Before any reaction occurs, the concentration of A in the reaction below is 0.0510 M. What is the equilibrium constant if the concentration of A at equilibrium is 0.0153 M?

Answers

Answer 1
A (aq) ⇌ 2B (aq) + C (aq)

Remember to use correct significant figures in your answer (round your answer to the nearest ten thousandth). Do not include units in your response.
Answer 2

Answer:

0.0119

Explanation:

There was a part missing. I think this is the whole question:

Before any reaction occurs, the concentration of A in the reaction below is 0.0510 M. What is the equilibrium constant if the concentration of A at equilibrium is 0.0153 M?

A (aq) ⇌ 2B (aq) + C(aq)

Remember to use correct significant figures in your answer. Do not include units in your response.

First, we have to make an ICE Chart, which stands for initial, change and equilibrium. We will call "x" unknown concentrations.

        A (aq) ⇌ 2B (aq) + C (aq)

I       0.0510       0            0

C         -x          +2x          +x

E    0.0510-x     2x            x

Since the concentration at equilibrium of A is 0.0153 M, we get

\(0.0510 - x = 0.0153 \\x = 0.0357\)

We can use the value of x to calculate the concentrations at equilibrium.

\([A]e = 0.0153 M \\[B]e = 2x = 2(0.0357) = 0.0714 M \\[C]e = x = 0.0357 M \\\)

The equilibrium constant, Kc, is the ratio of the equilibrium concentrations of products over the equilibrium concentrations of reactants each raised to the power of their stoichiometric coefficients.

\(Kc = \frac{[B]^{2} \times [C]}{[A]} = \frac{0.0714^{2} \times 0.0357}{0.0153} = 0.0119\)

The equilibrium constant for this reaction at equilibrium is 0.0119.

You can learn more about equilibrium here: https://brainly.com/question/4289021

Before Any Reaction Occurs, The Concentration Of A In The Reaction Below Is 0.0510 M. What Is The Equilibrium

Related Questions

Identify the activated complex in the following reaction.

a. CuFeSO
b. FeFe
c. FeCuSO4
d. FeSO4

Identify the activated complex in the following reaction. a. CuFeSOb. FeFec. FeCuSO4d. FeSO4

Answers

The activated complex in the following reaction is: FeCuSO4. The activated complex is a transition state that is an intermediate structure in a chemical reaction. Option C)

An activated complex is a structure that exists temporarily during a chemical reaction and corresponds to the top of the energy barrier that must be overcome for the reaction to proceed to completion.

The activated complex in the following reaction is: FeCuSO4. The activated complex is a transition state that is an intermediate structure in a chemical reaction. It is the structure with the greatest energy within the reaction process and is used to determine the rate at which the reaction occurs. An activated complex exists when the energy required to break the old bonds and form new ones has been absorbed. It has a specific configuration and energy content that is precisely defined.

A chemical reaction is the process by which atoms or groups of atoms in molecules interact to form new molecules. A chemical reaction is caused by the motion of electrons, which are negatively charged particles that surround atomic nuclei. The reaction proceeds through the formation of an intermediate species known as the transition state or activated complex. Reaction mechanisms are the sequence of steps involved in a chemical reaction. These steps describe the intermediate species formed as the reactants are converted to products. Hence option C) is correct.

for more questions on reaction

https://brainly.com/question/25769000

#SPJ8

10. When dissolved in water, most Group 1 metal salts can be described as
strong electrolytes.
strong acids.
weak electrolytes.
A
B
C
D
non-electrolytes.
(1)

Answers

When dissolved in water, most Group 1 metal salts can be described as strong electrolytes.

When Group 1 metal salts are dissolved in water, they can be described as strong electrolytes. This is because Group 1 metals, such as lithium (Li), sodium (Na), potassium (K), and so on, readily lose their outermost valence electron to form positive ions (cations). These cations then dissociate completely in water, separating from the anions to which they were originally bonded.

The dissociation of Group 1 metal salts in water results in the formation of positively charged metal ions and negatively charged non-metal ions (anions). These ions are free to move and conduct electric current, making the solution a good conductor of electricity. The complete dissociation of Group 1 metal salts in water and the presence of freely moving ions make them strong electrolytes.

Strong electrolytes are substances that ionize completely or almost completely in solution, producing a high concentration of ions. This is in contrast to weak electrolytes, which only partially ionize and produce a lower concentration of ions.

In summary, when Group 1 metal salts are dissolved in water, they form strong electrolytes due to their ability to dissociate completely into ions, leading to a high concentration of freely moving ions in the solution, thus enabling efficient electrical conductivity.

