3. classify each of the following as an element, a compound, or mixture: a. carbon in pencils b. carbon monoxide c. orange juice

Answers

Answer 1

Answer:

1 is an element

2 is a compound

3 is a mixture

Explanation:

One consists of only one type of material

two has two particles chemically bound together

three is a heterogeneous mixture which means they do not have a constant and uniform apperrance and composition


Related Questions

What is the charge of electrons?

Answers

Answer:

-1

Explanation:

during the cell cycle, compounds called cyclins increase and decrease in a regular pattern. what is the role of cyclins?

Answers

During the cell cycle, compounds called cyclins increase and decrease in a regular pattern. They regulate the stages of cell division and growth.

Cell cycle development is regulated in element by way of the sequential pastime of various cyclins. The cyclins are regulatory subunits that bind, prompt and provide substrate specificity for their catalytic companion serine-threonine kinases, collectively called cyclin-established kinases.

Cyclins are a family of proteins that don't have any enzymatic interest of their personal however spark off CDKs through binding to them.

S cyclins are involved inside the induction of DNA replication and early stages of mitosis. Their stages upward push at the beginning of S phase and fall in early mitosis.

Learn more cyclins here:- https://brainly.com/question/21087687

#SPJ4

PLEASE ANSWER QUICK! 50 POINTS!!!!
How does the structure of amino acids allow them to form a polypeptide?

Options:
A. Each amino acid has an amino group and a carboxyl group.
B. Each amino acid has a hydrogen atom and a carboxyl group.
C. Each amino acid has a carboxyl group and an R group.
D. Each amino acid has an R group and a hydrogen atom.

Answers

Answer:

A. Each amino acid has an amino group and a carboxyl group.

Answer:a

Explanation:

a little help with all of them hehe​

a little help with all of them hehe

Answers

Answer:

280 torr2.53 L192884.8 Pa11.46 moles

Explanation:

Q1

According to The Ideal Gas Equation :

P₁V₁/T₁ = P₂V₂/T₂P₁V₁ = P₂V₂ (as T₁ = T₂)P₂ = P₁V₁/V₂P₂ = 560 x 145 / 290P₂ = 560 x 0.5P₂ = 280 torr

Q2

P₁V₁/T₁ = P₂V₂/T₂V₁/T₁ = V₂/T₂V₂ = V₁T₂/T₁V₂ = 3 x (273 - 20) / (273 + 27)V₂ = 3 x 253 / 300V₂ = 253 x 0.01V₂ = 2.53 L

Q3

PV = nRTP = nRT/VP = 0.4 x 8.314 x (17 + 273) / 5 x 10⁻³P = 0.4 x 8.314 x 290 x 10³ / 5P = 400 x 8.314 x 58P = 23200 x  8.314P = 192884.8 Pa

Q4

PV = nRTn = PV/RTn = 2.8 x 98 / 0.082 x 292n = 274.4/23.944n = 11.46 moles

I'm so confused on what to do somebody plsss explain the steps

I'm so confused on what to do somebody plsss explain the steps

Answers

You are probably asked to convert the given number of methane (CH4) molecules into moles.

1.5 x 10^20 molecules of CH4 is  to 0.0249 moles of CH4

How do we calculate?

The atomic mass of carbon =  12.01 g/mol,

the atomic mass of hydrogen=  1.008 g/mol.

The molecular weight of CH4 is shown below:

Molecular weight CH4 = (1 x 12.01 g/mol) + (4 x 1.008 g/mol)

Molecular weight CH4   = 16.04 g/mol

Number of moles = number of molecules / Avogadro's number

Number of moles = (1.5 x 10^20) / (6.022 x 10^23 molecules/mol)

Number of moles = 0.0249 moles

Learn more about atomic mass at: https://brainly.com/question/30390726

#SPJ1

the ion in sea water that serves as a buffer isa. ca 2.b. na .c. co2.d. hco3-.

Answers

The ion in seawater that serves as a buffer is HCO₃⁻ (bicarbonate ion). Option D is correct.

