The product formed are ammonia and 2,2-dimethylbutanoic acid. HCl is used in protonation of 2,2-dimethyl butane nitrile in the initial step.
What is Acid-catalyzed hydrolysis?It is the process by which nitrile combines with an acid, water, and to produce carboxylic acid. Protonation, nucleophilic addition, and proton transfer are all components of the chemical process. In this reaction, water serves as a nucleophile.
What are the steps of production of ammonia and 2,2-dimethylbutanoic acid?2,2-dimethyl butane nitrile can be protonated by HCl in the first step. The protonated aminoketone will result from the water's nucleophilic attack on protonated nitrile. The nucleophilic attack on carbonyl carbon in the following step will result in a proton yield with a protonated diol intermediate. In subsequent steps, this will eliminate ammonia and proton. Ammonia and 2,2-dimethylbutanoic acid is the end product.
To know more about carboxylic acid please click here https://brainly.com/question/26855500
#SPJ4
What does each letter mean in the acronym pufart mean
Answer:
The acronym is used to remember evidence of a chemical change.
Explanation:
P=precipitate
U=unexpected color change
F=fizzing
A=aroma
R=replaced by a new substance
T= temperature change
A sample of gas occupies a volume of 66.8 mL . As it expands, it does 136.9 J of work on its surroundings at a constant pressure of 783 Torr . What is the final volume of the gas
To solve this problem, we can use the formula for work done by gas at constant pressure:
W = -PΔV
Where W is the work done, P is the constant pressure, and ΔV is the change in volume. Since the pressure is constant, we can rearrange this formula to solve for ΔV:
ΔV = -W/P
Plugging in the given values, we get:
ΔV = -(136.9 J)/(783 Torr)
We need to convert Torr to SI units of pressure, which is in Pascals (Pa). 1 Torr is equal to 133.32 Pa, so:
ΔV = -(136.9 J)/(783 x 133.32 Pa)
ΔV = -0.00155 m^3
The negative sign indicates that the gas has expanded, so the final volume will be the initial volume plus the change in volume:
V_final = V_initial + ΔV
V_final = 66.8 mL + (-0.00155 m^3)
We need to convert mL to m^3:
V_final = 0.0668 L + (-0.00155 m^3)
V_final = 0.06525 m^3
Therefore, the final volume of the gas is 0.06525 m^3.
Learn more about constant pressure here:
https://brainly.com/question/4224481
#SPJ11
What is the volume of kristas rock
Answer : The volume of kristas rock is 30 mL.
Explanation :
From the given image we conclude that:
Initial volume of liquid = 150 mL
Final volume of liquid = 180 mL
Now we have to determine the volume of kristas rock.
Volume of kristas rock = Final volume of liquid - Initial volume of liquid
Volume of kristas rock = 180 mL - 150 mL
Volume of kristas rock = 30 mL
Therefore, the volume of kristas rock is 30 mL.
"Orbitals of equal energy are each occupied by one electron before any is occupied by a second electron, and all electrons in singly occupied
orbitals must have the same spin" is a statement of
Select one:
a the Pauli exdusion principle,
b. the Aufbau principle.
the quantum effect
d. Hund's rule
Answer: the Aufbau principle.
Explanation:
Which of the following atom/ions would require the most energy to remove oneelectron?A) LiB) Ca2+ the electron is removed from an inner shell requiring the most energyC) Si2+D) Al2+E) P2+
Ca²⁺ the electron is removed from an inner shell requiring the most energy.
Correct option is B.
The amount of energy required to remove an electron from an atom depends on a number of factors. The electron surrounding the nucleus is arranged in shells, and energy is required to break through each of these shells until the most outer shell (valence shell) is reached. In general, the farther away from the nucleus the electron resides, the lower the energy barrier required to remove it.
However, for electrons located in higher energy, inner shells, electrons may require higher energy to remove them from their shell. For example, Li has an electron located in the outermost shell, requires the least amount of energy to remove it.
Correct option is B.
know more about electron here
https://brainly.com/question/12001116#
#SPJ11
When a molecule of oxygen moves from outside of a eukaryotic cell to eventually be reduced by complex iv of the electron transport chain, how many phospholipid bilayers does it need to cross?.
The oxygen molecule needs to cross three phospholipid bilayers.