Know more about Group 1 metal salts here:

https://brainly.com/question/13277375

#SPJ8

what part of of the universe is less than 1 km in diameter

Answers

Answer:

Meteoroids

Explanation:

Meteoroids are the elements of the universe that have the smallest diameter among all elements, reaching less than 1 km in diameter. They are any rocky or metallic body, which exists in space and does not reach more than 100 meters. It is common for meteoroids to fall to earth, but their impact is not as destructive as the impact of other space bodies, due to their tiny size.

Thermal energy transfer lab report.
I need answers for questions 1-11.
If you cannot answer every question, that is ok. I just need the help. Here are the questions.
1. What is the purpose of the lab, the importance of the topic, and the question you are trying to answer?

2. What is your hypothesis (or hypotheses) for this experiment?

3. What methods are you using to test this (or each) hypothesis?

4. Locate the data and observations collected in your lab guide. What are the key results? How would you best summarize the data to relate your findings?

5. Do you have quantitative data (numerical results or calculations)? Do you have qualitative data (written observations and descriptions)? How can you organize this date for your report?

6. What do the key results indicate?


7. If you constructed graphs, what trends do they indicate in your data?


8. Were there any problems with the experiment or the methods? Did you have any surprising results?

9. What do the results tell you about your hypothesis(es)?

10. How do the data support your claim above?

11. If you could repeat the experiment and make it better, what would you do differently and why?

Answers

Thermal energy flows from hot to colder bodies and is determined by the process of calorimetry.

What is thermal energy?

Thermal energy is the energy transfer process which occurs as a result temperature difference between two bodies.

Thermal energy flows from hot to colder bodies.

The quantity of Heat transfer is determined using a calorimeter.

The calorimeter works on the principle of conservation of energy. The principle of the calorimeter is stated as follows:

Heat lost = Heat gained

The quantity of Heat, q = mass × specific heat capacity × temperature difference

Therefore, it can be concluded that thermal energy flows from hot to colder bodies.

Learn more about thermal energy at: https://brainly.com/question/7541718

Answer:

I did this earlier, here's what I put.

Amoeba sisters vidoe recap digestive system anwser key

Answers

The digestion process in an amoeba occurs within its cell membrane. They are characterized by their ability to form temporary extensions of their cytoplasm called pseudopodia which they use to move, capture food, and perform various other functions.

What are amoeba?

A form of single celled organism known as an amoeba is a member of the protozoa phylum. It is a tiny, eukaryotic organism with the capacity to modify its shape continuously and lacks a fixed shape. Amoebas belong to the phylum Amoebozoa and are typically found in freshwater habitats, soil, and marine sediments.

An amoeba can generate temporary extensions of its cytoplasm, known as pseudopodia, which it uses for a variety of activities include locomotion, feeding, and trapping prey. The amoeba can travel and ingest food particles by surrounding them thanks to its flexible pseudopodia, which may be expanded in any direction.

Learn more on amoeba here https://brainly.com/question/2171888

#SPJ1

Here is the complete question:

Describe the digestive system of the amoeba.

Measuring liquid volume

Measuring liquid volume

Answers

The instrument to measure volume in the laboratory here is a graduated cylinder and volumes include, for example, 68 ml (1), 32,5 ml (2), 82 ml (3), etc.

What is a graduated cylinder?

A graduated cylinder is an instrument used in laboratories to measure the volume of a given solution, which is generally expressed as millimeter units (ml).

In this case, the millimeters can exactly determine the volume of liquid that will be used during the formulation of the solution.

In conclusion, the instrument to measure volume in the laboratory here is a graduated cylinder and volumes include, for example, 68 ml (1), 32,5 ml (2), 82 ml (3), etc.

Learn more about graduated cylinders here:

https://brainly.com/question/24869562

#SPJ1

Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C, given that [Sn2+]=0.0624 M, [Fe3+]=0.0437 M, [Sn4+]=0.00655 M, and [Fe2+]=0.01139 M. Standard reduction potentials can be found in this table.

Sn2+(aq)+2Fe3+(aq)↽−−⇀ Sn4+(aq)+2Fe2+(aq)

So far my incorrect answers have been:
0.28
0.798
0.178
0.142
0.881
0.61
and 0.812

Answers

Answer:

The cell potential for the given galvanic cell is 0.188 V.

Explanation:

To calculate the cell potential, we can use the Nernst equation:

Ecell = E°cell - (RT/nF)ln(Q)

where E°cell is the standard cell potential, R is the gas constant (8.314 J/mol·K), T is the temperature in Kelvin (25°C = 298 K), n is the number of moles of electrons transferred (in this case, n = 2), F is the Faraday constant (96,485 C/mol), and Q is the reaction quotient.

