A ____________ is a large area of open land that has been turned into a container for our trash.
garbage truck
housefill
recycling bin
landfill

Answers

Answer 1
The correct answer is Landfill
:)
Answer 2

Answer:

Landfill (D) is your answer to go in the blank.

Explanation:

The garbage truck is what transports our garbage and delivers it to the landfill.

Housefill isn't a thing.

Recycling Bin, is how you recycle and goes to a facility where it is modified to be re-used, and isn't transported to a landfill.


Related Questions

Please help me due in like 2 min
A model of the water cycle was made by adding a small amount of water into an aquarium, covering the aquarium with a piece of glass, and placing a lamp over the glass cover to add heat. What does the lamp represent when comparing this model to the real-life water cycle?

Clouds

Precipitation

The ocean

The sun

Answers

I say Precipitation

Answer: D) The sun

Explanation:


A cube, with a mass of 21 g is dropped in a graduated cylinder with 10 mL
water. The water level rises to 24 mL when the cube is added. What is the
cube's density (don't forget units)

Answers

Answer:55ml

Explanation:

What Mass Of CH4 formed When 8.3 moles Of CO React With Hydrogen according to this equation 2CO react with 2H2 give As CH4 react With CO2​

Answers

Answer:

66.4g

Explanation:

CO:CH4

2:1

CH4 moles= 8.3 ÷ 2

= 4.15 moles

CH4 = 12+ 4(1)= 16g

1 mole of CH4-------> 16g

4.15moles

(4.15x16)÷1

=66.4g

When does a metallic bond present

Answers

Answer:

Metallic bonds occur among metal atoms.

Air is made up of different gases, such as oxygen, nitrogen, and car
Which statement best describes these three components of air?
O Oxygen, nitrogen, and carbon dioxide are all classified as pure
O Oxygen, nitrogen, and carbon dioxide cannot react with another
Oxygen, nitrogen, and carbon dioxide are chemically bonded to
O Oxygen, nitrogen, and carbon dioxide can be classified as elemental?

Answers

The correct option would be that oxygen, nitrogen, and carbon dioxide cannot react with one another.

Why air components cannot react

The components of atmospheric air, nitrogen, oxygen, carbon dioxide, etc., cannot react with one another because there is not enough energy in the atmosphere to set the reaction rolling.

For a reaction to take place, there must be enough energy to break the bonds in each air component. This is why the air components will not spontaneously react with one another, except during special events such as lightning and thunder.

More on air components can be found here: https://brainly.com/question/17288850

#SPJ1

Which intermolecular forces exist in dry ice, CO2(S)?

Answers

Answer:

Ice (solid H2O) and dry ice (solid CO2) are examples of molecular solids. Molecular solids are held together by intermolecular forces—dispersion forces, dipole–dipole forces, and hydrogen bonding. Ice is held together by hydrogen bonds, and dry ice is held together by dispersion forces.

30 N

60 N
20 N
Net force:
Resulting force:

Answers

Answer:

Net force: 110 N

Resulting Force: 24.7289837 pounds-force

Explanation:

First you would add 30+60+20N which would be 110N

110N would equal to the 24.72898937 pounds of force.

Can someone help its confusing

Can someone help its confusing

Answers

Answer:

It's a metaphor. It's comparing Jordan and their emotions to a tornado

a buffer with a ph of 9.71 is to be prepared from nh3 and nh4cl. what ratio of base to salt would you use? kb(nh3)

Answers

To prepare a buffer of pH 9.71 using NH3 and NH4Cl, the base-to-salt ratio should be 1:1.

Let's understand this in detail:

The buffer solution should be prepared using NH3 and NH4Cl to achieve a pH of 9.71.

In this case, NH3 is the base, while NH4Cl is the salt component. The pKa and the concentration of the acid and base components determine the pH of a buffer solution.

The Henderson-Hasselbalch equation is used to calculate the pH of the buffer solution:

pH = pKa + log ([A-]/[HA])Here, A- is the concentration of the base, while HA is the concentration of the acid (in this case, NH4Cl).