The process of ATP synthesis in which electrons are transported from NADH or FADH2 to oxygen is known as oxidative phosphorylation. The process of cellular respiration ends at this stage. Chemiosmosis and the electron transport chain are two interrelated processes that make up oxidative phosphorylation. As electrons move from one molecule to the next in the electron transport chain, energy is released throughout the process, which is then utilized to create an electrochemical gradient. However, during chemiosmosis, ATP is produced using the energy stored in the gradient.
Oxygen is found at the end of the electron transport chain, where it takes electrons and picks up protons to make water.
Therefore, it follows that a molecule of oxygen must travel through three phospholipid bilayers, which are represented by the cell membrane and the external and internal membranes of the mitochondria, in order for it to go through the electron transport chain.
Read more about Oxidative phosphorylation:
brainly.com/question/28809568
#SPJ9
acetaldehyde decomposes when heated to yield methane and carbon monoxide according to the equation: ch3cho⟶ch4 co. Determine the rate law and the rate constant for the reaction from the following experimental data:
The rate law for the given reaction is Rate = \(k[CH3CHO]^n\), and the rate constant is k.
To determine the rate law and the rate constant for the acetaldehyde decomposition reaction
(\(CH^3CHO\) ⟶\(CH^4\) + CO),
we'll need the experimental data that shows the initial concentrations of \(CH^3CHO\) and the initial rates of the reaction. Unfortunately, the experimental data was not provided in your question.
However, I can guide you on how to use the experimental data once you have it. Follow these steps:
1. Observe the relationship between the initial concentrations of \(CH^3CHO\) and the initial rates in the provided data.
2. Determine the order of the reaction with respect to \(CH^3CHO\)(i.e., whether it's a first-order, second-order, or zero-order reaction).
3. Write the rate law equation, which will have the form: rate = \(k[CH^3CHO]^n\), where 'k' is the rate constant, [\(CH^3CHO\)] is the concentration of \(CH^3CHO\), and 'n' is the order of the reaction.
4. Use one of the provided data sets to calculate the value of the rate constant 'k'.
Once you have the experimental data, you can follow these steps to determine the rate law and the rate constant for the acetaldehyde decomposition reaction.
To know more about "Zero-order reaction" refer here:
https://brainly.com/question/29051069#
#SPJ11
reckless endangerment of human life what type of irony is used
The type of irony used in "reckless endangerment of human life" is verbal irony. Verbal irony is a figure of speech in which words are used to mean something different from their literal meaning.
In this instance, the phrase "reckless endangerment of human life" refers to behavior that puts people's lives in danger. However, it is ironic because it is a criminal offense that should be avoided and yet it is taking place. Verbal irony is often used for humorous or dramatic effect. This type of irony is used to create a contrast between what is said and what is meant. In this case, the phrase "reckless endangerment of human life" is used to describe behavior that is extremely dangerous, yet it is ironic because it is the opposite of what should be happening.
To learn more about Verbal irony check the link below-
https://brainly.com/question/1551288
#SPJ11
Skepticism is important in this scenario because it would help him to learn from the investigations of his colleagues. Ask future questions related to the investigation. Communicate his results at a conference. Ensure that his conclusion is supported by evidence.
Answer:
hello your question is incomplete below is the missing part of the question
A biochemist performs an experiment to study the behavior of water molecules near proteins. He concludes that water molecules occur in groups of five in the presence of proteins.
answer : Ensure that his conclusion is supported by evidence.
Explanation:
Skepticism during the conduction of an experiment is an act/trait that a scientist possess that will make him/her repeat an experiment for the purpose of verifying the data gotten from the previous experiment
hence the answer to the question is to Ensure that his conclusion is supported by evidence.
which of the following is not a correct way in which the reproductive system hormones interact with other body systems
The interaction of reproductive system hormones with other body systems that estrogen activates is incorrect.
What distinguishes the reproductive system from other bodily organs?In contrast to other body systems, the reproductive system works to secure the survival of an entire species, whereas all other body systems work to ensure the life of the individual.
What part do hormones play in the male and female reproductive systems, in your opinion?Sexuality and fertility are influenced by the three primary reproductive hormones, estrogen, testosterone, and progesterone. Pregnancy, puberty, menstruation, menopause, sex drive, sperm production, and other processes are all controlled by them. These hormones are made in the testes and ovaries in females.