First, we need to write the half-reactions and their standard reduction potentials:

Sn4+(aq) + 2e- → Sn2+(aq) E°red = 0.15 V

Fe3+(aq) + e- → Fe2+(aq) E°red = 0.77 V

The overall reaction is the sum of the half-reactions:

Sn2+(aq) + 2Fe3+(aq) → Sn4+(aq) + 2Fe2+(aq)

The reaction quotient Q can be expressed as:

Q = [Sn4+][Fe2+]^2 / [Sn2+][Fe3+]^2

Substituting the given concentrations, we get:

Q = (0.00655)(0.01139)^2 / (0.0624)(0.0437)^2 = 0.209

Now we can calculate the cell potential:

Ecell = 0.15 V + 0.0592 V log([Fe2+]^2/[Fe3+]) + 0.0592 V log([Sn4+]/[Sn2+])

= 0.15 V + 0.0592 V log(0.01139^2/0.0437^2) + 0.0592 V log(0.00655/0.0624)

= 0.188 V

Therefore, the cell potential for the given galvanic cell is 0.188 V.

The cell potential for the given galvanic cell in which the given reaction occurs at 25 °C is 0.188 V.

How to the cell potential of galvanic cell?

To find the cell potential, we take the Nernst equation:

Ecell = E°cell - (RT/nF)ln(Q)

In which R is the gas constant (8.314 J/mol·K) and E° cell is the standard cell potential.

T temperature in Kelvin (25°C = 298 K), and n is the number of moles of electrons transferred (n = 2), Q is the reaction quotient and F is the Faraday constant (96,485 C/mol).

Firstly, write the half-reactions and then their standard reduction potentials:

Sn⁴⁺(aq) + 2e⁻  → Sn²⁺(aq) E°red = 0.15 V

Fe³⁺(aq) + e⁻ → Fe²⁺(aq) E°red = 0.77 V

The overall reaction is the sum of the half-reactions:

Sn²⁺(aq) + 2Fe³⁺(aq) → Sn⁴⁺(aq) + 2Fe²⁺(aq)

The Q reaction quotient can be written as:

Q = [Sn⁴⁺][Fe²⁺]² ÷ [Sn²⁺][Fe²⁺]²

Substituting the given concentrations, we observe:

Q = (0.00655)(0.01139)² ÷ (0.0624)(0.0437)² = 0.209

Next, we can find the cell potential:

Ecell = 0.15 V + 0.0592 V log([Fe²⁺]²/[Fe³⁺]) + 0.0592 V log([Sn⁴⁺]/[Sn²⁺])

= 0.15 V + 0.0592 V log(0.01139²÷0.0437²) + 0.0592 V log(0.00655÷0.0624)

= 0.188 V

Thus, the cell potential for the given galvanic cell is 0.188 V.

Learn more about cell potential, here:

https://brainly.com/question/29719917

#SPJ2

PLEASE PLEASE I do not understand may someone kindly help me pls

PLEASE PLEASE I do not understand may someone kindly help me pls

Answers

Answer:

It can be verified since the information came from a government article. Or you could trust the magzine/general article if its from a well known article. Explanation:

you get the point, you can add on to this. I can't make it the best since im not in your class learning. Good luck


How much kinetic energy does a 6.08 kg ball have if it's moving with a speed of 1.14 m/s?

Answers

Answer: KE = 8.6917248 J

I'm not for sure but I am pretty positive this is the answer

Which one of the following salts is least soluble in water?

1. Na2SO4
2.CaBr2
3. LiCl
4. RbI
5. PbSO4

Answers

the answer is PbSO4 !!

Relations to my budget

Relations to my budget

Answers

When there is an increase in an activity, like sales or manufacturing, the overall amount of an expense, known as a fixed expense, does not change.

Thus, Normal definitions typically include the phrase within a relevant or appropriate range of activity since a change is likely to take place at fixed expense either an exceptionally high or low volume or expense.

Of course, the rent will probably need to adjust if sales quadruple or fall to 20% of the average level. However, as the extreme circumstances are outside of the relevant range for short-term analysis, the current rent of $2,000 is regarded as a fixed expense.)

The following are some instances of costs that are probably set within a fair range of retail sales, The yearly pay for the shop manager.

Thus, When there is an increase in an activity, like sales or manufacturing, the overall amount of an expense, known as a fixed expense, does not change.

