describes the law of conservation of energy is that energy cannot be created nor destroyed, but it changes from one form to another. The first law of thermodynamics, also referred to as this principle, asserts that the total energy within a closed system remains constant throughout its duration.
Energy may transform from one form to another, such as from kinetic to potential or from thermal to mechanical, but the total energy remains unchanged. This fundamental law has far-reaching implications in various scientific disciplines. It underlies the understanding of energy transfers and conversions in mechanical systems, chemical reactions, and even biological processes. It serves as a guiding principle for studying energy flow and efficiency in different contexts.
The law of conservation of energy has significant practical applications. It allows scientists and engineers to analyze and design systems with a clear understanding of energy conservation. It enables the development of energy-saving technologies and sustainable practices.
To know more about law of conservation of energy, refer:
https://brainly.com/question/24089603
b. How many kJ of heat are needed to completely vaporize 50.0g of water at 100°C? [Ans:113. kJ]
The amount, in kJ, of heat needed to completely vaporize 50.0g of water at 100°C is 118.8 kJ.
Heat of vaporization of waterThe heat needed to completely vaporize 50.0g of water at 100°C can be calculated using the following formula:
q = m x Hv
where:
q is the heat needed in joules (J)m is the mass of water in grams (g)Hv is the heat of vaporization of water which is approximately 40.65 kJ/mol at standard temperature and pressure.First, we need to convert 50.0g to moles by dividing by the molar mass of water which is approximately 18.015 g/mol3:
moles of water = 50.0 g / 18.015 g/mol moles of water = 2.776 mol
Thus:
q = (2.776 mol) x (40.65 kJ/mol) q = 112.8 kJ
In other words, 112.8 kJ of heat is needed to completely vaporize 50.0g of water at 100°C.
More on heat of vaporization can be found here: https://brainly.com/question/12625048
#SPJ1
How many molecules are in 5 moles of O2?
Answer: 6.02 × 10^24
Explanation:
What does it take in order for plates to move?
Answer:
Earth's thin outer shell is broken into big pieces called tectonic plates. These plates fit together like a puzzle, but they're not stuck in one place. They are floating on Earth's mantle, a really thick layer of hot flowing rock. The flow of the mantle causes tectonic plates to move in different directions.
Explanation:
Write the formula of the hemiacetal
product when
CH3-CH₂-CH₂-CH₂-CHO
reacts with CH₂CH₂OH. Also, write the
acetal product.
When CH3-CH2-CH2-CH2-CHO (butyraldehyde) reacts with CH2CH2OH (ethylene glycol), a hemiacetal is formed.
The reaction can be written as:
CH3-CH2-CH2-CH2-CHO + CH2CH2OH → CH3-CH2-CH(OH)-CH2-CH2OH
The hemiacetal product is CH3-CH2-CH(OH)-CH2-CH2OH.
If the reaction continues, a second molecule of ethylene glycol can react with the hemiacetal to form an acetal:
CH3-CH2-CH(OH)-CH2-CH2OH + CH2CH2OH → CH3-CH2-CH(OC2H4)-CH2-CH2OH + H2O
The acetal product is CH3-CH2-CH(OC2H4)-CH2-CH2OH.
What is a molecule ?Molecules can exist in different states, including gases, liquids, and solids. The physical and chemical properties of a molecule are determined by the types of atoms it contains, the way the atoms are arranged, and the types of chemical bonds between them. The study of molecules and their properties is an important area of chemistry and plays a crucial role in many areas of science and technology, including materials science, pharmaceuticals, and biochemistry.
To know more about Molecules visit :
https://brainly.com/question/19922822
#SPJ1
When potassium and chlorine form a chemical compound, the atoms
a. become less stable, and covalent bonds are
formed
b. become more stable, and covalent bonds are
formed
c. become less stable, and ionic bonds are
formed
d. become more stable, and ionic bonds are
formed
Answer:
D
Explanation:
Potassium metal and chlorine gas combine to form potassium chloride. The balanced equation is 2K (s) + Cl2 (g)→2KCl (s) There are two chlorine atoms on the left-hand side (LHS) and one chlorine atom on the right-hand side (RHS).