To know more about reproductive system visit:-
https://brainly.com/question/14235396
#SPJ4
question:-
which of the following is not a correct way in which the reproductive system hormones interact with other body systems i.e estrogen, testosterone, and progesterone?
Lily replicates an experiment that found that the number of calories in a particular food is 50 kcal. She obtained data from
five trials: 50 kcal 72 kcal, 50 kcal, 12 kcal, and 50 kcal. Which best desribes her data results? A. accurate B. incorrect C. invalid D. precise
Answer:
invalid
Explanation:
Just imagine doing this experiment MULTIPLE TIMES and one of the trials you get 72 Kcal while in another u get 12kcal. It doesn't make sense. Somewhere in the experiment she went wrong. So its invalid
the oxidation number of a nitrogen atom in n₂o₃ is
A nitrogen atom in N2O3 has an oxidation number of +3.
The unknown nitrogen oxidation number can be given a variable (x) to ascertain its oxidation number. Since oxygen has an oxidation number of - 2 and there are three oxygen particles in N₂O₃, the complete negative charge from oxygen is (- 2) × 3 = - 6.
The total charge of a compound is equal to the sum of its oxidation numbers. Since the compound in question is neutral, the sum of the oxidation numbers must be zero in this instance.
2(N) + 3(O) = 0
2x + (-6) = 0
2x = 6
x = 3
To learn more about oxidation numbers:
https://brainly.com/question/4222605
what is the chemical formula for silver sulfate
Answer:
Ag2SO4
Explanation:
What does the hydrosphere include?
Glaciers
Groundwater
Lava
Polar Ice
The hydrosphere include glaciers, groundwater, and polar ice. That is option A, B and C.
What is hydrosphere?Hydrosphere is defined as the part of the earth that is made up of water which includes the surface of the planet, underground, and in the air.
The water found in the hydrosphere of earth moves in cycles in such a way that non is lost.
The components of the hydrosphere include the following:
oceans, Polar ice,freshwater,surface water, groundwater, glacial water, and atmospheric water vapour.The polar ice is part of the hydrosphere because it is the frozen part of the earth's hydrosphere.
The lava is not part of the hydrosphere but part of lithosphere and it's released when volcanic eruptions occurs.
Therefore is can be concluded that glaciers, groundwater, and polar ice are parts of the hydrosphere while the lava is not part of the hydrosphere.
Learn more about hydrosphere here:
https://brainly.com/question/25796102
#SPJ1
I’m so lost someone help me
Answer:
Crudeoil is a mixture and it comprises of compounds mostly hydri carbons i think
What is the main difference between a homogeneous mixture and a heterogeneous mixture?.
Heterogeneous and homogeneous mixes are the two types of mixtures. While homogeneous mixes seem consistent throughout, heterogeneous mixtures have clearly discernible components. A solution, which can be a solid, liquid, or gas, is the most typical kind of homogeneous combination.
What is a homogenous mixture?A homogenous mixture is one whose composition is constant across the whole mixture. The dissolved salt is uniformly dispersed across the whole salt water sample, making the salt water in the example above homogenous.
What is a heterogenous mixture?A combination is said to be heterogeneous if its composition is not constant throughout. for example, vegetable soup is a complex concoction. Each mouthful of soup will have differing percentages of the various veggies and other ingredients.
To learn more about mixtures :
https://brainly.com/question/24898889
#SPJ4
Why might two objects be affected differently if the same strength force is exerted on them?
The two objects will be affected differently if if the same strength force is exerted on them as they will have different mass.
What is force?
Force is defined as a cause which is capable of changing the motion of an object. It can cause an object which has mass to change it's velocity. It is also simply a push or a pull . It has both magnitude as well as direction.Hence, it is a vector quantity.
It has SI units of Newton and is represented by'F'.Newton's second law states that force which acts on an object is equal to momentum which changes with time. If mass of object is constant, acceleration is directly proportional to net force acting on an object.
The concepts which related to force are thrust and torque .Thrust increases the velocity of an object and torque produces change in rotational speed of an object.
Learn more about force,here:
https://brainly.com/question/5961485
#SPJ1
why is citric acid added to food?to add colorto add tartnessto add bitternessto add sweetness
Citric acid is added to food to add tartness and enhance the flavor. The correct option is b.