For the buffer to have a pH of 9.71, we must calculate the pKa of NH4Cl. NH4Cl is an ammonium salt, and its acid dissociation constant is calculated using the Kb of NH3:

Kw = Ka x Kb

Ka x Kb = Kw

Kb = Kw/Ka = 10^-14 / 5.6 x 10^-10 = 1.8 x 10^-5

The pKa of NH4Cl is calculated as: pKa = 14 - pKb

pKa = 14 - 4.74 = 9.26

Now, we can use the Henderson-Hasselbalch equation to calculate the base-to-salt ratio for the buffer:

pH = 9.71pKa = 9.26[A-]/[HA] = 1 (since we want a 1:1 ratio of base to salt)

9.71 = 9.26 + log (1)0.45 = log (1)Antilog (0.45) = 2.82

Therefore, the base-to-salt ratio should be 1:1 (NH3:NH4Cl).

Learn more about buffers: Which of these substances acts as a buffer? https://brainly.com/question/1385846

#SPJ11

4Fe + 3O2 --> 2Fe2O3

Using your balanced equation from above, how many moles of Fe2O3 will form if I start the reaction with 5.67 moles of Oxygen? (You must show all work, with dimensional analysis)

Answers

As a result, there are 3 mole of oxygen gas in Fe 2 O 3.

How is the meaning of a mole determined?

Calculate the substance's weight by its molar to determine how many moles you have. The mass in milligrams with one mole of an item is known as its molar mass. The chemical unit's atomic weight, given in atomic mass units, determines the substance's mass (amu).

What is the mole theory formula?

Moles = Sample Mass / Molar Mass By multiplying the amount of mole by the Avogadro constant, you can get the overall number of atoms or molecules in a sample.

To know more about moles visit:

https://brainly.com/question/29724957

#SPJ1

How many moles do you have if you have 144 L of a gas at SATP?

How many moles do you have if you have 144 L of a gas at SATP?

Answers

Answer

moles = 5.81 mol

Explanation

Given:

Volume = 144 L

AT SATP

1 mole = 24.4651 L

Solution:

1 mole = 24.4651 L

x mole = 144 L

x = 144/24.4651

x = 5.8 mol

The data below show the concentration of AB versus time for the following reaction: AB(g)→A(g)+B(g) Time (s) [AB] (M)

0 0.950

50 0.459

100 0.302

150 0.225

200 0.180

250 0.149

300 0.128

350 0.112

400 0.0994

450 0.0894

500 0.0812

Determine the value of the rate constant.Predict the concentration of AB at 21 s .

Answers

The concentration of AB at 21 s is 0.526 M.

The data below show the concentration of AB versus time for the following reaction:

AB(g)→A(g)+B(g)Time (s)  [AB] (M)0  0.95050  0.459100  0.302150  0.225200  0.180250  0.149300  0.128350  0.112400  0.0994450  0.0894500  0.0812

Determine the value of the rate constant:

The reaction is a first-order reaction. The concentration of AB changes as follows:

[AB]t = [AB]0e^-ktln

([AB]t/[AB]0) = -ktln

(0.459/0.950) = -k(

0.693)k = 1.88 × 10^-3 s^-1

The rate constant value is 1.88 × 10^-3 s^-1.

Predict the concentration of AB at 21 s.

The formula for a first-order reaction is given by ln

([A]t/[A]0) = -ktln([AB]t

[AB]0) = -kt[AB]t = [AB]0 e^-kt

[AB]t = (0.950) e^-(1.88 × 10^-3)(21)[AB]t = 0.526 M.

To know more about first-order reaction please refer to:

https://brainly.com/question/31661139

#SPJ11

A seais usually defined as A.A body of freshwater that is not connected to the ocean B. A body of freshwater that is connected to the ocean C. A body of salt water that is not connected to the ocean D. Body of salt water that is connected to the ocean

Answers

Answer:

D. Body of salt water that is connected to the ocean

Explanation:

An ocean is a body of salt water which covers approximately 70% of the Earth's surface. About 97% of the Earth's water is comprised of ocean and as such it is the most prominent and defined feature of the Earth. There are basically four (4) categories of an oceanic basin and these are;

1. The Pacific ocean.

2. The Artic ocean.

3. The Atlantic ocean.

4. The Indian ocean.

A sea is usually defined as a body of salt water that is connected to the ocean and are surrounded (enclosed) by land partially.