5. The density of water at 4.00°C is 0.967 g/mL. How many molecules of water are present in a 499.8 mL bottle of water? Express your answer to the correct number of significant figures
There are approximately 1.62 x 10^25 water molecules in the 499.8 mL bottle of water.
To determine the number of water molecules in the given volume of water, we need to use the relationship between mass, volume, and molar mass of water.
First, we need to find the mass of water in the bottle:
Mass = Density * Volume
Mass = 0.967 g/mL * 499.8 mL = 483.9 g
Next, we need to convert the mass of water to moles using the molar mass of water. The molar mass of water (H2O) is approximately 18.015 g/mol.
Moles = Mass / Molar mass
Moles = 483.9 g / 18.015 g/mol = 26.88 mol
Finally, we can calculate the number of water molecules using Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.
Number of molecules = Moles * Avogadro's number
Number of molecules = 26.88 mol * (6.022 x 10^23 molecules/mol) = 1.62 x 10^25 molecules
Therefore, there are approximately 1.62 x 10^25 water molecules in the 499.8 mL bottle of water.
for more questions on molecules
https://brainly.com/question/24191825
#SPJ8
You have 400,000 atoms of a radioactive substance. After 3 half-lives have past, how many atoms remain? Remember that you cannot have a fraction of an atom, so round the answer to the nearest whole number.
Answer:
Explanation:
The number of atoms that remains after 3 half-lives given that it was originally 300000 atoms is 37500 atoms
Data obtained from the question
Original amount (N₀) = 300000 atoms
Number of half-lives (n) = 3
Amount remaining (N) =?
How to determine the amount remaining
The amount remaining after 3 half-lives can be obtained as illustrated below:
N = N₀ / 2ⁿ
N = 300000 / 2³
N = 300000 / 8
N = 37500 atoms
Among the following bonds, which would be the least polar? Electronegativity values are: Na = 0.9, O = 3.5, F = 4.0, Cl = 3.0, Br = 2.8, I = 2.5
Answer:
e. Na_I
Explanation:
a. Na–O
b. Na–F
c. Na–Cl
d. Na–Br
e. Na–I
Bond polarity can be calculated, examining the Pauling scale electronegativity values of the two atoms. The difference between these values will determine the predominant type of bond between the respective atoms.
Therefore, Na-I would be least polar bond. (The difference in the electronegativies of the two atom is least)
a
46. Make and Use Tables Find information in
newspaper articles or magazines describing
five recent earthquakes. Construct a table for
each earthquake that shows the date, location,
magnitude, and whether the damage caused
by the earthquake was light, moderate, or
heavy.
Answer:
the one above me is correct
Explain the significance of:_______. a) a very large value of K, b) a very small value of K, and c) a K value of about 1.0.
Answer:
See explanation
Explanation:
a) A large value of K shows that the reaction is product favoured. It implies that more reactants are converted to products and the equilibrium concentration of products in the system is far higher than that of the reactants. The reaction will proceed towards the right hand side.
b)A small value of K implies that the reaction is reactant favoured. There are more reactants than products present at equilibrium and the reaction will proceed towards the lefthand side.
c) K=1 implies the presence of a significant concentration of reactants and products in the system at equilibrium.
The following Lewis diagram represents the valence electron configuration of a main-group element.
This element is in group
.
According to the octet rule, this element would be expected to form an ion with a charge of
.
If is in period 5, the ion formed has the same electron configuration as the noble gas
.
The symbol for the ion is
.
This element is in group 1.
According to the octet rule, this element would be expected to form an ion with a charge of +1.
If X is in period 5, the ion formed has the same electron configuration as the noble gas Krypton
The symbol for the ion is Rb⁺
What is electronic configuration?Electronic configuration refers to the arrangement of electrons in the orbitals of an atom or molecule, indicating the energy level of the electrons, the number of electrons in each energy level, and the number of electrons in each orbital.
Considering the given element:
It has one valence electron, hence it is in group 1. Group 1 elements form ions with a charge of +1.
Losing one electron will give the ion the same electron configuration as Kyrton since it is the noble gas in Period 4.
The element is rubidium and the ion is Rb⁺.
Learn more about electronic configuration at: https://brainly.com/question/26084288
#SPJ1