Citric acid, a natural compound found in citrus fruits, is commonly added to food for its tart flavor and ability to enhance taste. Here's a step-by-step explanation:
1. Tartness: Citric acid is highly acidic and has a sour taste. When added to food, it provides a sharp, tangy flavor that adds tartness. This tartness can help balance the overall taste profile of a dish, especially in sweet or savory recipes.
2. Flavor enhancement: Citric acid acts as a flavor enhancer, intensifying the existing flavors in food. It has the ability to enhance the perception of other taste sensations, such as sweetness and saltiness, making food taste more vibrant and flavorful.
3. Preservation: Citric acid also acts as a natural preservative in some food products. It has antimicrobial properties that inhibit the growth of certain bacteria and fungi, helping to extend the shelf life of foods and prevent spoilage.
4. pH adjustment: Citric acid can be used to adjust the pH level of certain food products. It is commonly used in canning and preserving processes to create an acidic environment that inhibits bacterial growth and helps maintain product quality and safety.
Overall, the addition of citric acid to food primarily serves to enhance flavor, provide tartness, and potentially contribute to preservation. Option b is the correct one.
To know more about Citric acid refer here:
https://brainly.com/question/28266073#
#SPJ11
Factories that produce cement account for around 5% of global emissions of carbon dioxide worldwide. Carbon dioxide is a greenhouse gas that absorbs solar radiation and rereleases it into Earth's atmosphere.
Cement production has increased over time because the demand for cement has increased. Suppose that cement production continues to increase significantly over the next 50 years. Assuming that all other factors remain the same, what impact will this most likely have on the Earth?
A Gas other than carbon dioxide will become more concentrated in the atmosphere.
B Global temperatures on Earth will increase.
C Global temperatures on Earth will decrease.
D Gases other than carbon dioxide will become depleted in the atmosphere.
Answer:
Global temperature of earth will increase
Explanation:
green house gases will trap. the heat and it will make our atmosphere warm.
The increased level of greenhouse gases increases the temperature of the earth considerably. The Global temperatures on Earth will increase as a result of it. The correct option is B.
What is greenhouse effect?The process by which the radiations from the sun are absorbed by the greenhouse gases and not reflected back into the space is defined as the greenhouse effect. This insulates the surface of the earth and prevents it from freezing.
The gases which absorb the infrared radiations and cause greenhouse effect are called the greenhouse gases. Some examples are Carbon dioxide, chlorofluorocarbons, etc.
The phenomenon of gradual increase in the average temperature of the earth's atmosphere due to green house effect is called the global warming. Due to the greenhouse effect the ozone layer of the earth's atmosphere also get depleted.
Thus the correct option is B.
To know more about global warming, visit;
https://brainly.com/question/3553382
#SPJ3
which compound should have the largest lattice energy?
Answer:
From the given compounds MgO has the highest lattice energy.
the density of a 3.s39 m hn03 aqueous solution is i.iso g·ml-1 at 20 oc. what is the molal concentration?
The molal concentration of a 3.39 M HNO₃ aqueous solution with a density of 1.50 g/mL at 20°C is 2.28 mol/kg.
First, we need to convert the density to kg/L: 1.50 g/mL x 1 kg/1000 g = 0.0015 kg/mL
Next, we can calculate the molality using the formula: molality (m) = moles of solute / mass of solvent in kg
We know the concentration in Molarity, so we need to convert to moles of HNO₃ per kg of water. To do this, we need to first calculate the mass of 1 L of the solution: 1 L x 1.50 g/mL = 1.50 kg
Then, we can calculate the moles of HNO₃ in 1 L of solution: 3.39 mol/L x 1 L = 3.39 moles HNO₃
Finally, we can calculate the molality: m = 3.39 moles / 1.50 kg = 2.26 mol/kg
However, we need to take into account that the density of the solution is given at 20°C and the molality is defined at 25°C. To correct for this difference, we need to apply a temperature correction factor, which is 1.010 for HNO₃. m = 2.26 mol/kg x 1.010 = 2.28 mol/kg
learn more about molarity here:
https://brainly.com/question/8732513
#SPJ11
Which has a higher entropy, 1 mole of CF4(g) or 1 mole of CCL4(g) and why?
Answer: 1 mole of CCl4(g) has a higher entropy than 1 mole of CF4(g).