Basically, a sea is formed where a land and an ocean meet and as a result, an ocean is usually bigger than a sea.

Some examples of seas around the world are Red sea, Mediterranean sea, Sargasso sea, Caribbean sea, Baltic sea, Caspian sea, Chuckchi sea, etc.

Answer:

Yes The Anwer is D Hope This Help:)

what gas has increased in our atmosphere from 300 parts to 410 parts since 1950: 1) nitrogen, 2) carbon dioxide, 3) oxygen, 4) political hot air.

Answers

Gas that has increased in our atmosphere from 300 parts to 410 parts since 1950 is : 2) carbon dioxide (CO₂). It first exceeded 300 parts per million threshold in the 1950s and today it is over 410 parts per million.

What gas has increased in our atmosphere ?

The concentration of carbon dioxide in the atmosphere is currently nearly 412 parts per million. This shows a 47 percent increase since the beginning of the Industrial Age when the concentration was nearly 280 ppm.

The atmospheric level of carbon dioxide has been rising since the 1960's. In 2021, atmospheric carbon dioxide levels reached 416.45 parts per million in comparison to 1960 levels which was 316.91 parts per million.

To know more about carbon dioxide, refer

https://brainly.com/question/14445045

#SPJ4

Which question can be asked to determine if a wave is electromagnetic or mechanical

Answers

Answer: The Answer is

Does it require medium to travel

Explanation:

Answer:

does it require a medium

Explanation:

trust me

Use the average acceleration obtained in Activity 1 to determine how far the ball should drop at 0.3 second, 0.5 second, and 0.7 second. Using the simplified formula y = 1/2 at2 (because y0 = 0 and v0 = 0), calculate y to one decimal place.

Answers

Answer:

0.3 sec : -0.4 m

0.5 sec: -1.2 m

0.7 sec: -2.3 m

Explanation:

0.3 sec: 1/2(-9.3 m/s^2)(0.3 s)^2 = -0.4 m

0.5 sec: 1/2(-9.3 m/s^2)(0.5 s)^2 = -1.2 m

0.7 sec: 1/2(-9.3 m/s^2)(0.7 s)^2 = -2.3 m

What mass of sulfuric acid, H2SO4, is required to react with 3.27 g of potassium hydroxide, KOH? The products of this reaction are potassium sulfate and water.


Have both the unbalanced and balanced chemical equations.

Explain how to find the molar mass of the compounds.

Explain how the balanced chemical equation is used to find the ratio of moles

Explain how many significant figures your answer needs to have.

The numerical answer

Answers

Answer:

pa help din ako jan please

Answer:

Don't plagiarize here.

Explanation:

Your online teacher knows that you are looking here for the answer!!!!

How many moles of nitrogen, N , are in 67.0 g of nitrous oxide, N2O ?

Answers

Considering the chemical formula, 3.045 moles of nitrogen N are in 67.0 g of nitrous oxide, N₂O.

Chemical formula

Chemical formulas use letters and numbers to represent chemical species. The letters are called chemical symbols and represent the elements present in the chemical species.

The numbers located to the right of each chemical symbol is a subscript that indicates the number of moles of the element present in that compound. If no subscript appears after a chemical symbol, this implies that there is only one atom of that element.

Moles of nitrogen

The molar mass of N₂O is 44 g/mole. If the molar mass is the amount of mass that a substance contains in one mole, this means that 1 mole of N₂O contains 44 grams of the compound.

On the other hand, 1 mole (or 44 grams, according to the definition of molar mass) of N₂O contain 2 moles of N. So, you can apply the following rule of three: if 44 grams of the compound contains 2 moles of N, 67 grams of the compound contains how many moles of N?

amount of moles of N= (67 grams× 2 moles of N)÷ 44 grams

amount of moles of N= 3.045 moles

Finally, there is 3.045 moles of N.