Seawater is a complex mixture of various dissolved salts and ions, including sodium (Na⁺), chloride (Cl⁻), calcium (Ca²⁺), and bicarbonate (HCO₃⁻).

A buffer is the solution which resists changes in pH when an acid or base is added to it. It consists of a weak acid and its conjugate base, or a weak base and its conjugate acid. In the case of seawater, the bicarbonate ion (HCO₃⁻) acts as a buffer.

HCO₃⁻ can act as both a weak acid and its conjugate base. It can donate a proton (H⁺) to act as an acid or accept a proton to act as a base. This ability to accept or donate protons helps maintain the pH of seawater within a relatively narrow range.

When an acid is added to seawater, the bicarbonate ion (HCO₃⁻) can accept the excess protons and convert into carbonic acid (H₂CO₃). This conversion helps to reduce the increase in acidity and prevent a drastic decrease in pH.

Therefore, HCO₃⁻ in seawater acts as a buffer, helping to stabilize and maintain the pH of the water despite the addition of acids or bases.

Hence, D. is the correct option.

To know more about bicarbonate ion here

https://brainly.com/question/29084940

#SPJ4

to what tempature must a sample of helim gas be cooled from 119

Answers

The sample of helium gas must be cooled to approximately -220°C to reduce its volume from 5.9 L to 0.2 L at constant pressure.

According to the ideal gas law, the relationship between the volume (V), temperature (T), and pressure (P) of a gas can be expressed as PV = nRT, where n is the number of moles of the gas and R is the ideal gas constant. In this case, the pressure is constant, so we can simplify the equation to V/T = constant.

To find the final temperature required to reduce the volume from 5.9 L to 0.2 L, we can set up the following ratio:

(V1 / T1) = (V2 / T2)

Where V1 is the initial volume (5.9 L), T1 is the initial temperature (119°C + 273.15 = 392.15 K), V2 is the final volume (0.2 L), and T2 is the final temperature that we need to find.

Rearranging the equation, we have:

T2 = (V2 / V1) * T1

= (0.2 L / 5.9 L) * 392.15 K

≈ 13.28 K

Converting 13.28 K back to Celsius, we get:

T2 ≈ -259.87°C

Therefore, the sample of helium gas must be cooled to approximately -220°C (or -259.87°C) to reduce its volume from 5.9 L to 0.2 L at constant pressure.

The question should be:

To what temperature must a sample of helium gas be cooled from 119°C to reduce its volume from 5.9 L to 0.2 L at constant pressure?

To learn more about ideal gas law, Visit:

https://brainly.com/question/27870704

#SPJ11

draw the structural formula of 3-ethoxy-2-methylhexane.

Answers

The structural formula of 3-ethoxy-2-methylhexane can be written as CH3CH(CH3)CH(CH3)CH2CH2OCH2CH3. In this molecule, there is a six-carbon chain that contains two methyl groups and an ethoxy group. The ethoxy group is attached to the third carbon atom of the chain, while the methyl groups are attached to the second and fourth carbon atoms. The remaining two carbon atoms are attached to the fifth and sixth positions respectively.

The molecule is named as 3-ethoxy-2-methylhexane since the ethoxy group is attached to the third carbon atom of the hexane chain.

The total number of carbon atoms in the molecule is six, which gives it the name of hexane. Overall, 3-ethoxy-2-methylhexane is an organic compound that is used in various industrial applications.
Hi! I'm happy to help you understand the structural formula of 3-ethoxy-2-methylhexane. First, let's break down the name to identify the components of the molecule:

- "Hexane" is the base structure, indicating a six-carbon alkane chain.
- "3-ethoxy" means that an ethoxy group (CH3CH2O-) is attached to the third carbon atom in the hexane chain.
- "2-methyl" indicates a methyl group (CH3) attached to the second carbon atom in the hexane chain.