Explanation:
The entropy of a substance depends on its molecular structure and the number of ways its molecules can arrange themselves at a given temperature and pressure. In the case of 1 mole of CF4(g) and 1 mole of CCl4(g), both molecules have the same number of atoms, but the molecular structures are different. CF4 has a tetrahedral structure with four fluorine atoms symmetrically arranged around a central carbon atom, while CCl4 has a tetrahedral structure with four chlorine atoms symmetrically arranged around a central carbon atom.
Since the fluorine atoms are smaller than the chlorine atoms, the CF4 molecule is more compact and has less surface area than the CCl4 molecule. This means that CF4 molecules have fewer ways to arrange themselves in space, resulting in lower entropy than CCl4 molecules.
Therefore, 1 mole of CCl4(g) has a higher entropy than 1 mole of CF4(g).
To know more Entropies refer to this link-
https://brainly.com/question/31773993
#SPJ11
A mole of CCl4(g) has a higher entropy than a mole of CF4(g) because of its larger molar mass and the increased complexity and size of its Chlorine atoms, leading to a greater number of possible atomic arrangements and a higher degree of disorder.
Explanation:When comparing the entropy of 1 mole of CF4(g) and 1 mole of CCl4(g), the latter has a higher entropy due to its larger molar mass. Entropy, in this context, refers to the degree of disorder of a system, and it generally increases with the molecular complexity. CCl4 has a more significant size and complexity due to the Chlorine atoms, which are larger than the Fluorine atoms in CF4, leading to a greater number of possible arrangements and thus a higher entropy.
Simply put, a molecule with more atoms, especially heavier atoms, tends to have a higher entropy because there are more ways the atoms can arrange themselves, leading to a greater state of disorder. Therefore, 1 mole of CCl4(g) has higher entropy than 1 mole of CF4(g).
Learn more about Entropy here:https://brainly.com/question/17172535
#SPJ2
1. Draw the molecule that corresponds to each of the names given. a. m-chlorobenzoyl chloride b. methyl butanoate c. butanoic anhydride d. N,N-diethylhexanamide
a. m-chlorobenzoyl chloride: Cl-C(O)Cl
b. methyl butanoate: CH3-CO-O-CH3
c. butanoic anhydride: (CH3CH2CH2CO)2O
d. N,N-diethylhexanamide: HN(C2H5)2-C6H13-C=O
What are the molecular structures of m-chlorobenzoyl chloride, methyl butanoate, butanoic anhydride, and N,N-diethylhexanamide?a. m-chlorobenzoyl chloride:
Cl
|
C6H4-CO-Cl
b. methyl butanoate:
O
||
CH3-CH2-CH2-COOCH3
c. butanoic anhydride:
O
||
CH3-CH2-CH2-CO-O-CO-CH2-CH2-CH3
d. N,N-diethylhexanamide:
H H H H H H H H
| | | | | | | |
CH3-CH2-C-C-C-C-C-C-N(C2H5)2
| | | | | | |
H H H H H H H
These drawings represent the molecular structures of the given compounds: m-chlorobenzoyl chloride, methyl butanoate, butanoic anhydride, and N,N-diethylhexanamide.
Learn more about molecular structures
brainly.com/question/29857692
#SPJ11
WIll give brainliest! : In the following Punnett square, what is the phenotypic percentages of the offspring? From dwarfism slideshow - length of legs.
Answer:
75% will have long legs and 25% will have short legs
Explanation:
What would happen to a persons energy levels if the septum had a hole in it? Why?
Adding the number of protons to the number of neutrons determines what about the atom?
A
the atomic number
B
the atomic mass
(Hint: protons + neutrons = ?)
In any engineering design problem, the first step is to understand the problem and identify one or more possible solutions. In this task, you’ll analyze the problems you face as the chemical engineer challenged with setting up the ammonia-making process. Recall the chemical equation for producing ammonia:
N2 + 3H2 ⇌ 2NH3 + energy
1.Explain the problem surrounding the ammonia-making process in terms of chemical equilibrium.
Answer:
Explanation:
About 2,070 results (0.60 seconds)
Answer is: at lower temperatures the reaction rate would decrease. The lower is the temperature, the slower the reaction becomes. ... Because this is exothermic reaction (enthalpy is less than zero), at lower temperatures, the equilibrium is in favor of ammonia, but the reaction doesn't proceed at a detectable rate.