Learn more about chemical compound:

brainly.com/question/9763665

#SPJ1

If the following redox reaction occurred, which compound would be oxidized? Reduced?

Answers

In the following redox reaction, Fe (Iron) is being oxidized, while Cl₂ (Chlorine Gas) is being reduced. Oxidation is defined as the loss of electrons, while reduction is the gain of electrons.

Here, correct answer will be

In this reaction, the Fe is losing two electrons to the Cl₂, which is gaining two electrons. Therefore, the Fe is being oxidized, while the Cl₂ is being reduced.

It is important to note that the oxidation state of a compound can change without the compound itself changing. In this reaction, the oxidation states of the two compounds are changing, even though the compounds themselves are not.

The oxidation state of the Fe is increasing from 0 to +2, while the oxidation state of the Cl₂ is decreasing from 0 to -2. This is what makes this reaction a redox reaction.

Know more about Oxidation here

https://brainly.com/question/9496279#

#SPJ11

complete question is :-

If the following redox reaction occurred, which compound would be oxidized and Reduced?

2FeCl₃(s) → 2Fe(s) + 3Cl₂(g)

Whatt happens to water when its heated from 0 °C to 4 °C?

Answers

Answer:

molecules gain energ and start to move quickly

Water has highest density at 4∘C. This changes its properties from other simple fluids. When water is heated from 0∘C to 4∘C, the volume of liquid decreases. Thus for this transition, P ΔV is negative.

What type of reaction is this?
N2 + 3H2
2NH3

Answers

What is gluconeogenesis and where does it occur?
The three irreversible steps of glycolysis (name them) must be surpassed by what 3 enzymes/

Answers

The metabolic pathway by which glucose is synthesized from non-carbohydrate precursors such as amino acids, lactate, or glycerol is known as gluconeogenesis. This process occurs primarily in the liver.

What exactly is gluconeogenesis?

When the intake of dietary is insufficient or absent, gluconeogenesis provides glucose. It is also required for the maintenance of acid-base balance, amino acid metabolism, and the synthesis of carbohydrate-derived structural components.

Glycolysis has three irreversible steps:

1. Hexokinase/Glucokinase: This enzyme catalyzes the first step of glycolysis, the phosphorylation of glucose to glucose-6-phosphate.

2. phosphofructokinase-1: This enzyme catalyzes the third step of glycolysis by converting fructose-6-phosphate to fructose-1,6-bisphosphate.

3. Pyruvate kinase: This enzyme catalyzes the final step of glycolysis, the conversion of phosphoenolpyruvate to pyruvate.

Which three enzymes are involved in glycogenolysis?

Glycogen phosphorylase, phosphorylase kinase, and phosphoglucomutase are key enzymes in glycogenolysis.

To know more about the gluconeogenesis visit:

https://brainly.com/question/30908065

#SPJ1

Can magic 8 ball wash with water?

Answers

Yessss of course why not

Do you agree or disagree with the statement: "A rise of -7°C" means "a fall of 7°C"? Explain.

Answers

Answer:

i would agree

Explanation:

What is the best definition of solar radiation?Storing Storing of of energy energy in in Earth'Earth's s oceansoceansEnergy Energy from from the the Sun Sun that that reaches reaches EarthEarthMoisture Moisture and and heat heat energy energy in in the the atmosphereatmosphereIncreased Increased evaporation evaporation due due to to warm warm waterwater

Answers

Answer:The solar energy that we receive through solar radiation is directly or indirectly responsible for aspects as important to life as: Photosynthesis in plants; maintaining a planet temperature compatible with life. of the wind. The solar energy that reaches the earth's surface is 10,000 times greater than the energy currently consumed by all

Explanation:

The reaction 2A + B → C + D is studied to determine the kinetics of the reaction at a certain temperature, which is held constant throughout the experiment.

a. Find the order with respect to A and B and explain your reasoning.
b. Write the rate law that is consistent with part (a).
c. Determine the value for k and specify its units.