Learn more about Expenses, refer to the link:

https://brainly.com/question/29850561

#SPJ1

Give IUPAC names for the following compounds:

Give IUPAC names for the following compounds:

Answers

Answer:

Explanation:

IUPAC nomenclature is based on naming a molecule's longest chain of carbons connected by single bonds, whether in a continuous chain or in a ring. All deviations, either multiple bonds or atoms other than carbon and hydrogen, are indicated by prefixes or suffixes according to a specific set of priorities

Where did the zebra mussels originally come from? Plz help

Answers

Answer:

The zebra mussel is a fresh and brackish water bivalve mollusk. It feeds on plankton and suspended organic matter. It is listed 100 most damaging invasive alien species in the world of the International Union for Conservation of Nature

Zebra mussels are an invasive, fingernail-sized mollusk that is native to fresh waters in Eurasia. Their name comes from the dark, zig-zagged stripes on each shell. Zebra mussels probably arrived in the Great Lakes in the 1980s via ballast water that was discharged by large ships from Europe

Explanation:

hope this helps

Answer:

Eurasia

Explanation:

A new non-electrolyte molecule is discovered. When 241 mg of the molecule is dissolved in 250.0 mL of water, it has an osmotic pressure of 0.072 atm at 25 oC.What is the molar mass of the molecule

Answers

Answer:

327.89g/mol

Explanation:

Step 1:

The following data were obtained from the question:

Van 't Hoff factor (i) = 1 (since the molecule is non-electrolyte)

Temperature (T) = 25°C = 25°C + 273 = 298K

Gas constant (R) = 0.0821 atm.L/Kmol

Mass of molecule = 241mg

Volume of water = 250mL

Molarity (M) =?

Osmotic pressure (Π) = 0.072 atm

Step 2:

Determination of the molarity of the molecule.

This can be obtained as follow:

Π = iMRT

0.072 = 1 x M x 0.0821 x 298

Divide both side by 0.0821 x 298

M = 0.072 / (0.0821 x 298)

M = 2.94×10¯³ mol/L

Step 3:

Determination of the number of mole of the molecule. This can be obtained as follow:

Molarity = 2.94×10¯³ mol/L

Volume of water = 250mL = 250/1000 = 0.25L

Mole of molecule =..?

Molarity = mole /Volume

2.94×10¯³ = mole / 0.25

Cross multiply

Mole of molecule = 2.94×10¯³ x 0.25

Mole of molecule = 7.35×10¯⁴ mole.

Step 4:

Determination of the molar mass of the molecule.

Mole of molecule = 7.35×10¯⁴ mole.

Mass of molecule = 241mg = 241×10¯³g

Molar mass of molecule =..?

Mole = Mass /Molar Mass

7.35×10¯⁴ = 241×10¯³/ Molar Mass

Cross multiply

7.35×10¯⁴ x molar mass = 241×10¯³

Divide both side by 7.35×10¯⁴

Molar Mass = 241×10¯³/7.35×10¯⁴

Molar Mass = 327.89g/mol

Therefore, the molar mass of the molecule is 327.89g/mol

What is the correct conversion factor when converting from moles to liters?

Answers

The correct conversion factor when converting from moles to liters is the molar volume at a given temperature and pressure.

This value is dependent on the ideal gas law and can be determined using the ideal gas equation PV = nRT, where P represents pressure, V represents volume, n represents the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.

The molar volume of an ideal gas at standard temperature and pressure (STP), which is 0 degrees Celsius (273.15 Kelvin) and 1 atmosphere (101.3 kilopascals), is approximately 22.4 liters per mole.

Therefore, to convert moles to liters, you can multiply the number of moles by the molar volume at STP, which gives you the volume in liters.

It's important to note that the molar volume is an approximation and assumes ideal gas behavior.

Additionally, if you are working with gases at different temperatures and pressures, you would need to use the appropriate molar volume value corresponding to the given conditions.

for such more questions on volume

https://brainly.com/question/29796637

#SPJ8

The outer ______ are the parts of an atom that are involved in chemical reactions. A. electrons and protons B. electrons C. protons and neutrons D. protons

Answers

The outer ______ are the parts of an atom that are involved in chemical reactions. A. electrons and protons B. electrons C. protons and neutrons D. protons

The answer is B Electrons

Why is the chemical formula Li2H incorrect? Select the correct answer below: A. There should be one lithium, not two. B. There should be one lithium and two hydrogens. C. Lithium does not react with hydrogen. D. There should be three lithiums, not two.

Answers

Answer:

There should be one lithium, not two.

Explanation:

Lithium reacts with hydrogen at about 750°C to yield lithium hydride (LiH). LiH is white and powdery in appearance. It releases hydrogen gas when it reacts with water.

The correct formula for Lithium hydride is LiH and not Li2H because both lithium and hydrogen are univalent. Lithium has a valency of +1 while hydrogen has a valency of -1 in lithium hydride. Hydrides are formed between hydrogen and highly electro positive metals. In hydrides, hydrogen is forced to accept an electron from the highly electro positive metal.