Now, let's construct the structural formula:

CH3-CH(CH3)-CH(OCH2CH3)-CH2-CH2-CH3

In this formula:

- The hexane chain is represented by the sequence of CH3, CH, CH, CH2, CH2, and CH3.
- The methyl group (CH3) is attached to the second carbon atom, indicated by the CH in parentheses.
- The ethoxy group (OCH2CH3) is attached to the third carbon atom, shown within the parentheses of the CH(OCH2CH3) part.

I hope this helps you understand the structural formula of 3-ethoxy-2-methylhexane! If you have any more questions, feel free to ask.

30 points!!!!Pls helps ASAP!!!


Describe at least 2 ways in the simulation to change each of the parameters:

a. Volume of solution:

b. Amount of solute:

c. Concentration of solute in solution:

Answers

Two ways to change the parameters in a simulation are changing the volume of the solution and changing the amount of solute. Another way is to change the concentration of solute in solution by adjusting the amount of solute relative to the volume of solution.

Two ways to change the volume of the solution in a simulation are to either add more solvent or remove some solvent from the system.

The amount of solute in a simulation can be changed by adding more solute to the system or removing some solute from the system.

The concentration of solute in a solution can be changed by either adding more solute to the same volume of solvent or by diluting the solution with more solvent to decrease the concentration of the solute.

To know more about Volume of solution:

https://brainly.com/question/14710169

#SPJ4

Which are characteristics of natural selection? Select three options.
It affects populations.
It affects only individuals.
It occurs when there is genetic variation.
Olt occurs when organisms are genetically identical.
O It selects organisms with certain traits to survive.
It selects organisms at random to survive.

I need an answer quick

Answers

Affects populations,
Occurs when there is genetic variation
Selects organisms with certain traits to survive.

how does energy transfer from computer to speaker plz help fasttt​

Answers

Answer:

As the coil moves through the magnetic field, created by the magnet, an electric current flows through it. The electric current flows out from the microphone to a computer or other recording device, and you can hear it. Aspeaker works in almost the same way, except that the process isreversed.

Given the standard enthalpy changes for the following two reactions
Given the standard enthalpy changes for the following two reactions:



(1) 2C(s) + 2H2(g)C2H4(g)...... ΔH° = 52.3 kJ



(2) 2C(s) + 3H2(g)C2H6(g)......ΔH° = -84.7 kJ



what is the standard enthalpy change for the reaction:



(3) C2H4(g) + H2(g)C2H6(g)......ΔH° = ?

Answers

The standard enthalpy change for reaction (3) is 117.1 kJ.

The standard enthalpy change for reaction (3) can be calculated by using the enthalpy changes of reactions (1) and (2) and applying Hess's Law.

To do this, we need to manipulate the given equations so that the desired reaction (3) can be obtained.

First, we reverse reaction (1) to get the formation of C2H4(g) from C2H6(g):

C2H4(g)C2H6(g) ΔH° = -52.3 kJ

Next, we multiply reaction (2) by 2 and reverse it to obtain 2 moles of C2H6(g) reacting to form 3 moles of H2(g):

2C2H6(g)2C(s) + 3H2(g) ΔH° = 169.4 kJ

Now, we add the two modified equations together:

C2H4(g)C2H6(g) ΔH° = -52.3 kJ
2C2H6(g)2C(s) + 3H2(g) ΔH° = 169.4 kJ

When adding these equations, the C2H6(g) on the left side cancels out with the C2H6(g) on the right side, leaving us with the desired reaction (3):

C2H4(g) + H2(g)C2H6(g) ΔH° = -52.3 kJ + 169.4 kJ = 117.1 kJ

Learn more about standard enthalpy here :-

https://brainly.com/question/28303513

#SPJ11

Please help due at 11:00

Please help due at 11:00

Answers

It’ll be x-y !! :)) if you were wondering :3

Name the four types of friction. Provide one example not used in your lesson for each type.

Answers

Friction is the force that opposes motion between any surfaces that are in contact. There are four types of friction: static, sliding, rolling, and fluid friction. Static, sliding, and rolling friction occur between solid surfaces.

