Answer:
b
Explanation:
Common host plants attract tulip tree
I haven't really gotten into much detail about this subject.
Hope this helps!
what ways are cells similar to atoms?
Answer:
The answer is: they are both basic units or building blocks. Atoms are basic building blocks of matter. They join together and form molecules which form most of the things. Cells are basic building blocks of living things. They join together and form tissues which combine with other tissues to form organs, organs to organ systems, and organ systems function together to form an organism. So, cells are the smallest basic units of organisms.
I hope this helps!
please give the correct answer to this question
Answer: Lymphatic system
Explanation:
Not respiratory and excretory for sure.
Not nervous because the diagram doesn't show spinal nerves clearly. So its lymphatic system.
:-)
What is the concern of two organisms filling
the exact same niche in the same
ecosystem?
A. The two organisms will compete.
B. One organism will move to a new niche.
C. Organisms often share niches in symbiosis.
Please help!
Answer:
A..
hope it is correct dear
Mark me BRAINLIEST ❤️❤️❣️❣️❤️❤️
Answer:
organisms often share nitches in symbiisis
at what time should we definitely seek shade to avoid sun exposure? between 6am and 8am between 8am and 10am between 10am and 4pm between 4pm and 10pm
SCIENCE. PLEASE HELP!!!!
Answer:
Between 10am and 4pm
Explanation:
This is when the sun is at its higest point, allowing it to radiate more UV rays on your skin.
Answer:
during the time btw 10 am to 4 pm because sun is scorching at that time so you should seek shade btw this time
The graphic below shows an unlabeled animal cell. In which location would genetic material most likely be found?
Answer:
Nuclues.
Explanation:
The nucleus holds the genetic information.
Trace what happens to a piece of bread as it enters the mouth to the large intestine. Be sure to mention each organ of the digestive system and what happens to the bread in each part.( This is an essay question )put in high school level)
Answer:
The mechanical digestion begins with the with and the tongue whch breaks the bread,press it staging the soft palate Chemical digestion follows with the saliva-enzyme salivary amylase. The enzymes acts on starch in the bread and converts this to Maltose.A diassacharides , and oligosaccharides This ends CHO digestion in the mouth.
The digesting bread is push by waves of contraction of the horizontal and vertical muscles of the oesophagus.This wavelike contractions is called Peristalsis.
This is push down into the stomach through the opening of the upper sphincter.In the stomach the pH of the amylase enzyme in the bread now called chyle is reduced(neutralized) by the HCL of the medium.No digestion occurs in the stomach.
In the small intestine is the enzyme pancreatic Maltase,secreted from the pancreas.This enzyme catalysis the hydrolysis of the maltose ( diasaccharides,) to some monosaccharides subunits.At this stage the digesting bread is called chyme,with its maltose content.
Still in the small intestine maltase(from the epithelial brush borders of the small intestine) converts the hydrolysis of maltose to the sub units of glucose,fructose, and galactose,making the end of CHO digestions in the small intestine.
The large intestine is for absorption of water and storage and removal of undigested foods from the body.It is made up of the cecum, colon, rectum and anus.As unwanted food passes through this.,massive water absorption occurs, it contents and structure is change to stool as it escapes through the anus, as faeces.
Explanation:
After vigorous exercise, the muscles involved show a marked the increase in the concentration of
A. glucose
B. glycogen
C. lactic acid
D. citric acid
31. The type of immunity that occurs when the body makes its own
antibodies is __________ immunity
Answer:
passive immunity is the type of immunity inborn
Zara had a birthday and was able to choose a pet. The pet that she chose was a beautiful clownfish named Bozo, a common salt water fish. Zara already has a tank with goldfish at home. Use your knowledge of diffusion & osmosis to tell Zara how to take care of Bozo.
Answer:
See the answer below
Explanation:
Zara should keep Bozo in a separate salt water-containing tank away from the goldfish.
Bozo is adapted to living in salt waters. If it is kept in saltless water like the goldfish, its cells would lyse and the fish may die. The saltless water would be hypotonic to the cells of Bozo and water moves osmotically from a region of high water potential to a region of low water potential. Hence, the cells of Bozo would take-in water, become turgid, and may eventually lyse, leading to the death of the fish.
The goldfish cannot survive in salt water with Bozo because the water would be hypertonic to its cells. Hence, it will lose water to the surrounding salt water due to osmosis and may eventually die of dehydration.