The reaction 2A + B C + D is studied to determine the kinetics of the reaction at a certain temperature,

Answers

The rate of reaction refers to how quickly or solwly a reaction occurs;

a) Both A and B are second order

b) The rate law of the reaction is R = k[A]^2 [B]^2

c)The rate constant is  5.21 * 10^5 mol-3L^3s-1.

What is the rate of reaction?

The term rate of reaction refers to how quickly or slowly a reaction occurs.

a) To obtain the order with respect to A, we divide reaction (3) by (2) as follows;

5.01 * 10^-1/1.25 * 10^-1 = k[0.0070]^m [0.14]^n/k[0.0035]^m [0.14]^n

4 = 2^m

2^2 = 2^m

m =2

To obtain the order with respect to B, we divide reaction (2) by (1);

1.25 * 10^-1/3.13 * 10^-2 = k[0.0035]^m [0.014]^n/k[0.0035]^m [0.0070]^n

4 = 2^n

2^2 = 2^n

n = 2

b)The reaction is second order in both A and B hence the rate law is R = k[A]^2 [B]^2

c) We can obtain K using any of the reactions;

0.0313 molL-1s-1 = k[0.0035molL-1]^2 [0.0700molL-1]^2

k = 0.0313 molL-1s-1/[0.0035molL-1]^2 [0.0700molL-1]^2

k = 5.21 * 10^5 mol-3L^3s-1

Learn more about rate of reaction: https://brainly.com/question/8592296?

(50 POINTS, PLEASE HELP!!) Go back and read the goals for this lesson on page 1. Form a summary statement for each goal, showing you understand and have met the goals of this lab. Be sure to explain all major concepts and relationships presented in this lab. (3-5 sentences)

Goals:
Compare the sizes, charges, and relative positions of the subatomic particles: protons, neutrons, and electrons.
Relate an atom’s number of protons to its charge, name, and atomic number.
Calculate the mass number of an atom by summing the protons and neutrons.
Understand the definition of isotope.

Answers

Answer:

An atom is made of up subatomic particles called protons, neutrons and electrons. The center of an atom is called the nucleus and is where the protons and neutrons are held while electrons orbit the nucleus in orbital shells. A electron has a negative charge, a proton has a positive charge, and a neutron has no charge (neutral).

The atomic number of a atom is the total amount of the atom's protons. In a neutral atom (Not an ion), the amount of electrons is the same as the protons. Therefore, the atomic number also tells the amount of electrons in the atom.

A ion is a negatively or positively charged particle due to the giving or taking of electrons with one or more atoms (Called an ionic bond). An atom that gives away electrons becomes positively charge because that atom now has more protons than neutrons. An atom that takes an electron becomes negatively charge because that atom now has more electrons than protons.

Atomic Mass is the sum of an atom proton and neutrons. To determine how many neutron an atom has, subtract the atomic mass from the atomic number. Electrons do not play a part in atomic mass as their mass is  1/1,836 of a proton's mass.

A isotope is two or more forms of the same element that contain equal amounts of protons but different amount of neutrons.

Pl help it’s for a grade I will give Brainly

Pl help its for a grade I will give Brainly

Answers

Answer:

its B

Explanation:

A fundamental equation of thermodynamics, the Gibbs-Helmholtz equation, is a linear equation that relates free energy change, AG, to absolute temperature, T. The equation is AG = AH -TAS, where AH is enthalpy change and AS is entropy change. Using the above equation, find AG at 400 K for a reaction in which AH = 61.0 kcal and AS = 0.020 kcal/K. 7. A cost equation is known to be y = 10x + 250, where x is the number of units produced and y is the cost in $. Find the total cost of producing 5 000 units. Round your answer to four significant digits (SD).

Answers

At 400 K, the free energy change (ΔG) for the reaction is 53.0 kcal. The total cost of producing 5,000 units is $50,250.

To find ΔG at 400 K using the Gibbs-Helmholtz equation, we need to substitute the given values of ΔH and ΔS into the equation.