Hi,
let us go through the question again
N2 + 3H2 ⇌ 2NH3 + energy
Explain the problem surrounding the ammonia-making process in terms of chemical equilibrium.
So I would approach this question on the basis of effect of each of the reactants and products concentration on the equilibrium synthesis of ammonia.
If the concentration of any reactant is increased, the yield of ammonia is increased.
If the concentration of ammonia is reduced by removing it as it forms, the yield will as well be increased.
This reaction also yields heat meaning it is an exothermic reaction, so when we increase the temperature, the yield will be reduced. Hence it is favored by low temperature.
the value for the rate constant of a reaction can generally be expected to lt\,e'9 co (a) (b) decrease with increasing temperature. increase with increasing temperature. (c) decrease with increasing temperature only when the reaction is exothermic. (d) increase with increasing temperature only when the reaction is exothermic.
The value for the rate constant of a reaction can generally be expected to increase with increasing temperature.
The rate constant is a measure of the speed of a chemical reaction and is directly proportional to temperature, according to the Arrhenius equation. This means that as temperature increases, the rate constant also increases. This is true regardless of whether the reaction is exothermic or endothermic.
The Arrhenius equation shows that the rate constant of a reaction (k) is exponentially dependent on the activation energy (Ea) and inversely dependent on the temperature (T). As the temperature increases, the rate constant and the reaction rate tend to increase due to more energetic collisions between reactant molecules.
Learn more about rate constant here, https://brainly.com/question/26127112
#SPJ11
Calculate the standard enthalpy change for the following reaction at 25 °C. HCl(g)+NaOH(s)-> NaCl(s)+H2O(l)
The standard enthalpy change for the given reaction at 25 °C is approximately -134.53 kJ/mol.
To calculate the standard enthalpy change for the given reaction at 25 °C, we need to use the standard enthalpy of formation values for the reactants and products involved. However, the given reaction involves HCl(g) and NaOH(s), which are not standard states. Hence, we need to consider the enthalpy changes for the formation of these compounds from their respective elements.
The standard enthalpy change can be calculated using the equation:
ΔH° = ΣnΔH°f(products) - ΣmΔH°f(reactants)
where ΔH° is the standard enthalpy change, ΣnΔH°f(products) is the sum of the standard enthalpies of formation of the products (here, NaCl(s) and H2O(l)), and ΣmΔH°f(reactants) is the sum of the standard enthalpies of formation of the reactants (here, HCl(g) and NaOH(s)).
Looking up the standard enthalpy of formation values:
ΔH°f(NaCl(s)) = -411.12 kJ/mol
ΔH°f(H2O(l)) = -285.83 kJ/mol
ΔH°f(HCl(g)) = -92.31 kJ/mol
ΔH°f(NaOH(s)) = -470.11 kJ/mol
Plugging in these values:
ΔH° = [(1 mol * ΔH°f(NaCl(s))) + (1 mol * ΔH°f(H2O(l)))] - [(1 mol * ΔH°f(HCl(g))) + (1 mol * ΔH°f(NaOH(s)))]
ΔH° = [(1 * -411.12 kJ/mol) + (1 * -285.83 kJ/mol)] - [(1 * -92.31 kJ/mol) + (1 * -470.11 kJ/mol)]
ΔH° = (-696.95 kJ/mol) - (-562.42 kJ/mol)
ΔH° = -134.53 kJ/mol
Therefore, the standard enthalpy change for the given reaction at 25 °C is approximately -134.53 kJ/mol.
learn more about enthalpy here
https://brainly.com/question/32882904
#SPJ11
4-ethyl-2-methyl-3-propyl heptanoic acid
drawing
The structure of the 4-ethyl-2-methyl-3-propyl heptanoic acid is shown in the image attached
How do you know the structure of a compound?
The arrangement and connectivity of the atoms within a molecule are referred to as the structure of an organic substance. Along with other elements including oxygen, nitrogen, sulfur, and halogens, organic molecules are largely made of carbon atoms bound to hydrogen atoms.
It is crucial to remember that organic compounds can exist in several isomeric forms, where the same chemical formula leads to various structural configurations. The connection of atoms or the spatial arrangement of atoms in three-dimensional space might vary between isomers.
Learn more about structure of a compound:https://brainly.com/question/32780859
#SPJ1