2 C8H18 + 25 O2 > 16 CO2 + 18 H2O how many moles of O2 are needed to react fully with 4 moles of octane

Answers

Answer:

100 moles of O2 are needed to react fully with 4 moles of octane.

Explanation:

Answer:

50

Explanation:

To find the number of moles of O2 needed to react fully with 4 moles of octane (C8H18), we need to balance the equation first:

2 C8H18 + 25 O2 -> 16 CO2 + 18 H2O

So, the balanced equation tells us that for every 2 moles of C8H18, 25 moles of O2 are needed. Thus, to react with 4 moles of C8H18, we need 25 * (4/2) = 50 moles of O2.

what conclusions can be drawn about bottled water versus tap water, based on the reading in the textbook?

Answers

The decision between bottled water and tap water is strongly versus by preferences and priorities. Water supply is never a better option than bottled water.

Is vs versus in formal writing?

The use of "against" abbreviations is typically more casual than using the full word. Use the complete term if you need to maintain a formal tone. The word "versus" can always be correctly spelled. Spelling things out is usually an excellent option if you are having trouble remembering which acronym is appropriate for your circumstance.

What does the legal term "people versus ." mean?

The People v. Defendant, the standard case caption in criminal court, casts the local community against a lone accused in an act of collective condemnation. 1. '”). The prosecution is sometimes used to Instead of "the Peoples," the prosecution may be referred to as "the State," "the Province," or "the United States" in various jurisdictions. Consider Orin S.

To know more about versus visit:

https://brainly.com/question/29678996

#SPJ4

How far would Sara get if she ran for 87 minutes at a speed of .125 miles per minute?

Answers

Answer:

10.875 miles

So 87 minutes

.125 miles per minute

So just multiply int his case

87*.125

You’d get 10.875

The density of a gaseous organic compound is 340g/L at 45°C and 1.7atm. what is it's mole​

Answers

To determine the number of moles of the gaseous organic compound, we can use the ideal gas law equation: PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature.

How to calculate ?

First, we need to convert the density to mass per volume. The density of the gas is given as 340g/L. Therefore, the mass of 1 L of the gas is 340 g.

Next, we need to use the ideal gas law to calculate the number of moles. We know that the pressure is 1.7 atm, the temperature is 45°C (which is 318 K), and the volume can be calculated using the density and the molar mass of the compound. The molar mass can be determined from the molecular formula of the compound.

Assuming the compound is a hydrocarbon, we can use an average molar mass of 28. Thus, the volume of 1 mole of the gas can be calculated as follows:

V = (molar mass/density) × 1000 ml/L = (28/340) × 1000 = 82.35 ml/mol

Using the ideal gas law equation and plugging in the given values, we get:

n = (PV) / (RT) = (1.7 atm × 82.35 ml) / (0.0821 L atm/mol K ×318 K) = 0.839 mol

Therefore, the number of moles of the gaseous organic compound is 0.839 mol

To know more about Moles and Molar mass ,visit :

https://brainly.com/question/12007096

#SPJ9

3.Which of the following isotopes should be expected to be radioactive?Select one:a. Ab. Bc. Cd. D

3.Which of the following isotopes should be expected to be radioactive?Select one:a. Ab. Bc. Cd. D

Answers

Explanation:

To find the isotope that is expected to be radioactive we have to compare the given isotopes with the ones that we find the in the periodic table.

(A) Ti:

Isotope ----> atomic mass = 48 atomic number = 22

Periodic table ---> average atomic mass = 47.9 atomic number = 22

(B) Sr:

Isotope ----> atomic mass = 88 atomic number = 38

Periodic table ---> average atomic mass = 87.6 atomic number = 38

(C) Os:

Isotope ----> atomic mass = 192 atomic number = 76

Periodic table ---> average atomic mass = 190.2 atomic number = 76

(D) Pu:

Isotope ----> atomic mass = 244 atomic number = 94

Periodic table ---> average atomic mass = 244 atomic number = 94

If we take a look at them we will see that the only one that is different is osmium. The atomic mass of the isotope is 192 amu, that means that this isotope has 2 more neutrons than the average atom of the element. So we can expect that it could be radioactive.