A chunk of unidentified element, (element "X"), is reacted with nitrogen to form an ionic compound with the chemical formula X3N2. Which of the following elements is the most likely identity of X? a. Se b. Ba c. K d. Al e. Cl

Answers

The correct answer is b. Ba.

To determine which element is the most likely identity of X, we can use the valency of nitrogen and the formula of the ionic compound X3N2.

Nitrogen has a valency of 3-, which means it forms an ion with a charge of -3. Therefore, in the ionic compound X3N2, the total charge of the cations (X3+) must be equal to the total charge of the anions (2N3-).

We can write the equation to express this relationship as:

3X+ + 2N3- → X3N2

Since the compound contains three X cations and two N anions, the cation X must have a charge of +2 to balance the overall charge of the compound.

From the list of elements given, only Ba (barium) has a 2+ charge, which makes it the most likely identity of X. Therefore, the correct answer is b. Ba.

What is nitrogen?

It is a nonmetal and makes up about 78% of Earth's atmosphere, by volume. Nitrogen is the most abundant element in Earth's atmosphere and is chemically inert under normal conditions. It is an essential element for life as it is a component of amino acids, proteins, and nucleic acids such as DNA.

To know more about nitrogen, click the link given below:

https://brainly.com/question/16711904

#SPJ1

A student dissolves 15.0 g of ammonium chloride(NH4Cl) in 250. 0 g of water in a well-insulated open cup. She then observes the temperature of the water fall from 20.0 oC to 16.0 oC over the course of minutes. Use this data, and any information you need from the ALEKS Data resource, to answer the questions below about this reaction:
NH4Cl(s) rightarrow NH4+(aq) + Cl-(aq)
You can make any reasonable assumptions about the physical properties of the solution. Note for advanced students: it's possible the student did not do the experiment carefully, and the values you calculate may not be the same as the known and published values for this reaction.
1. Is this reaction exothermic, endothermic, or neither?
2. If you said the reaction was exothermic or endothermic, calculate the amount of heat that was released or absorbed by the reaction in this case.
3. Calculate the reaction enthalpy deltaHrxn per mole of NH4CI.

Answers

Answer:  

1) Endothermic.  

2) \(Q_{rxn}=4435.04J\)  

3) \(\Delta _rH=15.8kJ/mol\)

Explanation:  

Hello there!  

1) In this case, for these calorimetry problems, we can realize that since the temperature decreases the reaction is endothermic because it is absorbing heat from the solution, that is why the temperature goes from 22.00 °C to 16.0°C.  

2) Now, for the total heat released by the reaction, we first need to assume that all of it is released by the solution since it is possible to assume that the calorimeter is perfectly isolated. In such a way, it is also valid to assume that the specific heat of the solution is 4.184 J/(g°C) as it is mostly water, therefore, the heat released by the reaction is:

\(Q_{rxn}=-(15.0g+250.0g)*4.184\frac{J}{g\°C}(16.0-20.0)\°C\\\\ Q_{rxn}=4435.04J\)    

3) Finally, since the enthalpy of reaction is calculated by dividing the heat released by the reaction over the moles of the solute, in this case NH4Cl, we proceed as follows:

\(\Delta _rH=\frac{ Q_{rxn}}{n}\\\\\Delta _rH= \frac{ 4435.04J}{15.0g*\frac{1mol}{53.49g} } *\frac{1kJ}{1000J} \\\\\Delta _rH=15.8kJ/mol\)

Best regards!  

Best regards!

Convert 100.6 Kelvin to degrees C.

°C = K - 273
[?] °C ​

Answers

Answer:

  -172.6 °C

Explanation:

You want to know the Celsius equivalent of the temperature 100.6 K.

Conversion

The relation is ...

  C = K - 273.15

  C = 100.6 -273.15 = -172.55

The temperature is -172.55 °C, about -172.6 °C.

__

Additional comment

We have rounded to tenths, because that is precision of the temperature given. If you use 273 as the conversion constant, you will get -172.4.

write the lewis structure for h3po4 . if necessary, expand the octet on any appropriate atoms to lower the formal charge.

Answers

The molecule has a central phosphorus atom which uses all five of its valence electrons.It forms a double bond with one oxygen atom and three single bonds with three oxygen atoms.The three hydrogen atoms are bonded to the three singly-bonded oxygen atoms.

First calculate the total number of valence electrons and that is equal to. [(3)(1)+(1)(5)+(4)(6)] = 32 e-

For most stable structure we must keep few things in our mind i.e.

