A) Oxygen
B) Sulfur
C) nitrogen
D) no elements have that mass

A) Oxygen B) Sulfur C) NitrogenD) No Elements Have That Mass

Answers

Answer 1

Answer:

The answer would be oxygen.


Related Questions

What do you predict the chemical formula for the compound formed between calcium and sulfur?

Answers

Answer:

calcium donates two vanence electrons to sulfur atom to form Ca2+ ion and an S2+ - ion

8x10^-200 in significant figures PLEASE IVE BEEN STUCK ON IT FOR 2 HOURS

Answers

i got 0 ?? if that’s any help

For a 0.300 mol sample of helium gas in a 0.200 L container at 248K, will the pressure be greater if calculated with the ideal gas law or the van der Waals equation, and by roughly how much? (For He,a=0.0342L2atmmol2,b=0.0237 Lmol)

Answers

Answer:

It changes by roughly 1 atm.

Explanation:

Hello!

In this case, since the ideal gas equation differs from the van der Waals' one by the presence of the a and b parameters which correct the assumption of no interactions into the container, they are written as:

\(P=\frac{nRT}{V}\\\\P=\frac{RT}{v_m-b}-\frac{a}{v_m^2}\)

Thus, the pressure via the ideal gas equation is:

\(P=\frac{0.300mol*0.082\frac{atm*L}{mol*K}*248K}{0.200L}=30.5atm\)

And the pressure via the van der Waals equation, considering the molar volume (vm=0.200L/0.300L=0.667L/mol) is:

\(P=\frac{0.082\frac{atm*L}{mol*K}*248K}{0.667L/mol-0.0237L/mol}-\frac{0.0342atm*L^2/mol^2}{(0.667L/mol)^2}\\\\P=31.6atm-0.0769atm\\\\P=31.5atm\)

It means that the pressure change by 1 atm, which is not a significant difference for helium.

The difference in pressure calculated by the two methods is 84 atm.

The ideal gas equation is given by

PV =nRT

From the data given in the question;

P = ?

V = 0.200 L

n =  0.300 mol

T = 248K

R = 0.082 atmLK-1Mol-1

P = nRT/V

P =  0.300 mol × 0.082 atmLK-1Mol-1  × 248K/0.200 L

P = 30.5 atm

From Van der Waals equation;

P = RT/V - b - a/V^2

P =  (0.082 × 248/0.200 - 0.0237)  - (0.0342/ 0.200^2)

P = 114.5 atm

The difference in pressure calculated by the two methods is;

114.5 atm -  30.5 atm = 84 atm

Learn more: https://brainly.com/question/5803619

A slice of cheese has a mass of 21 g and a volume of 15 cm3. What is the density of the cheese in units of g/cm3 and g/mL?


How can I get g/mL?

Answers

Explanation:

First, you have to know the definition of density. Density is mass per unit volume, or D = m/V. In this problem, you are given the mass = 37 g and you are given the volume of 21 cm3. So, the density is simply m/V = 37g/21cm3 = 1.76g/cm3. It's that simple.

Taking into account the definition of density,  the density of the cheese is 1.4 \(\frac{g}{cm^{3} } \) or 1.4 \(\frac{ g}{mL} \).

Density

Density is defined as the property that matter, whether solid, liquid or gas, has to compress into a given space.

In other words, density is a quantity that allows us to measure the amount of mass in a certain volume of a substance. Then, the expression for the calculation of density is the quotient between the mass of a body and the volume it occupies:

\(density=\frac{mass}{volume} \)

From this expression it can be deduced that density is inversely proportional to volume: the smaller the volume occupied by a given mass, the higher the density.

Densty in this case

In this case, you know that:

mass= 21 gvolume= 15 cm³= 15 mL

Replacing in the definition of density:

\(density=\frac{21 g}{15 cm^{3} } =\frac{21 g}{15 mL} \)

Solving:

density= 1.4 \(\frac{g}{cm^{3} } \)= 1.4 \(\frac{ g}{mL} \)

In summary, the density of the cheese is 1.4 \(\frac{g}{cm^{3} } \) or 1.4 \(\frac{ g}{mL} \).