Answer: C. Os

What is the energy of an object in motion depends on?

Answers

\(\huge\boxed{\fcolorbox{red}{pink}{Answer}}\)

\(\huge\pink{▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬}\)

\(<p style="color:orange;border-width:10px;border-style:solid;border-color:olivedrab;">

The kinetic energy of an object is dependent both the mass of the object and its velocity. where m is the mass of the object; h is the height of the object, and g is the force of gravity acting on the object. This animation shows how energy converts between kinetic and potential energy.

</p>\)

\(\huge\pink{▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬▬}\)

How much of the water (in ml ) contains 150 mg of pb ? (assume a density of 1.0 g/ml .)

Answers

There are 0.15 ml of the water contains 150 mg of Pb .

Calculation ,

Formula used :

density = mass / volume                 ( i )

Given mass of the Pb in milligram ( mg ) = 150 mg

Given mass of the Pb in gram ( g ) = 150 × \(10^{-3}\) = 0.15 gram

Given density = 1.0 g/ml

We have to find volume of water in milliliter ( ml ) .

Putting the value of mass of the Pb , lead and density in equation ( i ) we get the volume of water in milliliter ( ml ) .

density = mass / volume

1.0 g/ml  =  0.15 gram / volume

volume =  0.15 gram / 1.0 g/ml = 0.15 ml

To learn more about density please click here ,

https://brainly.com/question/15164682

#SPJ4

The pressure P (in kilopascals), volume V (in liters), and temperature T (in kelvins) of a mole of an ideal gas are related by the equation PV=8.31T. Find the rate at which the volume is changing when the temperature is 295 K and increasing at a rate of 0.05 K/s and the pressure is 16 and increasing at a rate of 0.02kPa/s. Please show your answers to at least 4 decimal places.
dV/dt =

Answers

The rate at which the volume is changing, represented as dV/dt, is given by the equation (0.4155 - 0.32V(t)) / 16, where V(t) is the volume, and the values are substituted accordingly.

To find the rate at which the volume is changing, we need to differentiate the given equation with respect to time (t) using the chain rule:

PV = 8.31T

Differentiating both sides with respect to time:

P(dV/dt) + V(dP/dt) = 8.31(dT/dt)

We are given:

dT/dt = 0.05 K/s (rate of temperature change)

(dP/dt) = 0.02 kPa/s (rate of pressure change)

P = 16 kPa (initial pressure)

T = 295 K (initial temperature)

Substituting the given values into the equation, we have:

16(dV/dt) + 16V(0.02) = 8.31(0.05)

Simplifying the equation:

16(dV/dt) + 0.32V = 0.4155

Rearranging the equation to solve for dV/dt:

16(dV/dt) = 0.4155 - 0.32V

(dV/dt) = (0.4155 - 0.32V) / 16

To find the rate at which the volume is changing when T = 295 K, we substitute V = V(t) and T = 295 into the equation:

(dV/dt) = (0.4155 - 0.32V(t)) / 16

Calculating the value of (dV/dt) at the given temperature and rounding to at least 4 decimal places will provide the final answer.

learn more about temperature change here:

https://brainly.com/question/31788620

#SPJ11

In the previous step, you determined
0.25 mol HCI reacts. The molar mass
of Mg is 24.31 g/mol.
What mass of Mg is required?


PLEASE HELP ASAP

In the previous step, you determined0.25 mol HCI reacts. The molar massof Mg is 24.31 g/mol.What mass

Answers

Approximately 3.04 grams of magnesium would be required to react with 0.25 moles of hydrochloric acid.

To determine the mass of Mg required, we need to use the balanced chemical equation for the reaction between hydrochloric acid (HCl) and magnesium (Mg):

2HCl + Mg → MgCl2 + H2

From the balanced equation, we can see that 2 moles of HCl react with 1 mole of Mg. Therefore, if 0.25 mol of HCl reacts, we would need half of that amount, which is 0.125 mol of Mg.

To calculate the mass of Mg required, we need to multiply the number of moles of Mg by its molar mass. The molar mass of Mg is given as 24.31 g/mol. Therefore, the mass of Mg required can be calculated as follows:

Mass of Mg = Number of moles of Mg × Molar mass of Mg

Mass of Mg = 0.125 mol × 24.31 g/mol

Mass of Mg = 3.04 g

For such more questions on moles

https://brainly.com/question/19964502

#SPJ8

how many atoms altogether make up one molecule of glucose ​

Answers

Answer:

24 atoms makes altogether a molecule of glucose

All compounds are made of
a. atoms of two or more elements
b. two or more atoms of the same element
c. atoms arranged into a crystal
d. atoms joined by covalent bonds

sorry, guys! last one!

Answers

Answer: a. atoms of two or more elements

For example:H20

Explanation:

D) is a molecule

B) doesn't need to be same element

Answer: a

Explanation:

Which of the following explanations accounts for the fact that the ion-solvent interaction is greater for Li than for K

Answers

Li+ has a smaller ionic radius than K+

and smaller molecules have more collisions/interactions between each other

What is ion-solvent interaction ?

In the case of ion-solvent interactions, the state in which the interac-tions exist is an obvious one; it is the situation in which ions are inside the solvent.

Ions are charged particles, and charges interact with other charges. So there will also be ion-ion, as well as ion-solvent, interactions in the solution.

In the process of solvation, ions are surrounded by a concentric shell of solvent. Solvation is the process of reorganizing solvent and solute molecules into solvation complexes.

Learn more about Ion-solvent interaction here:

https://brainly.com/question/21307101

#SPJ4

Water flows over Niagara Falls at the average rate of 2,400,000 kg/s, and the average height of the falls is about 50 m. Knowing that the gravitational potential energy of falling water per second = mass (kg) × height (m) × gravity (9.8 m/s2), what is the power of Niagara Falls? How many 15 W LED light bulbs could it power?

Answers

Explanation:

It is given that,

Water flows over Niagara Falls at the average rate of 2,400,000 kg/s

The average height of the falls is 50 m

We need to find the power of Niagara Falls.

The gravitational potential energy of falling water is given by :

P = mgh

Power is rate of doing work i.e.

\(P=\dfrac{W}{t}\\\\P=\dfrac{mgh}{t}\\\\P=\dfrac{m}{t}\times gh\)

We have, m/t =  2,400,000 kg/s

So,

\(P=2400000\times 9.8\times 50\\\\P=1.176\times 10^9\ W\)

If the number of bulbs are n that could power 15 W LED, the,

\(n=\dfrac{1.176\times 10^9}{15}\\\\n=78400000\ \text{bulbs}\)

Rescorla performed the following experiment to test the prediction of the Rescorla-Wagner model. Phase 1 A-> 1 food pellet B -> I food pellet Phase 2 ABC -> 1 food pellet According to the Rescorla-Wagner model, what is a possible value for the Cue C (V.) at the end of phase 2?

Answers

According to the Rescorla-Wagner model, a possible value for the Cue C (V) at the end of phase 2 is 0.5.

The Rescorla-Wagner model is a model of classical conditioning that predicts the strength of an association between a conditioned stimulus (CS) and an unconditioned stimulus (US) based on the discrepancy between the predicted and actual outcomes. The model assumes that learning is a gradual process that depends on the strength of the CS-US association and the degree to which the US is surprising.

In the given experiment, during Phase 1, two cues A and B are presented with different levels of association with the US, which is the food pellet. During Phase 2, a new cue C is introduced along with the already conditioned cues A and B.

According to the Rescorla-Wagner model, the total associative strength of the cues during Phase 2 cannot exceed the maximum associative strength that can be supported by the US. As the US is already associated with the cues A and B, the addition of the new cue C means that the total associative strength should be distributed among all the cues.

Learn more about Rescorla-Wagner here:

https://brainly.com/question/30627357

#SPJ4

What is the trend of ionization energy when heading down a column of the periodic table?

Answers

On the periodic table, the ionization energy often decreases as one moves down a group (column). This is due to the fact that there are more energy levels (shells) and valence electrons are located further away from the positively charged nucleus as you progress down a group. As a result, they are not held as firmly and are easier to remove.

Additionally, as the number of energy levels rises, the shielding effect of inner electrons grows, further lowering the effective nuclear charge experienced by the valence electrons and making them simpler to remove.

For instance, due to the stability of the half-filled p-orbitals in Group 13, the first ionization energy of Group 3A (or Group 13) elements, such as boron and aluminium, is higher than that of Group 2A (or Group 2) elements, such as beryllium and magnesium.

Similar to this, the first ionisation energy of Group 6A (or Group 16) elements, such as oxygen and Sulphur, is higher than that of Group 5A (or Group 15) elements, such as nitrogen and phosphorus, because the smaller and more highly charged oxygen and Sulphur atoms exhibit more electron-electron repulsion.

In conclusion, there can be exceptions due to various causes, but the overall trend of ionisation energy when advancing down a group of the periodic table is a decrease due to growing distance between valence electrons and the nucleus and the shielding effect of inner electrons.

To know more about the ionization energy refer here :

https://brainly.com/question/28385102#

#SPJ11

Prompt 3: Describe four ways in which water (H20) is a strange molecule. Then:
A. Discuss what it is about the nature of the water molecule that causes water to behave in these four ways.
B. Explain how each of these strange characteristics is essential to life as we know it.

Answers

Water is a strange molecule, here are the four ways:1. High specific heat2. Density of water3. Hydrogen bonding4. Adhesion and cohesionA. The nature of the water molecule causes water to behave in these four ways because of the properties of the molecule. Water is a dipolar molecule with two negatively charged oxygen atoms and two positively charged hydrogen atoms.

The two hydrogen atoms are bonded to the oxygen atom by a covalent bond, and this bond is polar due to the difference in electronegativity between the atoms.B. The strange characteristics of water are essential to life as we know it in the following ways:1. High specific heat: This allows for water to moderate temperature changes in organisms and is essential for temperature regulation.2. Density of water: This is important for aquatic organisms because it allows them to float and not sink, while still being able to support their weight.

To know more nature visit:

https://brainly.com/question/30406208

#SPJ11

Other Questions
Why is the searching of the houses done by the poorer whites of the community? Every sixth customer at a flower shop receives a free Rose, and every 9th customer receives a free Lilly. Which customer will be the first to receive a free Rolls and free Lilly? A pot of dolphins contains 800 dolphins of various ages and lengths. The median length of dolphins in this pod is 5.8 feet. What information does this tell you about the length of dolphins in this pod? a 1-year call option on the stock, with an exercise price of $22, is available. based on the binomial model, what is the option's value? Which of the following statements are true? A. If A is an mxn matrix and if the equation Ax = bis inconsistent for some b in Rm, then A cannot have apivot position in every row. B. The equation Ax = b is consistent if the augmentedmatrix [ A b ] has a pivot position in every row. C. If the augmented matrix [ A b ] has a pivot positionin every row, then the equation Ax = b is inconsistent. D. Any linear combination of vectors can always bewritten in the form Ax for a suitable matrix A and vectorx. E. The solution set of a linear system whose augmentedmatrix is [ a1 a2 a3 b ] is the same as the solution set ofAx = b, if A = [ a1 a2 a3 ]. F. If the columns of an mxn matrix A span Rm, thenthe equation Ax = b is consistent for each b in Rm. Find the mean, median, and mode for the set of values. 9 6 8 1 3 4 5 2 6 8 4 9 12 3 4 10 7 6 The Invariance Principle predicts that the distribution of talent - and hence competitive balance - will be no different under free agency than it was when players were bound to teams. The above statement is true. The above statement is false. you are anxious to help teenagers fall asleep earlier in the evening. possible (but not necessarily recommended) solutions might include which of the following? Roberto, a toddler, is left with a stranger in a room when his mother leaves for a few minutes. He is very upset and difficult to calm in his mother's absence. When his mother returns, he approaches her but later resists by fighting against being held. According to Ainsworth and her colleagues, Roberto most likely belongs to the ________ attached group.ambivalentlyavoidantlysecurelyindependently memory for skills and habits are not formed in the hippocampus. true false How did the adoption of Shia Islam by the Safavid Empire affect the history of Persia? Military expansions by the Safavid armies opened new trade routes to the west.Military expansions by the Safavid armies opened new trade routes to the west. To encourage study of the Koran, the Safavids introduced the art of printing to Iran.To encourage study of the Koran, the Safavids introduced the art of printing to Iran. The empires attempts to expand Shia territory triggered military attacks from the Ottomans, who were Sunni.The empires attempts to expand Shia territory triggered military attacks from the Ottomans, who were Sunni. The imperial court and religious leaders set up two opposing bureaucracies.The imperial court and religious leaders set up two opposing bureaucracies. FOR BRAINLIEST describe the release of calcium from the sarcoplasmic reticulum, binding of calcium to troponin, actin-binding to myosin, sliding of actin over myosin, ADP, and Pi release from myosin. Joe has an idea for a new mobile restaurant business. He wants to convert an antique bus into a sit-down restaurant with a service window allowing him to serve people within the bus and walk-ups who want to get their food and take it home. Joe takes his idea and looks at the market desirability, the technical feasibility, and the business viability. Joe is performing a(n) Given the following quadratic function in standard form f(x)= -2(x - 1) + 16 answer the questions below.All the numbers in the responses are integers (do not use decimal places). No spaces should appear in any response.Coordinates of the y-intercept: (0,14) Coordinates of the vertex: (1,16) Equation of the axis of symmetry: X=-4/2x(-2) This function has real irrational x-intercepts of the form a bcSolve for the x-intercepts by taking the square root of both sides and enter the correct integer values for a,b,c Scorpio makes premium bikes using two departments, assembly and painting. Assembly estimates using 842,000 machine hours and painting uses 44,000 machine hours. Fixed manufacturing overhead costs are estimated to be $9,000,000 for assembly and $792,000 for painting. Variable manufacturing overhead per machine hour is $11.5 in both departments. Machine hours are used as the allocation base for a plantwide predetermined manufacturing overhead application rate.A bike dealership shop places an order for 20 bikes. The order requires 1,074 machine hours in assembly and 114 machine hours in painting. The job also requires $54,000 of direct materials and $108,000 of direct labor. What is the unit product cost (per bike) for the job when Scorpio uses a plantwide approach to calculating its PDOR? Alice in WonderlandWill mark the brainliestYou are required to write 4-6 paragraphs. You must do the following within the paragraphs:1. Give a small summary of the book, cartoon, and live action movie.2. Decide what the audience is for each: book, cartoon, and live action.3. Compare and contrast the movies and the book. Are there parts of the movie that follow the book more closely? Explain. Give at least 5 details that show how the two versions are alike or different. express the number 2.5x104 in decimal notation. repairs and maintenance expense at the twilight inn were $12,000 and $6,000 for the high and low months of activity, respectively. in the high month, 4,000 rooms were sold, while 1,000 rooms were sold in the low month. if the inn is open year-round, what amount represents the total annual fixed costs for the twilight inn, if the high/low two-point method is used? a photon of energy 113.6 ev ejects an electron from a hydrogen atom in its ground state. what is the kinetic energy in ev of the ejected electron? neglect recoil of the proton. 5. A company with sales of $250,000 anticipates sales growing 3% in the coming year. Receivable days on hand are currently 40 days and are projected to drop to 38 days. What is the projected balance of accounts receivable? C A.$26,027 B.$26,808 C C.$27,397 D.$28,808 6. All of the following steps should be taken when projecting net worth EXCEPT: C A.Project the growth in earnings C B.Project the dividend payout ratio I C.Project anticipated changes in other comprehensive income D.Project growth in capital stock at historical rates