Answer:
ratio
Explanation:
Which codon is the code for the amino acid histidine (His)
Messenger
Second base in codon
RNA Codons
U
С
A
G
UUU UCU
Phel
UAU UGU U
UUC)
UCC UAC)
Tyr
U
UGC)
Cys
Ser
C
UUA UCA
Leu
UAA Stop UGA Stop A
UUG
UCG
UAG Stop UGG Trp G
CUU CCU
CAU
U
CGU
CUC ССС
His
CAC) CGC
Leu Pro
с
CCA
Arg
CAA1
CUG
CGA
Gin
CCG CAG CGG
AUU ACU
AAU
AUC)lle ACC
Asn Ser
AAC) AGC
Thr
AUA
ACA AAA
AUG Start Me ACG
AGA
Lys Arg
AAG AGG
GUU GCU GAU1 GGU
GUC GCC
Asp
GAC) GGC
G
Val
Ala
GUA
GCA
Gly
GAA
Glu
GGA
GUG
GCG GAG) GGG
First base in codon
CUA
Third base in codon
AGU
A. CAA
B. UAC
Ο Ο Ο Ο
C. AAC
D. CAU
Answer:
The codon that codes for the amino acid histidine (His) is CAC. Therefore, the correct answer is D. CAU.
if you cut into an intact kidney with a scalpel on the side opposite the hilum which kidney structure would you cut first?b
when you cut into an intact Kidney on the side opposite the hilum, you will first encounter the renal cortex, which plays a vital role in filtering blood, forming urine, and maintaining electrolyte balance.
When cutting into an intact kidney with a scalpel on the side opposite the hilum, the first kidney structure you would encounter is the renal cortex. Here's a step-by-step explanation:
1. Kidney structure: The kidney is composed of several layers and structures, including the renal capsule, renal cortex, renal medulla, and renal pelvis.
2. Renal capsule: The outermost layer, which surrounds the entire kidney, providing protection and support.
3. Renal cortex: Located just beneath the renal capsule, it is the first kidney structure you would cut into on the side opposite the hilum.
4. Renal medulla: Deeper within the kidney, the medulla consists of cone-shaped structures called renal pyramids.
5. Renal pelvis: A central cavity that collects urine produced by the nephrons, funneling it into the ureter for excretion.
So, when you cut into an intact kidney on the side opposite the hilum, you will first encounter the renal cortex, which plays a vital role in filtering blood, forming urine, and maintaining electrolyte balance.
To Learn More ABout Kidney
https://brainly.com/question/13742966
SPJ11
During the Dutch Fork vs Irmo softball game, Bobby tore a connective tissue that attaches his thigh bone to his hip-bone. Which tissue was affected?
What’s the most significant greenhouse gas increase
Answer:
Carbon dioxide (CO2) is the primary greenhouse gas emitted through human activities.
I will give brainliest
Answer:
A rust mite is a multicellular organism because it has complicated specialized parts.
Which indicates how evidence of climate change supports the theory of continental drift?
coalfields in several continents
volcano formation
giac al evidence found in South America
folded mountains in Africa and South America
Answer: Glacier evidence
Explanation:
I hope this helped you
Answer:
The answer is C.) on edge 2022. Glacial evidence.
Explanation:
Why do chromosomes in body cells exist in pairs?
OA.
because chromosomes group together to fit into the small space of a cell
ОВ.
because each parent contributes one of each type of chromosome to its offspring
OC.
because chromosomes from one parent must remain separate from those of the other
OD.
because each chromosome is duplicated when an organism is born
Answer:
B
Explanation:
Each chromosome comes from each parent during reproduction/sex
Which are some characteristics of adaptive social behavior? Select three options.
The Answers are
A.)occurs among members of the same species
C.)is determined by natural selection
D.)increases an animal's likelihood of reproducing
what is the minimum number of microbes that must enter the body to cause infection? multiple choice question. lethal dose infectious dose equivalent dose effective dose
The minimum number of microbes that must enter the body to cause infection can vary depending on the specific microbe and the susceptibility of the individual. This is known as the infectious dose (ID). Therefore the correct option is option B.
The infectious dose is crucial since it influences how likely it is that a person may contract the disease. A pathogen with a low infectious dose, for instance, suggests that only a few microorganisms are required to generate an infection. On the other hand, a disease with a high infectious dosage requires a lot of microorganisms to infect a person.
"Infectious dose" is the appropriate response to the multiple-choice question. The words equivalent dose and effective dose are used in relation to radiation exposure, whereas the lethal dose refers to the quantity of a drug that is fatal to a specific proportion of the population.