ΔG = ΔH - TΔS

Given;

ΔH = 61.0 kcal

ΔS = 0.020 kcal/K

T = 400 K

Substituting these values into the equation;

ΔG = 61.0 kcal - (400 K)(0.020 kcal/K)

ΔG = 61.0 kcal - 8.0 kcal

ΔG = 53.0 kcal

Therefore, at 400 K, the free energy change (ΔG) for the reaction is 53.0 kcal.

To find the total cost of producing 5,000 units using the cost equation y = 10x + 250, we need to substitute x = 5,000 into the equation.

y = 10x + 250

Given;

x = 5,000

Substituting x = 5,000 into the equation:

y = 10(5,000) + 250

y = 50,000 + 250

y = 50,250

Therefore, the total cost of producing 5,000 units is $50,250.

To know more about free energy change here

https://brainly.com/question/32317964

#SPJ4

Which phrase best describes the role carbon plays in the structure of compounds present in living things? no role no role a minimal role a minimal role a somewhat important role a somewhat important role a fundamental role

Answers

Carbon plays a fundamental role in the structure of organic compounds.

What role does carbon play in compound structure?

Organic compounds are primarily composed of carbon. Carbon, like many other elements, can form stable bonds with itself. Organic compounds are classified into four types: carbohydrates, lipids, proteins, and nucleic acids.Without carbon, there would be no life on Earth. This is due, in part, to carbon's ability to easily form bonds with other atoms, which allows for greater flexibility in the form and function of biomolecules such as DNA and RNA, which are essential for the defining characteristics of life: expansion and replication.Carbon helps to regulate the Earth's temperature, allows all life to exist, is a key component of the food we eat, and is a major source of energy for our global economy.Carbon's ability to form stable bonds with many elements, including itself, is the reason for this. This property enables carbon to form a wide range of extremely large and complex molecules.

To learn more about carbon play in compound structure refer to

https://brainly.com/question/24419453

#SPJ4

Other Questions
What are the similarities between Three Mile Island and Chernobyl? describe fully the single transformation that maps triangle A into triangle B Read the excerpt from Robert Yatess notes from the Constitutional Convention on June 11, 1787.Mr. Wilson was of opinion, and therefore moved, that the mode of representation of each of the States ought to be from the number of its free inhabitants, and of every other description three fifths to one free inhabitant.The Three-Fifths Compromise In polar covalent bonds the shared electrons spend more time around the larger atom making that are slightly negative. true or false After the Columbine shootings, people were more likely to overestimate the amount of teen violence occurring in schools and to fear school violence. This is because of Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 Comparing Two Linear Functions Use the graph and table to answer the questions. Which vehicle loses the most value each year? Car: 20 000 (2. 16500) 15 000 (G, 10900) Which vehicle will lose all of its value first? Value ($) 10.000 5000 6 8 If the truck's rate of depreciation changes to a decrease of $1,650 each year, which vehicle will lose all of its value first? Years Truck: Years: x Value ($) y 21,000 3 17,700 6 14.400 Subtract. Write your answer in simplest form.13/15 - 2/5and i put 7/15 is this correct californias early ecological community was centered in the sierra nevada. true or false 5 examples of organizations who can request to see your credit report The marketing mix element that describes what a buyer exchanges with a seller in order to obtain a product is known as? which nursing intervention may help prevent cardiac decompensation in a laboring client with heart disease? suppose you own stock in national advertising which had earnings of $2.50 per share last year. if yesterday's closing price was $41.50, what is the price-earnings ratio of the stock? a(n) ____ union represents complete integration of all public affairs within a region. Choose a verse from scripture that discusses a theme from this unit (greetings, introductions, communication), and share how it motivates you as you begin learning Spanish. If you could detect early-stage Alzheimer's disease, would you expect to see brain changes that were similar to, although less extensive than, those seen in patients who have died of this disease? Explain. What is the length of EF in the right triangle below?1812 Write the linear equation in slope-intercept form and simplify.4x + 13y = 7 what is the alcohol concentration of a beverage that is 100 proof? the nurse is caring for a 12-year-old postop spinal rod placement client with scoliosis. which factor might intensity the child's postop pain experience?