Structure must be symmetrical

In oxy acids, hydrogen be attached with oxygen [O-H]

Those structure are preferred which have maximum no. of Zero formal charge.

We have H3PO4

Hydrogen will attach with oxygen and p will be our central atomNow use all valence electrons (32) for lone pairs and single bond.Check formal charge on all atom

We get -1 on O and +1 on P and rest are Zero

So for stable structure we will use a double bond between P and O with help of one lone pair of O and a coordinate bond will form.

So finally this is the stable structure of H3PO4

To know more about valence electrons :-

brainly.com/question/13993867

#SPJ4

If a gas is cooled from 222 K to 125 K and the volume is kept constant, what would be the final
pressure if the original pressure was 760 mmHg?

Answers

Assuming the mass of the gas also remains constant, this problem is an straightforward application of Gay-Lussac’s gas law: P1/T1 = P2/T2. That is, at a constant volume, the pressure and temperature of a gas are directly proportional.

We know the initial and final temperatures of the gas (T1 = 222 K; T2 = 125 K) and the initial pressure (760 mmHg). And we want to know what the final pressure would be. Since pressure and temperature are directly proportional and the final temperature is less than the initial temperature, we should expect the final pressure (P2) to be less than 760 mmHg.

Rearranging Gay-Lussac’s law to solve for P2, we obtain P2 = P1T2/T1. Plugging in our quantities, we get our final pressure: P2 = (760 mmHg)(125 K)/(222 K) = 428 mmHg.

many types of animals have internal skeletons a large part of these animals masses located in them bones as an animal grows its skeleton grows a growing animal must increase the size of its bones to do this animal needs lots of calcium an element important to do structure of Bones how can a growing animal get calcium to make new bones tissue? A-by removing calcium from the air B- by consuming food that contains Calcium C- by making calcium from other elements D- by removing calcium from the bones ​

Answers

Answer: b- by consuming food that contains calcium

Explanation:

when two water molecules are near each other, a hydrogen bond will form between the more positive and the more negative atoms of neighboring water molecules. t or f

Answers

It is false that when two water molecules are near each other, a hydrogen bond will form between the more positive and the more negative atoms.

What is the composition of a water particle?

A water particle is composed of two hydrogen atoms and one oxygen atom.

How do water particles bond?

When there are two water particles close a bond is formed between the hydrogen atom of one particle and the oxygen atom of a neighbor water particle, which means there is a hydrogen-oxygen bond rather than a hydrogen-hydrogen bond.

Learn more about water in https://brainly.com/question/28465561

#SPJ1

It is True that when two water molecules are near each other, a hydrogen bond will form between the more positive hydrogen atom of one molecule and the more negative oxygen atom of the neighboring molecule.

How is water molecules formed?

A water molecule is made up of two hydrogen atoms bonded to an oxygen atom, and its overall structure is bent. This is because the oxygen atom, forms a bond with hydrogen atoms. It also carries two pairs of unshared electrons. All of the electron pairs (shared and unshared) repel each other.

Hydrogen bond will form between the more positive and the more negative atoms of neighboring water molecules when two water molecules are near each other. This is due to the polar nature of water molecules, which have a slightly positive charge on the hydrogen atoms and a slightly negative charge on the oxygen atoms. These hydrogen bonds give water many of its unique properties, such as its high surface tension and high heat of vaporization.

Learn more about water molecules on

https://brainly.com/question/29413538

#SPJ1

how to find moles, when given molar mass

Answers

To find moles when given the molar mass, you can use the concept of molar mass as a conversion factor.Molar mass represents the mass of one mole of a substance, expressed in grams per mole (g/mol).

To calculate moles, divide the given mass of the substance by its molar mass. The equation is:

moles = mass / molar mass

For example, if you have 56 grams of carbon dioxide (CO2) and want to find the number of moles, you need to know the molar mass of CO2, which is approximately 44 g/mol. Using the equation above:

moles = 56 g / 44 g/mol

moles ≈ 1.27 mol

Therefore, there are approximately 1.27 moles of carbon dioxide in 56 grams.

For more such questions on molar mass

https://brainly.com/question/29424807

#SPJ8

Suppose a scientist proposes a plan to destroy all bacteria on Earth in order to get rid of diseases caused by bacteria. Explain why it would be a good idea to approve this plan or not.

Answers

This would not be a good idea because bacteria is everywhere and function as a part of out everyday lives. Starting off with animals, many animals rely on bacteria to digest their food so many animals would begin to die off. Ecosystems would fail due to nitrogen not being able to cycle.
Without bacteria biological waste would build up causing a drop in population, eventually going extinct.
Basically, the balance of nature between humans, animals, and plants would no longer exist.