For such more question on microbes:
https://brainly.com/question/8695285
#SPJ11
If a baby is born prematurely before type II cells produce sufficient pulmonary surfactant, which of the following might you expect? a. difficulty expressing fluid b. difficulty inflating the lungs c. difficulty with pulmonary capillary flow d. no difficulty as type I cells can provide enough surfactant for normal breathing
Premature birth causes pulmonary inflation difficulties because type II cells are unable to create enough pulmonary surfactant.
What use does pulmonary surfactant serve?It is known that pulmonary surfactant lowers surface tension in the alveoli at the air-water interface, limiting the collapse of these structures at end-expiration. Surfactant lessens the effort required for breathing in this way.
How can surfactant stop the collapse of the lungs?The lung cells exude surfactant, which distributes throughout the alveolar tissue. This chemical reduces surface tension, which facilitates easy breathing by preventing the collapse of the alveoli following exhalation. A complex mixture of proteins and phospholipids called pulmonary surfactant works to lower surface tension at the alveolar-air interface, preventing atelectasis.
To know more about pulmonary inflation visit:-
https://brainly.com/question/13252446
#SPJ4
an engine cut-off lanyard helps to reduce the risk of what?
An engine cut-off lanyard helps to reduce the risk of striking a person in the water with a propeller. The correct answer is option 2.
A propeller is a device with rotating blades that is used to propel a vehicle through a fluid, such as air or water. In the context of boating, a propeller is a rotating device that is attached to an engine and used to propel a boat through the water.
An engine cut-off lanyard is a safety device that is attached to the operator of a boat and to the engine's kill switch. If the operator is thrown from the boat, the lanyard will pull the kill switch, stopping the engine and preventing the propeller from causing injury to the operator or others in the water.
Therefore, an engine cut-off lanyard is an important safety feature that can help prevent accidents and injuries on the water. Option 2 is the correct answer.
Learn more about propeller here:
https://brainly.com/question/2285161
#SPJ4
The given question is incomplete. The complete question is:
An engine cut-off lanyard helps to reduce the risk of what?
1. Stopping the engine if the oil level gets low·
2. Striking a person in the water with a propeller·
3. Starting the engine without proper choke applied·
4. Over-revving an outboard engine at idle
A section that divides the body on the longitudinal plane into equal right and left parts is called:
A) median (midsagittal)
B) frontal
C) transverse
D) oblique
E) coronal
The median or midsagittal plane is a section that divides the body on the longitudinal plane into equal right and left parts.
Body planes are imaginary geometric planes that are used to decide the orientation of different bodily structures in zoological anatomy.
Median (midsagittal) - longitudinal plane into equal right and left parts. Frontal - divides the body or any of its parts into anterior and posterior portionsTransverse - divides the body into superior and inferior parts Oblique - Divides the body at an angle. The coronal - a vertical line divides the body into 2 sections ventral or dorsal.The frontal and the coronal are considered the same planes. Thus, the correct answer would be - median or midsagittal section or plane.
Learn more about anatomical planes:
https://brainly.com/question/18050354
Drag each tile to the correct box.
Put the stages of the nitrogen cycle in their correct order.
Fixation or volatilization, mineralization, nitrification, immobilization, and denitrification.
The sequence is as follow: Fixation, Nitrification, Assimilation, Ammonification and Dentrification.
What is a nitrogen cycle?The nitrogen cycle is the process by which nitrogen is converted into different chemical forms and moves between the biosphere, atmosphere, and geosphere. The stages of the nitrogen cycle, in order, are:
Nitrogen fixation: Nitrogen gas in the atmosphere is converted into a usable form, such as ammonia or nitrite, by nitrogen-fixing bacteria.
Nitrification: Ammonia or nitrite is converted into nitrate by nitrifying bacteria.
Assimilation: Nitrate is taken up by plants and converted into organic nitrogen compounds, such as proteins and nucleic acids, through the process of assimilation.
Ammonification: Organic nitrogen compounds are broken down by decomposers, such as bacteria and fungi, into ammonia or amino acids.
Denitrification: Ammonia or nitrite is converted back into nitrogen gas by denitrifying bacteria, completing the cycle.
Learn more about nitrogen cycle, here:
https://brainly.com/question/1615727
#SPJ2
design a controlled experiment to determine whether earthworms change the forest ecosystem. identify the environmental factor you will measure, state the specific hypothesis you will test, and design a procedure for collecting data accurately.