Learn more about density:

brainly.com/question/952755?referrer=searchResults

brainly.com/question/1462554?referrer=searchResults

A vessel with a volume of 18.9 L contains 2.80 g of nitrogen gas, 0.807 g of hydrogen gas, and 79.9 g argon gas. At 25°C, what is the pressure in the vessel?

Answers

The pressure in the vessel is 3.76 atm.

To find the pressure in the vessel, we can use the ideal gas law, which states:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles of gas, R is the gas constant, and T is the temperature in Kelvin.

First, we need to calculate the total number of moles of gas in the vessel:

n(total) = n(N₂) + n(H₂) + n(Ar)

We can find the number of moles of each gas using the formula:

n = m/M

where m is the mass of the gas and M is the molar mass of the gas.

n(N₂) = 2.80 g / 28.01 g/mol = 0.0999 mol

n(H₂) = 0.807 g / 2.02 g/mol = 0.400 mol

n(Ar) = 79.9 g / 39.95 g/mol = 2.00 mol

n(total) = 0.0999 mol + 0.400 mol + 2.00 mol = 2.50 mol

Next, we can convert the temperature from Celsius to Kelvin:

T = 25°C + 273.15 = 298.15 K

Finally, we can plug in the values into the ideal gas law:

PV = nRT

P(18.9 L) = (2.50 mol)(0.08206 L·atm/mol·K)(298.15 K)

P = (2.50 mol)(0.08206 L·atm/mol·K)(298.15 K) / (18.9 L)

P = 3.76 atm

Therefore, the pressure in the vessel is 3.76 atm.

learn more about pressure here

https://brainly.com/question/28012687

#SPJ1

SUPPER EASY WILL GIVE BRAINLIEST NEED HELP ASAP


7. Which
pocess is an example of a chemical
change?

A. Salt mixes with water and
dissolves.

B. An aspirin tablet is crushed into a fine
powder.

C. Water droplets form on the outside of a
cold drink glass.

D. An antacid tablet is added to water and
bubbles are produced.

Answers

Answer:

Your answer will be (D).

Hope this helps!

Answer:

D

Explanation:

You can tell when a chemical change occurs if a gas is produced (bubbles), an odor is produced, if there is a color change, or if the surroundings get hotter or colder.

Write the equation for the equilibrium constant (K) of the reaction studied in this exercise.

2C04 2- (ag) + 2Ht (ag) = CI20, 2- (ag) + H20(1)

Answers

The equation for the equilibrium constant (K) of the reaction studied in this exercise can be written as follows: K = ([\(CI_20\), 2-] * [\(H_20\)(1)]) / ([\(C0_4^ 2\)-] * [Ht])

In this equation, the concentrations of the species involved in the reaction are represented by the square brackets [ ]. The subscripts indicate the stoichiometric coefficients of each species in the balanced chemical equation.

The reaction being studied involves the following species:

\(C0_4^ 2\)- (ag) + 2Ht (ag) = \(CI_20\), 2- (ag) + \(H_20\)(1)

In the equilibrium constant expression, the concentration of \(CI_20\), 2- is multiplied by the concentration of \(H_20\)(1) and divided by the product of the concentrations of \(C0_4^ 2\)- and Ht. The stoichiometric coefficients in the balanced equation are used as exponents for the concentrations of the respective species.

It is important to note that the concentrations used in the equilibrium constant expression should be in molar units (mol/L) or expressed as partial pressures for gases.

Additionally, the equilibrium constant is specific to a given temperature, and its value provides information about the relative amounts of reactants and products at equilibrium.

For more such question on  equilibrium constant visit:

https://brainly.com/question/3159758

#SPJ8

find the valu of
|2x-1|=x+1 is​

Answers

Explanation:

|2x-1|=x+1

√(2x-1)²= x+1

(2x+1)²=(x+1)²

4x²-4x+1=x²+2x+1

3x²-6x=0

x²-2x=0

x(x-2)=0

x=0 or x=2

Where does a solid and liquid both occur on the heating curve

Answers

Answer:

d

Explanation:

Answer

where ever they occur

Explanation:

they occur in where they are contain

How to protect your eyes I want a Expert vefired type of Answer

Answers

Don't take your eyes for granted. Take these easy steps to keep your peepers healthy.

1. Eat Well

Good eye health starts with the food on your plate. Nutrients like omega-3 fatty acids, lutein, zinc, and vitamins C and E might help ward off age-related vision problems like macular degeneration and cataracts. To get them, fill your plate with:

Green leafy vegetables like spinach, kale, and collards

Salmon, tuna, and other oily fish

Eggs, nuts, beans, and other nonmeat protein sources

Oranges and other citrus fruits or juices

Oysters and pork

A well-balanced diet also helps you stay at a healthy weight. That lowers your odds of obesity and related diseases like type 2 diabetes, which is the leading cause of blindness in adults.

3. Wear Sunglasses

The right pair of shades will help protect your eyes from the sun's ultraviolet (UV) rays. Too much UV exposure boosts your chances of cataracts and macular degeneration.

Choose a pair that blocks 99% to 100% of UVA and UVB rays. Wraparound lenses help protect your eyes from the side. Polarized lenses reduce glare while you drive, but don’t necessarily offer added protection.

If you wear contact lenses, some offer UV protection. It's still a good idea to wear sunglasses for an extra layer.

4. Use Safety Eyewear

If you use hazardous or airborne materials on the job or at home, wear safety glasses or protective goggles.

Sports like ice hockey, racquetball, and lacrosse can also lead to eye injury. Wear eye protection. Helmets with protective face masks or sports goggles with polycarbonate lenses will shield your eyes.

5. Look Away From the Computer Screen

Staring at a computer or phone screen for too long can cause:

Eyestrain

Blurry vision

Trouble focusing at a distance

Dry eyes

Headaches

Neck, back, and shoulder pain

To protect your eyes:

Make sure your glasses or contacts prescription is up to date and good for looking at a computer screen.

If your eye strain won’t go away, talk to your doctor about computer glasses.

Move the screen so your eyes are level with the top of the monitor. That lets you look slightly down at the screen.

Try to avoid glare from windows and lights. Use an anti-glare screen if needed.

Choose a comfortable, supportive chair. Position it so that your feet are flat on the floor.

If your eyes are dry, blink more or try using artificial tears.

Rest your eyes every 20 minutes. Look 20 feet away for 20 seconds. Get up at least every 2 hours and take a 15-minute break.

SUGGESTED

6. Visit Your Eye Doctor Regularly

Everyone needs a regular eye exam, even young children. It helps protect your sight and lets you see your best.

Eye exams can also find diseases, like glaucoma, that have no symptoms. It's important to spot them early on, when they're easier to treat.

Depending on your eye health needs, you can see one of two types of doctors:

Ophthalmologists are medical doctors who specialize in eye care. They can provide general eye care, treat eye diseases, and perform eye surgery.

Optometrists have had 4 years of specialized training after college. They provide general eye care and can diagnose treat most eye diseases. They don't do eye surgery.

Hopes this helped

State the number of neutrons in an atom of Ne-20 and the number of neutrons in an atom of Ne-22. choose two answers * 1 point Ne 20: 10 Ne 20: 11 Ne 22: 12 Ne 22: 13

Answers

Answer:

Ne 20: 10

and

Ne 22: 12

Explanation:

Ne-20:

N = A - Z = 20 - 10 = 10 neutrons

Ne-22:

N = A - Z = 22 - 10 = 12 neutrons

N: number of neutrons

A: mass number

Z: atomic number

If salt water has a density of 1.2 g/mL, which object listed below would SINK? *
Object 1 with a density of 1.14 g/cm3
Object 3 with a density of 1.62 g/cm3
Object 4 with a density of 0.8 g/cm3
Object 2 with a density of 0.92 g/cm3

Answers

what are the objects listed?

45 The mass of an unidentified metal sphere is 133 grams. Students determine the
volume of the metal sphere by placing it in a graduated cylinder filled with 25
milliliters of water. The volume of the water rises to 40 milliliters when the metal
sphere is placed into the graduated cylinder. The students calculate the density
of the metal sphere in order to determine the identity of the metal using the
chart below.
Density of Common Metals
Density (g/mL)
Aluminum
Metal
2.70
Tin
7.26
Iron
7.87
8.86
Cobalt
What is the identity of the metal?
A Aluminum
B
Tin
C Iron
D Cobalt

45 The mass of an unidentified metal sphere is 133 grams. Students determine thevolume of the metal sphere

Answers

Answer:

D Cobalt

Explanation:

The volume of the sphere is  40 -25 = 15 cm^3

Density = mass/volume = 133 gm / 15 cm^3 = 8.87 gm/cm^3

  which corresponds to Cobalt from the chart

PLEASEEE HELPPP!!!!!!
Two students were conducting and experiment based on the ionization energy of alkali metals. The driving question for the experiment was: "What is the relationship between ionization energy and the rate of reaction (time for the reaction to be completed) using alkali metals."



Which of the following predictions would be the best option based on the student's prior knowledge learned and information provided in the graph above?

A.
Cesium will have a higher rate of reaction (faster) because it has the lowest ionization energy which indicates a higher reactivity.

B.
Cesium will have a lower rate of reaction (slower) because it has the lowest ionization energy which indicates a lower reactivity.

C.
The ionization energy of the alkali metals will not affect the rate of the reaction because the energy required to remove an electron does not affect time.

D.
Lithium will have a higher rate of reaction (faster) because it has the highest ionization energy which indicates a higher reactivity.

PLEASEEE HELPPP!!!!!! Two students were conducting and experiment based on the ionization energy of alkali

Answers

Answer:

A

Explanation:

Cs has a higher rate of reaction because it's easier to remove an electron from it, thereby leading to faster reactivity

Answer:

It's A but can i have brainliest pls i kinda need it

Explanation:

Iron reacts with chlorine to form iron(III) chloride.


2Fe + 3Cl2 → 2FeCl3


What mass (in grams) of chlorine gas is needed to react with 251 grams of iron?

Select one:

a.
71 grams


b.
392 grams


c.
479 grams


d.
622 grams

Answers

The mass (in grams) of chlorine gas is needed to react with 251 grams of iron is 479 grams. Option C.

To determine the mass of chlorine gas needed to react with 251 grams of iron, we need to use the stoichiometry of the balanced chemical equation:

2Fe + 3Cl2 → 2FeCl3

From the balanced equation, we can see that 2 moles of iron (Fe) react with 3 moles of chlorine gas (Cl2) to produce 2 moles of iron(III) chloride (FeCl3).

To calculate the mass of chlorine gas, we can follow these steps:

Step 1: Convert the given mass of iron (Fe) to moles.

Using the molar mass of iron (Fe), which is approximately 55.85 g/mol, we can calculate the number of moles of iron:

moles of Fe = mass of Fe / molar mass of Fe

moles of Fe = 251 g / 55.85 g/mol

moles of Fe ≈ 4.5 mol (rounded to one decimal place)

Step 2: Use the mole ratio from the balanced equation to find the moles of chlorine gas (Cl2) needed.

From the balanced equation, we know that 2 moles of Fe react with 3 moles of Cl2. Therefore, the moles of Cl2 can be calculated as:

moles of Cl2 = (moles of Fe / 2) * 3

moles of Cl2 = (4.5 mol / 2) * 3

moles of Cl2 ≈ 6.75 mol (rounded to two decimal places)

Step 3: Convert the moles of chlorine gas to grams.

Using the molar mass of chlorine gas (Cl2), which is approximately 70.90 g/mol, we can calculate the mass of chlorine gas:

mass of Cl2 = moles of Cl2 * molar mass of Cl2

mass of Cl2 = 6.75 mol * 70.90 g/mol

mass of Cl2 ≈ 479 grams (rounded to the nearest whole number) Option C is correct.

For more such question on mass. visit :

https://brainly.com/question/19385703

#SPJ8

Determine the number of moles of sodium carbonate (Na2CO3) in a 0.2120 g sample. This sample of Na2CO3 was used to standardise a stock solution of hydrochloric acid in which the Na2CO3 was fully neutralised. If 10.52 cm3 of the HCl solution was required determine the concentration of the HCl in mol dm–3.

Answers

The number of moles of the sodium carbonate would be 0.00200 mol.

The concentration of the HCl would be 0.190 mol/dm^3.

Number of moles

To determine the number of moles of sodium carbonate (Na2CO3) in the given sample, we first need to calculate its molar mass:

Na2CO3 molar mass = 2(22.99 g/mol) + 12.01 g/mol + 3(16.00 g/mol) = 105.99 g/mol

moles of Na2CO3 = mass of sample / molar mass

moles of Na2CO3 = 0.2120 g / 105.99 g/mol

moles of Na2CO3 = 0.00200 mol

Now, to determine the concentration of the hydrochloric acid (HCl) solution, we can use the following equation:

moles of Na2CO3 = moles of HCl

We know that 10.52 cm3 of the HCl solution was required to fully neutralize the Na2CO3. Let's assume that the concentration of the HCl solution is x mol/dm^3. Then we can use the following equation:

moles of HCl = concentration of HCl x volume of HCl solution (in dm3)

0.00200 mol = x mol/dm^3 x 0.01052 dm^3

Solving for x, we get:

x = 0.00200 mol / 0.01052 dm^3 = 0.190 mol/dm^3

Therefore, the concentration of the hydrochloric acid solution is 0.190 mol/dm^3.

More on number of moles can be found here: https://brainly.com/question/12513822

#SPJ1

Convert the following measurement

Convert the following measurement

Answers

Answer:

9.9 x 10^-2 g*cm²/s²

Explanation:

9.9 × 10^-9 kg*m²/s² =    g*cm²/s²

1 kg*m²/s² = 1 joule(s)

1 g*cm²/s² = 1 erg(s)

britannica

1 kg = 1000g = 1x10^3 g

1 m²= 10000 cm² = 1x10^4 cm²

add the exponents 3 and 4 which = 7

-9 + 7 = -2

9.9 × 10^-9 kg*m²/s² = 9.9 x 10^-2 g*cm²/s²

Which of the following societies would have the lowest environmental impact?
A populous, highly industrialized society with high levels of consumption.
A less populated, highly industrialized society with moderate consumption levels.
A small population that farms using hand tools, has no modern technology, and grows their own food.
A large population with moderate industrialization and consumption levels.

Answers

The society with the least negative effects on the environment is probably the one with a small population, traditional farming methods, no access to contemporary technology, and self-sufficient food production.

This is due to the fact that their way of living is less dependent on modern infrastructure and technology, both of which have a negative impact on the environment. Additionally, their agricultural methods are probably more environmentally friendly and sustainable.

The environmental effects of the other societies on the list would all be greater. Because of the use of fossil fuels and the production of products that require a lot of resources, a big, industrialized society with high levels of consumption would have a significant carbon footprint.

It would still take a lot of resources to maintain its infrastructure and create products in a less populous, highly industrialized society with moderate consumption levels, which would have a negative effect on the environment.

Given that the size of the population alone would necessitate significant resource consumption and infrastructure development, a big population with moderate industrialization and consumption levels would also have a big effect on the environment.

learn more about the population here

https://brainly.com/question/29885712

#SPJ1

1 Correct the following statement . Alkanol is
common system of naming alcohols in its series.​

Answers

Answer:

The common system of naming alcohol in its series is alcohol

Which equation obeys the law of conservation of mass? H2(g) + O2(g) → H2O(g)

H2(g) + O2(g) → H2O(g) +4He(g)

2H2(g) + O2(g) → 2H2O(g)

H2(g) → H2O(g)

H2(g) + O2(g) → 2H2O(g)

Answers

Answer:

2H2(g) + O2 -> 2H2O

Explanation:

According to the law of conservation of mass, mass cannot be created nor destroyed in a chemical formula.

The only chemical reaction of the five options that follows this law is

2H2(g) + O2 -> 2H2O because the mass of the compounds stays the same before the reaction (arrow) and after.

Before reaction (reactants) we have:

2 (H2) = 4H

1 (O2) = 2O

After reaction takes place (products) we have:

2 (H2O) = 4H and 2O

and so mass is conserved.

Answer: its the 3rd option

Explanation: on edge hope this helps

Acetic acid (mm = 60.05 g/mol) is a monoprotic acid; an amount of acetic acid was dissolved in enough water to make a 10.00 mL solution. Titration of this acid required 18.53 mL of 0.300 M sodium hydroxide. How many grams of acetic acid were used in this titration?

Answers

Since most reactions take place in solutions, it's critical to comprehend how the substance's concentration is expressed in a solution. The number of chemicals in a solution can be stated in a variety of ways. The grams of acetic acid is 611.90 g.

The number of moles of dissolved solute per liter of solution is the definition of molarity, a unit of concentration. Molarity is defined as the number of millimoles per milliliter of the solution by dividing the number of moles and the volume by 1000.

The equation which is used to calculate the molarity of two different solutions is:

M₁V₁ = M₂V₂

M₁ = M₂V₂ / V₁

0.300 × 18.53 / 10.00 = 0.55 M

Number of moles = Molarity × volume

n = 0.55 × 18.53 = 10.19

Mass = n × Molar mass = 10.19 × 60.05 = 611.90 g

To know more about molarity, visit;

https://brainly.com/question/16587536

#SPJ1

Explain why each of the following names is incorrect
(a) 2,2-Dimethyl-6-ethylheptane
(b) 4-Ethyl-5,5-dimethylpentane
(c) 3-Ethyl-4,4-dimethylhexane
(d) 5,5,6-Trimethyloctane
(e) 2-Isopropyl-4-methylheptane

Answers

Explanation:

Alkanes are the hydrocarbons in which single bonds are present between the carbon atoms

The suffix for alkane hydrocarbons used is '-ane'. The rules to write the nomenclature of alkanes follows:

Select the longest possible continuous carbon chain and it will be the parent chainNumbering is done as such that the alkyl substituents are given the lowest numberIf different alkyl groups are present, they are written in an alphabetical order irrespective of their position in the carbon chainIf two or more similar alkyl groups are present, the words, di, tri, tetra, and so on are used to specify the number of times alkyl groups appearIf two or more alkyl groups are present and the branching occurs, the numbering is done which gives the minimum possible number to all the substituents

For the given options:

(a) 2,2-Dimethyl-6-ethylheptane

The longest possible carbon chain has 8 carbon atoms (prefix used is 'oct-') and not 7(prefix used is 'hept-').

Thus, the correct IUPAC name will be 2,2,6-trimethyloctane.

(b) 4-Ethyl-5,5-dimethylpentane

The longest possible carbon chain has 6 carbon atoms (prefix used is 'hex-') and not 5(prefix used is 'pent-').

Thus, the correct IUPAC name will be 4-isopropylhexane.

(c) 3-Ethyl-4,4-dimethylhexane

The substituents are not given the minimum possible number. Total sum of the number in original compound = [4 + 4 + 3] = 11

But, if both the methyl groups are placed at 3rd position, then total sum of the number = [3 + 3 + 4] = 10

Thus, the correct IUPAC name will be 4-ethyl-3,3-dimethylhexane

(d) 5,5,6-Trimethyloctane

The substituents are not given the minimum possible number. Total sum of the number in original compound = [5 + 5 + 6] = 16

But, if both the methyl groups are placed at 3rd position and 4th position, then total sum of the number = [3 + 3 + 4] = 10

Thus, the correct IUPAC name will be 3,3,4-trimethyloctane

(e) 2-Isopropyl-4-methylheptane

The longest possible carbon chain has 8 carbon atoms (prefix used is 'oct-') and not 7 (prefix used is 'hept-').