What is the mass of 6.02 x 1024 molecules of the compound HCl?

Answers

Answer:

First, we need to determine the molar mass of HCl.

The molar mass of HCl = the mass of hydrogen (1.008 g/mol) + the mass of chlorine (35.45 g/mol) = 36.45 g/mol.

Next, we can use Avogadro's number (6.02 x 10^23 molecules/mol) to convert the number of molecules to moles:

6.02 x 10^24 molecules / 6.02 x 10^23 molecules/mol = 10 moles

Finally, we can use the molar mass to convert moles to grams:

10 moles x 36.45 g/mol = 364.5 grams

Therefore, the mass of 6.02 x 10^24 molecules of HCl is 364.5 grams.

6.02* 10^24 means 1 molecule of any substance
:. It means 1 mole of Hcl
:. To find the mass of HcL
no of moles = mass/ molar mass
To get the molar mass of HCL {H=1 CL=35.5}
:. H+CL = 1+ 35.5 =36.5
So we have our molar mass and number of moles now
Then we input it in the eqn
1=x/36.5
X= 36.5g of HCl

12. Which two elements have chemical properties that are most
similar?

A.C and N
B. Cl and Ar
C.K and Ca
D.Li and Na

Answers

Li and Na two elements have chemical properties that are most similar

The element that have the most similar chemical properties are those in the same group or column of the periodic table and one such group includes lithium sodium potassium these element are all shiny and conduct heat and electricity well and have similar chemical properties and the element in a group have the same number of electron in the outermost shell hence they have similar chemical properties

Know more about element

https://brainly.com/question/491273

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The pOH of a solution is 6.0. Which statement is correct?
Use pOH = -log[OH-] and PH+pOH = 14.
The pH of the solution is 20.0.
O The concentration of OH ions is 1.0 x 108 M.
The concentration of OH ions is 1.0 x 106 M.
O The pH of the solution is 8.0.
A

Answers

At pOH value  of 6.0 the pH value of the following solution is 8.0 and the concentration of [\(H^{+}\) ] ion is \(10^{-8}\)

In this question we will apply the formula

      pH +pOH = 14 . . . . . . . . . . . . .(1)

where pH = concentration of [\(H^{+}\) ] ion

pOH = concentration of [\(OH^{-}\) ] ion

As per the question

pOH =6.0

Putting the value of pOH in equation (1) we get the value of pH

              pH + 6.0 =14

             pH = 14 -6.0

             pH  = 8.0

 The value of pH if the pOH value is 6.0 is 8.0

To find the concentration of \(H^{+}\) ion we will use the following formula

This is calculated by the formula

                                 [\(H^{+}\)} = \(10^{-pH}\)

where we will write the values of pH

Hence the concentration of [\(H^{+}\)} ion is \(10^{-8}\)

Therefore at  pOH of 6.0 the pH value of the following solution is 8.0 and the concentration of [\(H^{+}\) ] ion is \(10^{-8}\)

Read more about pH

https://brainly.com/question/11300720

The complete question is -

What is the pH value and concentration of [\(H^{+}\) ] ion of the following if the pOH value of the solution is 6.0 ?