Hypothesis for a controlled experiment to determine whether earthworms change the forest ecosystem, The soil's PH will drastically change after the worms consume the leaf litter in a closed container filled with soil.
A number of plots of deciduous forest land would be the subject of an investigation in a controlled experiment to ascertain the effects of the new invasive worm. To make it easier to create artificial ecosystems in a lab, each plot should have boundaries that are limited. There ought to be three main groups: one without any worms, one with only native worms, and one with worms from both native and exotic species. similar circumstances ought to be applied to every individual plot: the same number of trees, the same amount of initial leaf litter, and the same amount of precipitation. The mass of the leaf litter should be taken at the conclusion of the experiment and compared to the initial mass. The plot with the exotic worms is anticipated to have the least amount of leaf litter compared to the other plots. The premise is: The amount of leaf litter that remains at the end of a season in a plot with only the native worm species will be significantly less if an exotic worm species is introduced into a deciduous forest ecosystem. To guarantee accurate results, multiple trials should be carried out.
know more about forest ecosystems here: https://brainly.com/question/24258058
#SPJ4
Which statements best describe the two methods of reproduction?
Method Y is sexual reproduction which produces offspring that are genetically different. Method Z is asexual reproduction which produces offspring that are genetically alike.
А
B
Method Y is asexual reproduction which produces offspring that are genetically different Method Z is sexual reproduction which produces offspring that are genetically alike.
с
Method Y is asexual reproduction that produces offspring which are genetically alike. Method Z is sexual reproduction which produces offspring that are genetically different
D
Method Y is sexual reproduction that produces offspring which are genetically alike. Method Z is asexual reproduction which produces offspring that are genetically different
Answer:
Is it C???
Explanation:
A company is growing algae in big tanks to make fish food. However, the algae is not growing very quickly, and they suspect either phosphorus, nitrogen, or iron is limiting. What could the company do to figure out which nutrient is limiting?a)Add phosphorus to one tank, nitrogen to another, and iron to a third, and see which treatment increases algal growth.b)Add phosphorus, iron, and nitrogen to all tanks, and see which nutrient increases algal growth.c)Add phosphorus to all tanks, because phosphorus is the nutrient that limits algal growth.d)Add nitrogen to all tanks, because nitrogen is the nutrient that limits algal growth.
Experiment
In this experiment, as the question the investigators are trying to answer is what component is the limiting one, it is necessary to test every one of them, independently. Therefore, the best option is to change the concentration of one of them and leave the rest unchanged. To accomplish this, would be necessary three different tanks, one for phosphorus, one for iron, and one for nitrogen (option A).
To determine which nutrient is limiting algal growth, the company can add phosphorus to one tank, nitrogen to another, and iron to a third, and see which treatment increases algal growth. Therefore, option A is correct.
By adding each nutrient separately to different tanks and observing the effects on algal growth, the company can identify which nutrient is limiting. If the addition of phosphorus to one tank leads to increased algal growth, it suggests that phosphorus was the limiting nutrient.
Similarly, if the addition of nitrogen or iron to their respective tanks results in increased algal growth, it indicates that nitrogen or iron, respectively, was the limiting nutrient. Thus, option A is correct.
Learn more about algal growth, here:
https://brainly.com/question/1224669
#SPJ6
Give the word and chemical equations for respiration and photosynthesis
Answer:
PHOTOSYNTHESIS
carbon dioxide(CO2)+water(H2O)+sun light in the presence of chlorophyll(C55H72O5N4Mg)⇒glucose(C6H12O6)+oxygen(O2)+ATP(energy)
RESPIRATION
Glucose(C6H12O6)+Oxygen(O2)⇒carbon dioxide(CO2)+water(H2O)+oxtgen(O2)
Explanation:
I HOPE THIS WILL HELP YOU :)
WHAT AARE UNICELLULAR ORGANISM
Answer:
Unicellular organisms are made up of only one cell that carries out all of the functions needed by the organism
Answer:
A unicellular organism, sometimes known as a single-celled organism, is a single-cell creature, as opposed to a multicellular organism, which has many cells. Prokaryotic organisms and eukaryotic organisms are the two types of unicellular creatures.
-------------------------------
hope it helps...
have a great day!
ANSWER ASAPP
Explain the movement of particles in each state of matter.