Thus, the correct IUPAC name will be 2,3,5-trimethyloctane

The structures of the compounds are attached below.

Explain why each of the following names is incorrect (a) 2,2-Dimethyl-6-ethylheptane (b) 4-Ethyl-5,5-dimethylpentane

help.
Which of the following human activities could lead to more frequent red tides?
A. Adding fertilizers to plants in your yard.
B. Oil left behind by cars driving on city roads.
C. Runoff from factories that are located near oceans.
D. All of the above.

Answers

Answer:

D

Explanation:

Which statement best describes why water is a polar molecule?

a. Water has a slightly negative oxygen atom and slightly positive hydrogen atoms.
b. Water has nonpolar bonds that cancel each other out due to similar electronegativity values.
c. Water has bonds where electrons are equally shared between oxygen and hydrogen atoms.
d. Water has a slightly positive oxygen atom and slightly negative hydrogen atoms.

Answers

Hydrogen atoms are slightly positive and oxygen atoms are slightly negative in water best describes water as polar molecule. Option A is correct.

Due to the molecule's bent shape, water (H₂O) is polar. The shape implies the greater part of the negative charge from the oxygen on side of the particle and the positive charge of the hydrogen atom is on the opposite side of the atom

Two properties of water that outcome from the polar holding between its atoms are attachment and bond. These properties make water atoms 'adhere' to one another and to be drawn to other polar particles.

A polar particle is typically shaped when the one finish of the particle is said to have more certain charges and though the far edge of the atom has negative charges, making an electrical shaft.

Learn more about Polar molecule:

brainly.com/question/17118815

#SPJ1

based on the techniqes yo have learned in the organic chemistry lab how would you seperate any unreated alcohol from the ester

Answers

Answer:

Fractional distillation and HP-LC

Explanation:

This is a technique useful for analytes with close boiling points. Any alcohol-ester azotopes can be further refined using high-performance liquid chromatography (HP-LC) column.

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

How many atoms are in Mg(NO 3) 2

Answers

Answer:

there's just one atom.

Calculate the mass of one water molecule in kg

Answers

We know that Avogadro's number states:

1 mole H2O water = 18 g = 6.02x10^23 formula units (molecules, atoms, ions, etc.) ==> molecules of water here.

Procedure:

18 g water (1 mole) -------- 6.02x10^23 molecules of water

X --------- 1 molecule of water

X = 3.0x10^-23 g

Answer: 1 molecule of water = 3.0x10^-23 g

A certain compound is 66.7% carbon, 3.74% hydrogen, and 29.6% oxygen. Find the empirical formula.

Answers

Answer: C3H2O

Explanation: To find the empirical formula of the compound, we need to determine the simplest whole number ratio of atoms in the compound.

Assuming we have 100 g of the compound, we can convert the percentages to masses of each element:

Carbon: 66.7 g

Hydrogen: 3.74 g

Oxygen: 29.6 g

Next, we need to convert these masses to moles using the atomic masses:

Carbon: 66.7 g / 12.01 g/mol = 5.55 mol

Hydrogen: 3.74 g / 1.01 g/mol = 3.70 mol

Oxygen: 29.6 g / 16.00 g/mol = 1.85 mol

Now we need to divide each of these mole values by the smallest of the three:

Carbon: 5.55 mol / 1.85 mol = 3.00

Hydrogen: 3.70 mol / 1.85 mol = 2.00

Oxygen: 1.85 mol / 1.85 mol = 1.00

These ratios give us the empirical formula:

C3H2O

However, we can simplify this formula by dividing each subscript by 2:

C1.5H1O0.5

Finally, we can multiply through by 2 to get rid of the decimals:

C3H2O

(BRAINLIEST + 100 POINTS!!!) What nutrient promotes normal heart rhythm and muscle function and can be found in nuts, legumes, whole-grain products, and dark green vegetables?


