Answer:
1.1
0.050*0.005
0.00025
Explanation:
f. . A metal cylinder has a mass of 100.00 g is heated to 95.50 celcius and then put in 245.5 g of water whose initial temperature is 22.50 Celsius. The final temperature of the mixture is 24.17 Celsius what is the specific heat of the metal.
\(\large\colorbox{orange}{May Be Helpful ✌️ Dear ✌️}\)\(\large\colorbox{orange}{May Be Helpful ✌️ Dear ✌️}\)
please help got 5 minutes
Answer:
A. This is because the def of the Aufbau principle is "that in the ground state of an atom or ion, electrons fill atomic orbitals of the lowest available energy levels before occupying higher levels." so i'm right.
draw a condensed structure of each of the following
1. 1,2,-propanediol
2. Ethyl methyl ether
3. Dichloromethane
The condensed structure of given compounds are shown in the below image.
What is functional group?Functional group is the specific group which is present in an organic compound gives information about the properties of that compound.
In 1,2-propanediol compound hydroxyl functional group is present on the 1st and 2nd position.In Ethyl methyl ether, ether functional group is present.In Dichloromethane, two atoms of chlorine groups are present.Hence, structure of the given compounds are shown in the below image.
To know more about functional group, visit the below link:
https://brainly.com/question/6028840
#SPJ1
How many electrons are in the 6p subshell of Rn?
In the electrical arrangement, the 6p subshell of the radon element contains 6 electrons.
What is electronic configuration of radon?Radon is the 86th element in the periodic table, with the symbol 'Rn'. Radon is a type of noble gas. Radon contains a total of eighty-six electrons. These electrons are grouped in accordance with the laws of several orbits.The p-orbital can hold up to six electrons. As a result, the following six electrons enter the 2p orbital. The second orbit is now completely filled. As a result, the remaining electrons will go into the third orbit.As a result, the entire electron configuration of radon is 1s^2 2s^2 2p^6 3s^2 3p^6 3d^10 4s^2 4p^6 4d^10 4f^14 5s^2 5p^6 5d^10 6s^2 6p^6.For more information on electronic configuration kindly visit to
https://brainly.com/question/29757010
#SPJ1
for a solution containing similar concentrations of hcn and nacn, . multiple choice if a small amount of acid is added, the hcn will neutralize it if a small amount of base is added, the ph would decrease very little if a small amount of acid is added, the ph would decrease very little if a small amount of base is added, the nacn will neutralize it if a small amount of acid is added, there would no change in ph
The pH would decrease very little if a small amount of acid is added.
What is pH value?The pH scale determines how acidic or basic water is. The range is 0 to 14, with 7 representing neutrality. Acidity is indicated by pH values below 7, whereas baseness is shown by pH values above 7. In reality, pH is a measurement of the proportion of free hydrogen and hydroxyl ions in water.
How does pH formula work?You need to know the hydronium ion concentration in moles per litre to determine the pH of an aqueous solution (molarity). The equation pH = - log [H3O+] is then used to determine the pH. Example: In a 0.0025 M HCl solution, determine the pH. Strong and entirely ionised in water, HCl is an acid.
Learn more about pH here:
brainly.com/question/15289741
#SPJ1
Write a balanced overall reaction given the unbalanced half‑reactions. Ca ⟶ Ca2+ Na+ ⟶ Na
Answer:
Ca + 2 Na+ + 2 e- ⟶ Ca2+ + 2 Na
Explanation:
The overall reaction is balanced by including the electrons that are transferred in the reaction. The balanced overall reaction is:
Ca + 2 Na+ + 2 e- ⟶ Ca2+ + 2 Na
This reaction shows the transfer of two electrons from calcium to sodium ions, which results in the formation of calcium ions and sodium atoms. This reaction is electrically neutral, with the same number of positive and negative charges on each side of the reaction. Overall, the reaction represents the transfer of electrons from one element to another, resulting in the formation of new chemical species.
Please it's due today
Answer:
B
Explanation:
Newton's third law. states that:
Action and reaction are equal and opposite.
Question 9
5 pts
Which energy transfer is correctly matched?
Fusion in the sun: chemical to light and heat
Lighting a match: heat energy into chemical energy
a cell phone: thermal to electrical
Turning on a ceiling fan: electrical to mechanical
Answer:
fusion in the sun
Explanation:
I know this because I am currently talking this test and I know it cause I did it
Answer:Turning on a ceiling fan: electrical to mechanical
I took the test and Fusion in the sun: chemical to light and heat Lighting a match: sound energy into chemical energy were the wrong answers.
Hydrogen gas contracts at constant pressure from 1.00 L to 0.95 L. The initial
temperature is 20 °C. Find the final temperature of the gas?
How many grams of oxygen are needed to
react with 425 grams of magnesium to
produce 600 grams of magnesium oxide?
I’m
Answer:
The value is \( M_{o} = 175 g\)
Explanation:
Generally the reaction between oxygen and magnesium is
\(2Mg_{({s})} + O_2_{(g)} \to 2MgO_{(s)}\)
Generally from the law of mass conservation in a chemical reaction we have that
\(M_{m} + M_{o} = M_{z}\)
Here \(M_{m}\) is the mass of magnesium
\(M_{o}\) is the mass of oxygen
\(M_{z}\) is the mass of magnesium oxide
So
\(425+ M_{o} = 600\)
=> \( M_{o} = 600 - 425\)
=> \( M_{o} = 175 g\)
State whether the error introduced by each of the following problems would result in a high or a low value for the Cu recovery or would not affect the results. Explain. a. Some of the copper nitrate solution splashes out of the beaker in step 1. _____________
Answer:
Low value for copper recovery
Explanation:
The percentage recovery is obtained from;
Percent recovery = amount of substance you actually collected / amount of substance you were supposed to collect × 100
Note that the fact that some of the copper nitrate solution splashed out of the beaker means that some amount copper has been lost from the system. This loss of copper leads to a lower value of copper recovered from solution.
Which task most likely involves a calculation that uses moles?
measuring a sugar sample on a balance
counting the number of jellybeans in a jar
determining the number of atoms in a jar of liquid
finding the rate of expansion of a gas-filled balloon
Answer:
determining the number of atoms in a jar of liquid
Explanation:
In determining the number of atoms that makes up a substance, the number of moles is very essential.
The mole is the convenient unit of quantity of particles. It can be likened to a quantity of things in everyday life like a dozen, a score and a gross.
A mole of any substance contains 6.02 x 10²³ particles These particles can be atoms, protons, neutrons, electrons etc.So, to find the number of atoms, we must know the number of moles.
Answer:
3rd choice
Explanation:
I got it correct
A 100 g block of a substance requires 0.5 kJ of heat to raise its temperature from 25.0°C to 37.8°C.
What is the substance?
A) iron
B) aluminum
C) gold
D) copper
The metal can be identified using its specific heat capacity. Here, the specific heat capacity of the substance calculated from calorimetric equation is 0.39 J/g °C , that is the specific heat of copper metal. Hence, option D is correct.
What is specific heat capacity ?The specific heat capacity of a substance is the heat energy required to raise the temperature of the substance by one degree Celsius per on gram. It is characteristic to the substance.
The calorimetric equation connecting the heat energy q, with mass of the substance m, specific heat c and temperature difference ΔT is given below:
q = m c ΔT.
Given, m = 100 g
q = 0.5 KJ = 500 J
ΔT = 37.8 - 25 °C = 12.8 °C
then c = q/mΔT
c = 500 J/12.8 °C × 100 g = 0.39 J/g °C
this specific heat corresponds to the copper metal.
Therefore, the block is made of copper metal.