Answer:
Gas:
assumes the shape and volume of its container ; particles can move past one anothercompressible ; lots of free space between particlesflows easily ; particles can move past one anotherLiquid:
assumes the shape of the part of the container which it occupies ; particles can move/slide past one anothernot easily compressible ; little free space between particlesflows easily ; particles can move/slide past one anotherSolid:
retains a fixed volume and shape; rigid - particles locked into placenot easily compressible ; little free space between particlesdoes not flow easily ; rigid - particles cannot move/slide past one anotherParticles in a:
1. gas are well separated with no regular arrangement.
2. liquid are close together with no regular arrangement.
3. solid are tightly packed, usually in a regular pattern.
Particles in a:
1. gas vibrate and move freely at high speeds.
2.liquid vibrate, move about, and slide past each other.
3. solid vibrate (jiggle) but generally do not move from place to place
hope that this helps :)
1) What is the rationale for experimental ablation method?
2) Explain the significance of the sham-lesion procedure.
2a) Explain how the activity of a brain region can be temporarily inactivated.
4) Compare and contrast the visual functions of rods and cones.
4a) Explain how the receptor potential produced in a photoreceptor by light generates action potentials within the retina.
6) Compare the anatomy and function of the dorsal and ventral streams.
6a) Describe the physical and psychological properties of sound.
7) Describe how the organ of Corti transduces sound waves into electrical potentials.
7a) Describe the neural pathways by which auditory signals for audition reach the cortex.
8) Explain how the brain codes for the spatial location of sound.
1) The experimental ablation method is a way of demonstrating the function of a particular brain region by removing it or inactivating it temporarily or permanently.
2) The sham-lesion procedure involves a similar surgical procedure to that of an ablation but without damaging the target area.
2a) Inactivation of a brain region involves the use of a drug or some other agent to temporarily disable or block activity within a particular region of the brain.
4) Rod cells are the primary photoreceptors for low-light conditions and are found in the outermost layer of the retina
4a) The generation of action potentials in the retina begins when a photon of light strikes a photoreceptor cell.
6) The dorsal stream is responsible for processing the object's location and motion.
6a) Sound is a physical phenomenon that is produced by the vibration of an object.
7) The organ of Corti is the sensory organ in the inner ear that is responsible for transducing sound waves into electrical potentials.
7a) The neural pathways by which auditory signals for audition reach the cortex begin in the cochlea.
8) The brain codes for the spatial location of sound by using several cues, including interaural time differences, interaural level differences, and spectral cues.
1) The rationale for this technique is that by making an animal brain-damaged in some particular region, researchers can learn more about how that region is involved in behavior. The major advantage of experimental ablation is that researchers can gain insights into what a particular brain region does by examining how a damaged brain differs from a normal one.
2) The purpose of this procedure is to create a control group with identical surgery minus the removal or inactivation of the target region. This allows researchers to control for any nonspecific effects of the surgical process.
2a) For instance, the drug muscimol, which is a GABA agonist, can be used to temporarily inactivate a specific brain area by binding to GABA receptors in that area.
4)Cone cells are photoreceptors that are responsible for color vision, visual acuity, and are found in the center of the retina. Rods are more sensitive to light than cones, and they provide better vision in dim light, while cones provide better vision in bright light.
4)The resulting receptor potential then travels from the photoreceptor cell to the bipolar cell, where it is further amplified. The resulting signal is then transmitted to the ganglion cell, which generates an action potential.
6)It sends information from the occipital lobe to the parietal lobe. In contrast, the ventral stream processes object recognition, sending information from the occipital lobe to the temporal lobe.
6a)The sound waves are propagated through a medium such as air, water, or a solid. The psychological properties of sound include pitch, loudness, and timbre.
7)When the basilar membrane vibrates in response to sound waves, the hair cells in the organ of Corti are also set into motion, generating an electrical signal that is transmitted to the brain.
7a) The auditory nerve carries information from the cochlea to the brainstem, where it is processed and sent to the thalamus. From the thalamus, the information is relayed to the auditory cortex in the temporal lobe.
8)The auditory cortex integrates these different cues to determine the location of a sound in space.
Learn more about experimental ablation at
https://brainly.com/question/31435659
#SPJ11
Plant cells have cell walls, but animal cells don’t. Why might that be?
Answer:
plant cell need cell wall whereas animal cell do not because the plants need rigid structure so that they can grow up and out. Cells have cell membrane. The membranes can flex. Animal cells can have varios shapes, but plant cells only have the shapes of plant cell wall.
Explanation: