sulfur, s8, combines with oxygen at elevated temperatures to form sulfur dioxide. if 240 oxygen molecules are used up in this reaction, how many sulfur molecules reacted?
The equation must have the following form to be balanced: 4CO2 + 2H2O = 2C2H2 + 5O2
S8: O2 = 1/8; S8 utilized = 240/8 = 30SO2 generated is equal to the number of sulphur molecules used, which is 240. Stoichiometry is the name given to the study of chemical processes in mathematics. Numerous calculations can be done, such as stoichiometry, which is most usually performed with moles but can also be done with masses and even percentages. Stoichiometric ratio A stoichiometric ratio is important when considering the interactions between specific elements or molecules. This exact ratio of reactant to product coefficients is necessary for a reaction to occur properly. Let's discuss some problems you can run across when you learn about stoichiometry. Chemical Equations in Balance Equations needing to be balanced is a fairly common stoichiometric issue type. This is an essential chemistry skill since a reaction can only occur if the ratio of reactants to products is correct.possess. Additionally, it provides an essential framework for organic chemistry. Balance the ensuing reply: _ CO2 + _ H2O C2H2 + _ O2 To be balanced, equations must have an equal number of each element on both sides of the reaction. Before balancing the oxygen, you can start by balancing the carbons and hydrogens. The equation must have the following form to be balanced: 4CO2 + 2H2O = 2C2H2 + 5O2
Learn more about Carbons here:
brainly.com/question/22530423
#SPJ4
How many positively charged nucleons are in an atom of ^50 24Cr?
Answer:
positively charged nucleons are 24
Explanation:
Given element:
₂₄⁵⁰ Cr
The superscript before the symbol of the atoms is mass number
The subscript before the symbol is the atomic number
Cr is the symbol of the atom
Now,
Atomic number is the number of protons in an atom.
The protons are the positively charged particles in an atom.
For this specie, the positively charged nucleons are 24
Ag+ is the Lewis ______
following reaction.
Ag+ (aq) + 2NH3(aq) = Ag (NH3)2 (aq)
=
A
base
B
acid
Ag^+ is an example of a Lewis acid.
What is a Lewis acid?According to the Lewis theory, a Lewis acid is any species that has an electron-deficient center or "hole" that can attract and accept a pair of electrons from a Lewis base. This electron-pair donation can result in the formation of a coordinate covalent bond between the Lewis acid and the Lewis base.
The concept of Lewis acids and bases is important in many areas of chemistry, including coordination chemistry, organometallic chemistry, and catalysis. It provides a useful framework for understanding chemical reactions and interactions between molecules in a wide range of chemical systems.
Learn more about Lewis acid:https://brainly.com/question/15570523
#SPJ1
When 496. 5 grams of Pb(NO3)2 reacts completely with KBr, how much will the
total mass of the products be? Explain your answer.
Mass mass problem - mass of reactant to mass of product
The total mass of the products is 853.8 g.
What is the total mass of the products?We know that we have to apply the principles of stoichiometry so as to be able to obtain the mass of the mass of the products and then the total mass of the products that is obtained in the reaction.
We have that in the question; 496. 5 grams of lead II nitrate reacts with potassium bromide is such a way that the lead II nitrate would be completely consumed in the reaction. This means that the lead II nitrate is the limiting reactant in the reaction.
Number of moles of the lead II nitrate = 496. 5 grams /331 g/mol
= 1.5 moles
If 1 mole of lead II nitrate produces 1 mole of lead II bromide
Mass of lead II bromide produced = 1.5 moles * 367 g/mol
= 550.5 g
If 1 mole of lead II nitrate produces 2 moles of potassium nitrate
1.5 moles of lead II nitrate produces 1.5 * 2 /1
= 3 moles of potassium nitrate
Mass of potassium nitrate = 3 moles * 101.1
= 303.3 g
Total mass produced = 550.5 g + 303.3 g
= 853.8 g
Learn more about stoichiometry:https://brainly.com/question/9743981
#SPJ1
Calculate the pH of a 0.25 M solution of NaNO2 (Ka(HNO2) = 4.5 x 10^-4) (1.97)
a) pH = 3.35
b) pH = 4.45
c) pH = 5.55
d) pH = 6.65
The pH of a 0.25 M solution of NaNO2= 6.65.
Given the concentration of NaNO2, we can find the concentration of NaOH and HNO2 as follows:
NaNO2 = 0.25 MNaOH = HNO2 = x
(since they have equal concentrations due to the stoichiometry of the reaction)
Thus, we can write the equilibrium constant expression as:
Ka = x^2/0.25
Now, let's solve for x:
x^2 = 0.25 x 4.5 x 10^-4x = √(0.25 x 4.5 x 10^-4) = 0.015
This value represents the concentration of both HNO2 and NaOH. Since we are interested in pH, we need to find the concentration of H+ ions using the following equation:
Kw = [H+][OH-]
Since we have found the concentration of OH- (which is the same as the concentration of NaOH),
we can solve for H+:
Kw = 1.0 x 10^-14[H+][0.015] = 1.0 x 10^-14[H+] = 6.7 x 10^-13
Finally, we can find pH:
pH = -log[H+]pH = -log(6.7 x 10^-13)pH = 6.65
Therefore, the correct option is d) pH = 6.65.
learn more about pH here
https://brainly.com/question/172153
#SPJ11
A chemist must prepare of hydrochloric acid solution with a pH of at . He will do this in three steps:
The volume of concentrated Hydrochloric acid that the chemist must measure out in the second step is 1.7 ml.
A chemist has to make 550.0 mL of 1.60 pH hydrochloric acid solution at 25 °C. He'll accomplish this in three stages: Distilled water should fill a 550.0 mL volumetric flask nearly halfway. A little amount of concentrated (8.0 M) stock hydrochloric acid solution should be measured out and added to the flask. Add enough distilled water to the flask to reach the mark.
Step 1: Calculate [H⁺] in the dilute solution
We will use the following expression.
pH = -log [H⁺]
[H⁺] = antilog - pH = antilog -1.60 = 0.0251 M
Since \(HCl\) is a strong monoprotic acid, the concentration of \(HCl\) in the dilute solution is 0.0251 M.
Step 2: Calculate the volume of the concentrated \(HCl\) solution:
To prepare 550.0 mL of a 0.0251 M \(HCl\) solution, calculate the volume of the 8.0 M solution using the dilution rule:
C₁ × V₁ = C₂ × V₂
V₁ = C₂ × V₂/C₁
V₁ = 0.0251 M × 550.0 mL/8.0 M = 1.7 mL
Learn more about Monoprotic acid:
https://brainly.com/question/22497931
#SPJ4
The complete question is:
A chemist must prepare of hydrochloric acid solution with a pH of at . He will do this in three steps: Fill a volumetric flask about halfway with distilled water. Measure out a small volume of concentrated () stock hydrochloric acid solution and add it to the flask. Fill the flask to the mark with distilled water. Calculate the volume of concentrated hydrochloric acid that the chemist must measure out in the second step. Round your answer to significant digits.
Laboratory thermometers should be Group of answer choices used only for the temperature range graduated on the thermometer shaken down before use immersed completely in the substance whose temperature is being measured cooled after use in cold tap water
The laboratory thermometers should be Group of answer choices shaken down before use. This is the main answer. Below of laboratory thermometers.Laboratory thermometers are devices that are utilized to measure the temperature of a substance in a laboratory.
They are used in a variety of laboratory applications. These thermometers must be handled with care and kept in good working order in order to provide accurate temperature measurements.Laboratory thermometers come in a variety of sizes and shapes, each designed to meet specific temperature measurement needs. They are made of a glass tube with a bulb at one end, and are designed to be shaken down before use. This is done to make sure the mercury or alcohol is all at the bottom of the tube.Immersion of the thermometer completely in the substance whose temperature is being measured is required.
The immersion must be complete and the thermometer should not touch the sides or bottom of the container. The temperature of the substance is measured when the mercury or alcohol has stabilized.Cooling the thermometer after use in cold tap water helps to reduce the stress on the glass from thermal expansion and contraction. This, in turn, helps to extend the life of the thermometer. The thermometer should be carefully handled to avoid breakage.
learn more about laboratory thermometers
https://brainly.com/question/27892710
#SPJ11
Please answer the following question using the data below: H2O vapor content: 13 grams H2O vapor capacity: 52 grams at 25 degrees Celsius 13 grams at 10 ∘
C 52 grams at 30 ∘
C What is the dew point for the conditions listed above? LCL 3π5 25C Relative Humidity =100%
Given data:H2O vapor content: 13 gramsH2O vapor capacity: 52 grams at 25 degrees Celsius 13 grams at 10∘C52 grams at 30∘CFormula used to find the dew point:$$\dfrac{13}{52}=\dfrac{(A*3\pi)/(ln100)}{(17.27-A)}$$$$\frac{1}{4}=\dfrac{(A*3\pi)/(ln100)}{(17.27-A)}$$
Where A is the constantDew Point:It is the temperature at which air becomes saturated with water vapor when the temperature drops to a point where dew, frost or ice forms. To solve this question, substitute the given data into the formula.$$13/52=\dfrac{(A*3\pi)/(ln100)}{(17.27-A)}$$$$13(17.27-A)=3\pi A(ln100)$$By simplifying the above expression, we get$$A^2-17.27A+64.78=0$$Using the quadratic formula, we get$$A=9.9,7.4$$
The dew point is 7.4 since it is less than 10°C.More than 100:The term "More than 100" has not been used in the question provided.
To know more about temperature visit:
https://brainly.com/question/7510619
#SPJ11
Help me answer these questions
Answer:
3.
a.climate
4.
c.average measurements of temperature and rainfall over many years
The Ka value for acetic acid, CH3COOH(aq), is 1.8x10^-5. Calculate the ph of a 2.80 M acetic acid solution.
PH=
Calculate the ph of the resulting solution when 3.00 mL of the 2.80 M acetic acid is diluted to make a 250.0 mL solution.
PH=
Answers are not 4.6 or 3.8
The pH of the solution containing 2.80 M acetic acid is 2.34.
Given, The Ka value for acetic acid, CH3COOH(aq), is 1.8x10^-5.Molar concentration of acetic acid, CH3COOH(aq), is 2.80 M.
Step 1 The equation for the ionization of acetic acid is as follows.CH3COOH(aq) + H2O(l) ⇆ H3O+(aq) + CH3COO-(aq)
Step 2Expression for Ka isKa = [H3O+][CH3COO-]/[CH3COOH(aq)]1.8 x 10-5 = [H3O+][CH3COO-]/2.80[H3O+] = √(Ka [CH3COOH(aq)]) = √(1.8 x 10-5 x 2.80) = 0.00462 M
Step 3pH = -log[H3O+] = -log(0.00462) = 2.34
So, the pH of the solution containing 2.80 M acetic acid is 2.34.
Acetic acid (CH3COOH) is a weak acid with a Ka value of 1.8x10⁻.
By utilizing this Ka value and the molar concentration of acetic acid, the pH of a 2.80 M acetic acid solution can be calculated.
Using the equation Ka = [H3O+][CH3COO-]/[CH3COOH(aq)], and after simplifying,
it can be determined that [H3O+] = √(Ka [CH3COOH(aq)]).
After substituting the values for Ka and [CH3COOH(aq)], [H3O+] is found to be 0.00462 M.
Finally, pH can be calculated by the expression pH = -log[H3O+], and we obtain the answer of pH=2.34.
To know more about acetic acid visit:
brainly.com/question/15202177
#SPJ11
Information about how a chemical reacts under high pressure can be found in the ""reactivity"" section of a msds. True or false?.
Information about how a chemical reacts under high pressure can be found in the "reactivity" section of a MSDS: True.
What is MSDS?MSDS is an abbreviation for Material Safety Data Sheet and it can be defined as a text-based document which is designed and developed to provide more information with respect to the chemical and physical properties of an equipment, chemical compound, or substance, based on the following:
ReactivityFlammabilityTemperatureRadioactivityIn this context, we can infer and logically deduce that it is true that the information about how a chemical react would under high pressure can be found in the "reactivity" section of a Material Safety Data Sheet (MSDS).
Read more on Material Safety Data Sheet here: https://brainly.com/question/3282390
#SPJ1
8.) a solution is made where 0.878 moles hcl is added to water that has a total volume of solution of 1855ml. what is the ph of the solution. hcl(aq) → h (aq) cl−(aq)
The pH of the HCl solution made by adding 0.878 moles HCl to water that has a total volume of a solution of 1855ml is 0.33.
To find the pH of the solution, follow these steps:
1. Calculate the concentration of HCl in the solution: Divide the moles of HCl by the volume of the solution in liters.
0.878 moles HCl / (1855 mL * 0.001 L/mL) = 0.473 M (molar concentration)
2. Since HCl is a strong acid, it will dissociate completely in water to form \(H^+\) ions and \(Cl^-\) ions:
HCl(aq) → \(H^+\)(aq) + \(Cl^-\)(aq)
3. The concentration of \(Cl^-\) ions in the solution will be equal to the concentration of HCl since it dissociates completely:
[ \(Cl^-\)] = 0.473 M
4. Use the formula for pH to find the pH of the solution:
pH = - \(log_{10}\) [ \(Cl^-\)]
pH = - \(log_{10}\) (0.473)
5. Calculate the pH:
pH ≈ 0.33
Therefore, the pH of the solution is approximately 0.33.
To learn more about solution refer: https://brainly.com/question/12729588
#SPJ11
Which statements correctly describe chemical reactions? Select all that apply.
Answer:
The statements that correctly describe chemical reactions are
A. If the reactants include 5 atoms of Fe, then the products must include 5 atoms of Fe.
C. If the reactants include an aluminum atom, then the products must include an aluminum atom.
E. If there are a total of 15 atoms in the reactants, there must be a total of 15 atoms in the product.
Explanation:
In a chemical reaction, reactants are the elements or compounds that react to give a particular product(s). The reactants are the substances that start the chemical reaction and they are found at the left hand side of the chemical equation. While the products are found at the right hand side of the chemical equation and they are seen at the end of the reaction.
In chemical reaction, the number of atoms that starts the reaction remains the same. That is the same number of atoms is seen in the products. This follows the law of conservation of matter - which postulates that matter cannot be created or destroyed.
But in a chemical reaction, number of molecules are not conserved.
The statements that correctly describe chemical reactions are:
A. If the reactants include 5 atoms of Fe, then the products must include 5 atoms of Fe.
C. If the reactants include an aluminum atom, then the products must include an aluminum atom.
E. If there are a total of 15 atoms in the reactants, there must be a total of 15 atoms in the product.
Chemical Reaction:A chemical reaction is a process in which one or more substances, also called reactants, are converted to one or more different substances, known as products. If a physical change occurs, the physical properties of a substance will change, but its chemical identity will remain the same.
Thus, the statements that are true for a chemical reactions are A, C and E.
Find more information about Chemical reaction here: brainly.com/question/26018275
An atom moving at its root mean square velocity at 100. °c has a wavelength of. Which atom is it? assume that the atom is the most abundant isotope of an element.
The atom that moves at its rms velocity at 100°C with a wavelength of 2.31 * 10 m is : SULPHUR ( s )
Determine the molar mass of the atomTo determine the atom we will have to determine the molar mass of the atom
Applying De Broglie equation
λ = h / mv
Vrms = \(\sqrt{\frac{3RT}{M} }\) ---- ( 1 )
Where : λ = 2.31 * 10⁻¹¹, R = 8.314 J / k.mol, T = 373 K, h = 6.626 * 10⁻³⁴ J.s
From equation ( 1 )
M = ( h² Ua ) / 3RT*λ² --- ( 2 )
where : Ua ( mass of an atom ) = 6.022 * 10²³, h = 6.626 * 10⁻³⁴, R = 8.314 J / k.mol, λ = 2.31 * 10⁻¹¹, T = 373 K
Insert values into equation ( 2 )
M ( molar mass ) = 32 g/mol
Sulphur has a molar mass of 32 g/mol therefore the atom is sulphur.
Hence we can conclude that The atom that moves at its rms velocity at 100°C with a wavelength of 2.31 * 10 m is : SULPHUR ( s ).
Learn more about sulphur : https://brainly.com/question/26328290
explain what happens when anhydrous calcium chloride are exposed to the atmosphere for about two days
Answer:
Explanation:
Calcium chloride is deliquescent. If exposed to air, it will absorb sufficient water from the air to allow it to dissolve. After a short while, instead of a white lump, you will have a pool of clear liquid.
When Dave is boiling water on the stove, he notices that the pot gets warmer when placed against a hot burner, and steam rises from the pot. Choose the words that correctly complete the sentences to describe what Dave is observing.Heat is the amount of energyChoose...the pot due to temperature differences. It results in a(n)Choose....
Heat is the amount of energy transferred between objects due to temperature differences. It results in a transfer of thermal energy from a warmer object to a cooler object. In this case, when Dave is boiling water on the stove, the pot gets warmer when placed against a hot burner, and steam rises from the pot.
The hot burner transfers heat to the pot through conduction, as the molecules in the burner collide with the molecules in the pot, transferring thermal energy. This leads to an increase in the temperature of the pot.
Simultaneously, the heat from the burner causes the water molecules in the pot to gain energy and increase in temperature. As the water reaches its boiling point, the added heat energy allows the water molecules to overcome intermolecular forces and transform into a gas phase, forming steam. The rising steam is a visible indication of the phase change from liquid to gas.
Therefore, Dave is observing the transfer of heat from the hot burner to the pot through conduction, resulting in an increase in the pot's temperature and the formation of steam as water undergoes a phase change.
To know more about energy transferred click this link -
brainly.com/question/13087586
#SPJ11
Compare and contrast the elements Potassium, K, and Neon, Ne. Use at least ten comparisons or descriptions.
I need this done asap!!!
Answer:
K is a group 1 element while Ne is a group 0 element
K is a good reducing agent while Ne is inert
K is metal while Ne is a gas
K has one valence electron while Ne has no valence electron
Explanation:
The room temperature BCC single-phase solid solution of carbon in iron is known as:
A. Austenite B. Ferrite C. Cementite D. Pearlite
B
The room temperature BCC single-phase solid solution of carbon in iron is known as B. Ferrite
Ferric is a type of iron that has been oxidized. It has a high oxidation state and is used in many industries. It is most commonly used as a catalyst in chemical reactions and as a pigment for paints, inks, and cosmetics. It is also used to create alloys and as a nutritional supplement. It is found in many foods, such as meats, eggs, nuts, whole grains, legumes, and leafy green vegetables.
The ferric BCC structure is a type of crystalline structure that is made up of iron atoms arranged in a body-centered cubic lattice. It is also known as the gamma-iron structure and is the most common type of iron crystal structure seen in nature.
The ferric BCC structure is composed of eight iron atoms arranged in a cube with one atom at the center and the other seven atoms located at the corners. The atoms are bound together through a combination of covalent and metallic bonds. The ferric BCC structure is the most thermodynamically stable form of iron at room temperature, making it the most common form seen in everyday life.
It has a high melting point and is highly resistant to corrosion. Its properties make it ideal for use in engineering applications such as automotive components, tools, and construction materials.
To know more about FCC, click below:
https://brainly.com/question/17111818
#SPJ4
Which square (A, B, C, or D) represents the repeating subunit of the polymer shown?
Answer:
c is the answer
Explanation: just answerd it and got it correct
you need to determine the mass of an aqueous solution. you determine the mass of your 10.0 ml graduated cylinder to be 23.176 g. after adding a volume of 3.29 ml of solution to the cylinder, you reweigh it and determine the new mass to be 26.451g. what is the mass of the aqueous solution in grams?
The mass of the aqueous solution that is added to the graduated cylinder was found to be 3.275 g.
The volume of the graduated cylinder = 10.0 mL
Volume of aqueous solution added to the cylinder = 3.29 mL
The initial mass of the graduated cylinder = 23.176 g
The mass of the graduated cylinder after aqueous solution was added or final mass = 26.451 g
In order to find the mass of the aqueous solution only, the initial weight of the graduated cylinder has to be subtracted from its final weight.
Therefore, mass of aqueous solution = (26.451 – 23.176) g = 3.275 g
The mass of the aqueous solution was found to be 3.275 g.
Learn more about mass of a substance here brainly.com/question/20065039
#SPJ4
what is mass tbh pls he;p
Answer:
how much matter is in an object
Explanation:
4. In what period can you find Nitrogen on the periodic table?
How do plants acquire the nutrients nitrogen and phosphorus?
Plants acquire nitrogen and phosphorus, which are essential nutrients for their growth and survival, from the soil. Nitrogen is typically taken up by plants in the form of nitrates (NO3-) or ammonium (NH4+) ions, which are absorbed through the roots.
Phosphorus is absorbed by plants in the form of phosphates (PO4^3-).
The process of acquiring nitrogen and phosphorus from the soil involves the following steps.
Absorption: The roots of the plant take up nitrates and phosphates from the soil solution through specialized structures called root hairs.Transport: Once absorbed, the ions are transported through the plant's vasculature to the leaves and other parts of the plant where they are needed.Assimilation: The ions are then incorporated into various compounds, such as amino acids, nucleotides, and phospholipids, which are used to build the structural and metabolic components of the plant.The availability of nitrogen and phosphorus in the soil can be limited, and their absence can restrict the growth and productivity of plants. To ensure adequate supply of these nutrients, farmers often use fertilizers to supplement the soil with extra nitrogen and phosphorus.
Learn more about plant nutrients:
https://brainly.com/question/30517541
#SPj4
lab report solubility edge
Answer:
i'm attaching the report i made
Explanation:
(It does include the chart information)
hope this helps! have a wonderful day :)
The solubility of a solid solute increases with temperature.
What is the effect of temperature on the solubility of a solute?The solubility of a solute is the amount of solute that dissolves in a given volume of solvent at a particular temperature.
The solubility of a solute increases with increase in temperature.
Based on the lab results, it was seen that with increase in temperature, the mass of sugar that dissolves in water increases.
50 mL of water at 2 °C dissolved only 80 g of sugar whereas at 102 °C, 250 g of sugar dissolved.
Therefore, it can be concluded that solubility of a solute increases with temperature.
Learn more about solubility at: https://brainly.com/question/23946616
PLEASE HELP ME :<
How many moles of Na2SO4 would be produced if 7.5 moles of Al(OH)3 are produced?
The number of moles of Na2SO4 that would be produced will be 11.25 moles.
Stoichiometric problemAluminum sulfate and sodium hydroxide react to produce aluminum hydroxide and sodium sulfate according to the following balanced equation:
\(Al_2(SO4)_3 + 6NaOH -- > 2Al(OH)_3 + 3Na_2SO_4\)
From the equation, the mole ratio of Al(OH)3 to Na2SO4 produced is 2:3. In other words, for every 2 moles of Al(OH)3 formed, 3 moles of Na2SO4 are formed.
Now, 7.5 moles of Al(OH)3 are produced, the equivalent moles of Na2SO4 formed would be:
3/2 x 7.5 = 11.25 moles
In other words, the number of moles of Na2SO4 that would be formed if 7.5 moles of Al(OH)3 are formed will be 11.25 moles.
More on stoichiometric problems can be found here: https://brainly.com/question/14301905
#SPJ1
2.F is a solution containing O.122mol/dm3 of HCl.G contains 7.0g of Y0H per dm3.Assuming at the end of titration exercise,28.00cm3 of the acid neutralized 25.00cm3 of the base.Calculate the, i.Concentration of G in mol/dm3 ii.Molar mass of YOH iii.Percentage by mass of Y in YOH The equation for the reaction HCl + YOH YCl + H20
i) The concentration of G in mol/dm3 is also 0.003416 mol/dm³.
ii) Molar mass of YOH is 204.49 g/mol
iii) The concentration of G is 0.003416 mol/dm³, the molar mass of YOH is 204.49 g/mol, and the percentage by mass of Y in YOH is 91.63%.
To solve this problem, we'll use the given information and the equation for the reaction: HCl + YOH → YCl + H2O
i. Concentration of G in mol/dm³:
From the given information, we know that 28.00 cm³ of the acid (F) neutralizes 25.00 cm³ of the base (G). This means the stoichiometric ratio between HCl and YOH is 1:1. Therefore, the number of moles of HCl neutralized by 28.00 cm³ of F is:
n(HCl) = concentration of F × volume of F in dm³
= 0.122 mol/dm³ × 28.00 cm³ / 1000 cm3/dm³
= 0.003416 mol
Since the stoichiometric ratio is 1:1, the concentration of G in mol/dm³ is also 0.003416 mol/dm3.
ii. Molar mass of YOH:
To calculate the molar mass of YOH, we need to know the mass of YOH used in the reaction. From the given information, we know that 7.0 g of YOH is present in 1 dm3 of G. Therefore, the molar mass of YOH can be calculated as:
Molar mass of YOH = Mass of YOH / Number of moles of YOH
= 7.0 g / 0.003416 mol
= 204.49 g/mol (rounded to two decimal places)
iii. Percentage by mass of Y in YOH:
The molar mass of Y in YOH can be calculated by subtracting the molar mass of OH from the molar mass of YOH:
Molar mass of Y = Molar mass of YOH - Molar mass of OH
= 204.49 g/mol - 17.01 g/mol
= 187.48 g/mol
The percentage by mass of Y in YOH can be calculated as:
Percentage by mass of Y = (Molar mass of Y / Molar mass of YOH) × 100%
= (187.48 g/mol / 204.49 g/mol) × 100%
= 91.63% (rounded to two decimal places)
Therefore, the concentration of G is 0.003416 mol/dm3, the molar mass of YOH is 204.49 g/mol, and the percentage by mass of Y in YOH is 91.63%.
for more questions on concentration
https://brainly.com/question/28564792
#SPJ8
QUICK PLEASE IM TIMED
A summary table may contain __________ categories than the original data table.
A) many more
B) a few more
C) fewer
D) none of the above
neon doesn't take part in chemical reaction why give reason
Answer: Neon is one of the Noble gases and are unreactive
Explanation: they are Unreactive because their outer shells (Valency ) are full thus making them stable so they do not need to loose or gain any electron
HOPE THIS HELPS if u need any more explanation comment in the comment section
What happens to the carbon dioxide that the alveoli receive from the blood?
Answer:
it is then exhaled
Explanation:
Carbon dioxide passes from the blood into the alveoli and is then exhaled.
When 2. 00 mol of SO2Cl2 is placed in a 2. 00-L flask at 303 K, 56% of the SO2Cl2 decomposes to SO2 and Cl2. Calculate Kc for this reaction at this temperature
At 303 K, 56% of the SO2Cl2 in a 2.00 mol flask of SO2Cl2 dissolves into SO2 and Cl2. At this temperature of 303 K, the Kc for this reaction is 1.58.
The decomposition of SO2Cl2 to SO2 and Cl2 is a reversible reaction. The equation for the reaction is:
SO2Cl2(g) <==> SO2(g) + Cl2(g)
We know that 56% of the SO2Cl2 has decomposed, so we can assume that the equilibrium constant, Kc, is less than 1. To calculate Kc, we will use the equilibrium concentrations of the reactants and products.
We know that the initial concentration of SO2Cl2 is 2.00 mol/2.00 L = 1.00 M, and that 56% of the SO2Cl2 has decomposed, so the equilibrium concentration of SO2Cl2 is 1.00 M * 0.44 = 0.44 M
The equilibrium concentrations of SO2 and Cl2 can be calculated by assuming that they are produced in equal amounts, so the equilibrium concentration of each will be 0.56 M (0.56 mol/L)
Kc is defined as the concentration of products raised to the power of their stoichiometric coefficients, divided by the concentration of reactants raised to the power of their stoichiometric coefficients.
Kc = [SO2][Cl2] / [SO2Cl2]^2
Kc = (0.56 M)^2 / (0.44 M) = 1.58
So the Kc for this reaction at 303 K is 1.58
It's worth noting that equilibrium constant, Kc, is not a constant but a function of temperature, concentration and pressure. The value of Kc for a reaction is different at different temperatures, pressures, etc.
To know more about reaction please refer: https://brainly.com/question/29039149
#SPJ4