Find more on specific heat:
https://brainly.com/question/11297584
#SPJ2
Select the correct structure that
corresponds to the name.
3-bromo-6-methyl-4-octene
CHE
A
Br
B.
CH3CH2CHBrCH = CHCH(CH3)CH2CH3
C. both
Someone please help
Answer:
b
Explanation:
one clue is the double bond at 4 carbon c=c
The correct structure that corresponds to the name.
3-bromo-6-methyl-4-octene is \($\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CHBrCH}=\mathrm{CHCH}\left(\mathrm{CH}_{3}\right) \mathrm{CH}_{2} \mathrm{CH}_{3}$\) .
What is 3-bromo-6-methyl-4-octene?The molecule in which bromine is attached with C-3 carbon and double present at C-4 carbon containing total number of 8 carbon atom can be considered as 3-bromo-6-methyl-4-octene.
What is structure?
A chemist specifies the molecular geometry and, where possible and required, the electronic structure of such given molecule as well as other solid during a chemical structure determination.
It can be seen that in molecule \($\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CHBrCH}=\mathrm{CHCH}\left(\mathrm{CH}_{3}\right) \mathrm{CH}_{2} \mathrm{CH}_{3}$\) bromine is attached with C-3 carbona and double bond exist at C-4 carbon. the total number of carbon atom is 8.
therefore, the structure of the compound will be \($\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CHBrCH}=\mathrm{CHCH}\left(\mathrm{CH}_{3}\right) \mathrm{CH}_{2} \mathrm{CH}_{3}$\).
To know more about structure of the 3-bromo-6-methyl-4-octene click here.
https://brainly.com/question/4072914.
#SPJ2
An element contains 25 electrons. How many empty orbitals are in its valence energy level?
Answer:
No empty orbitals but five unpaired electrons.
Explanation:
Hello there!
In this case, when going over the empty orbitals in valence energy levels, it is required to develop the electron configuration in order to appropriately describe the element. In such a way, for the element whose atomic number is 25 because it equals the number of electrons, we obtain:
\(1s^2,2s^2,2p^6,3s^2,3p^6,4s^2,3d^5\)
It means that the d orbital is half filled which means that it does not have any empty orbital wherein two electrons are contained per orbital. Moreover, we can find 5 unpaired electrons according to:
↑ ↑ ↑ ↑ ↑
Which is the orbital notation.
Best regards!
can someone give ideas for a science project?
Answer:
Here's ya idea: Can the food we eat affect our heart rate?
Explanation:
How good were your predictions in the warm-up?
can't give an answer to your question if there isn't a picture or being specific in the question.
Answer: 2 Out of 4
Explanation:
Bc my mom told me
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Heating Curve Question. I tried to be very deliberate solving this problem, but none of my answers - +50, -50, +49.6, etc. - were accpeted and I've just been stuck on this question for a few days. Any help is appreciated, thanks : )
Answer:
It sounds like the writer's experiences of scouting have had a profound impact on his life. He values the connection with nature and the skills he learnt, as well as the importance of preserving the environment for future generations. He also mentions the words and phrases associated with scouting, which he says can act as a reminder of the experience and the joy he felt during his time in the Scouts. It's clear that the writer values the experiences of scouting and has a strong appreciation for the outdoors.
What is the molarity of a 500 mL of solution made from 80g of NaOH and water?
Answer:
Molarity= Moles of solute/Volume of solution(in litres)
Solute:NaOH
Moles =mass/Molar Mass
Molar mass of NaOH= 22.9+16+1=39.9g/mol
Substituting
m=80/39.9
=2.0moles
Volume has to be in litres
There's 1000ml to a litre
So 500ml equals 0.5litres
Molarity = 2/0.5
= 4M.
Investigating Energy Systems
Harnessing Human Energy Chapter 1 Lesson 1.2
Reasoning Tool
Possible subclaims:
The Battery System does have energy.
or
The Battery System does not have energy.
The Hand-Crank Generator System does have energy.
or
The Hand-Crank Generator System does not have energy.
The Solar Cell System does have energy.
or
The Solar Cell System does not have energy.
Evidence
(observations about whether the system does or does not have energy)
This matters because . . .
(How does this evidence support the subclaim?)
Therefore, . . .
(subclaim)
The Possible sub-claim in relation to Investigating Energy Systems is the Solar Cell System does have energy.
Evidence is that -
As the sun shines on a solar panel, energy is captured by the Photovoltaic cells on the panel. This is significant as it generates electrical charges which causes the flow of electricity.
These are accelerated by shifting an internal electrical field within the cell. Therefore, a solar cell system is one that has amount of energy.
A solar cell is also known as a photovoltaic cell. It is an electrical device which uses a natural physical and chemical phenomenon, a photovoltaic effect to convert light energy directly into the electricity.
Solar cells are known as photovoltaic cells. These PV cells converts sunlight directly into electricity. Solar cells produces electricity in remote locations which allows machines to be powered very far from the nearest electrical outlet. Solar cells are reliable and low-maintenance source of renewable energy.
Therefore, A PV cell can reflect and absorb, or pass via light that strikes it. The semiconductor material in PV cell conducts electricity better than an insulator.
To learn more about Solar Cells,
brainly.com/question/28843907
#SPJ1
What is the net ionic equation of SnSO4+K2S=SnS+K2SO4?
Answer:
Sr{2+}(aq) + S{2-}(aq) → SrS(s)
Because any natural element used in the cathode produced negative particles that bent to a positive charge, scientists concluded that:
A) all atoms contained negative electrons
B) all atoms are actually negative
C) atoms were indivisible and had no sub-particles
D) metals contained positrons
Because any natural element used in the cathode produced negative particles that bent to a positive charge, scientists concluded that ll atoms contained negative electrons.
What is cathode ?A polarized electrical device's cathode is the electrode from which a regular current exits. The abbreviation CCD, which stands for Cathode Current Departs, might be used to remember this definition. Positive charges move in the direction described by a conventional current.
A cathode is a drawback. As an electron donor, it functions. It serves as an acceptor of electrons. The anode of an electrolytic cell is where the oxidation reaction occurs.
The negatively charged ions are drawn to the cathode, which is the negative electrode. Lead ions travel through the metal use negatively charged terminal of the battery and onto the lead ions because metal ions are usually positive. There must be a way to remember cathodes and anodes, cations and anions.
Thus, option A is correct.
To learn more about cathode, follow the link;
https://brainly.com/question/11920555
#SPJ6
Cumulative Exam Active
41 42 43 144
The electron configuration of nitrogen (N) is
O 1s²2s²2p³
O 1s²2s²2p4
O 1s²2s²2p5
O 1s²2s²2p6
The answer is: The electronic configuration of Nitrogen is \(1s^22s^22p^3\).
Electronic configuration: The electronic configuration is defined as the distribution of electrons of an atom in the atomic or molecular orbitals and is written using the labels for the subshell.
How to decide which orbital is filled first?
The order in which electrons are filled in atomic orbitals as:(Shown in image)
Just follow the arrows to select the orbitals, s orbital can have 2 electrons, p can have 6 electrons, d can have 10 electrons and f can 14 electrons.The electronic configuration in which the outer shell is completely filled is known as noble-gas configuration as they are similar to electronic configurations of noble gases.Now, the given element is nitrogen (\(N\)). The atomic number of Nitrogen is 7. Thus, these 7 electrons are filled as-\(1s^22s^22p^3\)
Therefore, the electronic configuration of Nitrogen is \(1s^22s^22p^3\).To learn more about the electronic configuration, visit:
https://brainly.com/question/21977349
#SPJ4
Nitrogen's complete electron configuration is 12s2s22p3.