Other Questions
I need help..Match each figure to an equation that represents what is seen in the figure. for each match explain how they are a match franklin company produces 40,000 printers per month, which is 80% of plant capacity. variable manufacturing costs are $80 per unit, and fixed manufacturing costs are $1,200,000, or $30 per unit. the printers are normally sold directly to retailers at $150 each. franklin has an offer from a foreign wholesaler to purchase an additional 4,000 printers at $100 per unit. acceptance of the offer would not affect normal sales of the product and the additional units can be manufactured without increasing plant capacity. what is the amount of increase (decrease) to net income if franklin accepts the order? What can you infer about the overall opinion of people in Virginia, Kentucky, and Tennessee in regard to prewar issues the following table give all tests to score for a statistic class complete the stem and leaf plot below describe the shape of the distribution the green revolution has improved global agricultural output. which of the following best describes the authors perspective on the beginning of the green revolution in the 1970s and 1980s? (Meme attached for you.)The following original section of DNA is replicated, and a mutation occurs in the sequence. Compare the original sequence to the copied sequence. Which type of mutation occurred?The original DNA.TTACGGCCTAThe copied DNA.TTACGCCTA1. Physical 2. insertion3. Deletion 4. substitution according to labouvie-vief, _____ describes the cognitive development of the emerging adult. ASAP PLEASE I NEED YouR HELPSubtract 4 b 2 + 4 b 4 from 3 b 2 + 2 b 5 . can anyone answer please The Mexico City government asks you to analyze the effects that the construction of a subway line had on the income level of the inhabitants of the neighborhoods surrounding the subway. In particular, the government is interested in identifying if this particular subway line increased the income level of the neighborhoods around it. The subway line goes at street level, creating a barrier across what once was a thriving neighborhood, Santa Luca, and dividing it into two new neighborhoods, Nueva Santa Luca and Colonia Progreso. Construction of the subway line started in 1960, while the announcement of its construction occurred at the end of 1959. The neighborhood that was partitioned by the new subway line was one of the oldest in the city, composed primarily of middle-class houses and some public housing developments. It was considered a "representative neighborhood of the city" because it shared socioeconomic characteristics with the majority of neighborhoods in the city. In fact, his characteristic was shared by another old neighborhood of the city, San Ignacio. In the decade preceding the building of the subway line, San Ignacio and Santa Luca behaved in almost identical ways in terms of the income level of the inhabitants, the demographic composition of the neighborhoods, the unemployment rate in the area, public services and educational and health facilities available to the inhabitants and the types of businesses and occupations available. Although close to Santa Luca, San Ignacio was not affected in any way by the construction of the subway line. Before the subway construction occurred, Santa Luc a had access to several of the main avenues of the city as well as to public markets where food and basic staples could be bought. The subway line radically changed this, as the public markets were located along the planned tracks. As a result, the public markets were relocated relatively evenly among the two new neighborhoods, Nueva Santa Luca and Colonia Progreso. However, access to the citys main avenues was forever changed. While Nueva Santa Luca remained connected to the main avenues, Colonia Progreso became isolated. In terms of access to schools, the primary and secondary schools that once were part of Santa Luc a ended up in the side of Colonia Progreso, and new schools were build in Nueva Santa Luca. Public utilities serve both new neighborhoods with the same quality of service. Construction of the subway line ended in June 1960, which was just a few months after the census was conducted. Similarly, the city government has been conducting a yearly survey on socioeconomic conditions since 1950. The survey is representative at the neighborhood level. This means we have information on the characteristics of Santa Lucas and San Ignacios population before the subway line was constructed, as well as information for the period afterwards. The city authorities give you access to the census of 1960 and of 1970, as well as access to the survey data up until 1980. Crucially, the census and the survey data are geo-referenced, so you can identify the geographical location of the households. In addition, the survey and the census provide you with information on the educational attainment of all household members, the occupation of the household head, the demographic composition of each household, the income of the household members who work, and a thorough description of appliances in the household. Based on this scenario, answer the following questions:1. Explain what are in this case the treatment and outcome variables 2. If possible, define the treatment and the control groups that can be observed in this scenario. 3. What empirical strategy (IV, Diff in Diff, Regression Discontinuity, Panel Analysis) would you adopt to analyze the causal effect of the subway line on the income level of the population? 4. Based on your previous answer, what conditions would you need to check in order to be sure that your empirical strategy is the correct one for getting a causal estimate? when a color is associated with hot or cold we refer to this as color ________. The cross bridge cycle is a series of molecular events that occur after excitation of the sarcolemma. What is a cross bridge? Bridge View Available Hint(s)A. Calcium bound to troponinB. Amyosin head bound to actinC. ATP bound to a myosin headD. Troponin bound to tropomyosin Kehinde is investigating how long his phone's battery lasts (in hours) for various brightness levels (on a scale of 0-100). His data is displayed in the table and graph below. Brightness Level (x) Hours (y) 17 6.1 27 5.7 47 6 53 4.5 90 2 99 0.3 10 20 30 40 50 60 70 80 90 10071 Calculate the correlation coefficient. Round accurately to at least three decimals. Use the correlation coefficient to describe the strength and direction: _____ the production possibility curve: group of answer choices A. is downward sloping because different inputs have comparative advantage in the production of different goods. B. depicts the combinations of goods that an economy can efficiently produce. C. depicts the relationship between production and costs incurred. D. shows how many guns and how many pounds of butter an economy should produce. "General Secretary Gorbachev, if you seek peace, if you seek prosperity for the Soviet Union and Eastern Europe, if you seek liberalization: Come here to this gate! Mr. Gorbachev, open this gate! Mr. Gorbachev, tear down this wall!" -President Reagan Was he referring to the east german government to free the people of Berlin? question 16 i mark as brainliest irene completes her research on the factors responsible for increasing crime rates in her state. in order to employ ethical practices in publishing her research report, irene must ensure that phenomena such as diffraction and interference can be most easily explained in terms of the which particle would you remove from an atom without changing its net charge, and which particle would you remove without changing its atomic mass? Going back to look for questions that may have originally misread, and consequently gotten wrong, is called:__.a. reviewing b. rewinding c. relookingd. redoing