(A)calcium

(B)magnesium

(C)vitamin C

(D)vitamin D

Answers

The element that helps the heart and is found in nuts and legumes is magnesium.

What is the element involved?

In this case, we are being asked about the element that promotes normal heart rhythm and muscle function and can be found in nuts, legumes, whole-grain products, and dark green vegetables. We have to know that this element is one of the key elements that are important to the health of a person.

Now we have to look at the options tat we have and see that magnesium is the element that is abundant in the nuts and the legumes and have been linked to the effective function of the heart.

Learn more about magnesium in health:https://brainly.com/question/29439413

#SPJ1

Other Questions
Which of the following types of soil has the greatest permeability? A. silty B. loam C. clay D. sandy can someone help pls ok heres the question Mr. Roosevelt has 48 nails that each weigh 1.35 ounces what is the weight of theese nails in ounces A.50.4 ozB.40.4 oz C.64.8 ozD.16.2 oz Tyres of an F1 race car fail after 100 hrs. A car race at Kyalami Racecourse takes 10Hrs to complete all the laps. a. What are the number of failures in the system? b. What is the probability that 2 tyres of a race car will fail in the race? Il faisait trs chaud. Il fallait boire beaucoup d'eau. La journe, je sortais peu. Les gens essayaient de faire du sport le matin trs tt. En gnral, maman et Papa ne ___________(DORMAIENT OR RIAIENT)?? pas bien. Heureusement le week-end, nous allions la plage dans la voiture de papa. Nous restions dans l'eau frache pendant des heures et c'tait fantastique! What characteristic does Gilgamesh show in thispassage?Which detail from the passage best reflects thischaracteristic? the responsibility for setting a company's mission, objectives, broad strategies, and policies primarily lies with its . May someone pls help me with this question? Thank you Which of the following describes the purpose of the artwork? To copy artists who came before To create a serious mood for the viewer To show a subject with a comic-like feel To use blending painting techniques The first input operation is called the ________, and its purpose is to get the first input value that will be tested by the validation loop.A. first inputB. loop set readC. loop validationD. priming readAnswer D. Priming Read How are the monotheistic religions different? Which statement BEST explains the effect of using a third-person point of view in this passage?ResponsesA It creates an impersonal tone.It creates an impersonal tone.B It reveals the inner thoughts of Randall and his parents.It reveals the inner thoughts of Randall and his parents.C It makes the passage more subjective.It makes the passage more subjective.D It allows the narrator to seem objective.It allows the narrator to seem objective. A Wire is first bent into the shape of a triangle. Each side of the triangle is 12 inches long. Then the wire is unbent and reshaped into a square. What is the length of a side of the square? Let f and g be the functions in the table below. x f(x) g(x) f '(x) g'(x)1 3 2 4 62 1 3 5 73 2 1 7 9 (a) If F(x) = f(f(x)), find F '(1).F '(1) = ___________________.(b) If G(x) = g(g(x)), find G'(2).G'(2) = ___________________. a portfolio manager in charge of a portfolio worth $10 million is concerned that the market might decline rapidly during the next six months and would like to use put options on an index to provide protection against the portfolio falling below $9.5 million. the index is currently standing at 500 and each contract is on 100 times the index. what should the strike price of options on the index be the portfolio has a beta of 0.5? assume that the risk-free rate is 10% per annum and there are no dividends. when does the small ribosomal subunit bind to the translational complex in eukaryotic cells? HELP ME a(n) __________________ for a juvenile is similar to a criminal trial for an adult. How does the Fed control interest rates?. 1.How did earthquakes affect the rise and progress of the civilization in America and the Pacific islands? 2. What should you do when a natural disaster like earthquake occurs in your place? 3. Among the three types of waves, what is the most destructive? Why? Please po pasagot what is the use of sandpaper and brushes to remove the epidermis and portions of the dermis called?