The shorthand electron configuration for noble gases is [He] 2s22p3. Nitrogen has an atomic number of 7. The nitrogen atoms' nucleus contain this many protons. An atom that is neutral has an equal number of protons and electrons. Thus, the ground state electron configuration will consist of 7 electrons in the suitable s and p orbitals (state of lowest energy). For nitrogen, the entire electron configuration is 1s22s22p. Scientists may easily express and explain how the electrons are organized around the nitrogen atom's nucleus by using the configuration notation for nitrogen (N). As a result, it is simpler to comprehend and forecast how atoms will cooperate to form chemical bonds.
Learn more about electronic configuration here-
https://brainly.com/question/11309892
#SPJ9
Which answer best describes the meaning of submerged?
The hurricane produced so much rain and flooding that cars were submerged.
drowned
damp
wet
underwater
Answer:
Drowned
Explanation:
We can use drown here, that sounds appropriate.
what is the pH of a solution with a hydronium concentration of 6.5x10^-4M?
A.)6.5
B.)4
C.)3.2
D.)10
To determine the pH of a solution based on the hydronium ion concentration, you can use the equation:
pH = -log[H₃O⁺]
where [H₃O⁺] is the concentration of hydronium ions.
In this case, the hydronium ion concentration is 6.5x10^-4 M.
Calculating the pH:
pH = -log(6.5x10^-4)
= -log(6.5) - log(10^-4)
= -log(6.5) + 4
Using a calculator or logarithmic tables, you can find that the logarithm of 6.5 is approximately 0.81.
pH ≈ 0.81 + 4
pH ≈ 4.81
Rounding to the nearest whole number, the pH of the solution is approximately 5.
Learn more about pH on:
https://brainly.com/question/2288405
#SPJ1
How many moles of acetic acid does 2.4 x 10 to the 24th power molecules represent?
Answer:
i have that question too someone help pleaseeeee
Explanation:
Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in the reaction below. How many molecules of HCl would have to be present to form 34.52 g of MgCl₂?
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)
Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.
To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)
The molar mass of MgCl₂ is 95.21 g/mol.
First, we need to calculate the number of moles of MgCl₂ formed:
Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂
Moles of MgCl₂ = 34.52 g / 95.21 g/mol
Moles of MgCl₂ = 0.363 mol
According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:
Moles of HCl = 2 * Moles of MgCl₂
Moles of HCl = 2 * 0.363 mol
Moles of HCl = 0.726 mol
To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.
Number of molecules of HCl = Moles of HCl * Avogadro's number
Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol
Number of molecules of HCl = 4.37 x 10^23 molecules
Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.
For more such questions on molecules
https://brainly.com/question/1351818
#SPJ8
According to labeling guidelines, only two "Signal Words" can appear on a label. One is Danger and the other is:a. Warningb. Toxicc. Explosived. Flammable
Here is the complete explanation about labeling guidelines.
What is labeling guidelines?Signal words are found on the pesticide product labels.
Of to the end, and they describe the acute to (short-term) toxicity of to by formulated pesticide of the product.
The signal word can become either: DANGER and be the WARNING . Products with to the DANGER signal word are the most toxic. Products of with the signal word in the WARNING are lower in the toxicity.
So the correct is danger of because it's indicated by flammable and high toxic.
To know more about labeling guidelines click-
https://brainly.com/question/25482413
#SPJ1
The internal energy of reaction is -855.1). The reaction has a change of
temperature of 63.20°C that consist of 8.85g of material. Assume the
heat capacity of 2.650J/g °C. What is the work energy of this process..
The work energy of this process : 2337.298 J
Further explanationThe laws of thermodynamics 1 state that: energy can be changed but cannot be destroyed or created
ΔU=Q-W
Q=m.c.Δt
\(\tt Q=8.85\times 2.650\times 63.2=1482.198~J\)
the work (W) :
\(\tt W=Q-\Delta U\\\\W=1482.198-(-855.1)=2337.298~J\)